@font-face {
  font-family: "lg";
  src: url(https://app.subiz.com.vn/dashboard-v4/public/64b800aa30714fd916dc.woff2) format("woff2"), url(https://app.subiz.com.vn/dashboard-v4/public/747d038541bfc6bb8ea9.ttf) format("truetype"), url(https://app.subiz.com.vn/dashboard-v4/public/356a0e9cb064c7a196c6.woff) format("woff"), url(https://app.subiz.com.vn/dashboard-v4/public/09cd8e9be7081f216644.svg?io9a6k#lg) format("svg");
  font-weight: normal;
  font-style: normal;
  font-display: block;
}
.lg-icon {
  /* use !important to prevent issues with browser extensions that change fonts */
  font-family: "lg" !important;
  speak: never;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  /* Better Font Rendering =========== */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.lg-container {
  font-family: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
}

.lg-next,
.lg-prev {
  background-color: rgba(0, 0, 0, 0.45);
  border-radius: 2px;
  color: #999;
  cursor: pointer;
  display: block;
  font-size: 22px;
  margin-top: -10px;
  padding: 8px 10px 9px;
  position: absolute;
  top: 50%;
  z-index: 1084;
  outline: none;
  border: none;
}
.lg-next.disabled,
.lg-prev.disabled {
  opacity: 0 !important;
  cursor: default;
}
.lg-next:hover:not(.disabled),
.lg-prev:hover:not(.disabled) {
  color: #fff;
}
.lg-single-item .lg-next,
.lg-single-item .lg-prev {
  display: none;
}

.lg-next {
  right: 20px;
}
.lg-next:before {
  content: "\e095";
}

.lg-prev {
  left: 20px;
}
.lg-prev:after {
  content: "\e094";
}

@-webkit-keyframes lg-right-end {
  0% {
    left: 0;
  }
  50% {
    left: -30px;
  }
  100% {
    left: 0;
  }
}
@-moz-keyframes lg-right-end {
  0% {
    left: 0;
  }
  50% {
    left: -30px;
  }
  100% {
    left: 0;
  }
}
@-ms-keyframes lg-right-end {
  0% {
    left: 0;
  }
  50% {
    left: -30px;
  }
  100% {
    left: 0;
  }
}
@keyframes lg-right-end {
  0% {
    left: 0;
  }
  50% {
    left: -30px;
  }
  100% {
    left: 0;
  }
}
@-webkit-keyframes lg-left-end {
  0% {
    left: 0;
  }
  50% {
    left: 30px;
  }
  100% {
    left: 0;
  }
}
@-moz-keyframes lg-left-end {
  0% {
    left: 0;
  }
  50% {
    left: 30px;
  }
  100% {
    left: 0;
  }
}
@-ms-keyframes lg-left-end {
  0% {
    left: 0;
  }
  50% {
    left: 30px;
  }
  100% {
    left: 0;
  }
}
@keyframes lg-left-end {
  0% {
    left: 0;
  }
  50% {
    left: 30px;
  }
  100% {
    left: 0;
  }
}
.lg-outer.lg-right-end .lg-object {
  -webkit-animation: lg-right-end 0.3s;
  -o-animation: lg-right-end 0.3s;
  animation: lg-right-end 0.3s;
  position: relative;
}
.lg-outer.lg-left-end .lg-object {
  -webkit-animation: lg-left-end 0.3s;
  -o-animation: lg-left-end 0.3s;
  animation: lg-left-end 0.3s;
  position: relative;
}

.lg-toolbar {
  z-index: 1082;
  left: 0;
  position: absolute;
  top: 0;
  width: 100%;
}
.lg-media-overlap .lg-toolbar {
  background-image: linear-gradient(0deg, rgba(0, 0, 0, 0), rgba(0, 0, 0, 0.4));
}
.lg-toolbar .lg-icon {
  color: #999;
  cursor: pointer;
  float: right;
  font-size: 24px;
  height: 47px;
  line-height: 27px;
  padding: 10px 0;
  text-align: center;
  width: 50px;
  text-decoration: none !important;
  outline: medium none;
  will-change: color;
  -webkit-transition: color 0.2s linear;
  -o-transition: color 0.2s linear;
  transition: color 0.2s linear;
  background: none;
  border: none;
  box-shadow: none;
}
.lg-toolbar .lg-icon.lg-icon-18 {
  font-size: 18px;
}
.lg-toolbar .lg-icon:hover {
  color: #fff;
}
.lg-toolbar .lg-close:after {
  content: "\e070";
}
.lg-toolbar .lg-maximize {
  font-size: 22px;
}
.lg-toolbar .lg-maximize:after {
  content: "\e90a";
}
.lg-toolbar .lg-download:after {
  content: "\e0f2";
}

.lg-sub-html {
  color: #eee;
  font-size: 16px;
  padding: 10px 40px;
  text-align: center;
  z-index: 1080;
  opacity: 0;
  -webkit-transition: opacity 0.2s ease-out 0s;
  -o-transition: opacity 0.2s ease-out 0s;
  transition: opacity 0.2s ease-out 0s;
}
.lg-sub-html h4 {
  margin: 0;
  font-size: 13px;
  font-weight: bold;
}
.lg-sub-html p {
  font-size: 12px;
  margin: 5px 0 0;
}
.lg-sub-html a {
  color: inherit;
}
.lg-sub-html a:hover {
  text-decoration: underline;
}
.lg-media-overlap .lg-sub-html {
  background-image: linear-gradient(180deg, rgba(0, 0, 0, 0), rgba(0, 0, 0, 0.6));
}
.lg-item .lg-sub-html {
  position: absolute;
  bottom: 0;
  right: 0;
  left: 0;
}

.lg-error-msg {
  font-size: 14px;
  color: #999;
}

.lg-counter {
  color: #999;
  display: inline-block;
  font-size: 16px;
  padding-left: 20px;
  padding-top: 12px;
  height: 47px;
  vertical-align: middle;
}

.lg-closing .lg-toolbar,
.lg-closing .lg-prev,
.lg-closing .lg-next,
.lg-closing .lg-sub-html {
  opacity: 0;
  -webkit-transition: -webkit-transform 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, color 0.08 linear;
  -moz-transition: -moz-transform 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, color 0.08 linear;
  -o-transition: -o-transform 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, color 0.08 linear;
  transition: transform 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.08 cubic-bezier(0, 0, 0.25, 1) 0s, color 0.08 linear;
}

body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable) .lg-img-wrap,
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable) .lg-video-cont,
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable) .lg-media-cont {
  opacity: 0;
  -moz-transform: scale3d(0.5, 0.5, 0.5);
  -o-transform: scale3d(0.5, 0.5, 0.5);
  -ms-transform: scale3d(0.5, 0.5, 0.5);
  -webkit-transform: scale3d(0.5, 0.5, 0.5);
  transform: scale3d(0.5, 0.5, 0.5);
  will-change: transform, opacity;
  -webkit-transition: -webkit-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
  -moz-transition: -moz-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
  -o-transition: -o-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
  transition: transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
}
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable).lg-complete .lg-img-wrap,
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable).lg-complete .lg-video-cont,
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item:not(.lg-zoomable).lg-complete .lg-media-cont {
  opacity: 1;
  -moz-transform: scale3d(1, 1, 1);
  -o-transform: scale3d(1, 1, 1);
  -ms-transform: scale3d(1, 1, 1);
  -webkit-transform: scale3d(1, 1, 1);
  transform: scale3d(1, 1, 1);
}

.lg-icon:focus-visible {
  color: #fff;
  border-radius: 3px;
  outline: 1px dashed rgba(255, 255, 255, 0.6);
}

.lg-toolbar .lg-icon:focus-visible {
  border-radius: 8px;
  outline-offset: -5px;
}

.lg-outer .lg-thumb-outer {
  background-color: #0d0a0a;
  width: 100%;
  max-height: 350px;
  overflow: hidden;
  float: left;
}
.lg-outer .lg-thumb-outer.lg-grab .lg-thumb-item {
  cursor: -webkit-grab;
  cursor: -moz-grab;
  cursor: -o-grab;
  cursor: -ms-grab;
  cursor: grab;
}
.lg-outer .lg-thumb-outer.lg-grabbing .lg-thumb-item {
  cursor: move;
  cursor: -webkit-grabbing;
  cursor: -moz-grabbing;
  cursor: -o-grabbing;
  cursor: -ms-grabbing;
  cursor: grabbing;
}
.lg-outer .lg-thumb-outer.lg-dragging .lg-thumb {
  -webkit-transition-duration: 0s !important;
  transition-duration: 0s !important;
}
.lg-outer .lg-thumb-outer.lg-rebuilding-thumbnails .lg-thumb {
  -webkit-transition-duration: 0s !important;
  transition-duration: 0s !important;
}
.lg-outer .lg-thumb-outer.lg-thumb-align-middle {
  text-align: center;
}
.lg-outer .lg-thumb-outer.lg-thumb-align-left {
  text-align: left;
}
.lg-outer .lg-thumb-outer.lg-thumb-align-right {
  text-align: right;
}
.lg-outer.lg-single-item .lg-thumb-outer {
  display: none;
}
.lg-outer .lg-thumb {
  padding: 5px 0;
  height: 100%;
  margin-bottom: -5px;
  display: inline-block;
  vertical-align: middle;
}
@media (min-width: 768px) {
  .lg-outer .lg-thumb {
    padding: 10px 0;
  }
}
.lg-outer .lg-thumb-item {
  cursor: pointer;
  float: left;
  overflow: hidden;
  height: 100%;
  border-radius: 2px;
  margin-bottom: 5px;
  will-change: border-color;
}
@media (min-width: 768px) {
  .lg-outer .lg-thumb-item {
    border-radius: 4px;
    border: 2px solid #fff;
    -webkit-transition: border-color 0.25s ease;
    -o-transition: border-color 0.25s ease;
    transition: border-color 0.25s ease;
  }
}
.lg-outer .lg-thumb-item.active, .lg-outer .lg-thumb-item:hover {
  border-color: rgb(169, 7, 7);
}
.lg-outer .lg-thumb-item img {
  width: 100%;
  height: 100%;
  object-fit: cover;
  display: block;
}
.lg-outer.lg-can-toggle .lg-item {
  padding-bottom: 0;
}
.lg-outer .lg-toggle-thumb:after {
  content: "\e1ff";
}
.lg-outer.lg-animate-thumb .lg-thumb {
  -webkit-transition-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  transition-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
}

.lg-outer .lg-video-cont {
  text-align: center;
  display: inline-block;
  vertical-align: middle;
  position: relative;
}
.lg-outer .lg-video-cont .lg-object {
  width: 100% !important;
  height: 100% !important;
}
.lg-outer .lg-has-iframe .lg-video-cont {
  -webkit-overflow-scrolling: touch;
  overflow: auto;
}
.lg-outer .lg-video-object {
  position: absolute;
  left: 0;
  right: 0;
  width: 100%;
  height: 100%;
  top: 0;
  bottom: 0;
  z-index: 3;
}
.lg-outer .lg-video-poster {
  z-index: 1;
}
.lg-outer .lg-has-video .lg-video-object {
  opacity: 0;
  will-change: opacity;
  -webkit-transition: opacity 0.3s ease-in;
  -o-transition: opacity 0.3s ease-in;
  transition: opacity 0.3s ease-in;
}
.lg-outer .lg-has-video.lg-video-loaded .lg-video-poster,
.lg-outer .lg-has-video.lg-video-loaded .lg-video-play-button {
  opacity: 0 !important;
}
.lg-outer .lg-has-video.lg-video-loaded .lg-video-object {
  opacity: 1;
}

@keyframes lg-play-stroke {
  0% {
    stroke-dasharray: 1, 200;
    stroke-dashoffset: 0;
  }
  50% {
    stroke-dasharray: 89, 200;
    stroke-dashoffset: -35px;
  }
  100% {
    stroke-dasharray: 89, 200;
    stroke-dashoffset: -124px;
  }
}
@keyframes lg-play-rotate {
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
.lg-video-play-button {
  width: 18%;
  max-width: 140px;
  position: absolute;
  top: 50%;
  left: 50%;
  z-index: 2;
  cursor: pointer;
  transform: translate(-50%, -50%) scale(1);
  will-change: opacity, transform;
  -webkit-transition: -webkit-transform 0.25s cubic-bezier(0.17, 0.88, 0.32, 1.28), opacity 0.1s;
  -moz-transition: -moz-transform 0.25s cubic-bezier(0.17, 0.88, 0.32, 1.28), opacity 0.1s;
  -o-transition: -o-transform 0.25s cubic-bezier(0.17, 0.88, 0.32, 1.28), opacity 0.1s;
  transition: transform 0.25s cubic-bezier(0.17, 0.88, 0.32, 1.28), opacity 0.1s;
}
.lg-video-play-button:hover .lg-video-play-icon-bg,
.lg-video-play-button:hover .lg-video-play-icon {
  opacity: 1;
}

.lg-video-play-icon-bg {
  fill: none;
  stroke-width: 3%;
  stroke: #fcfcfc;
  opacity: 0.6;
  will-change: opacity;
  -webkit-transition: opacity 0.12s ease-in;
  -o-transition: opacity 0.12s ease-in;
  transition: opacity 0.12s ease-in;
}

.lg-video-play-icon-circle {
  position: absolute;
  top: 0;
  left: 0;
  bottom: 0;
  right: 0;
  fill: none;
  stroke-width: 3%;
  stroke: rgba(30, 30, 30, 0.9);
  stroke-opacity: 1;
  stroke-linecap: round;
  stroke-dasharray: 200;
  stroke-dashoffset: 200;
}

.lg-video-play-icon {
  position: absolute;
  width: 25%;
  max-width: 120px;
  left: 50%;
  top: 50%;
  transform: translate3d(-50%, -50%, 0);
  opacity: 0.6;
  will-change: opacity;
  -webkit-transition: opacity 0.12s ease-in;
  -o-transition: opacity 0.12s ease-in;
  transition: opacity 0.12s ease-in;
}
.lg-video-play-icon .lg-video-play-icon-inner {
  fill: #fcfcfc;
}

.lg-video-loading .lg-video-play-icon-circle {
  animation: lg-play-rotate 2s linear 0.25s infinite, lg-play-stroke 1.5s ease-in-out 0.25s infinite;
}

.lg-video-loaded .lg-video-play-button {
  opacity: 0;
  transform: translate(-50%, -50%) scale(0.7);
}

.lg-progress-bar {
  background-color: #333;
  height: 5px;
  left: 0;
  position: absolute;
  top: 0;
  width: 100%;
  z-index: 1083;
  opacity: 0;
  will-change: opacity;
  -webkit-transition: opacity 0.08s ease 0s;
  -moz-transition: opacity 0.08s ease 0s;
  -o-transition: opacity 0.08s ease 0s;
  transition: opacity 0.08s ease 0s;
}
.lg-progress-bar .lg-progress {
  background-color: rgb(169, 7, 7);
  height: 5px;
  width: 0;
}
.lg-progress-bar.lg-start .lg-progress {
  width: 100%;
}
.lg-show-autoplay .lg-progress-bar {
  opacity: 1;
}

.lg-autoplay-button:after {
  content: "\e01d";
}
.lg-show-autoplay .lg-autoplay-button:after {
  content: "\e01a";
}
.lg-single-item .lg-autoplay-button {
  opacity: 0.75;
  pointer-events: none;
}

.lg-outer.lg-css3.lg-zoom-dragging .lg-item.lg-complete.lg-zoomable .lg-img-wrap,
.lg-outer.lg-css3.lg-zoom-dragging .lg-item.lg-complete.lg-zoomable .lg-image {
  -webkit-transition-duration: 0ms !important;
  transition-duration: 0ms !important;
}
.lg-outer.lg-use-transition-for-zoom .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
  will-change: transform;
  -webkit-transition: -webkit-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s;
  -moz-transition: -moz-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s;
  -o-transition: -o-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s;
  transition: transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s;
}
.lg-outer.lg-use-transition-for-zoom.lg-zoom-drag-transition .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
  will-change: transform;
  -webkit-transition: -webkit-transform 0.8s cubic-bezier(0, 0, 0.25, 1) 0s;
  -moz-transition: -moz-transform 0.8s cubic-bezier(0, 0, 0.25, 1) 0s;
  -o-transition: -o-transform 0.8s cubic-bezier(0, 0, 0.25, 1) 0s;
  transition: transform 0.8s cubic-bezier(0, 0, 0.25, 1) 0s;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
  -webkit-transform: translate3d(0, 0, 0);
  transform: translate3d(0, 0, 0);
  -webkit-backface-visibility: hidden;
  -moz-backface-visibility: hidden;
  backface-visibility: hidden;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image,
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-dummy-img {
  -webkit-transform: scale3d(1, 1, 1);
  transform: scale3d(1, 1, 1);
  -webkit-transition: -webkit-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s, opacity 0.15s !important;
  -moz-transition: -moz-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s, opacity 0.15s !important;
  -o-transition: -o-transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s, opacity 0.15s !important;
  transition: transform 0.5s cubic-bezier(0.12, 0.415, 0.01, 1.19) 0s, opacity 0.15s !important;
  -webkit-backface-visibility: hidden;
  -moz-backface-visibility: hidden;
  backface-visibility: hidden;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image.no-transition,
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-dummy-img.no-transition {
  transition: none !important;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image.reset-transition,
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-dummy-img.reset-transition {
  transform: scale3d(1, 1, 1) translate3d(-50%, -50%, 0px) !important;
  max-width: none !important;
  max-height: none !important;
  top: 50% !important;
  left: 50% !important;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image.reset-transition-x,
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-dummy-img.reset-transition-x {
  transform: scale3d(1, 1, 1) translate3d(-50%, 0, 0px) !important;
  top: 0 !important;
  left: 50% !important;
  max-width: none !important;
  max-height: none !important;
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image.reset-transition-y,
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-dummy-img.reset-transition-y {
  transform: scale3d(1, 1, 1) translate3d(0, -50%, 0px) !important;
  top: 50% !important;
  left: 0% !important;
  max-width: none !important;
  max-height: none !important;
}

.lg-icon.lg-zoom-in:after {
  content: "\e311";
}
.lg-actual-size .lg-icon.lg-zoom-in {
  opacity: 1;
  pointer-events: auto;
}
.lg-icon.lg-actual-size {
  font-size: 20px;
}
.lg-icon.lg-actual-size:after {
  content: "\e033";
}
.lg-icon.lg-zoom-out {
  opacity: 0.5;
  pointer-events: none;
}
.lg-icon.lg-zoom-out:after {
  content: "\e312";
}
.lg-zoomed .lg-icon.lg-zoom-out {
  opacity: 1;
  pointer-events: auto;
}

.lg-outer[data-lg-slide-type=video] .lg-zoom-in,
.lg-outer[data-lg-slide-type=video] .lg-actual-size,
.lg-outer[data-lg-slide-type=video] .lg-zoom-out, .lg-outer[data-lg-slide-type=iframe] .lg-zoom-in,
.lg-outer[data-lg-slide-type=iframe] .lg-actual-size,
.lg-outer[data-lg-slide-type=iframe] .lg-zoom-out, .lg-outer.lg-first-slide-loading .lg-zoom-in,
.lg-outer.lg-first-slide-loading .lg-actual-size,
.lg-outer.lg-first-slide-loading .lg-zoom-out {
  opacity: 0.75;
  pointer-events: none;
}

.lg-outer .lg-pager-outer {
  text-align: center;
  z-index: 1080;
  height: 10px;
  margin-bottom: 10px;
}
.lg-outer .lg-pager-outer.lg-pager-hover .lg-pager-cont {
  overflow: visible;
}
.lg-outer.lg-single-item .lg-pager-outer {
  display: none;
}
.lg-outer .lg-pager-cont {
  cursor: pointer;
  display: inline-block;
  overflow: hidden;
  position: relative;
  vertical-align: top;
  margin: 0 5px;
}
.lg-outer .lg-pager-cont:hover .lg-pager-thumb-cont {
  opacity: 1;
  -webkit-transform: translate3d(0, 0, 0);
  transform: translate3d(0, 0, 0);
}
.lg-outer .lg-pager-cont.lg-pager-active .lg-pager {
  box-shadow: 0 0 0 2px white inset;
}
.lg-outer .lg-pager-thumb-cont {
  background-color: #fff;
  color: #fff;
  bottom: 100%;
  height: 83px;
  left: 0;
  margin-bottom: 20px;
  margin-left: -60px;
  opacity: 0;
  padding: 5px;
  position: absolute;
  width: 120px;
  border-radius: 3px;
  will-change: transform, opacity;
  -webkit-transition: opacity 0.15s ease 0s, -webkit-transform 0.15s ease 0s;
  -moz-transition: opacity 0.15s ease 0s, -moz-transform 0.15s ease 0s;
  -o-transition: opacity 0.15s ease 0s, -o-transform 0.15s ease 0s;
  transition: opacity 0.15s ease 0s, transform 0.15s ease 0s;
  -webkit-transform: translate3d(0, 5px, 0);
  transform: translate3d(0, 5px, 0);
}
.lg-outer .lg-pager-thumb-cont img {
  width: 100%;
  height: 100%;
}
.lg-outer .lg-pager {
  background-color: rgba(255, 255, 255, 0.5);
  border-radius: 50%;
  box-shadow: 0 0 0 8px rgba(255, 255, 255, 0.7) inset;
  display: block;
  height: 12px;
  -webkit-transition: box-shadow 0.3s ease 0s;
  -o-transition: box-shadow 0.3s ease 0s;
  transition: box-shadow 0.3s ease 0s;
  width: 12px;
}
.lg-outer .lg-pager:hover, .lg-outer .lg-pager:focus {
  box-shadow: 0 0 0 8px white inset;
}
.lg-outer .lg-caret {
  border-left: 10px solid transparent;
  border-right: 10px solid transparent;
  border-top: 10px dashed;
  bottom: -10px;
  display: inline-block;
  height: 0;
  left: 50%;
  margin-left: -5px;
  position: absolute;
  vertical-align: middle;
  width: 0;
}

.lg-fullscreen:after {
  content: "\e20c";
}
.lg-fullscreen-on .lg-fullscreen:after {
  content: "\e20d";
}

.lg-outer .lg-dropdown-overlay {
  background-color: rgba(0, 0, 0, 0.25);
  bottom: 0;
  cursor: default;
  left: 0;
  position: absolute;
  right: 0;
  top: 0;
  z-index: 1081;
  opacity: 0;
  visibility: hidden;
  will-change: visibility, opacity;
  -webkit-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
  -o-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
  transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
}
.lg-outer.lg-dropdown-active .lg-dropdown,
.lg-outer.lg-dropdown-active .lg-dropdown-overlay {
  -webkit-transition-delay: 0s;
  transition-delay: 0s;
  -moz-transform: translate3d(0, 0px, 0);
  -o-transform: translate3d(0, 0px, 0);
  -ms-transform: translate3d(0, 0px, 0);
  -webkit-transform: translate3d(0, 0px, 0);
  transform: translate3d(0, 0px, 0);
  opacity: 1;
  visibility: visible;
}
.lg-outer.lg-dropdown-active .lg-share {
  color: #fff;
}
.lg-outer .lg-dropdown {
  background-color: #fff;
  border-radius: 2px;
  font-size: 14px;
  list-style-type: none;
  margin: 0;
  padding: 10px 0;
  position: absolute;
  right: 0;
  text-align: left;
  top: 50px;
  opacity: 0;
  visibility: hidden;
  -moz-transform: translate3d(0, 5px, 0);
  -o-transform: translate3d(0, 5px, 0);
  -ms-transform: translate3d(0, 5px, 0);
  -webkit-transform: translate3d(0, 5px, 0);
  transform: translate3d(0, 5px, 0);
  will-change: visibility, opacity, transform;
  -webkit-transition: -webkit-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
  -moz-transition: -moz-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
  -o-transition: -o-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
  transition: transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
}
.lg-outer .lg-dropdown:after {
  content: "";
  display: block;
  height: 0;
  width: 0;
  position: absolute;
  border: 8px solid transparent;
  border-bottom-color: #fff;
  right: 16px;
  top: -16px;
}
.lg-outer .lg-dropdown > li:last-child {
  margin-bottom: 0px;
}
.lg-outer .lg-dropdown > li:hover a {
  color: #333;
}
.lg-outer .lg-dropdown a {
  color: #333;
  display: block;
  white-space: pre;
  padding: 4px 12px;
  font-family: "Open Sans", "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 12px;
}
.lg-outer .lg-dropdown a:hover {
  background-color: rgba(0, 0, 0, 0.07);
}
.lg-outer .lg-dropdown .lg-dropdown-text {
  display: inline-block;
  line-height: 1;
  margin-top: -3px;
  vertical-align: middle;
}
.lg-outer .lg-dropdown .lg-icon {
  color: #333;
  display: inline-block;
  float: none;
  font-size: 20px;
  height: auto;
  line-height: 1;
  margin-right: 8px;
  padding: 0;
  vertical-align: middle;
  width: auto;
}
.lg-outer .lg-share {
  position: relative;
}
.lg-outer .lg-share:after {
  content: "\e80d";
}
.lg-outer .lg-share-facebook .lg-icon {
  color: #3b5998;
}
.lg-outer .lg-share-facebook .lg-icon:after {
  content: "\e904";
}
.lg-outer .lg-share-twitter .lg-icon {
  color: #00aced;
}
.lg-outer .lg-share-twitter .lg-icon:after {
  content: "\e907";
}
.lg-outer .lg-share-pinterest .lg-icon {
  color: #cb2027;
}
.lg-outer .lg-share-pinterest .lg-icon:after {
  content: "\e906";
}

.lg-comment-box {
  width: 420px;
  max-width: 100%;
  position: absolute;
  right: 0;
  top: 0;
  bottom: 0;
  z-index: 9999;
  background-color: #fff;
  will-change: transform;
  -moz-transform: translate3d(100%, 0, 0);
  -o-transform: translate3d(100%, 0, 0);
  -ms-transform: translate3d(100%, 0, 0);
  -webkit-transform: translate3d(100%, 0, 0);
  transform: translate3d(100%, 0, 0);
  -webkit-transition: -webkit-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  -moz-transition: -moz-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  -o-transition: -o-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  transition: transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
}
.lg-comment-box .lg-comment-title {
  margin: 0;
  color: #fff;
  font-size: 18px;
}
.lg-comment-box .lg-comment-header {
  background-color: #000;
  padding: 12px 20px;
  position: absolute;
  left: 0;
  right: 0;
  top: 0;
}
.lg-comment-box .lg-comment-body {
  height: 100% !important;
  padding-top: 43px !important;
  width: 100% !important;
}
.lg-comment-box .fb-comments {
  height: 100%;
  width: 100%;
  background: url(https://app.subiz.com.vn/dashboard-v4/public/fcba57cdb89652f9bb54.gif) no-repeat scroll center center #fff;
  overflow-y: auto;
  display: inline-block;
}
.lg-comment-box .fb-comments[fb-xfbml-state=rendered] {
  background-image: none;
}
.lg-comment-box .fb-comments > span {
  max-width: 100%;
}
.lg-comment-box .lg-comment-close {
  position: absolute;
  right: 5px;
  top: 12px;
  cursor: pointer;
  font-size: 20px;
  color: #999;
  will-change: color;
  -webkit-transition: color 0.2s linear;
  -o-transition: color 0.2s linear;
  transition: color 0.2s linear;
}
.lg-comment-box .lg-comment-close:hover {
  color: #fff;
}
.lg-comment-box .lg-comment-close:after {
  content: "\e070";
}
.lg-comment-box iframe {
  max-width: 100% !important;
  width: 100% !important;
}
.lg-comment-box #disqus_thread {
  padding: 0 20px;
}

.lg-outer .lg-comment-overlay {
  background-color: rgba(0, 0, 0, 0.25);
  bottom: 0;
  cursor: default;
  left: 0;
  position: fixed;
  right: 0;
  top: 0;
  z-index: 1081;
  opacity: 0;
  visibility: hidden;
  will-change: visibility, opacity;
  -webkit-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
  -o-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
  transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
}
.lg-outer .lg-comment-toggle:after {
  content: "\e908";
}
.lg-outer.lg-comment-active .lg-comment-overlay {
  -webkit-transition-delay: 0s;
  transition-delay: 0s;
  -moz-transform: translate3d(0, 0px, 0);
  -o-transform: translate3d(0, 0px, 0);
  -ms-transform: translate3d(0, 0px, 0);
  -webkit-transform: translate3d(0, 0px, 0);
  transform: translate3d(0, 0px, 0);
  opacity: 1;
  visibility: visible;
}
.lg-outer.lg-comment-active .lg-comment-toggle {
  color: #fff;
}
.lg-outer.lg-comment-active .lg-comment-box {
  -moz-transform: translate3d(0, 0, 0);
  -o-transform: translate3d(0, 0, 0);
  -ms-transform: translate3d(0, 0, 0);
  -webkit-transform: translate3d(0, 0, 0);
  transform: translate3d(0, 0, 0);
}

.lg-outer .lg-img-rotate {
  position: absolute;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  -webkit-transition: -webkit-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  -moz-transition: -moz-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  -o-transition: -o-transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
  transition: transform 0.4s cubic-bezier(0, 0, 0.25, 1) 0s;
}
.lg-outer[data-lg-slide-type=video] .lg-rotate-left,
.lg-outer[data-lg-slide-type=video] .lg-rotate-right,
.lg-outer[data-lg-slide-type=video] .lg-flip-ver,
.lg-outer[data-lg-slide-type=video] .lg-flip-hor, .lg-outer[data-lg-slide-type=iframe] .lg-rotate-left,
.lg-outer[data-lg-slide-type=iframe] .lg-rotate-right,
.lg-outer[data-lg-slide-type=iframe] .lg-flip-ver,
.lg-outer[data-lg-slide-type=iframe] .lg-flip-hor {
  opacity: 0.75;
  pointer-events: none;
}
.lg-outer .lg-img-rotate:before {
  content: "";
  display: inline-block;
  height: 100%;
  vertical-align: middle;
}

.lg-rotate-left:after {
  content: "\e900";
}

.lg-rotate-right:after {
  content: "\e901";
}

.lg-icon.lg-flip-hor, .lg-icon.lg-flip-ver {
  font-size: 26px;
}

.lg-flip-ver:after {
  content: "\e903";
}

.lg-flip-hor:after {
  content: "\e902";
}

.lg-medium-zoom-item {
  cursor: zoom-in;
}

.lg-medium-zoom .lg-outer {
  cursor: zoom-out;
}
.lg-medium-zoom .lg-outer.lg-grab img.lg-object {
  cursor: zoom-out;
}
.lg-medium-zoom .lg-outer.lg-grabbing img.lg-object {
  cursor: zoom-out;
}

.lg-relative-caption .lg-outer .lg-sub-html {
  white-space: normal;
  bottom: auto;
  padding: 0;
  background-image: none;
}
.lg-relative-caption .lg-outer .lg-relative-caption-item {
  opacity: 0;
  padding: 16px 0;
  transition: 0.5s opacity ease;
}
.lg-relative-caption .lg-outer .lg-show-caption .lg-relative-caption-item {
  opacity: 1;
}

.lg-group:after {
  content: "";
  display: table;
  clear: both;
}

.lg-container {
  display: none;
  outline: none;
}
.lg-container.lg-show {
  display: block;
}

.lg-on {
  scroll-behavior: unset;
}

.lg-overlay-open {
  overflow: hidden;
}

.lg-toolbar,
.lg-prev,
.lg-next,
.lg-pager-outer,
.lg-hide-sub-html .lg-sub-html {
  opacity: 0;
  will-change: transform, opacity;
  -webkit-transition: -webkit-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
  -moz-transition: -moz-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
  -o-transition: -o-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
  transition: transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
}

.lg-show-in .lg-toolbar,
.lg-show-in .lg-prev,
.lg-show-in .lg-next,
.lg-show-in .lg-pager-outer {
  opacity: 1;
}
.lg-show-in.lg-hide-sub-html .lg-sub-html {
  opacity: 1;
}
.lg-show-in .lg-hide-items .lg-prev {
  opacity: 0;
  -webkit-transform: translate3d(-10px, 0, 0);
  transform: translate3d(-10px, 0, 0);
}
.lg-show-in .lg-hide-items .lg-next {
  opacity: 0;
  -webkit-transform: translate3d(10px, 0, 0);
  transform: translate3d(10px, 0, 0);
}
.lg-show-in .lg-hide-items .lg-toolbar {
  opacity: 0;
  -webkit-transform: translate3d(0, -10px, 0);
  transform: translate3d(0, -10px, 0);
}
.lg-show-in .lg-hide-items.lg-hide-sub-html .lg-sub-html {
  opacity: 0;
  -webkit-transform: translate3d(0, 20px, 0);
  transform: translate3d(0, 20px, 0);
}

.lg-outer {
  width: 100%;
  height: 100%;
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1050;
  text-align: left;
  opacity: 0.001;
  outline: none;
  will-change: auto;
  overflow: hidden;
  -webkit-transition: opacity 0.15s ease 0s;
  -o-transition: opacity 0.15s ease 0s;
  transition: opacity 0.15s ease 0s;
}
.lg-outer * {
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box;
}
.lg-outer.lg-zoom-from-image {
  opacity: 1;
}
.lg-outer.lg-visible {
  opacity: 1;
}
.lg-outer.lg-css3 .lg-item:not(.lg-start-end-progress).lg-prev-slide, .lg-outer.lg-css3 .lg-item:not(.lg-start-end-progress).lg-next-slide, .lg-outer.lg-css3 .lg-item:not(.lg-start-end-progress).lg-current {
  -webkit-transition-duration: inherit !important;
  transition-duration: inherit !important;
  -webkit-transition-timing-function: inherit !important;
  transition-timing-function: inherit !important;
}
.lg-outer.lg-css3.lg-dragging .lg-item.lg-prev-slide, .lg-outer.lg-css3.lg-dragging .lg-item.lg-next-slide, .lg-outer.lg-css3.lg-dragging .lg-item.lg-current {
  -webkit-transition-duration: 0s !important;
  transition-duration: 0s !important;
  opacity: 1;
}
.lg-outer.lg-grab img.lg-object {
  cursor: -webkit-grab;
  cursor: -moz-grab;
  cursor: -o-grab;
  cursor: -ms-grab;
  cursor: grab;
}
.lg-outer.lg-grabbing img.lg-object {
  cursor: move;
  cursor: -webkit-grabbing;
  cursor: -moz-grabbing;
  cursor: -o-grabbing;
  cursor: -ms-grabbing;
  cursor: grabbing;
}
.lg-outer .lg-content {
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
}
.lg-outer .lg-inner {
  width: 100%;
  position: absolute;
  left: 0;
  top: 0;
  bottom: 0;
  -webkit-transition: opacity 0s;
  -o-transition: opacity 0s;
  transition: opacity 0s;
  white-space: nowrap;
}
.lg-outer .lg-item {
  display: none !important;
}
.lg-outer .lg-item:not(.lg-start-end-progress) {
  background: url(https://app.subiz.com.vn/dashboard-v4/public/fcba57cdb89652f9bb54.gif) no-repeat scroll center center transparent;
}
.lg-outer.lg-css3 .lg-prev-slide,
.lg-outer.lg-css3 .lg-current,
.lg-outer.lg-css3 .lg-next-slide {
  display: inline-block !important;
}
.lg-outer.lg-css .lg-current {
  display: inline-block !important;
}
.lg-outer .lg-item,
.lg-outer .lg-img-wrap {
  display: inline-block;
  text-align: center;
  position: absolute;
  width: 100%;
  height: 100%;
}
.lg-outer .lg-item:before,
.lg-outer .lg-img-wrap:before {
  content: "";
  display: inline-block;
  height: 100%;
  vertical-align: middle;
}
.lg-outer .lg-img-wrap {
  position: absolute;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  white-space: nowrap;
  font-size: 0;
}
.lg-outer .lg-item.lg-complete {
  background-image: none;
}
.lg-outer .lg-item.lg-current {
  z-index: 1060;
}
.lg-outer .lg-object {
  display: inline-block;
  vertical-align: middle;
  max-width: 100%;
  max-height: 100%;
  width: auto;
  height: auto;
  position: relative;
}
.lg-outer .lg-empty-html.lg-sub-html,
.lg-outer .lg-empty-html .lg-sub-html {
  display: none;
}
.lg-outer.lg-hide-download .lg-download {
  opacity: 0.75;
  pointer-events: none;
}
.lg-outer .lg-first-slide .lg-dummy-img {
  position: absolute;
  top: 50%;
  left: 50%;
}
.lg-outer.lg-components-open:not(.lg-zoomed) .lg-components {
  -webkit-transform: translate3d(0, 0%, 0);
  transform: translate3d(0, 0%, 0);
  opacity: 1;
}
.lg-outer.lg-components-open:not(.lg-zoomed) .lg-sub-html {
  opacity: 1;
  transition: opacity 0.2s ease-out 0.15s;
}
.lg-outer .lg-media-cont {
  text-align: center;
  display: inline-block;
  vertical-align: middle;
  position: relative;
}
.lg-outer .lg-media-cont .lg-object {
  width: 100% !important;
  height: 100% !important;
}
.lg-outer .lg-has-iframe .lg-media-cont {
  -webkit-overflow-scrolling: touch;
  overflow: auto;
}

.lg-backdrop {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  z-index: 1040;
  background-color: #000;
  opacity: 0;
  will-change: auto;
  -webkit-transition: opacity 333ms ease-in 0s;
  -o-transition: opacity 333ms ease-in 0s;
  transition: opacity 333ms ease-in 0s;
}
.lg-backdrop.in {
  opacity: 1;
}

.lg-css3.lg-no-trans .lg-prev-slide,
.lg-css3.lg-no-trans .lg-next-slide,
.lg-css3.lg-no-trans .lg-current {
  -webkit-transition: none 0s ease 0s !important;
  -moz-transition: none 0s ease 0s !important;
  -o-transition: none 0s ease 0s !important;
  transition: none 0s ease 0s !important;
}
.lg-css3.lg-use-css3 .lg-item {
  -webkit-backface-visibility: hidden;
  -moz-backface-visibility: hidden;
  backface-visibility: hidden;
}
.lg-css3.lg-fade .lg-item {
  opacity: 0;
}
.lg-css3.lg-fade .lg-item.lg-current {
  opacity: 1;
}
.lg-css3.lg-fade .lg-item.lg-prev-slide, .lg-css3.lg-fade .lg-item.lg-next-slide, .lg-css3.lg-fade .lg-item.lg-current {
  -webkit-transition: opacity 0.1s ease 0s;
  -moz-transition: opacity 0.1s ease 0s;
  -o-transition: opacity 0.1s ease 0s;
  transition: opacity 0.1s ease 0s;
}
.lg-css3.lg-use-css3 .lg-item.lg-start-progress {
  -webkit-transition: -webkit-transform 1s cubic-bezier(0.175, 0.885, 0.32, 1.275) 0s;
  -moz-transition: -moz-transform 1s cubic-bezier(0.175, 0.885, 0.32, 1.275) 0s;
  -o-transition: -o-transform 1s cubic-bezier(0.175, 0.885, 0.32, 1.275) 0s;
  transition: transform 1s cubic-bezier(0.175, 0.885, 0.32, 1.275) 0s;
}
.lg-css3.lg-use-css3 .lg-item.lg-start-end-progress {
  -webkit-transition: -webkit-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s;
  -moz-transition: -moz-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s;
  -o-transition: -o-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s;
  transition: transform 1s cubic-bezier(0, 0, 0.25, 1) 0s;
}
.lg-css3.lg-slide.lg-use-css3 .lg-item {
  opacity: 0;
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-prev-slide {
  -webkit-transform: translate3d(-100%, 0, 0);
  transform: translate3d(-100%, 0, 0);
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-next-slide {
  -webkit-transform: translate3d(100%, 0, 0);
  transform: translate3d(100%, 0, 0);
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-current {
  -webkit-transform: translate3d(0, 0, 0);
  transform: translate3d(0, 0, 0);
  opacity: 1;
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-prev-slide, .lg-css3.lg-slide.lg-use-css3 .lg-item.lg-next-slide, .lg-css3.lg-slide.lg-use-css3 .lg-item.lg-current {
  -webkit-transition: -webkit-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
  -moz-transition: -moz-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
  -o-transition: -o-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
  transition: transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
}

.lg-container {
  display: none;
}
.lg-container.lg-show {
  display: block;
}
.lg-container.lg-dragging-vertical .lg-backdrop {
  -webkit-transition-duration: 0s !important;
  transition-duration: 0s !important;
}
.lg-container.lg-dragging-vertical .lg-css3 .lg-item.lg-current {
  -webkit-transition-duration: 0s !important;
  transition-duration: 0s !important;
  opacity: 1;
}

.lg-inline .lg-backdrop,
.lg-inline .lg-outer {
  position: absolute;
}
.lg-inline .lg-backdrop {
  z-index: 1;
}
.lg-inline .lg-outer {
  z-index: 2;
}
.lg-inline .lg-maximize:after {
  content: "\e909";
}

.lg-components {
  -webkit-transform: translate3d(0, 100%, 0);
  transform: translate3d(0, 100%, 0);
  will-change: transform;
  -webkit-transition: -webkit-transform 0.35s ease-out 0s;
  -moz-transition: -moz-transform 0.35s ease-out 0s;
  -o-transition: -o-transform 0.35s ease-out 0s;
  transition: transform 0.35s ease-out 0s;
  z-index: 1080;
  position: absolute;
  bottom: 0;
  right: 0;
  left: 0;
}

@layer reset {
	.fla {
		background-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 512 512' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='%23ccc' d='M0 0h512v512H0z'/%3E%3Ctext fill='%23999' x='256' y='384' style='font: bold 333px sans-serif' text-anchor='middle'%3E%3F%3C/text%3E%3C/svg%3E");
		border-radius: 4px;
		background-size: cover;
	}
	.fla .flag-icon {
		background-color: #d2d2d2;
		background-size: cover;
		margin-top: 0;
		line-height: unset;
	}
	/*!
   * Bootstrap v4.3.1 (https://getbootstrap.com/)
   * Copyright 2011-2020 The Bootstrap Authors
   * Copyright 2011-2020 Twitter, Inc.
   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
   */
	*,
	*::before,
	*::after {
		box-sizing: border-box;
	}
	body {
		overflow: hidden;
		top: 0 !important;
		margin: 0;
		font-family:
			Inter, Arial, 'Noto Sans', sans-serif, 'Apple Color Emoji', 'Segoe UI Emoji', 'Segoe UI Symbol',
			'Noto Color Emoji';
		font-size: 16px;
		font-weight: 400;
		line-height: 1.5;
		color: #212529;
		background-color: #fff;
		-webkit-text-size-adjust: 100%;
		-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
		-webkit-font-smoothing: antialiased;
		-moz-osx-font-smoothing: grayscale;
	}
	[tabindex='-1']:focus:not(:focus-visible) {
		outline: 0 !important;
	}
	hr {
		margin: 10px 0;
		color: inherit;
		background-color: currentColor;
		border: 0;
		opacity: 0.25;
	}
	hr:not([size]) {
		height: 1px;
	}
	h6,
	h5,
	h4,
	h3,
	h2,
	h1 {
		margin-top: 0;
		margin-bottom: 5px;
		font-weight: 500;
		line-height: 1.2;
	}
	h1 {
		font-size: 40px;
	}
	h2 {
		font-size: 32px;
	}
	h3 {
		font-size: 28px;
	}
	h4 {
		font-size: 24px;
	}
	h5 {
		font-size: 20px;
	}
	h6 {
		font-size: 16.96px;
	}
	p {
		margin-top: 0;
		margin-bottom: 1rem;
	}
	abbr[title],
	abbr[data-original-title] {
		text-decoration: underline;
		text-decoration: underline dotted;
		cursor: help;
		text-decoration-skip-ink: none;
	}
	address {
		margin-bottom: 1rem;
		font-style: normal;
		line-height: inherit;
	}
	ol,
	ul {
		padding-left: 2rem;
	}
	ol,
	ul,
	dl {
		margin-top: 0;
		margin-bottom: 1rem;
	}
	ol ol,
	ul ul,
	ol ul,
	ul ol {
		margin-bottom: 0;
	}
	dt {
		font-weight: 600;
	}
	dd {
		margin-bottom: 0.5rem;
		margin-left: 0;
	}
	blockquote {
		margin: 0 0 1rem;
	}
	b,
	strong {
		font-weight: 500;
	}
	small {
		font-size: 0.875em;
	}
	mark {
		padding: 0.2em;
		background-color: #fcf8e3;
	}
	sub,
	sup {
		position: relative;
		font-size: 0.75em;
		line-height: 0;
		vertical-align: baseline;
	}
	sub {
		bottom: -0.25em;
	}
	sup {
		top: -0.5em;
	}
	a {
		color: #0d6efd;
		text-decoration: none;
	}
	a:hover {
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
		text-decoration: none;
	}
	a:not([href]),
	a:not([href]):hover {
		color: inherit;
		text-decoration: none;
	}
	pre,
	code,
	kbd,
	samp {
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		font-size: 1em;
	}
	pre {
		display: block;
		margin-top: 0;
		margin-bottom: 1rem;
		overflow: auto;
		font-size: 16px;
	}
	pre code {
		font-size: inherit;
		color: inherit;
		word-break: normal;
	}
	code {
		font-size: 16px;
		color: #d63384;
		word-wrap: break-word;
	}
	a > code {
		color: inherit;
	}
	kbd {
		padding: 0.2rem 0.4rem;
		font-size: 16px;
		color: #fff;
		background-color: #212529;
		border-radius: 0.25rem;
	}
	kbd kbd {
		padding: 0;
		font-size: 1em;
		font-weight: 600;
	}
	figure {
		margin: 0 0 1rem;
	}
	img {
		vertical-align: middle;
	}
	svg {
		overflow: hidden;
		vertical-align: middle;
		display: inline;
	}
	img {
		vertical-align: middle;
		display: inline;
	}
	table {
		border-collapse: collapse;
	}
	caption {
		padding-top: 0.5rem;
		padding-bottom: 0.5rem;
		color: #6c757d;
		text-align: left;
		caption-side: bottom;
	}
	th {
		text-align: inherit;
		text-align: -webkit-match-parent;
	}
	label {
		display: inline-block;
	}
	button {
		border-radius: 0;
	}
	button:focus {
		outline: 1px dotted;
		outline: 5px auto -webkit-focus-ring-color;
	}
	input,
	button,
	select,
	optgroup,
	textarea {
		margin: 0;
		font-family: inherit;
		font-size: inherit;
		line-height: inherit;
	}
	button,
	input {
		overflow: visible;
	}
	button,
	select {
		text-transform: none;
	}
	select {
		word-wrap: normal;
	}
	[list]::-webkit-calendar-picker-indicator {
		display: none;
	}
	button,
	[type='button'],
	[type='reset'],
	[type='submit'] {
		-webkit-appearance: button;
	}
	button:not(:disabled),
	[type='button']:not(:disabled),
	[type='reset']:not(:disabled),
	[type='submit']:not(:disabled) {
		cursor: pointer;
	}
	::-moz-focus-inner {
		padding: 0;
		border-style: none;
	}
	input[type='date'],
	input[type='time'],
	input[type='datetime-local'],
	input[type='month'] {
		-webkit-appearance: textfield;
	}
	textarea {
		overflow: auto;
		resize: vertical;
	}
	fieldset {
		min-width: 0;
		padding: 0;
		margin: 0;
		border: 0;
	}
	legend {
		float: left;
		width: 100%;
		padding: 0;
		margin-bottom: 0.5rem;
		font-size: 1.5rem;
		line-height: inherit;
		color: inherit;
		white-space: normal;
	}
	::-webkit-datetime-edit-fields-wrapper,
	::-webkit-datetime-edit-text,
	::-webkit-datetime-edit-minute,
	::-webkit-datetime-edit-hour-field,
	::-webkit-datetime-edit-day-field,
	::-webkit-datetime-edit-month-field,
	::-webkit-datetime-edit-year-field {
		padding: 0;
	}
	::-webkit-inner-spin-button {
		height: auto;
	}
	[type='search'] {
		outline-offset: -2px;
		-webkit-appearance: textfield;
	}
	::-webkit-search-decoration {
		-webkit-appearance: none;
	}
	::-webkit-color-swatch-wrapper {
		padding: 0;
	}
	::-webkit-file-upload-button {
		font: inherit;
		-webkit-appearance: button;
	}
	output {
		display: inline-block;
	}
	summary {
		display: list-item;
		cursor: pointer;
	}
	template {
		display: none;
	}
	main {
		display: block;
	}
	progress {
		vertical-align: baseline;
	}
	[hidden] {
		display: none !important;
	}
	:root {
		--blue: #0d6efd;
		--red: #ea3d2f;
		--orange: #f3aa18;
		--yellow: #ffc107;
		--green: #19b600;
		--white: #fff;
		--gray: #6c757d;
		--gray-dark: #343a40;
		--primary: #0d6efd;
		--secondary: #6c757d;
		--success: #19b600;
		--warning: #ffc107;
		--danger: #ea3d2f;
		--light: #e9ecef;
		--dark: #343a40;
		--white: #fff;
		--orange: #f3aa18;
		--font-family-sans-serif:
			Inter, Arial, 'Noto Sans', sans-serif, 'Apple Color Emoji', 'Segoe UI Emoji', 'Segoe UI Symbol',
			'Noto Color Emoji';
		--font-family-monospace: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		scrollbar-color: #bbb #eee;
	}
	.table {
		width: 100%;
		color: #212529;
		vertical-align: top;
		border: 1px solid #dee2e6;
	}
	.table th,
	.table td {
		padding: 0.5rem;
		border-bottom: 1px solid #dee2e6;
		white-space: nowrap;
		text-overflow: ellipsis;
		max-width: 400px;
		overflow: hidden;
	}
	.table tr:hover {
		color: #212529;
		background-color: rgba(0, 0, 0, 0.075);
	}
	.table tbody {
		vertical-align: inherit;
	}
	.table thead th {
		vertical-align: bottom;
	}
	.table tbody + tbody {
		border-top: 2px solid #dee2e6;
	}
	.table-sm th,
	.table-sm td {
		padding: 0.25rem;
	}
	.table-bordered {
		border: 1px solid #dee2e6;
	}
	.table-bordered th,
	.table-bordered td {
		border: 1px solid #dee2e6;
	}
	.table-bordered thead th,
	.table-bordered thead td {
		border-bottom-width: 1px;
	}
	.table-borderless th,
	.table-borderless td,
	.table-borderless thead th,
	.table-borderless tbody + tbody {
		border: 0;
	}
	.table-striped tbody tr:nth-of-type(odd) {
		background-color: rgba(0, 0, 0, 0.05);
	}
	.table-hover tbody tr:hover {
		color: #212529;
		background-color: rgba(0, 0, 0, 0.075);
	}
	.table-primary,
	.table-primary > th,
	.table-primary > td {
		background-color: rgb(187.24, 214.4, 254.44);
	}
	.table-primary th,
	.table-primary td,
	.table-primary thead th,
	.table-primary tbody + tbody {
		border-color: rgb(129.16, 179.6, 253.96);
	}
	.table-hover .table-primary:hover {
		background-color: rgb(161.9490163934, 199.2463114754, 254.2309836066);
	}
	.table-hover .table-primary:hover > td,
	.table-hover .table-primary:hover > th {
		background-color: rgb(161.9490163934, 199.2463114754, 254.2309836066);
	}
	.table-secondary,
	.table-secondary > th,
	.table-secondary > td {
		background-color: rgb(213.84, 216.36, 218.6);
	}
	.table-secondary th,
	.table-secondary td,
	.table-secondary thead th,
	.table-secondary tbody + tbody {
		border-color: rgb(178.56, 183.24, 187.4);
	}
	.table-hover .table-secondary:hover {
		background-color: rgb(200.3075090253, 203.6560288809, 206.6324909747);
	}
	.table-hover .table-secondary:hover > td,
	.table-hover .table-secondary:hover > th {
		background-color: rgb(200.3075090253, 203.6560288809, 206.6324909747);
	}
	.table-success,
	.table-success > th,
	.table-success > td {
		background-color: rgb(190.6, 234.56, 183.6);
	}
	.table-success th,
	.table-success td,
	.table-success thead th,
	.table-success tbody + tbody {
		border-color: rgb(135.4, 217.04, 122.4);
	}
	.table-hover .table-success:hover {
		background-color: rgb(172.718902439, 228.884695122, 163.775304878);
	}
	.table-hover .table-success:hover > td,
	.table-hover .table-success:hover > th {
		background-color: rgb(172.718902439, 228.884695122, 163.775304878);
	}
	.table-warning,
	.table-warning > th,
	.table-warning > td {
		background-color: rgb(255, 237.64, 185.56);
	}
	.table-warning th,
	.table-warning td,
	.table-warning thead th,
	.table-warning tbody + tbody {
		border-color: rgb(255, 222.76, 126.04);
	}
	.table-hover .table-warning:hover {
		background-color: rgb(255, 231.265, 160.06);
	}
	.table-hover .table-warning:hover > td,
	.table-hover .table-warning:hover > th {
		background-color: rgb(255, 231.265, 160.06);
	}
	.table-danger,
	.table-danger > th,
	.table-danger > td {
		background-color: rgb(249.12, 200.68, 196.76);
	}
	.table-danger th,
	.table-danger td,
	.table-danger thead th,
	.table-danger tbody + tbody {
		border-color: rgb(244.08, 154.12, 146.84);
	}
	.table-hover .table-danger:hover {
		background-color: rgb(246.7815720524, 179.0773799127, 173.5984279476);
	}
	.table-hover .table-danger:hover > td,
	.table-hover .table-danger:hover > th {
		background-color: rgb(246.7815720524, 179.0773799127, 173.5984279476);
	}
	.table-light,
	.table-light > th,
	.table-light > td {
		background-color: rgb(248.84, 249.68, 250.52);
	}
	.table-light th,
	.table-light td,
	.table-light thead th,
	.table-light tbody + tbody {
		border-color: rgb(243.56, 245.12, 246.68);
	}
	.table-hover .table-light:hover {
		background-color: rgb(234.0768421053, 236.93, 239.7831578947);
	}
	.table-hover .table-light:hover > td,
	.table-hover .table-light:hover > th {
		background-color: rgb(234.0768421053, 236.93, 239.7831578947);
	}
	.table-dark,
	.table-dark > th,
	.table-dark > td {
		background-color: rgb(198.16, 199.84, 201.52);
	}
	.table-dark th,
	.table-dark td,
	.table-dark thead th,
	.table-dark tbody + tbody {
		border-color: rgb(149.44, 152.56, 155.68);
	}
	.table-hover .table-dark:hover {
		background-color: rgb(185.0216751269, 187.09, 189.1583248731);
	}
	.table-hover .table-dark:hover > td,
	.table-hover .table-dark:hover > th {
		background-color: rgb(185.0216751269, 187.09, 189.1583248731);
	}
	.table-white,
	.table-white > th,
	.table-white > td {
		background-color: white;
	}
	.table-white th,
	.table-white td,
	.table-white thead th,
	.table-white tbody + tbody {
		border-color: white;
	}
	.table-hover .table-white:hover {
		background-color: rgb(242.25, 242.25, 242.25);
	}
	.table-hover .table-white:hover > td,
	.table-hover .table-white:hover > th {
		background-color: rgb(242.25, 242.25, 242.25);
	}
	.table-orange,
	.table-orange > th,
	.table-orange > td {
		background-color: rgb(251.64, 231.2, 190.32);
	}
	.table-orange th,
	.table-orange td,
	.table-orange thead th,
	.table-orange tbody + tbody {
		border-color: rgb(248.76, 210.8, 134.88);
	}
	.table-hover .table-orange:hover {
		background-color: rgb(250.3807407407, 222.2802469136, 166.0792592593);
	}
	.table-hover .table-orange:hover > td,
	.table-hover .table-orange:hover > th {
		background-color: rgb(250.3807407407, 222.2802469136, 166.0792592593);
	}
	.table-active,
	.table-active > th,
	.table-active > td {
		background-color: rgba(0, 0, 0, 0.075);
	}
	.table-hover .table-active:hover {
		background-color: hsla(0, 0%, -5%, 0.075);
	}
	.table-hover .table-active:hover > td,
	.table-hover .table-active:hover > th {
		background-color: hsla(0, 0%, -5%, 0.075);
	}
	.table_scroll__wrap {
		overflow: auto;
		display: block;
	}
	.table_scroll {
		overflow: auto;
		width: 100%;
		color: #212529;
		vertical-align: top;
		border: 1px solid #dee2e6;
	}
	.table_scroll th,
	.table_scroll td {
		padding: 0.5rem;
		border-bottom: 1px solid #dee2e6;
		white-space: nowrap;
		text-overflow: ellipsis;
		min-width: 100px;
		max-width: 400px;
		overflow: hidden;
	}
	.table_scroll tr:hover {
		cursor: pointer;
		color: #212529;
		background-color: rgba(0, 0, 0, 0.075);
	}
	.scroll-table-wrapper {
		position: relative;
		max-height: 100%;
		overflow: auto;
		width: 100%;
	}
	.scroll-table {
		border: none;
		width: 100%;
		color: #212529;
	}
	.scroll-table__th {
		background-color: #f8f9fa;
		padding: 10px;
		font-weight: 500;
		border-bottom: none;
		position: sticky;
		top: 0;
		z-index: 3;
		white-space: nowrap;
		box-shadow: inset 0 -1px 0 0 rgba(0, 0, 0, 0.15);
	}
	.scroll-table__th.cell--fixed-left {
		left: 0;
		z-index: 6;
	}
	.scroll-table__th.cell--fixed-left:after {
		content: '';
		position: absolute;
		top: 0;
		background-color: transparent;
		right: -30px;
		bottom: -1px;
		width: 30px;
		pointer-events: none;
		transition: 0.3s;
	}
	.scroll-table__th.cell--fixed-left.cell--blur:after {
		box-shadow: inset 10px 0 8px -8px rgba(0, 0, 0, 0.15);
	}
	.scroll-table__th.cell--fixed-right {
		right: 0;
		z-index: 6;
	}
	.scroll-table__th.cell--fixed-right:after {
		content: '';
		position: absolute;
		top: 0;
		background-color: transparent;
		left: -30px;
		bottom: -1px;
		width: 30px;
		pointer-events: none;
		transition: 0.3s;
	}
	.scroll-table__th.cell--fixed-right.cell--blur:after {
		box-shadow: inset -10px 0 8px -8px rgba(0, 0, 0, 0.15);
	}
	.scroll-table__td {
		background-color: #fff;
		font-size: 0.875rem;
		vertical-align: middle;
		border-bottom: 1px solid #dee2e6;
		padding: 10px;
		white-space: nowrap;
	}
	.scroll-table__td.cell--fixed-left {
		position: sticky;
		left: 0;
		z-index: 5;
	}
	.scroll-table__td.cell--fixed-left:after {
		content: '';
		position: absolute;
		top: 0;
		background-color: transparent;
		right: -30px;
		bottom: -1px;
		width: 30px;
		pointer-events: none;
		transition: 0.3s;
	}
	.scroll-table__td.cell--fixed-left.cell--blur:after {
		box-shadow: inset 10px 0 8px -8px rgba(0, 0, 0, 0.15);
	}
	.scroll-table__td.cell--fixed-right {
		position: sticky;
		right: 0;
		z-index: 5;
	}
	.scroll-table__td.cell--fixed-right:after {
		content: '';
		position: absolute;
		top: 0;
		background-color: transparent;
		left: -30px;
		bottom: -1px;
		width: 30px;
		pointer-events: none;
		transition: 0.3s;
	}
	.scroll-table__td.cell--fixed-right.cell--blur:after {
		box-shadow: inset -10px 0 8px -8px rgba(0, 0, 0, 0.15);
	}
	.table_blank {
		width: 100%;
		height: 50vh;
		text-align: center;
		color: #585d68;
		background-color: #fff;
	}
	.table_blank tr,
	.table_blank td:hover {
		background-color: #fff;
		cursor: default;
	}
	.table_blank__icon {
		font-size: 80px;
		color: #abaeb3;
		padding-bottom: 20px;
	}
	.sbz_common_table_container {
		display: flex;
		flex-direction: column;
		overflow: hidden;
		flex: 1;
		height: 100%;
	}
	.sbz_common_table_header {
		flex-shrink: 0;
		overflow-y: scroll;
	}
	.sbz_common_table_content_wrapper {
		flex: 1;
		position: relative;
		overflow: hidden;
	}
	.sbz_common_table_content {
		overflow-y: scroll;
		height: 100%;
	}
	.sbz_common_table_footer {
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
		padding: 10px 20px;
	}
	.sbz_table_row {
		border-bottom: 1px solid #dee2e6;
		display: flex;
		position: relative;
		transition: background 0.2s ease;
	}
	.sbz_table_row:hover {
		background-color: #f0f6ff;
		transition: background 0.05s ease;
	}
	.sbz_table_row.no_hover:hover {
		background-color: transparent;
	}
	.sbz_table_row.disabled {
		background: whitesmoke;
	}
	.sbz_table_row.disabled:hover {
		background-color: #f0f6ff;
	}
	.sbz_table_row.focused {
		background-color: #dceaff;
	}
	.sbz_table_row.focused:hover {
		background-color: #dceaff;
	}
	.sbz_table_row.selected {
		background-color: #dceaff;
	}
	.sbz_table_row.selected:hover {
		background-color: #dceaff;
	}
	.sbz_table_row.just_updated {
		background: #fff4d2;
	}
	.sbz_table_row.just_updated:hover {
		background-color: #fff4d2;
	}
	.sbz_table_row.dragging,
	.sbz_table_row.dragging:hover {
		background-color: #d5d5d5;
	}
	.sbz_table_row.newly_created {
		background: #fff8eb;
	}
	.sbz_table_row_dragdrop_wrapper {
		width: 100%;
		position: relative;
	}
	.sbz_table_row_dragdrop_wrapper:first-child .sbz_table_row_dragable_line.before {
		top: 0;
	}
	.sbz_table_row_dragdrop_wrapper:first-child .sbz_table_row_dragable_line.after {
		bottom: 0;
	}
	.sbz_table_row.header {
		user-select: none;
		font-size: 12px;
		font-weight: 500;
		text-transform: uppercase;
		color: #6c757d;
	}
	.sbz_table_row.header:hover {
		background-color: transparent;
	}
	.sbz_table_row.dragging {
		background-color: whitesmoke;
	}
	.sbz_table_row_dragdrop_wrapper:last-child .sbz_table_row_dragable_line.after {
		bottom: 0;
	}
	.sbz_table_row_dragdrop_wrapper:first-child .sbz_table_row_dragable_line.before {
		top: 0;
	}
	.sbz_table_row_dragable_line {
		position: absolute;
		width: 100%;
		left: 0;
		height: 3px;
		top: 0;
		bottom: 0;
		background-color: blue;
		z-index: 1;
	}
	.sbz_table_row_dragable_line.before {
		top: -1.5px;
		bottom: unset;
	}
	.sbz_table_row_dragable_line.after {
		top: unset;
		bottom: -1.5px;
	}
	.sbz_table_loading_inner {
		padding: 20px 40px;
		border-radius: 8px;
		background-color: rgba(255, 255, 255, 0.85);
		text-align: center;
		width: 280px;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
	}
	.sbz_table_cell {
		padding: 10px 10px;
		overflow: hidden;
		display: flex;
		align-items: center;
	}
	.sbz_table_cell:first-child {
		padding-left: 20px;
	}
	.sbz_table_cell:last-child {
		padding-right: 20px;
	}
	.sbz_table_cell.cell_grip {
		padding-left: 0;
		width: 25px;
	}
	.form-control {
		display: block;
		width: 100%;
		min-height: 32px;
		padding: 5px 10px;
		font-size: 16px;
		font-weight: 400;
		line-height: 1.5;
		color: #495057;
		background-color: #fff;
		background-clip: padding-box;
		border: 1px solid #cacaca;
		border-radius: 0.5rem;
	}
	.form-control::-ms-expand {
		background-color: transparent;
		border: 0;
	}
	.form-control:hover {
		background-color: #fff;
		border-color: #6c757d;
		outline: 0;
	}
	.form-control.focus,
	.form-control:focus {
		color: #495057;
		background-color: #fff;
		border-color: #495057;
		outline: 0;
	}
	.form-control:disabled:hover,
	.form-control[readonly]:hover {
		border: 1px solid #cacaca;
	}
	.form-control::placeholder {
		color: #adb5bd;
		opacity: 1;
	}
	.form-control:disabled,
	.form-control[readonly] {
		background-color: #e9ecef;
		opacity: 1;
	}
	.form-control-plaintext {
		display: block;
		width: 100%;
		padding: 0.375rem 0;
		margin-bottom: 0;
		line-height: 1.5;
		color: #212529;
		background-color: transparent;
		border: solid transparent;
		border-width: 1px 0;
	}
	.form-control-plaintext.form-control-sm,
	.form-control-plaintext.form-control-lg {
		padding-right: 0;
		padding-left: 0;
	}
	.form-control-sm {
		min-height: add(1.5em, add(0.5rem, 2px, false));
		padding: 0.25rem 0.5rem;
		font-size: 14px;
		border-radius: 0.25rem;
	}
	.form-control-lg {
		min-height: add(1.5em, add(1rem, 2px, false));
		padding: 0.5rem 1rem;
		font-size: 1.125rem;
		border-radius: 0.6rem;
	}
	.form-control-color {
		max-width: 3rem;
		padding: 0.375rem;
	}
	.form-control-color::-moz-color-swatch {
		border-radius: 0.5rem;
	}
	.form-control-color::-webkit-color-swatch {
		border-radius: 0.5rem;
	}
	.form-control-group {
		display: flex;
	}
	.form-control-group .form-control:not(:first-child) {
		border-top-left-radius: 0;
		border-bottom-left-radius: 0;
		border-left: 0;
	}
	.form-control-group .form-control:not(:last-child) {
		border-top-right-radius: 0;
		border-bottom-right-radius: 0;
		border-right: 0;
	}
	.form-control-group .btn:first-child {
		border-top-right-radius: 0;
		border-bottom-right-radius: 0;
	}
	.form-control-group .btn:last-child {
		border-top-left-radius: 0;
		border-bottom-left-radius: 0;
	}
	.form-control-group .btn.btn__white {
		box-shadow: none;
		border-color: #cacaca;
	}
	select.form-control {
		-webkit-appearance: none; /* For WebKit browsers (Chrome, Safari) */
		-moz-appearance: none; /* For Mozilla Firefox */
		padding-right: 32px;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		cursor: pointer;
		appearance: none; /* Standard property */
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%236c757d' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
		background-repeat: no-repeat;
		background-position: right 0.55rem center;
		background-size: 16px 12px;
	}
	select.form-control:hover,
	select.form-control:focus {
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
	}
	select.form-control:disabled,
	select.form-control[readonly] {
		cursor: unset;
	}
	.form-check:hover input.form-check-input:disabled {
		filter: none;
		border-color: none;
	}
	.form-check:hover .form-check-input {
		border-color: #646464;
	}
	.form-check:hover .form-check-input:checked {
		border-color: #0057d9;
	}
	.form-check {
		display: block;
		min-height: 24px;
		padding-left: 1rem;
		margin-bottom: 0;
		position: relative;
	}
	.form-check .form-check-input {
		position: absolute;
		margin-left: -1rem;
	}
	.form-check-input {
		width: 1rem;
		height: 1rem;
		margin-top: 0.25rem;
		vertical-align: top;
		background-color: #fff;
		border: 2px solid rgba(0, 0, 0, 0.25);
		appearance: none;
		color-adjust: exact;
		cursor: pointer;
	}
	.form-check-input[type='checkbox'] {
		cursor: pointer;
		border-radius: 0.25em;
	}
	.form-check-input[type='radio'] {
		margin-top: 4px;
		border-radius: 50%;
	}
	.form-check-input:active {
		filter: brightness(90%);
	}
	.form-check-input:focus {
		border-color: #646464;
		outline: 0;
		box-shadow: none;
	}
	.form-check-input:checked {
		background-color: #0d6efd;
		background-repeat: no-repeat;
		background-size: 100%;
		background-position: 0 0;
		border-color: #0d6efd;
	}
	.form-check-input:checked[type='checkbox'] {
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M4 8.5L6.5 11l6-6'/%3e%3c/svg%3e");
	}
	.form-check-input:checked[type='radio'] {
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e");
	}
	.form-check-input[type='checkbox']:indeterminate {
		background-color: #0d6efd;
		background-repeat: no-repeat;
		background-position: center center;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M5 8h6'/%3e%3c/svg%3e");
		background-size: 1em;
		border-color: #0d6efd;
	}
	.form-check-input:disabled {
		filter: none;
		cursor: default;
		opacity: 0.5;
	}
	.form-check-input[disabled] ~ .form-check-label,
	.form-check-input:disabled ~ .form-check-label {
		opacity: 0.5;
	}
	.form-check-input.form-check-input--task {
		width: 18px;
		height: 18px;
		margin-top: 1px;
	}
	.form-check-input.form-check-input--task:checked {
		border-color: #159a00;
		background-color: #159a00;
	}
	.form-check-input.form-check-input--light:checked {
		background-color: #fff;
	}
	.form-check-input.form-check-input--light:checked[type='checkbox'] {
		border-color: #6c757d;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%236c757d' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M4 8.5L6.5 11l6-6'/%3e%3c/svg%3e");
	}
	.form-check-input.form-check-input--light:checked[type='radio'] {
		border-color: #6c757d;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%236c757d'/%3e%3c/svg%3e");
	}
	.form-check-input.form-check-input--bold[type='checkbox']:indeterminate {
		background-color: #fff;
		background-repeat: no-repeat;
		background-position: center center;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%230d6efd' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M5 8h6'/%3e%3c/svg%3e");
		background-size: 1em;
		border-color: #0d6efd;
	}
	.form-check-input.form-check-input--bold:checked {
		background-color: #fff;
	}
	.form-check-input.form-check-input--bold:checked[type='checkbox'] {
		border-color: #0d6efd;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%230d6efd' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M4 8.5L6.5 11l6-6'/%3e%3c/svg%3e");
	}
	.form-check-input.form-check-input--bold:checked[type='radio'] {
		border-color: #0d6efd;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%230d6efd'/%3e%3c/svg%3e");
	}
	.form-check-label {
		margin-bottom: 0;
		padding-left: 0.5rem;
		cursor: pointer;
	}
	.form-check-input:disabled ~ .form-check-label {
		cursor: default;
	}
	.form-check-inline {
		display: inline-block;
		margin-right: 1rem;
	}
	.valid-feedback {
		display: none;
		width: 100%;
		margin-top: 0.25rem;
		font-size: 0.875em;
		color: #19b600;
	}
	.valid-tooltip {
		position: absolute;
		top: 100%;
		z-index: 5;
		display: none;
		max-width: 100%;
		padding: 0.25rem 0.5rem;
		margin-top: 0.1rem;
		font-size: 14px;
		color: #fff;
		background-color: rgba(25, 182, 0, 0.9);
		border-radius: 0.5rem;
	}
	.was-validated :valid ~ .valid-feedback,
	.was-validated :valid ~ .valid-tooltip,
	.is-valid ~ .valid-feedback,
	.is-valid ~ .valid-tooltip {
		display: block;
	}
	.was-validated .form-control:valid,
	.form-control.is-valid {
		border-color: #19b600;
		padding-right: add(1.5em, 0.75rem);
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2319b600' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
		background-repeat: no-repeat;
		background-position: right add(0.375em, 0.1875rem) center;
		background-size: add(0.75em, 0.375rem) add(0.75em, 0.375rem);
	}
	.was-validated .form-control:valid:focus,
	.form-control.is-valid:focus {
		border-color: #19b600;
		box-shadow: 0 0 0 0.2rem rgba(25, 182, 0, 0.25);
	}
	.was-validated textarea.form-control:valid,
	textarea.form-control.is-valid {
		padding-right: add(1.5em, 0.75rem);
		background-position: top add(0.375em, 0.1875rem) right add(0.375em, 0.1875rem);
	}
	.was-validated .form-check-input:valid,
	.form-check-input.is-valid {
		border-color: #19b600;
	}
	.was-validated .form-check-input:valid:checked,
	.form-check-input.is-valid:checked {
		background-color: rgb(32.0054945055, 233, 0);
	}
	.was-validated .form-check-input:valid:focus,
	.form-check-input.is-valid:focus {
		box-shadow: 0 0 0 0.2rem rgba(25, 182, 0, 0.25);
	}
	.was-validated .form-check-input:valid ~ .form-check-label,
	.form-check-input.is-valid ~ .form-check-label {
		color: #19b600;
	}
	.form-check-inline .form-check-input ~ .valid-feedback {
		margin-left: 0.5em;
	}
	.invalid-feedback {
		display: none;
		width: 100%;
		margin-top: 0.25rem;
		font-size: 0.875em;
		color: #ea3d2f;
	}
	.invalid-tooltip {
		position: absolute;
		top: 100%;
		z-index: 5;
		display: none;
		max-width: 100%;
		padding: 0.25rem 0.5rem;
		margin-top: 0.1rem;
		font-size: 14px;
		color: #fff;
		background-color: rgba(234, 61, 47, 0.9);
		border-radius: 0.5rem;
	}
	.was-validated :invalid ~ .invalid-feedback,
	.was-validated :invalid ~ .invalid-tooltip,
	.is-invalid ~ .invalid-feedback,
	.is-invalid ~ .invalid-tooltip {
		display: block;
	}
	.was-validated .form-control:invalid,
	.form-control.is-invalid {
		border-color: #ea3d2f;
		padding-right: add(1.5em, 0.75rem);
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23ea3d2f' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23ea3d2f' stroke='none'/%3e%3c/svg%3e");
		background-repeat: no-repeat;
		background-position: right add(0.375em, 0.1875rem) center;
		background-size: add(0.75em, 0.375rem) add(0.75em, 0.375rem);
	}
	.was-validated .form-control:invalid:focus,
	.form-control.is-invalid:focus {
		border-color: #ea3d2f;
		box-shadow: 0 0 0 0.2rem rgba(234, 61, 47, 0.25);
	}
	.was-validated textarea.form-control:invalid,
	textarea.form-control.is-invalid {
		padding-right: add(1.5em, 0.75rem);
		background-position: top add(0.375em, 0.1875rem) right add(0.375em, 0.1875rem);
	}
	.was-validated .form-check-input:invalid,
	.form-check-input.is-invalid {
		border-color: #ea3d2f;
	}
	.was-validated .form-check-input:invalid:checked,
	.form-check-input.is-invalid:checked {
		background-color: rgb(238.6768558952, 104.2052401747, 93.3231441048);
	}
	.was-validated .form-check-input:invalid:focus,
	.form-check-input.is-invalid:focus {
		box-shadow: 0 0 0 0.2rem rgba(234, 61, 47, 0.25);
	}
	.was-validated .form-check-input:invalid ~ .form-check-label,
	.form-check-input.is-invalid ~ .form-check-label {
		color: #ea3d2f;
	}
	.form-check-inline .form-check-input ~ .invalid-feedback {
		margin-left: 0.5em;
	}
	td.xcel {
		border: 1px solid #ddd;
		padding: 0;
	}
	th.xcel {
		background: #f8f8f8;
		border: 1px solid #ddd;
		padding: 5px;
	}
	tr:hover td.xcel {
		background: #f7f7f7;
	}
	.form-control.form-control-xcel {
		min-height: 33px;
		border: 1px solid rgba(0, 0, 0, 0);
		border-radius: 0;
		outline: none;
		width: 100%;
		background: transparent;
		height: 100%;
		padding: 5px;
	}
	.form-control.form-control-xcel:active {
		border: 1px solid #bbb;
	}
	.form-control.form-control-xcel:focus {
		border: 1px solid #bbb;
	}
	.xcel.xcel__new {
		height: 34px;
	}
	.form-control.form-control__light {
		border: none;
		outline: none;
		background-color: #f3f3f3;
	}
	.form-control.form-control__light:hover,
	.form-control.form-control__light:focus,
	.form-control.form-control__light:active {
		border: none;
		outline: none;
		background-color: #e8e8e8;
	}
	.form-control.form-control__light.form-control__primary {
		background-color: #dceaff;
		color: #0d6efd;
	}
	.form-control.form-control__light.form-control__primary:hover,
	.form-control.form-control__light.form-control__primary:focus,
	.form-control.form-control__light.form-control__primary:active {
		border: none;
		outline: none;
		background-color: #dceaff;
	}
	.form-control.form-control__light.form-control__success {
		background-color: #d4edda;
		color: #19b600;
	}
	.form-control.form-control__light.form-control__success:hover,
	.form-control.form-control__light.form-control__success:focus,
	.form-control.form-control__light.form-control__success:active {
		border: none;
		outline: none;
		background-color: #d4edda;
	}
	.date-range-input {
		cursor: pointer;
	}
	.btn {
		display: inline-block;
		font-weight: 500;
		line-height: 1.5;
		color: #212529;
		text-align: center;
		vertical-align: middle;
		cursor: pointer;
		user-select: none;
		background-color: transparent;
		border: 1px solid transparent;
		transition: all ease-out 150ms;
		overflow: hidden;
		padding: 0.375rem 0.55rem;
		font-size: 16px;
		border-radius: 0.5rem;
		overflow: hidden;
		white-space: nowrap;
		text-overflow: ellipsis;
	}
	.btn:hover {
		color: #212529;
		text-decoration: none;
	}
	.btn:hover .btn__icon__next {
		margin-right: 0;
		margin-left: 7.5px;
	}
	.btn:focus,
	.btn.focus {
		outline: 0;
	}
	.btn:disabled,
	.btn.disabled,
	fieldset:disabled .btn {
		pointer-events: none;
		opacity: 0.65;
	}
	.btn .btn__icon__next {
		width: 1em;
		height: 1em;
		transition: all 150ms ease-out;
		margin-right: 5px;
		margin-left: 2.5px;
	}
	.btn__primary {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.btn__primary:hover {
		color: #fff;
		background-color: rgb(1.8668032787, 92.4067622951, 225.8831967213);
		border-color: rgb(1.762295082, 87.2336065574, 213.237704918);
	}
	.btn__primary:focus,
	.btn__primary.focus {
		color: #fff;
		background-color: rgb(1.8668032787, 92.4067622951, 225.8831967213);
		border-color: rgb(1.762295082, 87.2336065574, 213.237704918);
	}
	.btn__primary:active,
	.btn__primary.active,
	.show > .btn__primary.dropdown-toggle {
		color: #fff;
		background-color: rgb(1.762295082, 87.2336065574, 213.237704918);
		border-color: rgb(1.6577868852, 82.0604508197, 200.5922131148);
	}
	.btn__primary:disabled,
	.btn__primary.disabled {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.btn__secondary {
		color: #fff;
		background-color: #6c757d;
		border-color: #6c757d;
	}
	.btn__secondary:hover {
		color: #fff;
		background-color: rgb(90.2703862661, 97.7929184549, 104.4796137339);
		border-color: rgb(84.3605150215, 91.3905579399, 97.6394849785);
	}
	.btn__secondary:focus,
	.btn__secondary.focus {
		color: #fff;
		background-color: rgb(90.2703862661, 97.7929184549, 104.4796137339);
		border-color: rgb(84.3605150215, 91.3905579399, 97.6394849785);
	}
	.btn__secondary:active,
	.btn__secondary.active,
	.show > .btn__secondary.dropdown-toggle {
		color: #fff;
		background-color: rgb(84.3605150215, 91.3905579399, 97.6394849785);
		border-color: rgb(78.4506437768, 84.9881974249, 90.7993562232);
	}
	.btn__secondary:disabled,
	.btn__secondary.disabled {
		color: #fff;
		background-color: #6c757d;
		border-color: #6c757d;
	}
	.btn__success {
		color: #fff;
		background-color: #19b600;
		border-color: #19b600;
	}
	.btn__success:hover {
		color: #fff;
		background-color: rgb(19.7458791209, 143.75, 0);
		border-color: rgb(17.9945054945, 131, 0);
	}
	.btn__success:focus,
	.btn__success.focus {
		color: #fff;
		background-color: rgb(19.7458791209, 143.75, 0);
		border-color: rgb(17.9945054945, 131, 0);
	}
	.btn__success:active,
	.btn__success.active,
	.show > .btn__success.dropdown-toggle {
		color: #fff;
		background-color: rgb(17.9945054945, 131, 0);
		border-color: rgb(16.2431318681, 118.25, 0);
	}
	.btn__success:disabled,
	.btn__success.disabled {
		color: #fff;
		background-color: #19b600;
		border-color: #19b600;
	}
	.btn__warning {
		color: #212529;
		background-color: #ffc107;
		border-color: #ffc107;
	}
	.btn__warning:hover {
		color: #212529;
		background-color: rgb(223.75, 167.8125, 0);
		border-color: rgb(211, 158.25, 0);
	}
	.btn__warning:focus,
	.btn__warning.focus {
		color: #212529;
		background-color: rgb(223.75, 167.8125, 0);
		border-color: rgb(211, 158.25, 0);
	}
	.btn__warning:active,
	.btn__warning.active,
	.show > .btn__warning.dropdown-toggle {
		color: #212529;
		background-color: rgb(211, 158.25, 0);
		border-color: rgb(198.25, 148.6875, 0);
	}
	.btn__warning:disabled,
	.btn__warning.disabled {
		color: #212529;
		background-color: #ffc107;
		border-color: #ffc107;
	}
	.btn__danger {
		color: #fff;
		background-color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.btn__danger:hover {
		color: #fff;
		background-color: rgb(220.4890829694, 37.1015283843, 22.2609170306);
		border-color: rgb(208.9082969432, 35.1528384279, 21.0917030568);
	}
	.btn__danger:focus,
	.btn__danger.focus {
		color: #fff;
		background-color: rgb(220.4890829694, 37.1015283843, 22.2609170306);
		border-color: rgb(208.9082969432, 35.1528384279, 21.0917030568);
	}
	.btn__danger:active,
	.btn__danger.active,
	.show > .btn__danger.dropdown-toggle {
		color: #fff;
		background-color: rgb(208.9082969432, 35.1528384279, 21.0917030568);
		border-color: rgb(197.327510917, 33.2041484716, 19.922489083);
	}
	.btn__danger:disabled,
	.btn__danger.disabled {
		color: #fff;
		background-color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.btn__light {
		color: #212529;
		background-color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn__light:hover {
		color: #212529;
		background-color: rgb(210.8552631579, 216.875, 222.8947368421);
		border-color: rgb(203.4736842105, 210.5, 217.5263157895);
	}
	.btn__light:focus,
	.btn__light.focus {
		color: #212529;
		background-color: rgb(210.8552631579, 216.875, 222.8947368421);
		border-color: rgb(203.4736842105, 210.5, 217.5263157895);
	}
	.btn__light:active,
	.btn__light.active,
	.show > .btn__light.dropdown-toggle {
		color: #212529;
		background-color: rgb(203.4736842105, 210.5, 217.5263157895);
		border-color: rgb(196.0921052632, 204.125, 212.1578947368);
	}
	.btn__light:disabled,
	.btn__light.disabled {
		color: #212529;
		background-color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn__dark {
		color: #fff;
		background-color: #343a40;
		border-color: #343a40;
	}
	.btn__dark:hover {
		color: #fff;
		background-color: rgb(34.8534482759, 38.875, 42.8965517241);
		border-color: rgb(29.1379310345, 32.5, 35.8620689655);
	}
	.btn__dark:focus,
	.btn__dark.focus {
		color: #fff;
		background-color: rgb(34.8534482759, 38.875, 42.8965517241);
		border-color: rgb(29.1379310345, 32.5, 35.8620689655);
	}
	.btn__dark:active,
	.btn__dark.active,
	.show > .btn__dark.dropdown-toggle {
		color: #fff;
		background-color: rgb(29.1379310345, 32.5, 35.8620689655);
		border-color: rgb(23.4224137931, 26.125, 28.8275862069);
	}
	.btn__dark:disabled,
	.btn__dark.disabled {
		color: #fff;
		background-color: #343a40;
		border-color: #343a40;
	}
	.btn__white {
		color: #212529;
		background-color: #fff;
		border-color: #fff;
	}
	.btn__white:hover {
		color: #212529;
		background-color: rgb(235.875, 235.875, 235.875);
		border-color: rgb(229.5, 229.5, 229.5);
	}
	.btn__white:focus,
	.btn__white.focus {
		color: #212529;
		background-color: rgb(235.875, 235.875, 235.875);
		border-color: rgb(229.5, 229.5, 229.5);
	}
	.btn__white:active,
	.btn__white.active,
	.show > .btn__white.dropdown-toggle {
		color: #212529;
		background-color: rgb(229.5, 229.5, 229.5);
		border-color: rgb(223.125, 223.125, 223.125);
	}
	.btn__white:disabled,
	.btn__white.disabled {
		color: #212529;
		background-color: #fff;
		border-color: #fff;
	}
	.btn__orange {
		color: #212529;
		background-color: #f3aa18;
		border-color: #f3aa18;
	}
	.btn__orange:hover {
		color: #212529;
		background-color: rgb(217.4537037037, 148.7345679012, 11.2962962963);
		border-color: rgb(205.3333333333, 140.4444444444, 10.6666666667);
	}
	.btn__orange:focus,
	.btn__orange.focus {
		color: #212529;
		background-color: rgb(217.4537037037, 148.7345679012, 11.2962962963);
		border-color: rgb(205.3333333333, 140.4444444444, 10.6666666667);
	}
	.btn__orange:active,
	.btn__orange.active,
	.show > .btn__orange.dropdown-toggle {
		color: #fff;
		background-color: rgb(205.3333333333, 140.4444444444, 10.6666666667);
		border-color: rgb(193.212962963, 132.1543209877, 10.037037037);
	}
	.btn__orange:disabled,
	.btn__orange.disabled {
		color: #212529;
		background-color: #f3aa18;
		border-color: #f3aa18;
	}
	.btn__outline_primary {
		color: #0d6efd;
		border-color: #0d6efd;
	}
	.btn__outline_primary:hover {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.btn__outline_primary:active,
	.btn__outline_primary.active,
	.show > .btn__outline_primary.dropdown-toggle {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.btn__outline_primary:disabled,
	.btn__outline_primary.disabled {
		color: #0d6efd;
		background-color: transparent;
	}
	.btn__outline_secondary {
		color: #6c757d;
		border-color: #6c757d;
	}
	.btn__outline_secondary:hover {
		color: #fff;
		background-color: #6c757d;
		border-color: #6c757d;
	}
	.btn__outline_secondary:active,
	.btn__outline_secondary.active,
	.show > .btn__outline_secondary.dropdown-toggle {
		color: #fff;
		background-color: #6c757d;
		border-color: #6c757d;
	}
	.btn__outline_secondary:disabled,
	.btn__outline_secondary.disabled {
		color: #6c757d;
		background-color: transparent;
	}
	.btn__outline_success {
		color: #19b600;
		border-color: #19b600;
	}
	.btn__outline_success:hover {
		color: #fff;
		background-color: #19b600;
		border-color: #19b600;
	}
	.btn__outline_success:active,
	.btn__outline_success.active,
	.show > .btn__outline_success.dropdown-toggle {
		color: #fff;
		background-color: #19b600;
		border-color: #19b600;
	}
	.btn__outline_success:disabled,
	.btn__outline_success.disabled {
		color: #19b600;
		background-color: transparent;
	}
	.btn__outline_warning {
		color: #ffc107;
		border-color: #ffc107;
	}
	.btn__outline_warning:hover {
		color: #212529;
		background-color: #ffc107;
		border-color: #ffc107;
	}
	.btn__outline_warning:active,
	.btn__outline_warning.active,
	.show > .btn__outline_warning.dropdown-toggle {
		color: #212529;
		background-color: #ffc107;
		border-color: #ffc107;
	}
	.btn__outline_warning:disabled,
	.btn__outline_warning.disabled {
		color: #ffc107;
		background-color: transparent;
	}
	.btn__outline_danger {
		color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.btn__outline_danger:hover {
		color: #fff;
		background-color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.btn__outline_danger:active,
	.btn__outline_danger.active,
	.show > .btn__outline_danger.dropdown-toggle {
		color: #fff;
		background-color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.btn__outline_danger:disabled,
	.btn__outline_danger.disabled {
		color: #ea3d2f;
		background-color: transparent;
	}
	.btn__outline_light {
		color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn__outline_light:hover {
		color: #212529;
		background-color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn__outline_light:active,
	.btn__outline_light.active,
	.show > .btn__outline_light.dropdown-toggle {
		color: #212529;
		background-color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn__outline_light:disabled,
	.btn__outline_light.disabled {
		color: #e9ecef;
		background-color: transparent;
	}
	.btn__outline_dark {
		color: #343a40;
		border-color: #343a40;
	}
	.btn__outline_dark:hover {
		color: #fff;
		background-color: #343a40;
		border-color: #343a40;
	}
	.btn__outline_dark:active,
	.btn__outline_dark.active,
	.show > .btn__outline_dark.dropdown-toggle {
		color: #fff;
		background-color: #343a40;
		border-color: #343a40;
	}
	.btn__outline_dark:disabled,
	.btn__outline_dark.disabled {
		color: #343a40;
		background-color: transparent;
	}
	.btn__outline_white {
		color: #fff;
		border-color: #fff;
	}
	.btn__outline_white:hover {
		color: #212529;
		background-color: #fff;
		border-color: #fff;
	}
	.btn__outline_white:active,
	.btn__outline_white.active,
	.show > .btn__outline_white.dropdown-toggle {
		color: #212529;
		background-color: #fff;
		border-color: #fff;
	}
	.btn__outline_white:disabled,
	.btn__outline_white.disabled {
		color: #fff;
		background-color: transparent;
	}
	.btn__outline_orange {
		color: #f3aa18;
		border-color: #f3aa18;
	}
	.btn__outline_orange:hover {
		color: #212529;
		background-color: #f3aa18;
		border-color: #f3aa18;
	}
	.btn__outline_orange:active,
	.btn__outline_orange.active,
	.show > .btn__outline_orange.dropdown-toggle {
		color: #212529;
		background-color: #f3aa18;
		border-color: #f3aa18;
	}
	.btn__outline_orange:disabled,
	.btn__outline_orange.disabled {
		color: #f3aa18;
		background-color: transparent;
	}
	.btn__lg,
	.btn__switch_lg > .btn,
	.btn__group_lg > .btn {
		padding: 0.5rem 1rem;
		font-size: 1.125rem;
		border-radius: 0.6rem;
	}
	.btn__sm,
	.btn__switch_sm > .btn,
	.btn__group_sm > .btn {
		padding: 0.25rem 0.5rem;
		font-size: 14px;
		border-radius: 0.25rem;
	}
	.btn__xs {
		padding: 0.2rem 0.3rem;
		font-size: 12px;
		border-radius: 0.2rem;
	}
	.btn__bg {
		padding: 0.75rem 1.5rem;
		font-size: 24px;
		border-radius: 0.75rem;
	}
	.btn__close {
		width: 24px;
		height: 24px;
		cursor: pointer;
		background: rgba(0, 0, 0, 0.0666666667);
		border-radius: 50%;
		padding: 3px;
		stroke: rgba(0, 0, 0, 0.3333333333);
		outline: none;
	}
	.btn__close:hover {
		stroke: rgba(0, 0, 0, 0.6666666667);
		background: #ced4da;
	}
	.btn__close.btn__close_noti {
		background: white;
		box-shadow: 0 2px 4px rgba(0, 0, 0, 0.08);
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.btn__close.btn__close_light {
		background: rgba(0, 0, 0, 0.2);
		border-radius: 50%;
		padding: 5px;
		stroke: rgba(255, 255, 255, 0.5333333333);
		outline: none;
	}
	.btn__close.btn__close_light:hover {
		stroke: #ffffff;
		background: rgba(0, 0, 0, 0.3333333333);
	}
	.btn.btn__rounded {
		border-radius: 999px;
	}
	.btn.btn--padding-lg {
		padding-right: 30px;
		padding-left: 30px;
	}
	.btn.btn--padding-md {
		padding-right: 20px;
		padding-left: 20px;
	}
	.btn.btn__light_primary {
		background-color: #eff8ff;
		border-color: #eff8ff;
		color: #0d6efd;
	}
	.btn.btn__light_primary:hover {
		background-color: #cce0ff;
		border-color: #cce0ff;
	}
	.btn.btn__dashed_primary {
		background-color: #fff;
		border-color: #0d6efd;
		color: #0d6efd;
		border: 1px dashed;
	}
	.btn.btn__dashed_primary:hover {
		color: #0047b5;
		border-color: #0047b5;
	}
	.btn.btn__dashed_warning {
		background-color: #fff;
		border-color: #ffc107;
		color: #ffc107;
		border: 1px dashed;
	}
	.btn.btn__dashed_warning:hover {
		color: #d39e00;
		border-color: #d39e00;
	}
	.btn.btn__dashed_success {
		background-color: #fff;
		border-color: #19b600;
		color: #19b600;
		border: 1px dashed;
	}
	.btn.btn__dashed_success:hover {
		color: #1e7e34;
		border-color: #1e7e34;
	}
	.btn.btn__dashed_danger {
		background-color: #fff;
		border-color: #ea3d2f;
		color: #ea3d2f;
		border: 1px dashed;
	}
	.btn.btn__dashed_danger:hover {
		color: #bd2130;
		border-color: #bd2130;
	}
	.btn.btn__dashed_secondary {
		background-color: #fff;
		border-color: #6c757d;
		color: #6c757d;
		border: 1px dashed;
	}
	.btn.btn__dashed_secondary:hover {
		color: #495057;
		border-color: #495057;
	}
	.btn.btn__white {
		border-color: #dfe1e4;
		box-shadow: rgba(0, 0, 0, 0.09) 0px 1px 4px;
	}
	.btn_caret {
		padding-left: 5px;
		padding-right: 5px;
	}
	.btn_caret .icon-tabler-chevron-down path:last-child {
		fill: currentColor;
	}
	.button_option {
		border-radius: 5px;
		margin-bottom: 10px;
		padding: 8px 12px;
		cursor: pointer;
		border-width: 1px;
		border-style: solid;
		color: #0d6efd;
		border-color: #0d6efd;
	}
	.button_option:hover {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.button_option:active,
	.button_option.active,
	.show > .button_option.dropdown-toggle {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.button_option:disabled,
	.button_option.disabled {
		color: #0d6efd;
		background-color: transparent;
	}
	.btn.btn__transparent {
		background-color: transparent;
		border-color: transparent;
	}
	.btn.btn__transparent:hover {
		background-color: #e9ecef;
		border-color: #e9ecef;
	}
	.btn.btn__transparent.btn__transparent_priamry {
		background-color: transparent;
		border-color: transparent;
		color: #0d6efd;
	}
	.btn.btn__transparent.btn__transparent_priamry:hover {
		background-color: #025ce2;
		border-color: #025ce2;
		color: #fff;
	}
	.btn.btn__transparent.btn__transparent_success {
		background-color: transparent;
		border-color: transparent;
		color: #19b600;
	}
	.btn.btn__transparent.btn__transparent_success:hover {
		background-color: shade-color(#19b600, 2);
		border-color: shade-color(#19b600, 2);
		color: #fff;
	}
	.btn__group,
	.btn__group_vertical {
		position: relative;
		display: inline-flex;
		vertical-align: middle;
	}
	.btn__group > .btn,
	.btn__group_vertical > .btn {
		position: relative;
		flex: 1 1 auto;
	}
	.btn__group > .btn:hover,
	.btn__group > .btn:focus,
	.btn__group > .btn:active,
	.btn__group > .btn.active,
	.btn__group_vertical > .btn:hover,
	.btn__group_vertical > .btn:focus,
	.btn__group_vertical > .btn:active,
	.btn__group_vertical > .btn.active {
		z-index: 1;
	}
	.btn__toolbar {
		display: flex;
		flex-wrap: wrap;
		justify-content: flex-start;
	}
	.btn__toolbar .input__group {
		width: auto;
	}
	.btn__group > .btn:not(:first-child),
	.btn__group > .btn__group:not(:first-child) {
		margin-left: -1px;
	}
	.btn__group > .btn:not(:last-child):not(.dropdown__toggle),
	.btn__group > .btn__group:not(:last-child) > .btn {
		border-top-right-radius: 0;
		border-bottom-right-radius: 0;
	}
	.btn__group > .btn:not(:first-child),
	.btn__group > .btn__group:not(:first-child) > .btn {
		border-top-left-radius: 0;
		border-bottom-left-radius: 0;
	}
	.dropdown__toggle-split {
		padding-right: 0.4125rem;
		padding-left: 0.4125rem;
	}
	.dropdown__toggle-split::after,
	.dropup .dropdown__toggle-split::after,
	.dropright .dropdown__toggle-split::after {
		margin-left: 0;
	}
	.dropleft .dropdown__toggle-split::before {
		margin-right: 0;
	}
	.btn__sm + .dropdown__toggle_split,
	.btn__switch_sm > .btn + .dropdown__toggle_split,
	.btn__group_sm > .btn + .dropdown__toggle_split {
		padding-right: 0.375rem;
		padding-left: 0.375rem;
	}
	.btn__lg + .dropdown__toggle_split,
	.btn__switch_lg > .btn + .dropdown__toggle_split,
	.btn__group_lg > .btn + .dropdown__toggle_split {
		padding-right: 0.75rem;
		padding-left: 0.75rem;
	}
	.btn__group_vertical {
		flex-direction: column;
		align-items: flex-start;
		justify-content: center;
	}
	.btn__group_vertical > .btn,
	.btn__group_vertical > .btn__group {
		width: 100%;
	}
	.btn__group_vertical > .btn:not(:first-child),
	.btn__group_vertical > .btn__group:not(:first-child) {
		margin-top: -1px;
	}
	.btn__group_vertical > .btn:not(:last-child):not(.dropdown__toggle),
	.btn__group_vertical > .btn__group:not(:last-child) > .btn {
		border-bottom-right-radius: 0;
		border-bottom-left-radius: 0;
	}
	.btn__group_vertical > .btn:not(:first-child),
	.btn__group_vertical > .btn__group:not(:first-child) > .btn {
		border-top-left-radius: 0;
		border-top-right-radius: 0;
	}
	.btn__group_toggle > .btn,
	.btn__group_toggle > .btn__group > .btn {
		margin-bottom: 0;
	}
	.btn__group_toggle > .btn input[type='radio'],
	.btn__group_toggle > .btn input[type='checkbox'],
	.btn__group_toggle > .btn__group > .btn input[type='radio'],
	.btn__group_toggle > .btn__group > .btn input[type='checkbox'] {
		position: absolute;
		clip: rect(0, 0, 0, 0);
		pointer-events: none;
	}
	.badge {
		display: inline-block;
		padding: 0.3em 0.5em;
		font-size: 14px;
		font-weight: 400;
		line-height: 1;
		color: #fff;
		text-align: center;
		white-space: nowrap;
		font-weight: 600;
		vertical-align: baseline;
		border-radius: 5px;
	}
	.badge:empty {
		display: none;
	}
	.btn .badge {
		position: relative;
		top: -1px;
	}
	.badge__primary {
		color: #0d6efd;
		background-color: rgba(13, 110, 253, 0.15);
	}
	.badge__bold_primary {
		color: #fff;
		background-color: #0d6efd;
	}
	.badge__secondary {
		color: #6c757d;
		background-color: rgba(108, 117, 125, 0.15);
	}
	.badge__bold_secondary {
		color: #fff;
		background-color: #6c757d;
	}
	.badge__success {
		color: #19b600;
		background-color: rgba(25, 182, 0, 0.15);
	}
	.badge__bold_success {
		color: #fff;
		background-color: #19b600;
	}
	.badge__warning {
		color: #ffc107;
		background-color: rgba(255, 193, 7, 0.15);
	}
	.badge__bold_warning {
		color: #fff;
		background-color: #ffc107;
	}
	.badge__danger {
		color: #ea3d2f;
		background-color: rgba(234, 61, 47, 0.15);
	}
	.badge__bold_danger {
		color: #fff;
		background-color: #ea3d2f;
	}
	.badge__light {
		color: #e9ecef;
		background-color: rgba(233, 236, 239, 0.15);
	}
	.badge__bold_light {
		color: #fff;
		background-color: #e9ecef;
	}
	.badge__dark {
		color: #343a40;
		background-color: rgba(52, 58, 64, 0.15);
	}
	.badge__bold_dark {
		color: #fff;
		background-color: #343a40;
	}
	.badge__white {
		color: #fff;
		background-color: rgba(255, 255, 255, 0.15);
	}
	.badge__bold_white {
		color: #fff;
		background-color: #fff;
	}
	.badge__orange {
		color: #f3aa18;
		background-color: rgba(243, 170, 24, 0.15);
	}
	.badge__bold_orange {
		color: #fff;
		background-color: #f3aa18;
	}
	.badge.badge__sm {
		font-size: 12px;
		padding: 3px 6px;
	}
	.badge.badge__light {
		color: #495057;
		background-color: #f8f9fa;
	}
	.tooltip {
		max-width: 400px;
		display: block !important;
		z-index: 10000;
	}
	.tooltip .tooltip-inner {
		background: #212529;
		color: white;
		border-radius: 6px;
		padding: 4px 10px;
		font-size: 14px;
		font-weight: 500;
	}
	.tooltip .tooltip-arrow {
		width: 0;
		height: 0;
		border-style: solid;
		position: absolute;
		margin: 5px;
		border-color: #212529;
	}
	.tooltip[x-placement^='top'] {
		margin-bottom: 5px;
	}
	.tooltip[x-placement^='top'] .tooltip-arrow {
		border-width: 5px 5px 0 5px;
		border-left-color: transparent !important;
		border-right-color: transparent !important;
		border-bottom-color: transparent !important;
		bottom: -5px;
		left: calc(50% - 5px);
		margin-top: 0;
		margin-bottom: 0;
	}
	.tooltip[x-placement^='bottom'] {
		margin-top: 5px;
	}
	.tooltip[x-placement^='bottom'] .tooltip-arrow {
		border-width: 0 5px 5px 5px;
		border-left-color: transparent !important;
		border-right-color: transparent !important;
		border-top-color: transparent !important;
		top: -5px;
		left: calc(50% - 5px);
		margin-top: 0;
		margin-bottom: 0;
	}
	.tooltip[x-placement^='right'] {
		margin-left: 5px;
	}
	.tooltip[x-placement^='right'] .tooltip-arrow {
		border-width: 5px 5px 5px 0;
		border-left-color: transparent !important;
		border-top-color: transparent !important;
		border-bottom-color: transparent !important;
		left: -5px;
		top: calc(50% - 5px);
		margin-left: 0;
		margin-right: 0;
	}
	.tooltip[x-placement^='left'] {
		margin-right: 5px;
	}
	.tooltip[x-placement^='left'] .tooltip-arrow {
		border-width: 5px 0 5px 5px;
		border-top-color: transparent !important;
		border-right-color: transparent !important;
		border-bottom-color: transparent !important;
		right: -5px;
		top: calc(50% - 5px);
		margin-left: 0;
		margin-right: 0;
	}
	.tooltip[aria-hidden='true'] {
		visibility: hidden;
		opacity: 0;
		transition:
			opacity 60ms linear,
			visibility 60ms linear;
	}
	.tooltip[aria-hidden='false'] {
		visibility: visible;
		opacity: 1;
		transition:
			opacity 60ms linear,
			visibility 60ms linear;
	}
	.text-truncate {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.text__nowrap {
		white-space: nowrap !important;
	}
	.text__truncate,
	.ai_agent_intent_box_head_text,
	.ticket_status,
	.ticket_list_header_title,
	.ticket_layout_sidebar_item_text,
	.product_select_sidebar_item,
	.dropdown2_item_title,
	.convo_header__source,
	.onboarding_box_head_title,
	.kv_row_label {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.text__left {
		text-align: left !important;
	}
	.text__right {
		text-align: right !important;
	}
	.text__center {
		text-align: center !important;
	}
	.text__justify {
		text-align: justify !important;
	}
	.text__lowercase {
		text-transform: lowercase !important;
	}
	.text__uppercase {
		text-transform: uppercase !important;
	}
	.text__capitalize {
		text-transform: capitalize !important;
	}
	.text__primary {
		color: #0d6efd !important;
	}
	.text__secondary,
	.ticket_rating_star_icon_wrapper,
	.onboarding_row.done .onboarding_row_content_title,
	.onboarding_row.done .onboarding_row_content_desc {
		color: #6c757d !important;
	}
	.text__success {
		color: #19b600 !important;
	}
	.text__warning,
	.ticket_rating_star_icon_wrapper:not(.readonly):hover .ticket_rating_star_icon,
	.ticket_rating_star_icon_wrapper.active .ticket_rating_star_icon {
		color: #ffc107 !important;
	}
	.text__danger {
		color: #ea3d2f !important;
	}
	.text__light {
		color: #e9ecef !important;
	}
	.text__dark {
		color: #343a40 !important;
	}
	.text__white {
		color: #fff !important;
	}
	.text__orange {
		color: #f3aa18 !important;
	}
	.text__muted,
	.timeline_group_day,
	.ai_agent_table_row_desc,
	.automation_template_card_desc,
	.ticket_detail_page_info_section_title,
	.order_pipeline_card_description,
	.bot_step__index,
	.trial_subscription_page_header_desc,
	.subscription_info_card_subtitle,
	.campaign_telesale_next_call_card_section_title,
	.my_activities_grid_calendar_label,
	.dropdown2_item_icon_wrapper .icon-tabler,
	.kv_row_label,
	.onboarding_modal_desc {
		opacity: 0.7;
	}
	.text__semibold {
		font-weight: 500 !important;
	}
	.text__bold {
		font-weight: 600 !important;
	}
	.text__italic {
		font-style: italic !important;
	}
	.text__underline {
		text-decoration: underline !important;
	}
	.text__sm {
		font-size: 14px !important;
	}
	.text__xs,
	.message_sent_status_text {
		font-size: 12px !important;
		line-height: 15px !important;
	}
	.text__xxs {
		font-size: 10px !important;
		line-height: 12px !important;
	}
	.text__lg {
		font-size: 18px !important;
	}
	.text__xl {
		font-size: 20px !important;
	}
	.text__xxl {
		font-size: 24px !important;
	}
	.text__3xl {
		font-size: 28px !important;
	}
	.section__header {
		font-weight: 500;
		font-size: 16px;
	}
	.w_25 {
		width: 25% !important;
	}
	.w_50 {
		width: 50% !important;
	}
	.w_75 {
		width: 75% !important;
	}
	.w_100 {
		width: 100% !important;
	}
	.w_auto {
		width: auto !important;
	}
	.h_25 {
		height: 25% !important;
	}
	.h_50 {
		height: 50% !important;
	}
	.h_75 {
		height: 75% !important;
	}
	.h_100 {
		height: 100% !important;
	}
	.h_auto {
		height: auto !important;
	}
	.progress {
		display: flex;
		height: 1rem;
		overflow: hidden;
		font-size: 0.75rem;
		background-color: #e9ecef;
		border-radius: 0.25rem;
	}
	.progress-bar {
		display: flex;
		flex-direction: column;
		justify-content: center;
		color: #fff;
		text-align: center;
		background-color: #007bff;
		transition: width 0.6s ease;
	}
	.progress-bar.static {
		transition: none;
	}
	.progress-bar-striped {
		background-image: linear-gradient(
			45deg,
			rgba(255, 255, 255, 0.15) 25%,
			transparent 25%,
			transparent 50%,
			rgba(255, 255, 255, 0.15) 50%,
			rgba(255, 255, 255, 0.15) 75%,
			transparent 75%,
			transparent
		);
		background-size: 1rem 1rem;
	}
	.progress-bar.progress-bar-loading {
		animation: indeterminateAnimation 1s infinite linear;
		transform-origin: 0% 50%;
	}
	@keyframes indeterminateAnimation {
		0% {
			transform: translateX(0) scaleX(0);
		}
		20% {
			transform: translateX(0) scaleX(0.2);
		}
		100% {
			transform: translateX(100%) scaleX(0.4);
		}
	}
	.progress_circle {
		display: flex;
		justify-content: center;
		align-items: center;
		width: 20px;
		height: 20px;
		border-radius: 50%;
		background:
			radial-gradient(closest-side, white 0 70%, transparent 75% 100%),
			conic-gradient(#19b600 var(--progress), #e9ecef 0);
	}
	.convos {
		min-width: 200px;
		max-width: 360px;
		position: relative;
		flex: 3;
		display: flex;
		flex-direction: column;
	}
	.convos__avatar_avt {
		width: 100%;
		height: 100%;
		position: relative;
	}
	.convos__avatar.convos__avatar_disabled {
		opacity: 0.3;
		pointer-events: none;
	}
	.convos__convo.convos__convo__disabled:hover .convos__convo__free {
		opacity: 1;
	}
	.convos__channel_img {
		width: 20px;
		height: 20px;
		border-radius: 50%;
	}
	.convos__channel {
		width: 26px;
		height: 26px;
		position: absolute;
		bottom: -5px;
		right: -5px;
		background: #fff;
		border-radius: 50%;
		z-index: 2;
		display: flex;
		justify-content: center;
		align-items: center;
	}
	.convos__avatar_avt.convos__avatar_avt__hidden {
		display: none;
	}
	.convos_preset_filter_link {
		cursor: pointer;
		position: relative;
		display: flex;
		align-items: center;
		margin-bottom: 5px;
	}
	.convos_preset_filter_link:last-child {
		margin-bottom: 0;
	}
	.convos_preset_filter_link.active {
		font-weight: 600;
	}
	.convos_preset_filter_link.active .convos_preset_filter_count {
		font-weight: 600;
	}
	.convos_preset_filter_link.active:before {
		color: #19b600;
		font-weight: 400;
		position: absolute;
		right: 5px;
		top: 0;
		font-size: 20px;
	}
	.convos_preset_filter_link_img {
		width: 20px;
		height: 20px;
		margin-right: 10px;
		object-fit: cover;
	}
	.convos_preset_filter_count {
		font-size: 13px;
		margin-left: auto;
		color: #6c757d;
	}
	.root {
		display: flex;
		flex: 1;
		flex-direction: column;
		overflow: hidden;
		width: 100vw;
		height: 100vh;
	}
	.root__header {
		flex-shrink: 0;
	}
	.root__body {
		display: flex;
		flex: 1;
		flex-direction: row;
		overflow: hidden;
		position: relative;
	}
	.root_content {
		background: white;
		position: relative;
		overflow: hidden;
		flex: 1;
	}
	.sidebar {
		display: flex;
		flex-direction: column;
		flex-shrink: 0;
		width: 45px;
		position: relative;
		height: 100%;
		background: #fff;
		z-index: 100;
		border-right: 1px solid #dee2e6;
	}
	.sidebar__item_label {
		color: #444;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		margin-left: 10px;
	}
	.popup_notification {
		position: absolute;
		z-index: 9999;
		right: 50%;
		left: 50%;
	}
	.popup_notification__item {
		display: flex;
		justify-content: center;
		border-radius: 5px;
		max-width: 80vw;
		margin: 10px auto;
		padding: 7px 20px;
		color: #fff;
	}
	.modal__container.notify-popup {
		position: fixed;
		top: 10px;
		left: 20px;
		z-index: 150;
		border-radius: 8px;
		overflow: hidden;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.notify-popup__head {
		width: 497px;
		height: 300px;
	}
	.notify-popup__head img {
		width: 100%;
		height: 100%;
		object-fit: cover;
	}
	.notify-popupw .modal-main {
		display: grid;
		grid-template-rows: 35% 65%;
		background: rgba(67, 129, 248, 0.1);
	}
	.notify-popup .body {
		padding: 0 30px;
		text-align: center;
		font-size: 14px;
		line-height: 18px;
		color: #000;
		display: flex;
		flex-direction: column;
		justify-content: center;
		background: #fff;
	}
	.notify-popup__title {
		font-size: 22px;
		font-weight: 700;
		text-transform: capitalize;
	}
	.notify-popup .modal-content {
		background: #fff;
		width: 497px;
		border-radius: 8px;
	}
	.notify-popup__desc {
		font-size: 18px;
		opacity: 0.8;
	}
	.nav_my_profile {
		border-radius: 12px;
		top: calc(100% + 13px);
		right: 0;
		position: absolute;
		width: 330px;
		background-color: #fff;
		border: #e5e5e5 1px solid;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		z-index: 2147483647;
		max-height: 80vh;
		overflow: auto;
	}
	.nav_my_profile__info {
		padding: 8px 20px;
		display: flex;
		align-items: center;
		justify-content: space-between;
		border-bottom: 1px solid #e5e5e5;
		cursor: pointer;
	}
	.nav_my_profile__info:hover {
		background-color: #ededed;
	}
	.help_wave.help_wave__hidden {
		opacity: 0;
	}
	.help_wave {
		cursor: pointer;
		position: absolute;
		right: 40px;
		width: 250px;
		bottom: 157px;
		background: #0d6efd;
		user-select: none;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		padding: 10px;
		border-radius: 8px;
		color: white;
		transition: all 0.2s;
		z-index: 2147483647;
	}
	.help_wave.has_phone {
		right: 44px;
	}
	.error_settings_dropdown {
		position: absolute;
		right: 7px;
		width: 335px;
		top: 6px;
		user-select: none;
		background-color: #ea3d2f;
		color: white;
		box-shadow: 0 2px 20px rgba(0, 0, 0, 0.44);
		padding: 10px;
		border-radius: 8px;
		transition: all 0.2s;
		z-index: 905;
	}
	.activity__root {
		display: flex;
		overflow: hidden;
		height: 100%;
	}
	.main {
		display: flex;
		overflow: auto;
		position: relative;
		display: flex;
		height: 100%;
		justify-content: space-between;
	}
	.quickview {
		width: 100%;
		position: relative;
		height: 100%;
		display: flex;
	}
	.quickview__btn_close {
		position: absolute;
		z-index: 10;
		flex-shrink: 0;
		margin-right: 10px;
		margin-top: 10px;
		top: 10px;
		right: 10px;
		border-radius: 50%;
		height: 40px;
		width: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		background: white;
		cursor: pointer;
	}
	.quickview__btn_close .quickview__btn_close__icon {
		stroke: #495057;
	}
	.quickview__btn_close:hover .quickview__btn_close__icon {
		stroke: #000;
	}
	.header_bar.header_bar__churned {
		background-color: #848484;
	}
	.header_bar {
		background-color: #0f457d;
		height: 46px;
		padding: 0 20px;
		display: flex;
	}
	.header_bar_left {
		display: flex;
		align-items: center;
		flex-wrap: none;
	}
	.header_bar_center {
		flex: 1;
		display: flex;
		flex-wrap: nowrap;
		align-items: center;
	}
	.header_bar_logo {
		margin-right: 20px;
		width: 80px;
		opacity: 0.9;
		object-fit: cover;
		align-self: center;
		cursor: pointer;
	}
	.header_bar_logo:hover {
		opacity: 1;
	}
	.header_bar_menu_link {
		font-weight: 500;
		font-size: 16px;
		height: 36px;
		flex-shrink: 0;
		color: rgba(255, 255, 255, 0.6666666667) !important;
		padding: 6px 10px;
		margin: 0 5px;
		display: flex;
		align-items: center;
		position: relative;
		cursor: pointer;
	}
	.header_bar_menu_link:hover {
		color: white !important;
		border-radius: 8px;
		background: rgba(0, 0, 0, 0.2);
	}
	.header_bar_menu_link.active {
		background: rgba(0, 0, 0, 0.5);
		color: white !important;
		border-radius: 8px;
	}
	.header_bar_menu_link.active:after {
		width: 100%;
		transition: width ease 150ms;
	}
	.header_bar_menu_link.active .sidebar__icon_active_subiz_live {
		border: 3px solid #09183c;
	}
	.header_bar_menu_link:last-child {
		margin-right: 0;
	}
	.header_bar_menu_link:after {
		content: '';
		position: absolute;
		left: 50%;
		transform: translate(-50%, 0);
		bottom: -1px;
		width: 50%;
		transition: all ease 250ms;
	}
	.header_bar_menu_link .dropdown_item {
		color: initial;
	}
	.header_bar_menu_link .progress_circle {
		background:
			radial-gradient(closest-side, #0f457d 0 70%, transparent 75% 100%),
			conic-gradient(#19b600 var(--progress), #e9ecef 0);
	}
	.header_bar_menu_link:hover .progress_circle {
		background:
			radial-gradient(closest-side, #0c3764 0 70%, transparent 75% 100%),
			conic-gradient(#19b600 var(--progress), #e9ecef 0);
	}
	.header_bar_menu_link.active .progress_circle {
		background:
			radial-gradient(closest-side, #07223e 0 70%, transparent 75% 100%),
			conic-gradient(#19b600 var(--progress), #e9ecef 0);
	}
	.header_bar_menu_link_icon {
		display: block;
		stroke-width: 1.5;
		outline: none;
	}
	.header_menu_icon {
		font-weight: 500;
		font-size: 16px;
		flex-shrink: 0;
		color: rgba(255, 255, 255, 0.7333333333) !important;
		padding: 6px;
		margin: 0 2.5px;
		display: flex;
		align-items: center;
		position: relative;
		cursor: pointer;
	}
	.header_menu_icon:hover {
		border-radius: 50%;
		color: white !important;
		background: rgba(0, 0, 0, 0.2);
	}
	.header_menu_icon.active {
		background: rgba(0, 0, 0, 0.5);
		color: white !important;
		border-radius: 50%;
	}
	.header_menu_icon.active:after {
		width: 100%;
		transition: width ease 150ms;
	}
	.header_bar_message_count_badge {
		padding: 0 5px;
		background-color: #ea3d2f;
		color: #fff;
		font-size: 10px;
		top: 24px;
		position: absolute;
		font-weight: 500;
		margin-left: 5px;
		left: 8px;
		border-radius: 15px;
	}
	.header_bar_task_count_badge {
		padding: 0 5px;
		background-color: #838383;
		color: #fff;
		font-size: 10px;
		top: 24px;
		position: absolute;
		font-weight: 500;
		margin-left: 5px;
		left: 8px;
		border-radius: 15px;
	}
	.header_bar_noti_count_badge {
		background-color: #ea3d2f;
		color: #fff;
		padding: 3px 6px;
		border-radius: 10px;
		font-size: 10px;
		font-weight: 700;
		border: 2px solid #0f457d;
		position: absolute;
		top: -8px;
		line-height: 1;
		right: 0;
		min-width: 22px;
		text-align: center;
		transform: translateX(50%);
	}
	.header_bar_call_dot {
		width: 15px;
		height: 15px;
		border-radius: 50%;
		border: 3px solid #0f457d;
		position: absolute;
		bottom: 12px;
		right: 2px;
		align-items: center;
	}
	.status_agent_dot {
		width: 12px;
		height: 12px;
		border-radius: 50%;
		border: 2px solid #ffffff;
		align-items: center;
		position: absolute;
		bottom: 3px;
		left: 28px;
	}
	.item_unavailable {
		opacity: 0.5;
	}
	.header_bar_right {
		display: flex;
		margin-left: auto;
		align-items: center;
	}
	.header_bar_agent_avatar_container {
		align-self: center;
		max-height: 36px;
		margin-left: 5px;
		position: relative;
		padding: 6px 10px;
		display: flex;
		align-items: center;
	}
	.header_bar_agent_avatar_container:hover {
		background: rgba(0, 0, 0, 0.2);
		border-radius: 6px;
	}
	.header_bar_agent_avatar_container.active {
		background: rgba(0, 0, 0, 0.5);
		border-radius: 6px;
	}
	.account_info_name {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.header_bar_agent_avatar {
		width: 100%;
		height: 100%;
		object-fit: cover;
		cursor: pointer;
		border-radius: 50%;
	}
	@keyframes status-pulsate-tertiary {
		25% {
			transform: scale(1, 1);
		}
		80% {
			transform: scale(3, 3);
			opacity: 0;
		}
		100% {
			transform: scale(3, 3);
			opacity: 0;
		}
	}
	.sidebar__icon_active_subiz_live {
		position: absolute;
		background: #19b600;
		border-radius: 50%;
		border: 3px solid #0f457d;
		left: 23px;
		width: 14px;
		height: 14px;
		top: 21px;
	}
	.sidebar__icon_active_subiz_live.play::before {
		content: '';
		position: absolute;
		inset: 0;
		z-index: 0;
		background: inherit;
		border-radius: inherit;
		opacity: 1;
		animation-duration: 2s;
		animation-name: status-pulsate-tertiary;
	}
	.more_menu_dropdown {
		border-radius: 8px;
		top: calc(100% + 10px);
		padding: 10px;
		right: -25px;
		position: absolute;
		width: 350px;
		background-color: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		z-index: 110;
	}
	.more_menu_dropdown:after {
		border: solid transparent;
		position: absolute;
		pointer-events: none;
		border-color: hsla(0, 0%, 100%, 0);
		border-bottom-color: #fff;
		border-width: 10px;
		top: -18px;
		right: 8px;
	}
	.more_menu_order_dropdown {
		border-radius: 8px;
		top: calc(100% + 10px);
		padding: 10px;
		left: 0px;
		position: absolute;
		width: 280px;
		background-color: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		z-index: 110;
	}
	.more_menu_order_dropdown:after {
		border: solid transparent;
		position: absolute;
		pointer-events: none;
		border-color: hsla(0, 0%, 100%, 0);
		border-bottom-color: #fff;
		border-width: 10px;
		top: -18px;
		right: 8px;
	}
	.more_menu_item {
		background-color: transparent;
		border-radius: 8px;
		cursor: pointer;
		color: #343a40;
		padding: 10px;
		display: flex;
	}
	.more_menu_item:hover {
		background-color: #495057;
		color: white;
	}
	.more_menu_item:hover .badge.badge__primary {
		background-color: #fff;
		color: #343a40;
	}
	.more_menu_item_icon {
		width: 30px;
		margin-right: 10px;
	}
	.more_menu_item_header {
		font-weight: 500;
	}
	.more_menu_item_sub {
		opacity: 0.8;
		font-weight: 400;
	}
	.root_content_inner {
		width: 100%;
		height: 100%;
		overflow: hidden hidden;
		position: relative;
	}
	.call_online_dot {
		background: #19b600;
	}
	.call_offline_dot {
		background: #ffbb28;
	}
	.call_unavailable_dot {
		background: rgb(160, 160, 160);
	}
	.call_item {
		display: flex;
	}
	.call_icon {
		color: #ffffff;
	}
	.calling {
		color: white;
		z-index: 160;
		position: fixed;
		overflow-x: hidden;
		bottom: 74px;
		right: 50px;
		width: 330px;
		align-items: flex-end;
		border-radius: 14px;
		box-shadow:
			0px 0px 0px 0px,
			rgba(0, 0, 0, 0.22) 0px 10px 40px 0px,
			rgba(0, 0, 0, 0.17) 0px 0px 16px 0px;
	}

	.minimize_icon {
		width: 24px;
		height: 24px;
		border-radius: 12px;
		display: flex;
		justify-content: center;
		align-items: center;
		cursor: pointer;
		user-select: none;
		background-color: rgba(0, 0, 0, 0.17);
		font-weight: 500;
		transifion: background-color 150s ease-out;
	}
	.minimize_icon:hover {
		background-color: rgba(0, 0, 0, 0.4);
	}
	.calling_user_name {
		font-weight: 500;
		font-size: 20px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		color: white;
	}
	.calling_user_number {
		font-weight: 400;
		font-size: 18px;
		color: white;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}

	.global_help_button {
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		transform: rotate(-90deg) translate(-100%, -50%);
		width: 120px;
		height: 50px;
		display: flex;
		padding-top: 5px;
		align-items: flex-start;
		font-size: 13px;
		background-color: #0d6efd;
		color: #fff;
		border-radius: 0;
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
		z-index: 999;
		font-weight: 500;
		position: absolute;
		bottom: 260px;
		right: -80px;
		display: flex;
		justify-content: center;
		transition: 0.25s;
	}
	.global_help_button.global_help_button__enabled {
		cursor: pointer;
	}
	.global_help_button.global_help_button__enabled:hover {
		transform: rotate(-90deg) translate(-100%, -70%);
	}
	.global_call_button {
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		transform: rotate(-90deg) translate(-100%, -50%);
		width: 70px;
		height: 50px;
		display: flex;
		padding-top: 5px;
		align-items: flex-start;
		font-size: 13px;
		background-color: #19b600;
		color: #fff;
		border-radius: 0;
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
		z-index: 999;
		font-weight: 500;
		position: absolute;
		bottom: 100px;
		right: -55px;
		display: flex;
		justify-content: center;
		transition: 0.25s;
		cursor: pointer;
	}
	.global_call_button:hover {
		transform: rotate(-90deg) translate(-100%, -70%);
	}
	.global_call_button .icon-tabler-phone {
		stroke: transparent;
	}
	.global_call_button .icon-tabler-phone path:last-child {
		fill: currentColor;
	}
	.global_call_button.global_call_button__muted {
		background-color: #343a40;
	}
	.global_call_button.global_call_button__disabled {
		cursor: default;
		background-color: #ced4da;
	}
	.global_call_button.global_call_button__warning {
		background-color: #ffc107;
	}
	.link.link__dark,
	.onboarding_row.done .link__dark.onboarding_row_cta,
	.link__dark.onboarding_row_ignore_link,
	.link__dark.message_event_action_link {
		color: white;
		stroke: #fff;
	}
	.link.link__dark:hover,
	.onboarding_row.done .link__dark.onboarding_row_cta:hover,
	.link__dark.onboarding_row_ignore_link:hover,
	.link__dark.message_event_action_link:hover {
		color: white;
		stroke: #fff;
	}
	.modal_content.onboarding_modal_content {
		width: 500px;
		position: relative;
	}
	.onboarding_modal_content_inner {
		padding: 15px 20px;
		padding-bottom: 0;
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.onboarding_modal_x {
		width: 28px;
		height: 28px;
		background-color: #fff;
		color: #adb5bd;
		cursor: pointer;
		border-radius: 50%;
		position: absolute;
		display: flex;
		align-items: center;
		justify-content: center;
		top: 20px;
		right: 20px;
		border: 1px solid #dee2e6;
		box-shadow: 0 5px 15px rgba(0, 0, 0, 0.15);
		z-index: 1;
	}
	.onboarding_modal_x:hover {
		color: #6c757d;
	}
	.onboarding_modal_nav_dot {
		width: 16px;
		height: 16px;
		cursor: pointer;
		position: relative;
	}
	.onboarding_modal_nav_dot.active {
		cursor: auto;
	}
	.onboarding_modal_nav_dot.active:before {
		background-color: #0d6efd;
	}
	.onboarding_modal_nav_dot:before {
		content: '';
		position: absolute;
		width: 8px;
		height: 8px;
		border-radius: 9999px;
		background-color: #ced4da;
		top: 4px;
		left: 4px;
	}
	.onboarding_modal_img_wrapper {
		height: 370px;
		overflow: hidden;
		position: relative;
		display: flex;
	}
	.onboarding_modal_img_inner {
		width: 100%;
		height: 100%;
		position: relative;
		overflow: hidden;
		z-index: 1;
	}
	.onboarding_modal_content_wrapper {
		position: relative;
		height: 120px;
		overflow: hidden;
	}
	.onboarding_modal_content_container {
		position: absolute;
		top: 0;
		left: 0;
		transition: 0.5s;
		display: flex;
		flex-direction: column;
		width: 100%;
		height: 100%;
	}
	.onboarding_modal_img {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		object-fit: cover;
		transition: 0.5s;
		z-index: -1;
	}
	.onboarding_modal_img_navigation {
		cursor: pointer;
		position: absolute;
		z-index: 1;
		color: rgba(255, 255, 255, 0.6);
		top: 50%;
		transform: translateY(-50%);
	}
	.onboarding_modal_img_navigation:hover {
		color: rgba(255, 255, 255, 0.85);
	}
	.onboarding_modal_img_navigation.left {
		left: 0;
	}
	.onboarding_modal_img_navigation.right {
		right: 0;
	}
	@media only screen and (min-width: 500px) and (max-width: 1281px) {
		.onboarding_modal_img_wrapper {
			height: 280px;
			justify-content: center;
			background: whitesmoke;
		}
		.onboarding_modal_img_inner {
			width: 400px;
		}
		.onboarding_modal_img_navigation {
			color: rgba(0, 0, 0, 0.3);
		}
		.onboarding_modal_img_navigation:hover {
			color: rgba(0, 0, 0, 0.5);
		}
	}
	.onboarding_modal_title {
		font-size: 24px;
		font-weight: 500;
	}
	.onboarding_modal_desc {
		margin-top: 0;
	}
	.global_email_button {
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		transform: rotate(-90deg) translate(-100%, -50%);
		width: 70px;
		height: 50px;
		display: flex;
		padding-top: 5px;
		align-items: flex-start;
		font-size: 13px;
		background-color: #d44638;
		color: #fff;
		border-radius: 0;
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
		z-index: 999;
		font-weight: 500;
		position: absolute;
		bottom: 320px;
		right: -55px;
		display: flex;
		justify-content: center;
		transition: 0.25s;
		cursor: pointer;
	}
	.global_email_button:hover {
		transform: rotate(-90deg) translate(-100%, -70%);
	}
	.global_email_window {
		width: 600px;
		height: 600px;
		position: fixed;
		background-color: #fff;
		bottom: 0;
		z-index: 170;
		right: 60px;
		overflow: hidden;
		box-shadow:
			0px 8px 10px 1px rgba(0, 0, 0, 0.14),
			0px 3px 14px 2px rgba(0, 0, 0, 0.12),
			0px 5px 5px -3px rgba(0, 0, 0, 0.2);
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.global_email_window.hidden {
		display: none;
	}
	.global_email_window.mini {
		width: 300px;
		height: unset;
	}
	.global_email_window.mini .global_email_window_content {
		display: none;
	}
	.global_email_window.mini .global_email_window_footer {
		display: none;
	}
	.global_email_window_header {
		padding: 4px 10px;
		background-color: #f8f9fa;
		display: flex;
		align-items: center;
		flex-shrink: 0;
	}
	.global_email_window_content {
		flex: 1;
		min-height: 0;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.global_email_window_content .email_header {
		flex-shrink: 0;
	}
	.global_email_window_content_info_wrapper {
		display: flex;
		align-items: center;
		padding: 4px 0px;
		margin-left: 10px;
		margin-right: 10px;
		border-bottom: 1px solid #dee2e6;
	}
	.global_email_window_content_info_wrapper:last-child {
		border-bottom: none;
	}
	.global_email_window_footer {
		padding: 4px 10px;
		background-color: #f8f9fa;
		display: flex;
		align-items: center;
		justify-content: flex-end;
		flex-shrink: 0;
	}
	.warning_modal_wrapper {
		width: 420px;
		position: relative;
	}
	.warning_modal_wrapper .warning_modal_header {
		background-color: #9d9d9d;
		height: 200px;
		justify-content: center;
		align-items: center;
	}
	.warning_modal_wrapper .warning_modal_content_wrapper {
		padding: 10px 30px;
	}
	.warning_modal_wrapper .warning_modal_content_wrapper .warning_modal_content_title {
		font-size: 20px;
		font-weight: 700;
		margin: 10px;
	}
	.bg-success {
		background-color: #19b600;
	}
	.bg-success-light {
		background-color: rgba(25, 182, 0, 0.15);
	}
	.bg-secondary {
		background-color: #6c757d;
	}
	.bg-secondary-light {
		background-color: rgba(108, 117, 125, 0.15);
	}
	.bg-primary {
		background-color: #0d6efd;
	}
	.bg-primary-light {
		background-color: rgba(13, 110, 253, 0.15);
	}
	.bg-warning {
		background-color: #ffc107;
	}
	.bg-warning-light {
		background-color: rgba(255, 193, 7, 0.15);
	}
	.bg-danger {
		background-color: #ea3d2f;
	}
	.bg-danger-light {
		background-color: rgba(234, 61, 47, 0.15);
	}
	.bg-dark {
		background-color: #343a40;
	}
	.hello-bar.bg-warning {
		background-color: #fe9a28;
	}
	.hello-bar {
		color: white;
		height: 24px;
		font-size: 12px;
		line-height: 1;
		padding: 6px 0;
		font-weight: 500;
		position: relative;
	}
	.hello-bar a {
		color: white;
		font-weight: 700;
		text-decoration: underline;
	}
	.hello-bar b {
		font-weight: 700;
	}
	.sbz_popup_cta_btn {
		position: absolute;
		bottom: -30px;
		width: 320px;
		height: 120px;
		font-size: 24px;
		font-weight: 500;
		background-color: #0d6efd;
		cursor: pointer;
		border-radius: 60px;
		color: #fff;
		box-shadow: rgba(0, 0, 0, 0.3) 0px 12px 45px;
	}

	.reflink {
		background: #ffebaf;
		padding: 5px 8px;
		border: 1px dashed var(--yellow);
		border-radius: 3px;
		font-weight: 500;
		color: #41371a;
	}
	.account_header_layout {
		padding: 0 30px;
		height: 46px;
		background-color: #fafafa;
		display: flex;
		justify-content: space-between;
		border-bottom: 1px solid #dee2e6;
	}
	.account_manage_container {
		width: 400px;
		height: 260px;
		padding: 10px 20px;
		border: 1px solid #e6e6e6;
		border-radius: 8px;
		position: absolute;
		z-index: 110;
		left: 10px;
		right: 0;
		top: 50px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		overflow: auto;
		background-color: #fff;
	}
	.account_manage_list {
		display: flex;
		flex-wrap: wrap;
		justify-content: space-between;
	}
	.account_box_container {
		display: flex;
		flex-direction: column;
		align-items: center;
		justify-content: center;
		padding: 10px;
		border: 1px solid #e6e6e6;
		border-radius: 8px;
		width: 45%;
		margin-bottom: 8px;
	}
	.account_box {
		display: flex;
		flex-direction: column;
		align-items: center;
		justify-content: center;
		padding: 10px;
		border-radius: 8px;
		height: 140px;
		width: 100%;
		overflow: hidden;
		cursor: pointer;
	}
	.account_box:hover {
		background-color: #e9ecef;
	}
	.account_box .box_name {
		width: 100%;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		text-align: center;
	}
	.account_box.account_box_disabled {
		filter: grayscale(1);
		cursor: default;
	}
	.account_box.account_box_disabled:hover {
		background-color: unset;
	}
	.plan_tag {
		margin: 5px 5px 5px 0;
		padding: 0px 5px;
		font-size: 12px;
		font-weight: 400;
		line-height: 18px;
		border-radius: 15px;
		display: inline-block;
		max-width: 100%;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		text-align: center;
	}
	.plan_tag__success {
		color: rgb(65, 117, 5);
		background: rgb(227, 234, 218);
		border-color: rgb(198, 214, 180);
	}
	.plan_tag__primary {
		color: #007aff;
		background: #ddebff;
		border-color: rgb(179, 182, 255);
	}
	.plan_tag__orange {
		color: rgb(248, 177, 28);
		background: rgb(254, 243, 221);
		border-color: rgb(253, 232, 187);
	}
	.plan_tag__danger {
		color: #ea3d2f;
		background-color: #f9d6d4;
		border-color: #f7e4e2;
	}
	.switch_account_item {
		border-bottom: 1px solid #dee2e6;
		padding: 10px 20px;
	}
	.agent_profile_body {
		border-bottom: 1px solid #dee2e6;
	}
	.agent_profile_item {
		padding: 8px 20px;
		cursor: pointer;
		display: flex;
		align-items: center;
	}
	.agent_profile_item:hover {
		background-color: #ededed;
	}
	.agent_profile_item.active {
		background-color: #e9ecef;
	}
	.text__ellipsis {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.expired_bar {
		background: #fdcd0d;
		height: 30px;
		padding: 0 20px;
		display: flex;
		align-items: center;
	}
	.trial_expired_title {
		margin-right: 10px;
		font-size: 14px;
	}
	.trial_expired_title strong {
		font-weight: 700;
	}
	.message_internal_actions {
		z-index: 20;
		transition:
			opacity 150ms ease,
			visibility 150ms ease;
		visibility: hidden;
		opacity: 0;
		display: flex;
		padding: 2px;
		border-radius: 10px;
		justify-content: center;
		align-items: center;
	}
	.message_internal_action {
		cursor: pointer;
		color: #343a40;
		margin-left: 5px;
		margin-right: 5px;
	}
	.message_internal_action:hover {
		color: #0d6efd;
	}
	.message_editor_quote {
		width: 100%;
		border-bottom: 1px solid #adb5bd;
		display: flex;
		padding: 5px 10px;
	}
	.message_editor_quote.message_editor_quote_hide {
		display: none;
	}
	.message_editor_quote_content {
		font-size: 13px;
		padding-right: 10px;
		overflow: hidden;
	}
	.truncate_2_line {
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
		overflow: hidden;
	}
	.truncate_3_line,
	.generic-attachment--element-subtitle {
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		overflow: hidden;
	}
	.truncate_4_line {
		display: -webkit-box;
		-webkit-line-clamp: 4;
		-webkit-box-orient: vertical;
		overflow: hidden;
	}
	.truncate_5_line {
		display: -webkit-box;
		-webkit-line-clamp: 5;
		-webkit-box-orient: vertical;
		overflow: hidden;
	}
	.message_editor_quote_text {
		color: #6c757d;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		line-height: 1.25;
		white-space: pre;
	}
	.policy-view {
		height: 100vh;
		overflow: auto;
	}
	.privacy-policy {
		width: 900px;
		padding-top: 30px;
		padding-bottom: 20px;
		margin: 0 auto;
	}
	.privacy-policy h1 {
		font-size: 2em;
	}
	.privacy-policy h3 {
		font-size: 1.17em;
	}
	.term_of_service_layout {
		height: 100vh;
		overflow: auto;
	}
	.term_of_service_layout .term_of_service_body {
		width: 900px;
		padding-top: 30px;
		padding-bottom: 20px;
		margin: 0 auto;
	}
	.term_of_service_layout .term_of_service_body h1 {
		font-size: 2em;
	}
	.term_of_service_layout .term_of_service_body h3 {
		font-size: 1.17em;
	}
	.trial_warning_modal_wrapper {
		padding: 20px 30px;
		max-height: 100%;
	}
	.trial_warning_modal_wrapper .subs-package {
		margin-top: 5px;
		display: flex;
		padding: 12px 20px;
		align-items: center;
		justify-content: space-between;
		border: 1px solid #dee2e6;
		border-radius: 8px;
	}
	.internet_status {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		font-size: 12px;
		z-index: 10;
		text-align: center;
		padding: 2px 5px;
	}
	.internet_status.negative {
		background-color: #212325;
		color: #fff;
	}
	.internet_status.positive {
		background-color: #19b600;
		color: #fff;
	}
	.kv_row {
		display: flex;
		margin-top: 3px;
	}
	.kv_row_label {
		width: 140px;
		margin-right: 20px;
		flex-shrink: 0;
	}
	.kv_row_content {
		white-space: pre-wrap;
	}
	::-webkit-scrollbar {
		width: 8px;
		height: 8px;
		background: #fafafa;
	}
	::-webkit-scrollbar-track {
		border-radius: 0px;
	}
	::-webkit-scrollbar-thumb {
		border-radius: 3px;
		background: #ddd;
	}
	/* Handle on hover */
	::-webkit-scrollbar-thumb:hover {
		background: #bbb;
	}
	.prose_editor p {
		margin-bottom: 0; /* reset */
	}
	.prose_editor strong,
	.prose_editor b {
		font-weight: 700;
	}
	.message_editor {
		cursor: text;
		position: relative;
		border: 1px solid #aaa;
		border-radius: 7px;
		background-color: white;
		display: flex;
		transition:
			background-color 200ms ease,
			border 500ms ease;
	}
	.message_editor:hover {
		border-color: #000;
	}
	.message_editor.message_editor__plain {
		flex-wrap: wrap;
		justify-content: flex-end;
		border: none;
		background-color: #f4f4f4;
	}
	.message_editor.message_editor__plain:hover,
	.message_editor.message_editor__plain:active {
		background: #efefef;
	}
	.message_editor.message_editor__html {
		flex-wrap: wrap;
		flex-direction: column-reverse;
		align-items: flex-start;
		background: #f8f9fa;
	}
	.message_editor.message_editor__html .message_editor__actions {
		position: absolute;
		bottom: 100%;
		right: 0;
	}
	.message_editor__attachments__image {
		display: flex;
		flex-wrap: wrap;
		border-top: 1px solid #dee2e6;
		max-height: 120px;
		overflow: auto;
		width: 100%;
		padding-bottom: 10px;
	}
	.message_editor__attachment {
		margin: 10px 0 0 10px;
		position: relative;
	}
	.message_editor__attachment_image {
		max-width: 60px;
		height: 60px;
		object-fit: cover;
		border-radius: 10px;
		user-select: none;
	}
	.message_editor__attachment_image.image--small {
		width: 60px;
		height: 60px;
	}
	.message_editor__attachment_x {
		position: absolute;
		right: 5px;
		top: 5px;
		color: #dee2e6;
		background: rgba(0, 0, 0, 0.4784313725);
		padding: 4px;
		border-radius: 100%;
		cursor: pointer;
		border: 1px solid;
	}
	.message_editor__attachment_x:hover {
		color: white;
		background: rgba(0, 0, 0, 0.8549019608);
	}
	.message_editor__attachment_x.x--small {
		top: 0;
		right: 0;
	}
	.message_editor__remove_file {
		color: #ced4da;
		flex: 0 0 30px;
		margin-left: 10px;
		padding: 4px;
		border-radius: 100%;
		cursor: pointer;
	}
	.message_editor__remove_file:hover {
		color: black;
	}
	.message_editor__attachments__file {
		display: flex;
		flex-wrap: wrap;
		border-top: 1px solid #dee2e6;
		width: 100%;
		padding-bottom: 10px;
	}
	.message_editor__attachment_file {
		display: flex;
		max-width: 250px;
		object-fit: cover;
		border-radius: 10px;
		border: 1px solid #dee2e6;
		align-items: center;
		padding: 10px;
		user-select: none;
	}
	.message_editor__attachment_file_logo {
		flex: 0 0 30px;
		border-right: 1px solid #dee2e6;
		display: block;
		fill: #ebebeb;
		padding-right: 10px;
	}
	.message_editor__attachment_file_name {
		font-weight: 500;
	}
	.add-agent {
		cursor: pointer;
	}
	.modal-main .addtags .label {
		width: unset;
	}
	.message_editor__attachment_order {
		border: 1px solid #aaa;
		background: white;
		border-radius: 8px;
		width: 200px;
		height: 200px;
		overflow-y: auto;
		overflow-x: hidden;
		padding: 10px;
	}
	.message_editor__attachment_order_label {
		font-size: 13px;
		color: #777;
	}
	.message_editor__attachment_order_note {
		font-size: 14px;
		white-space: pre-wrap;
		overflow: hidden;
		text-overflow: ellipsis;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
	}
	.message_editor__attachment_order_product_img {
		width: 50px;
		height: 50px;
		margin-right: 10px;
		border-radius: 5px;
		flex-shrink: 0;
		display: block;
		object-fit: contain;
		background: whitesmoke;
	}
	.template_picker {
		position: absolute;
		bottom: 100%;
		background: white;
		padding: 0px 0px 0px 0px;
		z-index: 99;
		width: 100%;
		background: white;
		border-radius: 8px 8px 0px 0px;
		margin-bottom: 0px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		max-height: 60vh;
		display: flex;
		flex-direction: column;
	}
	.template_picker.template_picker__hide {
		display: none;
	}
	.template_picker__template {
		color: black;
		cursor: pointer;
		padding-top: 8px;
		padding-bottom: 8px;
	}
	.template_picker__template:hover {
		background: #e0f0ff;
	}
	.template_picker__header {
		display: flex;
		align-items: center;
		flex-shrink: 0;
		padding-top: 10px;
		padding-right: 15px;
		padding-left: 20px;
		padding-bottom: 10px;
		border-bottom: 1px solid #e2e2e2;
	}
	.template_picker__templates {
		flex: 1;
		background: #f3f3f3;
		overflow-y: auto;
		overflow-x: hidden;
	}
	.template_picker__template_label_wrapper {
		margin-left: 20px;
		display: flex;
		padding-bottom: 5px;
		overflow: hidden;
	}
	.template_picker__template_label {
		margin-right: 5px;
		display: inline-block;
		align-self: center;
		text-overflow: ellipsis;
		white-space: nowrap;
		overflow: hidden;
		padding: 2px 5px;
		background-color: #d9e6f2;
		color: #1c2d8c;
		font-weight: 500;
		font-size: 13px;
		border-radius: 4px;
	}
	.template_picker__template_summary {
		font-size: 15px;
		margin-left: 20px;
		margin-right: 10px;
		line-height: 18px;
		color: #333;
		word-break: break-word;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		display: -webkit-box;
		overflow: hidden;
	}
	.template_picker__template.template_picker__template__active {
		background: rgba(167.88, 202.8, 254.28, 0.5);
	}
	.template_picker__upgrade {
		display: flex;
		flex-direction: column;
		align-items: center;
		margin: 10px;
	}
	.suggestion {
		position: absolute;
		bottom: 100%;
		background: white;
		padding: 0px 0px 0px 0px;
		z-index: 99;
		left: 0;
		max-width: 100%;
		background: white;
		border-radius: 8px 8px 0px 0px;
		margin-bottom: 0px;
		max-height: 250px;
		overflow: auto;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.suggestion__item {
		color: black;
		cursor: pointer;
		display: flex;
		min-width: 150px;
		align-items: center;
		justify-content: space-between;
		padding: 10px 20px;
	}
	.suggestion__item:hover {
		background: #e0f0ff;
	}
	.suggestion__item__text {
		flex: 1;
		display: flex;
		align-items: center;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.suggestion__item__help {
		opacity: 0;
		justify-self: flex-end;
		margin-left: 20px;
	}
	.suggestion__item__help code {
		color: #fff;
	}
	.suggestion__item.suggestion__item__active {
		background: #0d6efd;
		color: white;
	}
	.suggestion__item.suggestion__item__active .suggestion__item__help {
		opacity: 1;
	}
	.email_header {
		position: relative;
		width: 100%;
		background: white;
		border-top: none;
		border-radius: 5px;
	}
	.email_header .vue-tags-input {
		background: #324652;
	}
	.email_header .vue-tags-input .ti-new-tag-input {
		margin-top: -2px;
		background: transparent;
		color: black;
	}
	.email_header .vue-tags-input .ti-input {
		border: none !important;
		padding: 0 !important;
		transition: border-bottom 200ms ease !important;
	}
	.email_header div.vue-tags-input {
		max-width: unset;
	}
	.email_header li.ti-new-tag-input-wrapper {
		margin: 0;
		margin-bottom: 2.5px;
		margin-top: 2.5px;
		min-height: 26px;
	}
	.email_header li.ti-new-tag-input-wrapper .ti-new-tag-input {
		width: 0px;
	}
	.email_header input.ti-tag-input {
		font-size: 16px;
		margin-top: -2px;
	}
	.email_header .ti-icon-undo {
		display: none;
	}
	.email_header .input-subject {
		margin-top: 5px;
		margin-bottom: 5px;
		height: 28px;
		font-size: 16px;
		width: 100%;
		border: none;
	}
	.email_header__label {
		margin-top: 3px;
		color: #757575;
		margin-right: 10px;
		white-space: nowrap;
	}
	.email_header .input-label {
		color: #757575;
		font-size: 16px;
		font-weight: 600;
		margin-top: 10px;
		margin-bottom: 10px;
	}
	.email_header .ti-new-tag-input {
		font-size: 16px;
	}
	.email_header .minimize-btn,
	.email_header .expand-btn {
		position: absolute;
		right: 10px;
		top: 10px;
		cursor: pointer;
		color: gray;
		user-select: none;
		z-index: 5;
	}
	.email_header .minimize-btn:hover,
	.email_header .expand-btn:hover {
		color: black;
	}
	.email_header__subject_input {
		width: 100%;
		border: none;
	}
	.email_header__subject_input:focus {
		outline: none;
	}
	.email_header__subject {
		display: flex;
		align-items: center;
		padding: 10px 0;
		margin: 0 10px;
		border-bottom: 1px solid #eee;
	}
	.email_header__from {
		display: flex;
		align-items: center;
		padding: 10px 0;
		margin: 0 120px 0 10px;
	}
	.email_header__to.email_header__to__mini {
		display: flex;
		align-items: center;
		padding: 10px 0;
		margin: 0 10px 0 10px;
		border-top: none;
	}
	.email_header__to {
		display: flex;
		align-items: flex-start;
		padding: 10px 0;
		margin: 0 10px;
		border-top: 1px solid #eee;
		border-bottom: 1px solid #eee;
	}
	.email_header .subject-input {
		display: flex;
		border-bottom: 1px solid #ebebeb;
	}
	.email_header div.ti-input {
		border: none;
	}
	.email_header .vue-tags-input .ti-autocomplete {
		background: white;
		border-bottom-left-radius: 5px;
		border-bottom-right-radius: 5px;
		border: 1px solid #cacaca;
		border-top: none;
	}
	.email_header .vue-tags-input .ti-item {
		padding-top: 5px;
		padding-bottom: 5px;
		padding-left: 5px;
	}
	.email_header .vue-tags-input .ti-item div {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	/* the selected item in the autocomplete layer, should be highlighted */
	.email_header .vue-tags-input .ti-item.ti-selected-item {
		background: #d4eafe;
		color: black;
	}
	/* style the placeholders color across all browser */
	.email_header .vue-tags-input ::-webkit-input-placeholder {
		color: #a4b1b6;
	}
	.email_header .vue-tags-input ::-moz-placeholder {
		color: #a4b1b6;
	}
	.email_header .vue-tags-input :-ms-input-placeholder {
		color: #a4b1b6;
	}
	.email_header .vue-tags-input :-moz-placeholder {
		color: #a4b1b6;
	}
	.email_header .vue-tags-input .ti-tag.ti-invalid {
		color: #750000;
	}
	.email_header .vue-tags-input .ti-tag.ti-invalid .ti-icon-close {
		color: #fff0f0;
	}
	.email_header .vue-tags-input .ti-tag.ti-invalid .ti-icon-close:hover {
		color: white;
	}
	.email_header .ti-icon-close {
		padding-top: 1px;
		color: #abb8ff;
	}
	.email_header .ti-icon-close:hover {
		color: black;
	}
	.email_header .vue-tags-input .ti-tag.ti-editing {
		background: #fffbde;
	}
	/* default styles for all the tags */
	.email_header .vue-tags-input .ti-tag {
		border-radius: 7px;
		background: #ebf6ff;
		font-size: 16px;
		color: #010d75;
		position: relative;
		margin: 0;
		margin-right: 5px;
		cursor: pointer;
		margin-top: 2.5px;
		margin-bottom: 2.5px;
	}
	.email_header .vue-tags-input .ti-tag:hover {
		background: #e0f1ff;
	}
	.email_header .vue-tags-input .ti-tag .ti-tag-center {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		max-width: 200px;
	}
	/* we defined a custom css class in the data model, now we are using it to style the tag */
	.email_header .vue-tags-input .ti-tag.custom-class {
		background: transparent;
		border: 1px solid #ebde6e;
		color: #ebde6e;
		margin-right: 4px;
		border-radius: 0px;
		font-size: 13px;
	}
	/* the styles if a tag is invalid */
	.email_header .vue-tags-input .ti-tag.ti-invalid {
		background-color: #ffcaba;
	}
	.email_header .vue-tags-input .ti-tag.ti-invalid:hover {
		background-color: #ffbaaa;
	}
	/* if the user input is invalid, the input color should be red */
	.email_header .vue-tags-input .ti-new-tag-input.ti-valid {
		color: #010d75;
	}
	/* if a tag or the user input is a duplicate, it should be crossed out */
	.email_header .vue-tags-input .ti-duplicate span,
	.vue-tags-input .ti-new-tag-input.ti-duplicate {
		text-decoration: line-through;
	}
	.email_header .vue-tags-input li.ti-tag.ti-deletion-mark {
		background: #ffd7d7;
		color: #750000;
	}
	.dynamic-field.ProseMirror-selectednode {
		border: 1px dashed shade-color(#ffc107, 8);
		background-color: tint-color(#ffc107, 2);
	}
	.dynamic-field {
		position: relative;
		background-color: rgba(255, 193, 7, 0.231372549);
		color: shade-color(#ffc107, 6);
		border-radius: 4px;
		padding: 0 4px;
		border: 1px dashed shade-color(#ffc107, 2);
		cursor: pointer;
		text-transform: lowercase;
		display: inline;
	}
	.dynamic-field:hover {
		background-color: tint-color(#ffc107, 2);
		color: shade-color(#ffc107, 8);
		transition: background-color 150ms ease;
	}
	.message_editor__tab {
		border-radius: 5px;
		background: #ececec;
		padding: 2px 5px;
		margin-bottom: 5px;
		margin-right: 5px;
		cursor: pointer;
	}
	.mention {
		color: #104c7b;
		background: #dff1ff;
		padding: 0 2px;
		border-radius: 4px;
	}
	.message_editor__action_item_dot {
		position: absolute;
		width: 10px;
		height: 10px;
		border-radius: 50%;
		background-color: #ea3d2f;
		border: 2px solid;
		border-color: inherit;
		top: 4px;
		left: 17px;
	}

	.sbz-dynamic-field {
		cursor: pointer;
		padding: 0px 2px;
		border-radius: 4px;
		background-color: rgb(255, 222.76, 126.04);
		text-transform: lowercase;
	}

	.lexical-preview-div p {
		margin-bottom: 0;
	}
	.lexical-preview-div h1,
	.lexical-preview-div h2,
	.lexical-preview-div h3,
	.lexical-preview-div h4,
	.lexical-preview-div h5,
	.lexical-preview-div h6 {
		font-size: initial;
	}
	.lexical-preview-div ul,
	.lexical-preview-div ol {
		margin-top: 10px;
		margin-bottom: 10px;
	}
	.lexical-preview-div .sbz_lexical_text__bold {
		font-weight: 700;
	}
	.lexical-preview-div .sbz_lexical_text__italic {
		font-style: italic;
	}
	.lexical-preview-div .sbz_lexical_text__underline {
		text-decoration: underline;
	}

	.messages_bg {
		position: relative;
		background: #f0f2f5;
		display: flex;
		flex-direction: column;
		flex: 4;
	}
	.messages {
		flex: 4;
		position: relative;
		display: flex;
		position: relative;
		overflow: hidden;
		vertical-align: top;
		background: #f0f2f5;
		flex-direction: column;
	}
	.messages.email {
		background-color: whitesmoke;
	}
	.messages.whatsapp {
		background-color: #efeae2;
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e58c947d9b5c9612269f.jpg);
		background-position: center;
		background-repeat: no-repeat;
		background-size: cover;
	}
	.messages.instagram_comment {
		background: rgba(240, 148, 51, 0.2);
		background: -moz-linear-gradient(
			45deg,
			#f09433 0%,
			rgba(230, 104, 60, 0.1333333333) 25%,
			rgba(220, 39, 67, 0.1333333333) 50%,
			rgba(204, 35, 102, 0.1333333333) 75%,
			rgba(188, 24, 136, 0.1333333333) 100%
		);
		background: -webkit-linear-gradient(
			45deg,
			rgba(240, 148, 51, 0.1333333333) 0%,
			rgba(230, 104, 60, 0.1333333333) 25%,
			rgba(220, 39, 67, 0.1333333333) 50%,
			rgba(204, 35, 102, 0.1333333333) 75%,
			rgba(188, 24, 136, 0.1333333333) 100%
		);
		background: linear-gradient(
			45deg,
			rgba(240, 148, 51, 0.1333333333) 0%,
			rgba(230, 104, 60, 0.1333333333) 25%,
			rgba(220, 39, 67, 0.1333333333) 50%,
			rgba(204, 35, 102, 0.1333333333) 75%,
			rgba(188, 24, 136, 0.1333333333) 100%
		);
		filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#f09433", endColorstr="#bc1888",GradientType=1 );
	}
	.convo_events {
		margin: 0 auto;
		overflow-x: auto;
		overflow-y: scroll;
		width: 100%;
		padding-left: 8px;
		padding-bottom: 40px;
		width: 100%;
		flex: 1 1 0;
		position: relative;
		display: flex;
		flex-direction: column-reverse;
	}
	.convo_events.email {
		max-width: unset;
	}
	.convo_events.convo_events__comment {
		padding-top: 20px;
	}
	.convo_events__empty_img {
		margin: 0 auto;
		display: block;
		margin-top: 350px;
		width: 200px;
	}
	/* Style message bottom*/
	.convo_event__time {
		display: block;
		text-align: center;
		margin-top: 20px;
		color: #6c757d;
	}
	.message_file {
		border-radius: 7px;
		padding: 10px;
		margin-top: 5px;
		border-radius: 10px;
		cursor: pointer;
		max-width: calc(100% - 50px);
		position: relative;
	}
	.message_file:after {
		content: '';
		position: absolute;
		top: 0;
		left: 100%;
		height: 100%;
		width: 120px;
		background: transparent;
	}
	.message_file.message_file__agent:after {
		left: unset;
		right: 100%;
	}
	.message_file.message_file__comment {
		margin-right: 0;
		color: #000;
		background-color: #fff;
		border: 1px solid #aaa;
		max-width: 100%;
	}
	.message_file.message_file__agent {
		margin-right: 50px;
		color: black;
		background-color: white;
		align-self: flex-end;
	}
	.message_file.message_file__user {
		margin-left: 50px;
		color: #000;
		background-color: #fff;
		box-shadow:
			0px 1px 4px rgba(0, 0, 0, 0.05),
			0px 4px 36px rgba(0, 0, 0, 0.05);
	}
	.message_file__link {
		display: flex;
		flex-direction: row;
		align-items: center;
	}
	.message_file__download {
		margin-right: 10px;
		color: #6c757d;
		flex-shrink: 0;
	}
	.message_order {
		margin-top: 10px;
		color: #000;
		border: 1px solid #aaa;
		background: white;
		border-radius: 8px;
		width: 250px;
		overflow-y: auto;
		overflow-x: hidden;
		padding: 10px;
	}
	.message_order.message_order__agent {
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_order.message_order__user {
		margin-left: 50px;
	}
	.message_file__filename {
		text-overflow: ellipsis;
		white-space: nowrap;
		overflow: hidden;
	}
	.message_file__size {
		color: #6c757d;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.message_link.message_link__user {
		display: inline-block;
		margin-left: 50px;
	}
	.message_link.message_link__agent,
	.message_link.message_link__dummy,
	.message_link.message_link__workflow {
		display: inline-block;
		margin-right: 50px;
	}
	.message_link.message_image__link,
	.message_image.message_link__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_seen {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
		color: #6c757d;
		margin-top: 5px;
	}
	.message_link__img {
		margin-top: 5px;
		border-top-right-radius: 7px;
		border-bottom-right-radius: 7px;
		max-height: 450px;
		max-width: 100%;
		object-fit: contain;
		display: block;
		border-left: 3px solid #ced4da;
		padding-left: 10px;
	}
	.message_link__description {
		background: #fff;
		border: 1px solid #eeeeee;
		box-shadow:
			0px 1px 4px rgba(0, 0, 0, 0.05),
			0px 4px 36px rgba(0, 0, 0, 0.05);
		padding: 10px;
		white-space: pre-wrap;
		border-top-left-radius: 7px;
		border-top-right-radius: 7px;
		word-break: break-word;
	}
	.message_link {
		margin-top: 5px;
		position: relative;
	}
	.message_image.message_image__user {
		display: inline-block;
	}
	.message_image.message_image__agent,
	.message_image.message_image__dummy {
		display: inline-block;
		justify-content: flex-end;
	}
	.message_image.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.message_image__img {
		max-height: 350px;
		height: 100%;
		max-width: 100%;
		object-fit: contain;
		border-radius: 8px;
		min-width: 70px;
		overflow: hidden;
		border: 1px solid #e0e0e0;
	}
	.message_image__img:hover {
		border: 1px solid #bbb;
	}
	.message_image {
		margin-top: 5px;
		position: relative;
	}
	.message_video.message_video__user {
		display: inline-block;
		margin-left: 50px;
	}
	.message_video.message_video__agent,
	.message_video.message_video__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_video.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.message_video {
		margin-top: 5px;
		position: relative;
		position: relative;
	}
	.message_video:after {
		content: '';
		position: absolute;
		top: 0;
		left: 100%;
		height: 100%;
		width: 120px;
		background: transparent;
	}
	.message_video.message_video__agent:after {
		left: unset;
		right: 100%;
	}
	.message_video__video {
		border-radius: 10px;
		width: 100%;
		height: 100%;
	}
	.message_video__video:focus {
		outline: none;
	}
	.message_container_wrapper {
		width: 100%;
		margin: 0 auto;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.message_container_wrapper.error .message_text,
	.message_container_wrapper.error .message_file {
		background-color: #feecf0;
	}
	.message_sent_status_text {
		margin-top: 3px;
		color: #6c757d;
		padding-bottom: 5px;
	}
	.message_sent_status_text.agent {
		margin-right: 50px;
		text-align: right;
	}
	.message_sent_status_text.user {
		margin-left: 50px;
	}
	.message_sent_status_text.error {
		opacity: 1;
		max-width: 300px;
		word-wrap: break-word;
		color: #ea3d2f;
	}
	.message_edited {
		font-size: 12px;
		opacity: 0.7;
	}
	.message_edited_user {
		margin-left: 50px;
	}
	.message_edited_agent {
		margin-right: 50px;
		text-align: right;
	}
	.message_text.message_text__deleted {
		opacity: 0.6;
		font-style: italic;
	}
	.message_text.message_text__user {
		display: inline-block;
		margin-left: 50px;
		color: #14093a;
		background-color: #dce1ef;
	}
	.message_text {
		position: relative;
		white-space: pre-wrap;
		border-radius: 7px;
		word-break: break-word;
		position: relative;
		padding: 10px 15px;
		margin-top: 5px;
	}
	.message_text.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.message_ai_tip {
		white-space: pre-wrap;
		border-radius: 8px;
		padding: 4px 10px;
		border: 1px solid #dee2e6;
		margin-bottom: 5px;
	}
	.message_ai_tip.message_ai_tip__agent {
		margin-right: 50px;
	}
	.message_text.message_text__agent,
	.message_text.message_text__workflow,
	.message_text.message_text__dummy {
		display: inline-block;
		margin-right: 50px;
		color: black;
		background: white;
		align-self: flex-end;
	}
	.message_text.message_text__workflow {
		background-color: #fff5ce;
	}
	.message_html.message_html__user {
		margin-left: 50px;
	}
	.message_html__email_to {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.message_html__email_subject {
		font-weight: 500;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.message_html__email_label {
		font-weight: normal;
		color: #6c757d;
		width: 60px;
		display: inline-block;
		text-align: right;
		margin-right: 5px;
	}
	.message_html__header {
		padding-bottom: 20px;
		margin-bottom: 10px;
		border-bottom: 2px dashed #dee2e6;
	}
	.message_html {
		position: relative;
		padding: 20px;
		margin-top: 10px;
		color: #000;
		background: #fff;
		width: 100%;
		overflow: auto;
		border: 1px solid #bababa;
		box-shadow:
			0px 1px 4px rgba(0, 0, 0, 0.05),
			0px 4px 36px rgba(0, 0, 0, 0.05);
	}
	.message_html.message_html__agent,
	.message_html.message_html__dummy {
		margin-right: 50px;
		align-self: flex-end;
	}
	.message-text--error {
		color: rgb(72, 66, 66);
	}
	.message_audio.message_audio__user {
		display: inline-block;
		margin-left: 50px;
	}
	.message_audio.message_audio__agent,
	.message_audio.message_audio__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_audio.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.message__audio {
		height: 100%;
	}
	.message_audio {
		margin-top: 5px;
		position: relative;
		margin: 5px 0 0 0;
		height: 45px;
		display: inline;
		position: relative;
	}
	.message_audio:after {
		content: '';
		position: absolute;
		top: 0;
		left: 100%;
		height: 100%;
		width: 120px;
		background: transparent;
	}
	.message_audio.message_audio__agent:after {
		left: unset;
		right: 100%;
	}
	.message_postback.message_postback__user {
		display: inline-block;
		margin-left: 50px;
	}
	.message_postback.message_postback__agent,
	.message_postback.message_postback__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_postback {
		margin-top: 5px;
		position: relative;
		background: #dee2e6;
		white-space: pre-wrap;
		border-radius: 7px;
		word-break: break-word;
		position: relative;
		padding: 7px 10px;
		margin-top: 5px;
		color: #000;
		background: rgba(240, 240, 240, 0.6666666667);
	}
	.message_audio__audio {
		all: inherit;
		width: 100%;
	}
	.message__info {
		text-align: center;
		color: #6c757d;
		margin: 10px;
	}
	.message_state {
		position: absolute;
		z-index: 1;
		bottom: 0px;
		display: flex;
		align-items: center;
		right: 30px;
		display: block;
	}
	.message_state.message_state__received {
		width: 12px;
		height: 12px;
		color: #fff;
		padding: 2px;
		border-radius: 50%;
		background: #adb5bd;
	}
	.message_state.message_state__error {
		right: 29px;
		width: 14px;
		fill: #ffc107;
		stroke: #ea3d2f;
	}
	.message_state.message_state__seen {
		width: 14px;
		color: #19b600;
	}
	.message_state.message_state__sending {
		width: 13px;
		color: #ced4da;
	}
	.message_state.message_state__sent {
		width: 12px;
		height: 12px;
		color: #fff;
		padding: 2px;
		border-radius: 50%;
		background: #dee2e6;
	}
	.message_container {
		position: relative;
		display: flex;
		flex-direction: column;
		width: 80%;
	}
	.message_container:hover .message_actions {
		display: flex;
	}
	.message_actions.message_actions__show {
		display: flex;
	}
	.message_actions {
		display: none;
		align-items: center;
		margin-left: 10px;
	}
	.message_actions__action {
		cursor: pointer;
		color: #6c757d;
		stroke: #6c757d;
		margin-left: 10px;
		position: relative;
	}
	.message_actions__action:hover {
		color: #0d6efd;
		stroke: #0d6efd;
	}
	.message_actions__action.message_actions__action__disabled {
		cursor: default;
		color: #dee2e6;
		stroke: #dee2e6;
	}
	.message_actions__action.message_actions__action__disabled:hover {
		color: #dee2e6;
		stroke: #dee2e6;
	}
	.message_container.message_container__dummy {
		align-self: flex-end;
	}
	.generic-attachment-container.generic-attachment-container__dummy,
	.generic-attachment-container.generic-attachment-container__workflow,
	.generic-attachment-container.generic-attachment-container__agent {
		align-self: flex-end;
		padding-right: 50px;
		max-width: 80%;
		overflow: hidden;
	}
	.message_container.message_container__agent,
	.message_container.message_container__workflow {
		flex-direction: row;
		justify-content: flex-end;
		align-self: flex-end;
		padding-left: 40px;
	}
	.message_container.message_container__comment {
		display: flex;
		max-width: 100%;
		overflow: hidden;
		flex-direction: row;
		width: unset;
	}
	.message_container.message_container__comment .message_text {
		margin-top: 0;
		border-radius: 8px;
		margin-left: 0;
		color: #000;
		background: #f5f5f5;
	}
	.message_container.message_container__user {
		display: flex;
		flex-direction: row;
		padding-right: 40px;
	}
	.message_container.message_container__user.message_container__image {
		padding-left: 50px;
		position: relative;
		width: fit-content;
		padding-right: 0;
	}
	.message_container_reactions {
		margin-top: -5px;
	}
	.message_container.message_container__dummy.message_container__image,
	.message_container.message_container__workflow.message_container__image,
	.message_container.message_container__agent.message_container__image {
		padding-right: 50px;
		display: flex;
		justify-content: flex-end;
		flex-direction: row;
		position: relative;
		width: fit-content;
		padding-left: 0;
	}
	.text_message_sender.text_message_sender__agent,
	.text_message_sender.text_message_sender__dummy {
		justify-content: flex-start;
		flex-direction: row-reverse;
	}
	.text_message_sender {
		display: flex;
		align-items: flex-end;
		margin-top: 20px;
	}
	.text_message_sender__avatar {
		width: 50px;
		display: flex;
		justify-content: center;
	}
	.text_message_sender__name {
		display: flex;
		align-items: center;
		color: #495057;
		max-width: 50%;
	}
	.message-system {
		text-align: center;
		margin: 10px;
		color: #6c757d;
	}
	.message_form.message_form__agent,
	.message_form.message_form__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.message_form.message_form__user {
		display: inline-block;
		margin-left: 50px;
	}
	.message_form {
		margin-top: 5px;
		position: relative;
		display: flex;
		flex-direction: column;
		padding: 10px;
		-webkit-box-shadow: 0 0 10px #dee2e6;
		box-shadow: 0 0 10px #dee2e6;
		border-radius: 7px;
		margin-top: 10px;
	}
	.input--error {
		border: 1px solid red;
	}
	.input--success {
		background-color: #f9f9f9;
		pointer-events: none;
	}
	.red {
		color: #ea3d2f;
	}
	.message_button.message_button__user {
		display: inline-block;
		margin-left: 50px;
		border: 1px solid #eeeeee;
		box-shadow:
			0px 1px 4px rgba(0, 0, 0, 0.05),
			0px 4px 36px rgba(0, 0, 0, 0.05);
	}
	.message_button {
		white-space: pre-wrap;
		border-radius: 7px;
		word-break: break-word;
		position: relative;
		margin-top: 5px;
		min-width: 200px;
	}
	.message_button.message_button__agent,
	.message_button.message_button__dummy {
		display: inline-block;
		margin-right: 50px;
		align-self: flex-end;
	}
	.url-button-attachment:first-child {
		border-top-left-radius: 7px;
		border-top-right-radius: 7px;
	}
	.url-button-attachment:last-child {
		border-bottom-left-radius: 7px;
		border-bottom-right-radius: 7px;
		border-bottom: 1px solid #0d6efd;
	}
	.url-button-attachment {
		text-decoration: none;
		padding: 10px;
		display: block;
		text-align: center;
		color: #0d6efd;
		background: #fff;
		border-top: 1px solid #0d6efd;
		border-left: 1px solid #0d6efd;
		border-right: 1px solid #0d6efd;
		width: 100%;
	}
	.url-button-attachment:hover {
		text-decoration: none;
	}
	.generic-attachment-container.generic-attachment-container__user {
		width: 70%;
	}
	.generic-attachment-container.generic-attachment-container__user .generic-attachment {
		margin-left: 50px;
	}
	.generic-attachment-container {
		position: relative;
		margin-top: 5px;
	}
	.generic-attachments {
		display: block;
	}
	.generic-attachment {
		display: flex;
		width: 100%;
		overflow: hidden;
		width: 100%;
		white-space: nowrap;
		user-select: none;
		cursor: grab;
	}
	.generic-attachment.focused {
		border: 1px solid #495057;
	}
	.generic-attachment-container.generic-attachment-container__agent .generic-attachment {
		overflow-y: hidden;
		overflow-x: auto;
		max-width: 100%;
	}
	.product_attachment {
		border: 1px solid #d8d8d8;
		background: white;
		border-radius: 8px;
		width: 200px;
		position: relative;
		display: flex;
		flex-direction: column;
		flex-shrink: 0;
	}
	.product_attachment.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.product_attachment__img_container {
		overflow: hidden;
		width: 100%;
		padding-top: 60%;
		position: relative;
		display: block;
		border-top-left-radius: 7px;
		border-top-right-radius: 7px;
	}
	.product_attachment.product_attachment__user {
		margin-right: 0;
		margin-left: 50px;
		align-self: flex-start;
	}
	.btn.product_attachment__create_order_btn {
		position: absolute;
		top: calc(100% + 8px);
		width: 100%;
		border-radius: 20px;
		display: flex;
		align-items: center;
		padding: 5px 8px;
		border-color: tint-color(#0d6efd, 4);
		color: #0d6efd;
		font-size: 14px;
	}
	.btn.product_attachment__create_order_btn:hover {
		border-color: #0d6efd;
		background-color: rgba(167.88, 202.8, 254.28, 0.1);
	}
	.product_attachments_wrapper.convo_ended .btn.product_attachment__create_order_btn {
		display: none;
	}
	.product_attachment__create_order_btn_icon {
		width: 18px;
		height: 18px;
		border-radius: 50%;
		margin-right: 5px;
		background: #0d6efd;
		color: #fff;
		display: flex;
		justify-content: center;
		align-items: center;
		flex-shrink: 0;
	}
	.product_attachment__img {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		border-bottom: 1px solid #d8d8d8;
		object-fit: cover;
	}
	.product_attachment__price {
		color: #6c757d;
		padding-left: 10px;
	}
	.product_attachment__btns {
		margin-top: 5px;
	}
	.product_attachment__btn {
		border-top: 1px solid #d8d8d8;
		display: flex;
		padding: 8px 10px;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		text-transform: capitalize;
	}
	.product_attachment__btn:last-child {
		margin-right: 0;
	}
	a.product_attachment__title {
		display: block;
		padding: 8px 10px 0 10px;
		font-weight: 500;
		color: #000;
		text-decoration: none;
	}
	a.product_attachment__title:hover {
		text-decoration: underline;
	}
	a.product_attachment__title[href^='https'],
	a.product_attachment__title[href^='http'] {
		text-decoration: none;
	}
	a.product_attachment__title[href^='https']:hover,
	a.product_attachment__title[href^='http']:hover {
		text-decoration: underline;
	}
	.product_attachment__subtitle {
		white-space: pre-wrap;
		padding: 0 10px;
		color: #6c757d;
		font-size: 14px;
		margin-bottom: 8px;
		margin-top: 5px;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		overflow: hidden;
	}
	.generic-attachment--element {
		display: flex;
		flex-direction: column;
		border: 1px solid #d8d8d8;
		background: white;
		border-radius: 7px;
		overflow: hidden;
		width: 220px;
		flex-shrink: 0;
		margin-right: 10px;
		vertical-align: top;
		transition: all 0.1s;
	}
	.generic-attachment--element:last-child {
		margin-right: 0;
	}
	.generic-attachment--element .generic-attachment--element-img {
		width: 100%;
		height: 150px;
		object-fit: cover;
	}
	.generic-attachment--element .url-button-attachment:first-child {
		border-radius: 0;
	}
	.generic-attachment--element .url-button-attachment {
		padding: 10px;
		display: block;
		padding-top: 10px;
		padding-bottom: 10px;
		text-align: center;
		border: none;
		border-top: 1px solid #d8d8d8;
		width: 100%;
	}
	.generic-attachment--element.generic-attachment--element--edit {
		width: 270px;
		filter: brightness(1);
	}
	.generic-attachment--element.generic-attachment--element--fade {
		width: 270px;
		filter: brightness(0.8);
		cursor: pointer;
	}
	.generic-attachment--element.generic-attachment--element--fade:hover {
		filter: brightness(1);
	}
	.generic-attachment--element-title {
		padding: 0px 13px;
		margin-top: 13px;
		color: #000;
		font-weight: 500;
		font-size: 16px;
		line-height: 20px;
		white-space: normal;
		text-align: left;
	}
	.generic-attachment--element-title-input {
		padding: 13px 10px 6px 10px;
		color: #000;
		font-weight: 500;
		font-size: 16px;
		line-height: 20px;
		border: none;
		display: block;
		width: 100%;
	}
	.generic-attachment--element-title-input:focus {
		outline: 0;
	}
	.generic-attachment--element-subtitle {
		padding: 0px 13px;
		color: gray;
		margin-top: 5px;
		margin-bottom: 5px;
		white-space: pre-wrap;
		text-align: left;
	}
	.generic-attachment--element-subtitle-input {
		padding: 0 10px;
		display: block;
		color: gray;
		border: none;
		width: 100%;
	}
	.generic-attachment--element-subtitle-input:focus {
		outline: 0;
	}
	.message_container__agent .message_reactions {
		margin-right: 45px;
	}
	.message_reactions {
		position: relative;
		display: flex;
		background: #fff;
		box-shadow: 0px 0px 10px rgba(0, 0, 0, 0.1);
		border-radius: 35px;
		z-index: 1;
		bottom: 5px;
		padding: 1px 4px;
		align-items: center;
	}
	.message_reactions.message_reactions__user {
		margin-left: 60px;
	}
	.message_reactions.message_reactions__agent,
	.message_reactions.message_reactions__dummy {
		margin-right: 60px;
	}
	.message_reactions__reaction {
		display: flex;
		align-items: center;
		position: relative;
		margin-right: 10px;
		font-weight: 500;
	}
	.message_reactions__reaction:last-child {
		margin-right: 0;
	}
	.message_reactions__reaction_counter {
		color: #0d6efd;
		margin-left: 3px;
		font-size: 14px;
	}
	.message_container__user .message_actions__action .dropdown {
		right: unset;
		left: 0;
	}
	.detect_user_info_from_message__container {
		padding: 10px;
		border-radius: 8px;
		position: absolute;
		left: 0;
		z-index: 110;
		background: #12171c;
		box-shadow:
			0 1px 8px rgba(0, 0, 0, 0.1),
			0 4px 32px rgba(0, 0, 0, 0.1),
			0 8px 64px rgba(0, 0, 0, 0.12);
		color: #fff;
		white-space: nowrap;
		visibility: hidden;
		opacity: 0;
		display: none;
		user-select: none;
	}
	.detect_user_info_from_message__container__visible {
		visibility: visible;
		z-index: 50000;
		opacity: 1;
		display: block;
	}
	.detect_user_info_from_message__container__up {
		top: -113px;
	}
	.detect_user_info_from_message__container__user {
		left: 0;
		right: auto;
	}
	.detect_user_info_from_message__container__agent {
		left: auto;
		right: 0;
	}
	.detect_user_info_from_message__btn_submit {
		margin-left: 5px;
	}
	.message_quick_replies {
		display: flex;
		flex-wrap: wrap;
	}
	.message_quick_reply {
		position: relative;
		padding: 5px 15px;
		border: 1px solid #0d6efd;
		margin-top: 10px;
		color: #0d6efd;
		border-radius: 5px;
		overflow: hidden;
		white-space: nowrap;
		text-overflow: ellipsis;
	}
	.message_quick_reply.message_quick_reply__add_btn {
		user-select: none;
		cursor: pointer;
		border: 1px dashed #0d6efd;
		margin-right: 0;
		margin-top: 0;
		margin-bottom: 10px;
	}
	.message_quick_reply.message_quick_reply__add_btn:hover {
		border: 1px dashed shade-color(#0d6efd, 4);
		color: shade-color(#0d6efd, 4);
	}
	.message_quick_reply:hover .message_quick_reply__btns {
		opacity: 1;
		z-index: 10;
	}
	.message_quick_reply__btns {
		position: absolute;
		display: flex;
		align-items: center;
		top: -15px;
		right: -5px;
		opacity: 0;
		box-shadow: 0 2px 5px rgba(0, 0, 0, 0.15);
		border-radius: 10px;
		background: #fff;
	}
	.message_quick_reply__btns:hover {
		opacity: 1;
	}
	.message_quick_reply__btn {
		cursor: pointer;
		width: 24px;
		height: 24px;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #343a40;
	}
	.message_quick_reply__btn:hover {
		color: #0d6efd;
	}
	.message_quick_reply__input {
		outline: none;
		border: none;
		padding: 5px 15px;
		position: absolute;
		color: #0d6efd;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		background-color: transparent;
	}
	.message_quick_reply__input_hidden_span {
		visibility: hidden;
		height: 0;
		padding: 5px 15px;
		white-space: pre;
		padding-left: 30px;
	}
	.message_quick_reply.message_quick_reply__editable {
		padding: 0;
		border: 1px solid #0d6efd;
		margin: 0;
		margin-right: 10px;
		margin-bottom: 10px;
		color: #0d6efd;
		border-radius: 5px;
		overflow: unset;
		white-space: unset;
		text-overflow: unset;
		position: relative;
		min-width: 50px;
		max-width: 100%;
		height: 34px;
	}
	.message_quick_reply.message_quick_reply__editable:hover {
		border-color: shade-color(#0d6efd, 4);
	}
	.generic_template_button_handler {
		cursor: grab;
		display: flex;
		align-items: center;
		width: 20px;
		padding-right: 5px;
		opacity: 0.3;
	}
	.generic_template_button_handler:hover {
		opacity: 0.7;
	}
	.generic_template_button_title {
		color: #0d6efd;
		flex: 1;
		text-align: center;
	}
	.generic_template_button_title.generic_template_button_title__add {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		color: #6c757d;
		cursor: pointer;
	}
	.generic_template_button_title.generic_template_button_title__add:hover {
		color: #0d6efd;
	}
	.generic_template_button:first-child {
		border-top-left-radius: 7px;
		border-top-right-radius: 7px;
		border-radius: 0;
	}
	.generic_template_button:last-child {
		border-bottom-left-radius: 7px;
		border-bottom-right-radius: 7px;
	}
	.generic_template_button {
		text-decoration: none;
		background: #fff;
		align-items: center;
		width: 100%;
		display: flex;
		padding: 5px;
		padding-top: 10px;
		padding-bottom: 10px;
		border: none;
		border-top: 1px solid #d8d8d8;
		width: 100%;
	}
	.generic_template_button:hover .generic_template_button__btn {
		opacity: 1;
	}
	.generic_template_button.generic_template_button__edit {
		display: block;
		padding: 10px;
		position: relative;
		background: #f8f9ff;
	}
	.generic_template_button__btn {
		color: #a8a8a8;
		cursor: pointer;
		opacity: 0;
		margin-left: 3px;
	}
	.generic_template_button__btn:focus {
		outline: 0;
	}
	.generic_template_button__btn:hover {
		color: #0d6efd;
	}
	.generic_template_button_edit_label {
		margin-top: 10px;
		margin-bottom: 5px;
	}
	.generic_template_button_edit_label:first-child {
		margin-top: 0;
	}
	.generic_template_button_edit {
		border: 1px solid #d8d8d8;
	}
	.generic_template_summary {
		display: flex;
		flex-wrap: wrap;
		justify-content: center;
	}
	.generic_template_summary_img {
		border: 2px solid #d8d8d8;
		padding: 2px;
		border-radius: 5px;
		cursor: pointer;
		margin-right: 10px;
		width: 40px;
		height: 30px;
		display: block;
		margin-top: 10px;
	}
	.generic_template_summary_img.generic_template_summary_img__add {
		border: 2px dashed #d8d8d8;
		user-select: none;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #d8d8d8;
		font-weight: 500;
	}
	.generic_template_summary_img.generic_template_summary_img__add:hover {
		border-color: #0d6efd;
		color: #0d6efd;
	}
	.generic_template_summary_img.generic_template_summary_img__active {
		border-color: #0d6efd;
	}
	.generic_template__element_img {
		position: relative;
	}
	.generic_template__product_tag {
		position: absolute;
		bottom: 10px;
		background: rgba(0, 0, 0, 0.6);
		left: 10px;
		color: white;
		border-radius: 20px;
		padding: 2px 10px;
		font-size: 13px;
	}
	.generic_template__element_img__btns {
		position: absolute;
		top: 0;
		right: 0;
		position: absolute;
		display: flex;
		align-items: center;
		top: 10px;
		right: 10px;
		padding: 0 5px;
		opacity: 1;
		z-index: 2;
		-webkit-box-shadow: 0px 0px 54px 27px rgba(0, 0, 0, 0.75);
		-moz-box-shadow: 0px 0px 54px 27px rgba(0, 0, 0, 0.75);
		box-shadow: 0px 0px 54px 27px rgba(0, 0, 0, 0.75);
		border-radius: 10px;
		background: #fff;
	}
	.generic_template__element_img__btn {
		width: 26px;
		height: 26px;
		padding: 6px 6px;
		color: #333;
		cursor: pointer;
	}
	.generic_template__element_img__btn:hover {
		color: #0d6efd;
	}
	.generic_template__element_img__btn:focus {
		outline: 0;
	}
	.generic-attachment-navigator {
		position: absolute;
		top: 50%;
		transform: translateY(-50%);
		cursor: pointer;
		width: 20px;
		font-size: 80px;
		display: flex;
		align-items: center;
		justify-content: center;
		color: rgba(245, 245, 245, 0.85);
		z-index: 999;
	}
	.generic-attachment-navigator:hover {
		color: #6c757d;
	}
	.generic-attachment-navigator.generic-attachment-navigator--disabled {
		display: none;
	}
	.generic-attachment-navigator.generic-attachment-navigator--left {
		left: 2px;
	}
	.generic-attachment-navigator.generic-attachment-navigator--right {
		right: 2px;
	}
	.dropdown.generic_template_search_product_dropdown {
		top: calc(100% + 1px);
		min-width: 250px;
		max-width: 250px;
		left: -35px;
		box-shadow: 0 5px 10px 0 rgba(0, 0, 0, 0.35);
		display: flex;
		flex-direction: column;
		height: 265px;
		max-height: 265px;
	}
	.generic_template_search_product_input {
		padding-left: 30px;
		padding-right: 30px;
	}
	.generic_template_search_product_input_search_icon {
		position: absolute;
		color: #6c757d;
		top: 50%;
		left: 20px;
		transform: translateY(-50%);
	}
	.generic_template_search_product_input_loading_icon.spinner1 {
		position: absolute;
		top: 20px;
		right: 20px;
	}
	.generic_template_select_product_wrapper {
		position: absolute;
		top: 10px;
		left: 10px;
		box-shadow: 0 5px 10px 0 rgba(0, 0, 0, 0.35);
	}
	.generic_template_img_overlay {
		position: absolute;
		inset: 0;
		background-color: rgba(0, 0, 0, 0.5);
		align-items: center;
		justify-content: center;
		display: none;
	}
	.generic-attachment--element--edit:not(.generic-attachment--element--fade):hover .generic_template_img_overlay {
		display: flex;
	}
	.generic_template_img_trash_icon {
		color: #fff;
		cursor: pointer;
		position: absolute;
		top: 10px;
		right: 10px;
		opacity: 0.85;
	}
	.generic_template_img_trash_icon:hover {
		opacity: 1;
	}
	.generic_template_img_btn {
		border-radius: 20px;
		display: flex;
		align-items: center;
		padding: 5px 20px;
		cursor: pointer;
		border: 1.5px solid #fff;
		background: transparent;
		color: #fff;
		width: fit-content;
		opacity: 0.85;
	}
	.generic_template_img_btn:hover {
		opacity: 1;
		background-color: rgba(0, 0, 0, 0.5);
	}
	.message_template_page {
		height: 100%;
		padding: 20px 30px;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.message_template_page .message_template_modal_box {
		flex: 1;
	}
	.message_template_modal_box {
		font-size: 14px;
		height: 55vh;
		display: flex;
		flex-direction: column;
	}
	.message_template_modal_box_head {
		border-top-right-radius: 8px;
		border-top-left-radius: 8px;
		border: 1px solid #dee2e6;
		border-bottom: none;
		flex-shrink: 0;
		display: flex;
		align-items: center;
	}
	.message_template_modal_box_content {
		border-bottom-right-radius: 8px;
		border-bottom-left-radius: 8px;
		border: 1px solid #dee2e6;
		border-top: none;
		flex: 1;
		overflow-y: scroll;
	}
	.message_template_modal_box_content .sbz_table_cell {
		padding: 0;
	}
	.message_template_modal_box_content .sbz_table_row {
		border: none;
	}
	.message_template_modal_box_content .sbz_common_table_header {
		display: none;
	}
	.message_template_modal_box_item {
		display: flex;
		align-items: center;
		padding: 10px;
		border-bottom: 1px solid #dee2e6;
	}
	.message_template_modal_box_item_key {
		padding: 5px 8px;
		background-color: #e9ecef;
		font-size: 13px;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		line-height: 1;
		border-radius: 4px;
		margin-right: 5px;
		margin-bottom: 5px;
	}
	.message_template_modal_box_item_key:last-child {
		margin-right: 0;
	}
	.message_template_modal_box_item_img {
		border-radius: 5px;
		border: 1px solid #dee2e6;
		overflow: hidden;
		width: 40px;
		height: 40px;
		margin-top: 5px;
	}
	.message_template_modal_box_item_actions {
		margin-left: 30px;
		flex-shrink: 0;
		align-items: center;
		justify-content: flex-end;
		display: none;
		align-self: flex-start;
	}
	.message_template_modal_box_item:hover .message_template_modal_box_item_actions {
		display: flex;
	}
	.message_template_edit_modal_channel_type_img {
		width: 20px;
		height: 20px;
		border-radius: 4px;
		object-fit: cover;
		margin-right: 5px;
	}
	.message_template_modal_content {
		display: flex;
		flex-direction: column;
		width: 450px;
		max-height: 80vh;
		background-color: #fff;
		z-index: 160;
		margin: auto;
		border-radius: 5px;
	}
	.message_template_modal_content_header {
		display: flex;
		align-items: center;
		border-bottom: 1px solid #dee2e6;
		padding: 15px 20px;
		flex-shrink: 0;
	}
	.message_template_modal_content_body {
		padding: 10px 20px;
		flex: 1;
		overflow: auto;
	}
	.message_template_modal_content_footer {
		display: flex;
		align-items: center;
		border-top: 1px solid #dee2e6;
		padding: 10px 20px;
		flex-shrink: 0;
	}
	.email_message_card {
		background-color: #fff;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		margin: 20px;
		margin-bottom: 0;
	}
	.email_message_card.error {
		border-color: #ea3d2f;
		background-color: #feecf0;
	}
	.email_message_card_header {
		padding: 10px 20px;
		padding-bottom: 8px;
		display: flex;
		align-items: center;
		border-bottom: 1px solid #f5f5f5;
	}
	.email_message_card_content {
		padding: 8px 20px;
	}
	.email_message_card_footer {
		padding: 10px 20px;
		display: flex;
		align-items: center;
		border-top: 1px solid #f5f5f5;
		flex-wrap: wrap;
		padding-bottom: 0;
	}
	.email_message_card_attachment {
		max-width: 250px;
		overflow: hidden;
		padding: 8px 10px;
		margin-right: 10px;
		margin-bottom: 10px;
		display: flex;
		border-radius: 8px;
		background-color: #f8f9fa;
		display: flex;
		color: #333;
	}
	.email_message_card_attachment:hover {
		background-color: #e9ecef;
	}
	.email_message_card_attachment_icon {
		width: 40px;
		height: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		flex-shrink: 0;
	}
	.facebook_comment_card {
		max-width: 500px;
		margin: 0 auto;
		background-color: #fff;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		margin-top: 20px;
	}
	.instagram_comment_card {
		width: 800px;
		max-width: 95%;
		height: 450px;
		max-height: 100%;
		display: flex;
		margin: 0 auto;
		border: 1px solid rgba(0, 0, 0, 0.2666666667);
	}
	.facebook_comment_card_post {
		padding: 20px 30px;
		border-bottom: 1px solid #dee2e6;
	}
	.instagram_comment_preview {
		flex: 3;
		display: flex;
		align-items: center;
		overflow: hidden;
		background: rgba(255, 255, 255, 0.6784313725);
		flex-shrink: 0;
	}
	.instagram_comment_content {
		border-left: 1px solid #efefef;
		flex: 3;
		background: white;
		max-width: 350px;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.facebook_comment_card_post_header {
		display: flex;
	}
	.instagram_comment_card_post_header {
		display: flex;
		height: 60px;
		border-bottom: 1px solid #efefef;
		padding: 10px 15px;
	}
	.facebook_comment_card_post_img {
		width: 40px;
		height: 40px;
		border-radius: 50%;
		object-fit: cover;
	}
	.instagram_comment_card_post_img {
		width: 40px;
		height: 40px;
		border-radius: 50%;
		object-fit: cover;
	}
	.facebook_comment_card_comments {
		padding: 20px 30px;
	}
	.instagram_comment_card_comments {
		flex: 1;
		overflow: auto;
		display: flex;
		flex-direction: column-reverse;
		padding: 15px 0px 15px 20px;
	}
	.facebook_comment_message_wrapper {
		display: flex;
		margin-left: 35px;
		margin-bottom: 15px;
	}
	.facebook_comment_message_wrapper:last-child {
		margin-bottom: 0;
	}
	.facebook_comment_message_wrapper.first {
		margin-left: 0;
	}
	.instagram_comment_message_wrapper {
		display: flex;
		margin-bottom: 15px;
	}
	.facebook_comment_message_wrapper.error .facebook_comment_message {
		background-color: #feecf0;
	}
	.facebook_comment_message {
		background-color: #e4f3fd;
		padding: 8px 15px;
		border-radius: 8px;
		margin-bottom: 3px;
		position: relative;
		white-space: pre-wrap;
	}
	.facebook_comment_message.user {
		background-color: #f0f0f0;
	}
	.instagram_comment_message {
		padding: 0 15px;
		word-break: break-word;
		overflow: hidden;
		margin-bottom: 3px;
		position: relative;
	}
	.message_quote_sender {
		display: flex;
		color: #6c757d;
		font-size: 13px;
		margin-left: 50px;
		margin-bottom: -2px;
		margin-top: 15px;
	}
	.message_quote_sender.internal-chat {
		margin-left: 20px;
		margin-top: 10px;
	}
	.message_quote_sender.quote_sender__agent {
		margin-left: 0;
		justify-content: flex-end;
		margin-right: 50px;
	}
	.google_review_card {
		max-width: 500px;
		margin: 0 auto;
		background-color: #fff;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		margin-top: 20px;
	}
	.google_review_card_post {
		padding: 20px 30px;
		border-bottom: 1px solid #dee2e6;
	}
	.google_review_card_comments {
		padding: 20px 30px;
	}
	.google_review_location_name {
		font-size: 20px;
		font-weight: 500;
	}
	.email_header .ti-tags .ti-tag span {
		line-height: 20px;
	}
	.message_container.has_grid.message_container__image {
		display: grid;
		grid-gap: 2px;
		margin-top: 8px;
		width: 70%;
	}
	.message_container.has_grid.message_container__image.grid_columns_1 {
		grid-template-columns: repeat(1, 1fr);
	}
	.message_container.has_grid.message_container__image.grid_columns_2 {
		grid-template-columns: repeat(2, 1fr);
	}
	.message_container.has_grid.message_container__image.grid_columns_3 {
		grid-template-columns: repeat(3, 1fr);
	}
	.message_container.has_grid.message_container__image.grid_columns_3 .message_image,
	.message_container.has_grid.message_container__image.grid_columns_2 .message_image {
		position: relative;
		padding-top: 100%;
		margin: 0;
	}
	.message_container.has_grid.message_container__image.grid_columns_3 .message_image .message_image__img,
	.message_container.has_grid.message_container__image.grid_columns_2 .message_image .message_image__img {
		position: absolute !important;
		inset: 0;
		width: 100%;
		max-height: unset;
		border-radius: 4px;
		min-width: unset;
	}
	.message_container.message_container__image:not(.has_grid) {
		max-width: 70%;
	}
	.message_event_single_reaction {
		position: absolute;
		display: none;
		right: -8px;
		bottom: -10px;
		z-index: 5;
		width: 24px;
		height: 24px;
		border-radius: 50%;
		background: #fff;
		box-shadow: 0px 0px 10px rgba(0, 0, 0, 0.1);
		align-items: center;
		justify-content: center;
	}
	.message_event_single_reaction.agent {
		right: unset;
		left: -8px;
	}
	.message_event_single_reaction:before {
		content: '';
		position: absolute;
		inset: -4px;
	}
	.message_event_actions {
		position: absolute;
		display: none;
		top: calc(50% - 10px);
		left: calc(100% + 10px);
		align-items: center;
		height: 20px;
		z-index: 5;
	}
	.message_event_actions.keep {
		display: flex !important;
	}
	.message_event_actions.agent {
		flex-direction: row-reverse;
		left: unset;
		right: calc(100% + 10px);
	}
	.message_event_action_link_wrapper {
		margin-right: 5px;
	}
	.message_event_action_link_wrapper:last-child {
		margin-right: 0;
	}
	.message_event_action_link_wrapper.agent {
		margin-right: 0;
		margin-left: 5px;
	}
	.message_event_action_link_wrapper.agent:last-child {
		margin-left: 0;
	}
	.message_event_action_link {
		width: 18px;
		height: 18px;
		line-height: 1;
	}
	.message_event_action_emoji {
		width: 28px;
		height: 28px;
		line-height: 1;
		margin-right: 8px;
		cursor: pointer;
	}
	.message_event_action_emoji:last-child {
		margin-right: 0;
	}
	.message_container:hover .message_text .message_event_actions {
		display: flex;
	}
	.message_container:hover .message_text .message_event_single_reaction {
		display: flex;
	}
	.message_image_wrapper:hover .message_container__image .message_event_actions {
		display: flex;
	}
	.message_image_wrapper:hover .message_container__image .message_event_single_reaction {
		display: flex;
	}
	.message_file:hover .message_event_actions {
		display: flex;
	}
	.message_file:hover .message_event_single_reaction {
		display: flex;
	}
	.message_file.focused {
		box-shadow: 0 0 0 2px #495057;
	}
	.message_video:hover .message_event_actions {
		display: flex;
	}
	.message_video:hover .message_event_single_reaction {
		display: flex;
	}
	.message_audio:hover .message_event_actions {
		display: flex;
	}
	.message_audio:hover .message_event_single_reaction {
		display: flex;
	}
	.form-component {
		margin-bottom: 10px;
	}
	.form-component:last-child {
		margin-bottom: 0;
	}
	.form-ratings-wrapper {
		display: inline-flex;
	}
	.star-wrapper .star {
		width: 32px;
		height: 30px;
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/79cf728a8fa95b1b4445.png);
		background-position: 0px 0px;
		background-size: cover;
	}
	.star-wrapper {
		cursor: pointer;
		padding-right: 6px;
	}
	.star-wrapper:last-child {
		padding-right: 0;
	}
	.star-wrapper.hovering .star {
		background-position: -32px 0;
	}
	.star-wrapper.selected {
		cursor: auto;
	}
	.star-wrapper.selected .star {
		background-position: -64px 0;
	}
	.product_attachments_wrapper {
		margin-top: 10px;
		padding-left: 50px;
		width: 100%;
		display: flex;
	}
	.product_attachments_wrapper.agent {
		padding-left: 0;
		padding-right: 50px;
		justify-content: flex-end;
	}
	.product_attachments_wrapper.convo_ended .product_attachments_scroll_container {
		padding-bottom: 10px;
	}
	.product_attachments_scroll_container {
		overflow-x: auto;
		overflow-y: hidden;
		max-width: 70%;
		padding-bottom: 50px;
	}
	.product_attachments_inner {
		width: fit-content;
		display: inline-flex;
		flex-wrap: nowrap;
		padding: 2px;
		gap: 20px;
	}
	.product_attachments_wrapper.agent .product_attachments_inner {
		justify-content: flex-end;
	}
	.message_zalo_call {
		margin-top: 5px;
		padding: 6px 15px;
	}
	.message_zalo_call__user {
		margin-left: 50px;
	}
	.message_zalo_call__agent {
		margin-right: 50px;
	}
	.message_zalo_contact {
		margin-top: 4px;
		border-radius: 8px;
		overflow: hidden;
		width: 300px;
		display: flex;
		flex-direction: column;
	}
	.message_zalo_contact.message_zalo_contact__user {
		margin-left: 50px;
	}
	.message_zalo_contact.message_zalo_contact__agent {
		margin-right: 50px;
	}
	.message_zalo_contact_content {
		position: relative;
		width: 100%;
		padding: 12px 15px;
	}
	.message_zalo_contact_content_bg {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/b876f5a3f476455218ae.svg);
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		background-position: 0 0;
		z-index: 1;
	}
	.message_zalo_contact_content_inner {
		z-index: 2;
		position: relative;
	}
	.message_zalo_contact_avatar_thumb {
		width: 40px;
		height: 40px;
		border-radius: 50%;
		border: 2px solid #fff;
	}
	.message_zalo_contact_actions_wrapper {
		border: 1px solid #dee2e6;
		border-bottom-left-radius: 8px;
		border-bottom-right-radius: 8px;
		border-top: none;
		background-color: #fff;
		display: flex;
	}
	.message_zalo_contact_action {
		flex: 1;
		cursor: pointer;
		display: flex;
		justify-content: center;
		align-items: center;
		padding-top: 8px;
		padding-bottom: 8px;
		cursor: pointer;
		color: #495057;
	}
	.message_zalo_contact_action:hover {
		color: #212529;
	}
	.message_zalo_contact_action_seperator {
		width: 2px;
		height: 24px;
		flex-shrink: 0;
		background-color: #dee2e6;
		position: relative;
		top: 8px;
	}
	.testcase_detail_convo_message {
		display: inline-block;
		position: relative;
		white-space: pre-wrap;
		border-radius: 8px;
		word-break: break-word;
		padding: 10px 15px;
		margin-top: 5px;
	}
	.testcase_detail_convo_message_user {
		background-color: #f1f3f5;
	}
	.testcase_detail_convo_message_agent {
		background-color: #f1f3f5;
	}
	.testcase_detail_convo_message_reviewer {
		background-color: #ffedb7;
	}
	.spinner1 {
		position: relative;
		display: inline-block;
		vertical-align: middle;
		border-style: solid;
		background: transparent;
		border-radius: 50%;
		animation: animate 0.5s linear infinite;
		-webkit-backface-visibility: hidden;
	}
	.rotate_twinkle {
		animation:
			animate 3s linear infinite,
			twinkler 3s linear infinite;
	}
	.rotate {
		animation: animate 3s linear infinite;
	}
	@keyframes animate {
		0% {
			transform: rotate(0deg) rotateZ(360deg);
		}
		100% {
			transform: rotate(360deg) rotateZ(360deg);
		}
	}
	.twinkle {
		animation: twinkler 3s linear infinite;
	}
	@keyframes twinkler {
		0% {
			color: green;
		}
		30% {
			color: blue;
		}
		60% {
			color: red;
		}
		90% {
			color: orange;
		}
	}
	.switch {
		display: flex;
		position: relative;
		text-indent: -9999px;
		width: max-content;
		margin: 0;
		height: max-content;
		cursor: pointer;
	}
	.switch.switch__disabled {
		opacity: 0.6;
		pointer-events: none;
	}
	.switch__track {
		width: 100%;
		height: 100%;
		display: block;
		position: relative;
		border: 1px solid #b3b3b3;
		background: #b3b3b3;
		border-radius: 16px;
		overflow: hidden;
		box-shadow: inset 0 1px 3px 0 rgba(0, 0, 0, 0.09);
	}
	.switch__thumb {
		position: absolute;
		content: '';
		top: 1px;
		left: 1px;
		background: #fff;
		border-radius: 16px;
		width: 12px;
		transition: 0.3s;
		bottom: 1px;
		box-shadow:
			0 2px 4px 0 rgba(0, 0, 0, 0.24),
			0 1px 1px 0 rgba(0, 0, 0, 0.05);
	}
	.switch__input {
		width: 0;
		height: 0;
		opacity: 0;
	}
	.switch__input:checked + .switch__track {
		background: #0d6efd;
		border-color: #0d6efd;
	}
	.switch__input:checked + .switch__track.switch__track--light {
		background: tint-color(#0d6efd, 6);
		border-color: tint-color(#0d6efd, 6);
	}
	.switch__input:checked + .switch__track.switch__track__green {
		background: #19b600;
		border-color: #19b600;
	}
	.switch__input:checked + .switch__track.switch__track__green.switch__track--light {
		background: tint-color(#19b600, 6);
		border-color: tint-color(#19b600, 6);
	}
	.switch__input:checked + .switch__track.switch__track__yellow {
		background: #ffc107;
		border-color: #ffc107;
	}
	.switch__input:checked + .switch__track.switch__track__yellow.switch__track--light {
		background: tint-color(#ffc107, 6);
		border-color: tint-color(#ffc107, 6);
	}
	.switch__input:checked + .switch__track.switch__track__dark {
		background: #343a40;
		border-color: #343a40;
	}
	.switch__input:checked + .switch__track.switch__track__dark.switch__track--light {
		background: #4c4c4c;
		border-color: #4c4c4c;
	}
	.switch__input:checked + .switch__track .switch__thumb {
		left: calc(100% - 1px);
		transform: translateX(-100%);
	}
	.radio {
		display: flex;
		position: relative;
		margin-bottom: 8px;
		cursor: pointer;
		font-size: 14px;
		-webkit-user-select: none;
		-moz-user-select: none;
		-ms-user-select: none;
		user-select: none;
		width: max-content;
	}
	.radio__input {
		opacity: 0;
		width: 0;
		height: 0;
	}
	.radio__checkmark {
		position: relative;
		border: 1px solid #5f6369;
		border-radius: 50%;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.radio:hover .radio__input ~ .radio__checkmark {
		border-color: #2196f3;
	}
	.radio__input:checked ~ .radio__checkmark {
		border-color: rgb(1.3442622951, 66.5409836066, 162.6557377049);
	}
	.radio__checkmark:after {
		content: '';
		position: absolute;
		display: none;
	}
	.radio__input:checked ~ .radio__checkmark:after {
		display: block;
	}
	.radio__checkmark:after {
		border-radius: 50%;
		background: #0d6efd;
		top: 2px;
		left: 2px;
		right: 2px;
		bottom: 2px;
	}
	.radio__label {
		display: flex;
		align-items: center;
		margin-left: 5px;
	}
	.radio-btn-group {
		display: flex;
	}
	.radio-button {
		display: flex;
		align-items: center;
		justify-content: center;
		color: #adb5bd;
		padding: 5px;
		border: 1px solid #dee2e6;
		cursor: pointer;
		font-size: 1rem;
		user-select: none;
		margin-bottom: 0;
		line-height: 1;
	}
	.radio-button:first-child {
		border-top-left-radius: 4px;
		border-bottom-left-radius: 4px;
	}
	.radio-button:last-child {
		border-top-right-radius: 4px;
		border-bottom-right-radius: 4px;
	}
	.radio-button:not(:last-child) {
		border-right: none;
	}
	.radio-button input[type='radio'] {
		display: none;
	}
	.radio-button.radio-button--active,
	.radio-button:hover {
		background-color: rgba(0, 0, 0, 0.05);
		color: #495057;
	}
	.radio-button.radio-button--active .radio-button__icon,
	.radio-button:hover .radio-button__icon {
		stroke: #495057;
	}
	.radio-button.radio-button--no-border-radius {
		border-radius: 0;
	}
	.radio-button.radio-button--primary {
		border-color: #0d6efd;
		color: #0d6efd;
		background-color: #fff;
	}
	.radio-button.radio-button--primary:hover {
		border-color: shade-color(#0d6efd, 4);
		color: shade-color(#0d6efd, 4);
		background-color: #fff;
	}
	.radio-button.radio-button--primary.radio-button--active {
		border-color: #0d6efd;
		color: #fff;
		background-color: #0d6efd;
	}
	.radio-button.radio-button--primary.radio-button--active .radio-button__icon {
		stroke: #fff;
	}
	.radio-button__icon {
		width: 1rem;
		height: 1rem;
		stroke: #adb5bd;
	}
	.input2 {
		transition: all 0.2s;
		position: relative;
		border-radius: 5px;
		display: flex;
		flex: 1;
		align-items: center;
		cursor: pointer;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.input2:hover .input2__text {
		text-decoration: underline;
	}
	.input2:hover .input2__placeholder {
		color: #adb5bd;
	}
	.input2.input2__loading {
		cursor: default;
		background-color: #fff;
	}
	.input2.input2__loading:hover {
		background-color: #fff;
	}
	.input2.input2__loading .input2__input {
		cursor: default;
	}
	.input2__placeholder {
		color: #ced4da;
	}
	.input2__icon__pencil {
		stroke: #495057;
		flex-basis: 20px;
		width: 25px;
		opacity: 0;
		transition: all 0.3s;
	}
	.input2__text {
		display: block;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.input2:hover .input2__icon__pencil {
		opacity: 1;
	}
	.input2__icon__close {
		flex-basis: 30px;
		width: 40px;
		width: 18px;
		margin-left: 5px;
		fill: #fff;
		stroke: #ced4da;
		cursor: pointer;
		transition: all 0.3s;
	}
	.input2__icon__close:hover {
		fill: #f3aa18;
		stroke: #000;
	}
	.input2__icon__loader {
		flex-basis: 30px;
		width: 40px;
		width: 18px;
		margin-right: 5px;
		margin-left: 5px;
		stroke: #ffc107;
	}
	.input2__icon__save {
		flex-basis: 30px;
		width: 40px;
		width: 18px;
		margin-left: 5px;
		cursor: pointer;
		stroke: #19b600;
		fill: #fff;
		transition: all 0.3s;
	}
	.input2__icon__save:hover {
		fill: #19b600;
		stroke: #000;
	}
	.input2__input {
		padding: 0;
		border: none;
		flex: 1;
		width: 20px;
		background-color: transparent;
	}
	.input2__input:focus {
		outline-width: 0;
	}
	.input2__date.form-control.input {
		border: none;
		height: 22px;
		padding: 0;
		min-height: 0;
		background: transparent;
	}
	.input2__date.form-control.input:focus {
		box-shadow: none;
		outline-width: 0;
	}
	.profile {
		border-left: 1px solid #dee2e6;
		overflow-y: scroll;
		overflow-x: auto;
		max-width: 440px;
		min-width: 200px;
		flex: 3;
		display: flex;
		flex-direction: column;
		position: relative;
		min-height: 100%;
		background: white;
	}
	.user_info {
		display: flex;
		flex-direction: column;
	}
	.user_info__field {
		display: flex;
		margin-top: 5px;
		flex-direction: row;
		margin-left: 20px;
		margin-right: 10px;
		align-items: center;
	}
	.user_info__field.user_info__field__fullname {
		margin-bottom: 0;
		margin-top: 10px;
		font-size: 20px;
		font-weight: 500;
		width: 100%;
		margin-left: 0;
		margin-right: 0;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.user_info__field.user_info__field__description {
		display: flex;
		margin-top: 0;
		flex-direction: row;
		margin-right: 0;
		margin-bottom: 0;
		white-space: nowrap;
	}
	.user_info__field.user_info__field__actions {
		display: flex;
		margin-top: 0;
		flex-direction: row;
		margin-bottom: 0;
	}
	.user_info__field_label {
		height: 31px;
		padding-top: 4px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		min-width: 90px;
		color: #777;
		margin-right: 10px;
		align-items: center;
		flex-shrink: 0;
	}
	.user_info__field_label_icon {
		flex-shrink: 0;
		margin-top: -4px;
		color: #dadada;
		margin-right: 5px;
		width: 16px;
	}
	.user_info__field_label.user_info__field_label__icon {
		align-self: center;
		min-width: 16px;
		color: #6c757d;
		fill: #e9ecef;
	}
	.user_info__add_field_btn {
		border-radius: 5px;
		border: 2px dashed #dee2e6;
		margin-left: 20px;
		margin-right: 20px;
		margin-top: 10px;
		cursor: pointer;
		padding: 5px;
		color: #495057;
		text-transform: uppercase;
		text-align: center;
	}
	.user_info__add_field_btn:hover {
		color: #343a40;
		border: 2px dashed #adb5bd;
	}
	.campaign_name.campaign_name__organic {
		border-color: #2fa84f;
		color: #2fa84f;
	}
	.campaign_name.campaign_name__direct {
		border-color: #367bf5;
		color: #367bf5;
	}
	.campaign_name.campaign_name__referring {
		border-color: #8719e0;
		color: #8719e0;
	}
	.campaign_name.campaign_name__advertising {
		border-color: #f3aa18;
		color: #f3aa18;
	}
	.campaign_name.campaign_name__social {
		border-color: #495057;
		color: #495057;
	}
	.campaign_name {
		display: inline-block;
		border-radius: 8px;
		background: #fff;
		padding: 0px 5px;
		max-width: 150px;
		border: 1px solid #fff;
		font-size: 14px;
		font-weight: 500;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		flex-shrink: 0;
	}
	.online-dot {
		width: 10px;
		height: 10px;
		flex-shrink: 0;
		background-color: #19b600;
		border-radius: 10px;
		margin-right: 5px;
		display: inline-block;
	}
	.offline-dot {
		width: 10px;
		height: 10px;
		border: 1px solid #b3b3b3;
		background-color: #cacaca;
		border-radius: 10px;
		margin-right: 5px;
	}
	.dropdown_container .profile_section__more {
		cursor: pointer;
		color: #6c757d;
		user-select: none;
		font-size: 14px;
		border: none;
	}
	.dropdown_container .profile_section__more:hover {
		color: #000;
		border: none;
	}
	.user_convos__undone_icon {
		position: absolute;
		width: 8px;
		height: 8px;
		border-radius: 50%;
		bottom: 5px;
		right: 2px;
		background: #0d6efd;
	}
	.user_orders {
		display: flex;
		flex-direction: column;
		padding-bottom: 10px;
		border-top: 1px solid #e5e5e5;
	}
	.user_records {
		display: flex;
		flex-direction: column;
		padding-bottom: 12px;
		border-top: 1px solid #e5e5e5;
	}
	.user_records__body {
		margin-top: 12px;
		margin-right: 20px;
		margin-left: 20px;
	}
	.user_record_card {
		min-width: 0;
		margin-bottom: 8px;
		padding: 10px 15px;
		border: 1px solid #dee2e6;
		border-radius: 8px;
		background: #fff;
		cursor: pointer;
	}
	.user_record_card:hover {
		background: #f8f9fa;
	}
	.user_record_card:last-child {
		margin-bottom: 0;
	}
	.user_record_progress {
		display: flex;
		gap: 4px;
		width: 100%;
		margin-top: 10px;
	}
	.user_record_progress__segment {
		flex: 1;
		min-width: 0;
		height: 10px;
		border-radius: 3px;
		background: #e9ecef;
	}
	.user_record_progress__segment_active {
		background: #0d6efd;
	}
	.user_record_progress__segment_success {
		background: #19b600;
	}
	.user_record_progress__segment_danger {
		background: #ea3d2f;
	}
	.user_profile_labels {
		display: flex;
		flex-direction: column;
		padding-bottom: 10px;
		border-top: 1px solid #e5e5e5;
	}
	.user_tasks {
		display: flex;
		flex-direction: column;
		padding-bottom: 10px;
		border-top: 1px solid #e5e5e5;
	}
	.user_tasks__body {
		margin-left: 20px;
		margin-right: 20px;
	}
	.user_tickets {
		display: flex;
		flex-direction: column;
		padding-bottom: 10px;
		border-top: 1px solid #e5e5e5;
	}
	.user_labels__body {
		margin-top: 5px;
		margin-left: 20px;
		min-height: 30px;
		margin-right: 20px;
	}
	.user_info__basic_section {
		overflow: hidden;
	}
	.user_info__avatar {
		flex-shrink: 0;
	}
	.order_modal {
		position: fixed;
		overflow: hidden;
		display: flex;
		height: 0;
		overflow: hidden;
		background: white;
		bottom: 0;
		width: 0;
		z-index: 1000;
		border-top-left-radius: 5px;
		border-top-right-radius: 5px;
	}
	.order_modal.full_page {
		max-height: 100%;
		height: 100%;
		border-radius: 0;
		position: absolute;
		right: 0;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.06),
			0px 4px 32px rgba(0, 0, 0, 0.06),
			0px 8px 64px rgba(0, 0, 0, 0.08);
	}
	.order_modal.full_page .order_modal__header {
		background-color: #fff;
		border-color: #dee2e6;
	}
	.order_modal__show {
		right: 20px;
		height: 1000px;
		max-height: 85vh;
		width: unset;
		box-shadow:
			rgba(0, 0, 0, 0.1) 0px 0px 0px 1px,
			rgba(0, 0, 0, 0.04) 0px 3px 6px,
			rgba(0, 0, 0, 0.2) 0px 0px 30px;
	}
	.order_modal__header {
		background: white;
		padding: 8px 15px 8px 15px;
		display: flex;
		height: 50px;
		border-bottom: 1px solid #dddddd;
		justify-content: space-between;
		align-items: center;
	}
	.order_modal__footer {
		background: white;
		padding: 10px 20px 10px 20px;
		display: flex;
		border-top: 1px solid #dee2e6;
		align-items: center;
	}
	.order_modal__header_title {
		flex: 1;
		font-size: 17px;
	}
	.order_progress {
		padding-right: 10px;
		width: 100%;
		position: relative;
		display: flex;
		height: 27px;
	}
	.order_progress_region_bg {
		background: #dfdfdf;
		z-index: 3;
		padding: 0 0 0 18px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		display: flex;
		align-items: center;
		overflow: hidden;
		justify-content: center;
		width: 100%;
		height: 100%;
		border-top-left-radius: 5px;
		border-bottom-left-radius: 5px;
	}
	.order_progress_region_count {
		display: inline-block;
		padding: 3px 6px;
		font-size: 11px;
		font-weight: 700;
		line-height: 1;
		text-align: center;
		white-space: nowrap;
		vertical-align: baseline;
		border-radius: 5px;
		background-color: rgba(0, 0, 0, 0.0784313725);
		margin-left: 6px;
		color: #929292;
	}
	.order_progress_region {
		position: relative;
		overflow: hidden;
		display: flex;
		flex-direction: column;
		align-items: center;
		flex-grow: 1;
		padding-right: 17px;
		color: black;
		cursor: pointer;
	}
	.order_progress_region::after {
		border-top-right-radius: 4px;
		width: 19px;
		height: 19px;
		content: '';
		position: absolute;
		background: #dfdfdf;
		right: 7px;
		box-shadow: 0 0 0 3px #efefef;
		top: 4px;
		z-index: 2;
		transform: rotate(45deg);
	}
	.order_progress_region:first-child .order_progress_region_bg {
		padding-left: 10px;
	}
	.order_progress_region:hover .order_progress_region_bg {
		background: #d2d2d2;
	}
	.order_progress_region:hover::after {
		background: #d2d2d2;
	}
	.order_progress_region.order_progress_region__active {
		cursor: default;
	}
	.order_progress_region.order_progress_region__active .order_progress_region_bg {
		background: #0d6efd;
		color: white;
		font-weight: 500;
	}
	.order_progress_region.order_progress_region__active .order_progress_region_count {
		color: white;
	}
	.order_progress_region.order_progress_region__active::after {
		background: #0d6efd;
	}
	.order_progress_region.order_progress_region__active:hover .order_progress_region_bg {
		background: #0d6efd;
	}
	.order_progress_region.order_progress_region__active:hover::after {
		background: #0d6efd;
	}
	.order_modal_region {
		display: flex;
	}
	.order_modal_region_left {
		flex: 2;
		padding-left: 20px;
		flex-shrink: 0;
	}
	.order_modal_region_right {
		flex: 3;
		flex-shrink: 0;
		margin-left: 20px;
	}
	.order_modal_region_header {
		margin-top: 20px;
		background: #f5f5f5;
		color: #848484;
		padding: 6px 20px;
	}
	.order_item_input {
		padding: 0;
		display: block;
		width: 100%;
		background: transparent;
		border: none;
		outline: none;
	}
	.order_item_input:active,
	.order_item_input:focus {
		outline: none;
	}
	.order_item_price_input {
		font-size: 14px;
		border: 0;
		width: auto;
		border-radius: 5px;
		width: 95px;
		background: white;
		padding: 1px 3px;
		border: 1px solid transparent;
	}
	.order_item_price_input:hover,
	.order_item_price_input:active,
	.order_item_price_input:focus {
		background: #e8e8e8;
		outline: 0;
	}
	.order_item_price_input::-webkit-outer-spin-button,
	.order_item_price_input::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	/* Firefox */
	.order_item_price_input[type='number'] {
		-moz-appearance: textfield;
	}
	.order_item_price_input:empty:before {
		content: attr(placeholder);
		color: gray;
	}
	.order_item_price_input br {
		display: none;
	}
	.order_item_quantity {
		border: 0;
		background: white;
		width: auto;
		border-radius: 5px;
		width: 100%;
	}
	.order_item_quantity:hover {
		background: #e8e8e8;
	}
	.order_item_quantity:active,
	.order_item_quantity:focus {
		background: #e8e8e8;
		outline: 0;
	}
	.order_item_quantity::-webkit-outer-spin-button,
	.order_item_quantity::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	.order_product_suggest_dropdown {
		top: 100%;
		left: 0;
		width: 100%;
		z-index: 20;
		background: white;
		overflow: hidden;
		position: absolute;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.order_product_suggest_head {
		margin: 0 0 0 0;
		padding: 5px 10px 5px 10px;
		background: white;
		display: flex;
		justify-content: space-between;
		flex-shrink: 0;
		width: 100%;
		border-bottom: 1px solid #e5e5e5;
	}
	.order_product_suggest_body {
		overflow-y: scroll;
		overflow-x: hidden;
		max-height: 300px;
	}
	.order_user_suggest_dropdown {
		max-height: 300px;
		background: white;
		z-index: 3;
		overflow: auto;
		position: absolute;
		width: 100%;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.order_suggest_user {
		position: relative;
		align-items: center;
		display: flex;
		overflow: hidden;
		width: 100%;
		padding: 3px 10px;
		cursor: pointer;
	}
	.order_suggest_user:hover {
		background: #edf4ff;
	}
	.order_product_suggest_product {
		position: relative;
		align-items: center;
		display: flex;
		overflow: hidden;
		width: 100%;
		height: 46px;
		padding: 5px 10px;
		cursor: pointer;
	}
	.order_product_suggest_product:hover {
		background: #edf4ff;
	}
	.order_item_shipping_price {
		border: 0;
		width: 100%;
		background: transparent;
		padding: 0px;
		text-align: right;
	}
	.order_item_shipping_price:active,
	.order_item_shipping_price:focus {
		outline: 0;
	}
	.order_item_shipping_price::-webkit-outer-spin-button,
	.order_item_shipping_price::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	.order_info_form_control {
		border: 0;
		background: transparent;
		padding: 0px;
	}
	.order_info_form_control:hover {
		text-decoration: underline;
	}
	.order_info_form_control:active,
	.order_info_form_control:focus {
		outline: 0;
	}
	.order_note {
		width: 100%;
		border: 0;
		overflow: hidden;
		padding: 5px 10px;
		min-height: 40px;
		background: whitesmoke;
		font-size: 14px;
		border-bottom-right-radius: 20px;
		resize: none;
	}
	.order_note:hover {
		outline: 0;
	}
	.order_note:active,
	.order_note:focus {
		outline: 0;
	}
	.order_shipping_address {
		border: 2px solid #c2c2c2;
		width: 100%;
		padding: 10px 15px;
		border-radius: 10px;
		margin-bottom: 10px;
		background: white;
	}
	.order_shipping_address.order_shipping_address__active {
		border: 2px solid #0d6efd;
	}
	.order_shipping_address_label {
		width: 90px;
		margin-top: 5px;
		margin-right: 10px;
	}
	.order_shipping_address.order_shipping_address__new {
		border: none;
		background: transparent;
		padding: 0;
		margin-bottom: 0;
	}
	.order_shipping_address_input {
		width: 100%;
		border: 0;
		overflow: hidden;
		padding: 3px 10px;
		color: black;
		background: #f5f5f5;
		border-radius: 4px;
	}
	.order_shipping_address_input:hover {
		outline: 0;
		background: #f0f0f0;
	}
	.order_shipping_address_input:active,
	.order_shipping_address_input:focus {
		background: #f0f0f0;
		outline: 0;
	}
	.order_shipping_address_suggestion {
		font-size: 14px;
		border: 1px solid #c2c2c2;
		width: 100%;
		padding: 5px 5px;
		border-radius: 3px;
		margin-bottom: 5px;
		background: white;
	}
	.order_shipping_address_suggestion:hover {
		border: 1px solid #0d6efd;
	}
	.order_adjustment_input {
		width: 100%;
		border: 1px dashed #888;
		overflow: hidden;
		padding: 2px 5px;
		color: black;
		background: transparent;
		border-radius: 4px;
	}
	.order_adjustment_input:hover {
		outline: 0;
		background: #f0f0f0;
	}
	.order_adjustment_input:active,
	.order_adjustment_input:focus {
		background: #f0f0f0;
		outline: 0;
	}
	.order_adjustment_input::-webkit-outer-spin-button,
	.order_adjustment_input::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	.dropdown_link__selected.salesperson_selected {
		border: none;
		background: white;
		padding: 2px 8px;
		border-radius: 3px;
	}
	.dropdown_link__selected.salesperson_selected:hover {
		color: unset;
		border: none;
	}
	.dropdown_link__selected.tax_selected {
		border: none;
		color: #6c757d;
	}
	.dropdown_link__selected.tax_selected:hover {
		color: #000;
		border: none;
	}
	.order_print_sidebar__label {
		font-weight: 500;
		margin-top: 20px;
		margin-bottom: 2px;
	}
	.user_info_date_input {
		padding-top: 0;
		padding-left: 0;
		padding-bottom: 0;
		flex: 1;
		overflow: hidden;
		border: none;
		box-shadow: none;
		outline: none !important;
	}
	.user_info_date_input::placeholder {
		color: #ced4da;
	}
	.user_info_date_input:hover::placeholder {
		color: #adb5bd;
	}
	.user_avatar_online_dot {
		width: 20px;
		height: 20px;
		position: absolute;
		bottom: 5px;
		right: 5px;
		border: 3px solid #fff;
		background-color: #19b600;
		border-radius: 50%;
	}
	.user_avatar_offline_badge {
		position: absolute;
		bottom: 3px;
		right: 0px;
		height: 22px;
		border: 2px solid #fff;
		background-color: #e6ffe2;
		color: #19b600;
		border-radius: 11px;
		padding: 0 5px;
		font-size: 10px;
		line-height: 1;
		display: flex;
		align-items: center;
	}
	.user_avatar_offline_badge.grey {
		background-color: #f8f9fa;
		color: #495057;
	}
	.user_channel_icon {
		width: 24px;
		height: 24px;
		border-radius: 4px;
	}
	.page_item {
		padding: 10px 15px;
		border-radius: 8px;
		display: flex;
		background: whitesmoke;
		margin-bottom: 10px;
		height: 80px;
	}
	.page_item.page_item__selected {
		background: #eef7ff;
	}
	.user_info__field_label.primary_attr_label {
		align-self: flex-start;
	}
	.user_attr_cb_wrapper {
		width: calc(50% - 10px);
		overflow: hidden;
		margin-right: 10px;
		margin-bottom: 5px;
	}
	.user_attr_cb_wrapper:nth-child(2n) {
		margin-right: 0;
	}
	.onboarding_inner {
		width: 700px;
		align-items: center;
		justify-content: center;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.onboarding__tagline2 {
		text-align: center;
		width: 400px;
		margin-bottom: 50px;
	}
	.onboarding__logo {
		margin-bottom: 60px;
	}
	.onboarding__box {
		flex: 1;
		border-radius: 5px;
		margin-top: 30px;
		border: 1px solid lightgray;
		margin: 10px;
		padding: 30px;
		display: flex;
		flex-direction: column;
		align-items: center;
	}
	.onboarding__tagline {
		text-transform: capitalize;
		text-align: center;
		color: #000;
		font-weight: 600;
		font-size: 18px;
		margin-bottom: 20px;
		width: 400px;
	}
	.onboarding {
		align-items: center;
		justify-content: center;
		display: flex;
		background: #fff0e3;
		background: white;
		width: 900px;
		transition:
			left ease-out 450ms,
			opacity ease-out 250ms;
		opacity: 1;
		height: 100vh;
		position: absolute;
		left: 50%;
		top: 50%;
		transform: translateX(-50%) translateY(-50%);
	}
	.onboarding.onboarding__hidden_right {
		opacity: 0;
		left: 100%;
	}
	.onboarding.onboarding__hidden_left {
		opacity: 0;
		left: -100%;
	}
	.onboarding-modal__head {
		font-size: 24px;
		padding: 15px 30px;
		border-bottom: 1px solid #dee2e6;
		color: #495057;
	}
	.onboarding-modal__foot {
		padding: 15px 30px;
		border-top: 1px solid #dee2e6;
	}
	.onboarding-box {
		padding: 60px 30px 30px;
		background-color: #f8f9fa;
		text-align: center;
		border-radius: 8px;
	}
	.onboarding-box__title {
		font-size: 20px;
		color: #495057;
		margin-bottom: 2.5px;
	}
	.onboarding-box__subtitle {
		color: #6c757d;
	}
	.onboarding-card {
		background-color: #fff;
		border-radius: 8px;
		box-shadow: 0 5px 15px rgba(0, 0, 0, 0.05);
		padding: 30px 20px 20px;
		display: flex;
		flex-direction: column;
		align-items: center;
		width: 260px;
		transition: 0.3s;
		min-height: 220px;
	}
	.onboarding-card__icon {
		color: tint-color(#0d6efd, 2);
		margin-bottom: 20px;
		width: 32px;
		height: 32px;
	}
	.onboarding-card__title {
		font-size: 16px;
		margin-bottom: 2.5px;
	}
	.onboarding-card__subtitle {
		color: #6c757d;
		text-align: center;
	}
	.onboarding__box_logo {
		width: 30px;
		height: 30px;
		margin-bottom: 20px;
	}
	.onboarding__box_logo img {
		width: 100%;
		height: 100%;
	}
	.onboarding__code {
		position: relative;
		width: 100%;
	}
	.onboarding__code_code {
		background: whitesmoke;
		font-size: 14px;
		border-radius: 4px;
		width: 100%;
		white-space: pre-wrap;
		padding: 10px 20px;
		overflow-y: auto;
		word-break: break-all;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
	}
	.onboarding_page_wrapper {
		height: 100%;
		overflow: auto;
		background: white;
	}
	.onboarding_box {
		border: 1px solid #dee2e6;
		border-radius: 8px;
		background-color: #fff;
	}
	.onboarding_box_head {
		padding: 12px 20px;
		display: flex;
		align-items: center;
		cursor: pointer;
	}
	.onboarding_box_head:hover {
		background: #f0f4ff;
	}
	.onboarding_box_head_title {
		flex: 1;
		font-size: 18px;
		font-weight: 500;
	}
	.onboarding_box_content {
		border-top: 1px solid #dee2e6;
	}
	.onboarding_row {
		display: flex;
		padding-bottom: 20px;
		padding-top: 20px;
		padding-left: 20px;
		padding-right: 20px;
	}
	.onboarding_row:hover {
		background: #fcfcfc;
	}
	.onboarding_row_left {
		flex-shrink: 0;
		margin-right: 15px;
		width: 40px;
		position: relative;
	}
	.onboarding_row_left .tabler-icon {
		position: relative;
		top: 4px;
	}
	.onboarding_row_content_title {
		font-size: 18px;
		font-weight: 500;
	}
	.onboarding_row_ignore_link {
		visibility: hidden;
	}
	.onboarding_row:not(.done):hover .onboarding_row_ignore_link {
		visibility: visible;
	}
	.onboarding_row.done {
		background: whitesmoke;
	}
	.onboarding_row.done .onboarding_row_content_title {
		font-weight: 400;
	}
	.onboarding_row.done .onboarding_row_ignore_link {
		visibility: hidden;
	}
	.onboarding_row_right {
		overflow: hidden;
		display: flex;
		flex: 1;
	}
	.onboarding_row .onboarding_row_left .icon-tabler {
		cursor: pointer;
	}
	.onboarding_row .icon-tabler-circle {
		color: #ccd2d7;
	}
	.onboarding_row .icon-tabler-circle:hover {
		color: #495057;
	}
	.convo_header {
		display: flex;
		align-items: center;
		border-bottom: 1px solid #e5e5e5;
		padding-left: 15px;
		padding-right: 7px;
		height: 64px;
		position: relative;
		border-bottom: 1px solid #e5e5e5;
		background-color: #fff;
	}
	.assign_agent {
		width: 450px;
		position: relative;
		max-height: 600px;
		overflow: auto;
		background: white;
		display: flex;
		flex-direction: column;
	}
	.assign_agent__header {
		display: flex;
		border-bottom: 1px solid #eeeeee;
		justify-content: space-between;
		padding: 10px 20px;
		font-size: 20px;
		font-weight: 500;
	}
	.assign_agent__member {
		display: flex;
		white-space: nowrap;
		align-items: center;
		margin-bottom: 20px;
	}
	.convo_header__tags {
		flex: 1;
		display: flex;
		align-items: center;
		position: relative;
		min-width: 100px;
	}
	.convo_header__tags .convo_tag {
		margin-top: 0;
		margin-bottom: 0;
	}
	.add_tag {
		width: 450px;
		min-height: 450;
		position: relative;
		max-height: 600px;
		overflow: auto;
		background: white;
		padding: 20px;
		display: flex;
		flex-direction: column;
	}
	.convo_header__source {
		font-size: 14px;
	}
	.convo_header__source_channel {
		flex-shrink: 0;
		color: #6c757d;
	}
	.convo_header__source_link {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		color: #6c757d;
		cursor: pointer;
	}
	.convo_header__source_link:hover {
		color: #000;
	}
	.convo_header__source_link.none {
		cursor: auto;
	}
	.convo_header__source_link.none:hover {
		color: #6c757d;
	}
	.convo_header__source_img {
		width: 16px;
		height: 16px;
		flex-shrink: 0;
	}
	.convo_header__source_img .emoji {
		width: 100%;
		height: 100%;
	}
	.convo_header__dropdown_container {
		position: relative;
	}
	.convo_header__dropdown_icon {
		color: #adb5bd;
		margin-right: 10px;
	}
	.convo_header__done_btn {
		cursor: pointer;
		width: 20px;
		height: 20px;
		background-size: contain;
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e1208c637fc15303975d.svg);
	}
	.convo_header__done_btn:hover {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/f8844ddd54cddb124c43.svg);
	}
	.convo_header__done_btn.convo_header__done_btn__disabled {
		opacity: 0.3;
		cursor: default;
	}
	.convo_header__done_btn.convo_header__done_btn__disabled:hover {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e1208c637fc15303975d.svg);
	}
	.convo_header__clickable {
		stroke: #6c757d;
		cursor: pointer;
	}
	.convo_header__clickable:hover {
		stroke: #000;
	}
	.convo-tags-input {
		display: flex;
		flex-wrap: wrap;
		border: 1px solid #cacaca;
		padding-left: 5px;
		min-height: 32px;
	}
	.convo-tags-input.is-focused {
		border-color: #495057;
	}
	.convo-tags-input__input-wrapper {
		margin: 5px 5px 5px 0;
	}
	.convo-tags-input__input {
		height: 100%;
		border: none;
		outline: none;
	}
	.convo_header__tags .convo_tag.convo_tag__add_btn {
		border: 1px solid #dfe1e4;
		color: #6c757d;
	}
	.convo_header__tags .convo_tag.convo_tag__add_btn:hover {
		border: 1px solid #dfe1e4;
		background-color: #ececec;
		color: #495057;
	}
	.convo_header__tags .convo_tags__more .convo_tag {
		background: whitesmoke;
	}
	@media only screen and (min-width: 1300px) and (max-width: 1550px) {
		.convos {
			width: 320px;
			flex: unset;
			flex-shrink: 0;
		}
	}
	@media only screen and (min-width: 900px) and (max-width: 1299px) {
		.convos {
			width: 280px;
			flex: unset;
			flex-shrink: 0;
		}
	}
	.emoji {
		position: relative;
		width: 20px;
		height: 20px;
		background-size: 100%;
		background-repeat: no-repeat;
		border: none;
		display: inline-block;
		vertical-align: text-top;
	}
	.emoji.emoji__xl {
		width: 32px;
		height: 32px;
	}
	.emoji.emoji__lg {
		width: 28px;
		height: 28px;
	}
	.emoji.emoji__md {
		width: 23px;
		height: 23px;
	}
	.emoji.emoji__sm {
		width: 18px;
		height: 18px;
	}
	.emoji.emoji__xs {
		width: 14px;
		height: 14px;
	}
	.emoji.emoji__angry {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/98f2a99ce0a9446c7672.png);
	}
	.emoji.emoji__confused {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/def4e71e5e777daa59d2.png);
	}
	.emoji.emoji__crying,
	.emoji.emoji__cry {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/49c03d05b42d14bebb2f.png);
	}
	.emoji.emoji__grinning {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/0f4d6e2d253f7283842f.png);
	}
	.emoji.emoji__heart_eyes,
	.emoji.emoji__heart-eyes {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/edca5cf863894b131e2b.png);
	}
	.emoji.emoji__neutral_face,
	.emoji.emoji__neutral {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/f910f2a3c5e49181066c.png);
	}
	.emoji.emoji__disappointed,
	.emoji.emoji__sad {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/bb191b0d3486fd2cf2b7.png);
	}
	.emoji.emoji__sleepy {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/46b54e5558e12b9df103.png);
	}
	.emoji.emoji__smile,
	.emoji.emoji__smiling {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/65724c188b90d71ed303.png);
	}
	.emoji.emoji__open_mouth,
	.emoji.emoji__surprised {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/af7b9271af93e720f43f.png);
	}
	.emoji.emoji__tired_face,
	.emoji.emoji__tired {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e36d2843610159e13b09.png);
	}
	.emoji.emoji__stuck_out_tongue,
	.emoji.emoji__tongue-out {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/6df72bc1d7a1e935185d.png);
	}
	.emoji.emoji__wink {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/9da3cba1f8367bd501d6.png);
	}
	.emoji.emoji__moyai {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/3d7a7adeb30e86531f85.png);
	}
	.emoji.emoji__dislike,
	.emoji.emoji__unlike,
	.emoji.emoji__thumbsdown {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/61f3359759dbe397368f.png);
	}
	.emoji.emoji__like,
	.emoji.emoji__thumbsup {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/ddbb0089a32557758351.png);
	}
	.emoji.emoji__ok_hand {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/231e2b7d6e7eb997cf50.png);
	}
	.emoji.emoji__octopus {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/4b49e94ccc143a6ed9e0.png);
	}
	.emoji.emoji__pig2 {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/1e6b2c0a9dcf6bf8dad5.png);
	}
	.emoji.emoji__wave {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/7114f58f295b5be143d0.png);
	}
	.emoji.emoji__mouse {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/3dfbc082a6f737780c14.png);
	}
	.emoji.emoji__mouse2 {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/142024173cd143e38265.png);
	}
	.emoji.emoji__rat {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/d5faf14279a0b0fc2d5e.png);
	}
	.emoji.emoji__ticket {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e358e52556cdd585e96f.png);
	}
	.emoji.emoji__scream {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/857b5c57edc3a089bc9a.png);
	}
	.emoji_picker {
		cursor: default;
		display: flex;
		flex-direction: row;
		z-index: 20;
		position: absolute;
		width: 270px;
		background: #fff;
		color: #000;
		border-radius: 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		right: 35px;
		bottom: 45px;
		flex-wrap: wrap;
		padding: 10px;
		justify-content: space-between;
		align-items: center;
		opacity: 1;
	}
	.emoji.emoji__preview {
		width: 30px;
		height: 30px;
		margin: 10px;
	}
	.emoji_picker__item {
		opacity: 1;
		cursor: pointer;
		background-size: 50%;
		width: 50px;
		height: 50px;
		transition: background-color 0.2s;
		border-radius: 100%;
	}
	.emoji_picker__item:hover {
		background-color: #dee2e6;
	}
	.emoji_picker_wrapper {
		display: inline-block;
	}
	.emoji_wrapper {
		display: inline-block;
		line-height: 1;
	}
	.lexical-emoji {
		color: transparent;
		background-size: 16px 16px;
		background-position: center;
		background-repeat: no-repeat;
		caret-color: #212529;
	}
	.lexical-emoji.thumbsup {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f44d.svg');
	}
	.lexical-emoji.thumbsdown {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f44e.svg');
	}
	.lexical-emoji.angry {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f620.svg');
	}
	.lexical-emoji.confused {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f615.svg');
	}
	.lexical-emoji.cry {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f622.svg');
	}
	.lexical-emoji.grinning {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f600.svg');
	}
	.lexical-emoji.heart_eyes {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f60d.svg');
	}
	.lexical-emoji.neutral {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f610.svg');
	}
	.lexical-emoji.sleepy {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f62a.svg');
	}
	.lexical-emoji.pensive {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f614.svg');
	}
	.lexical-emoji.smile {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f604.svg');
	}
	.lexical-emoji.tongue_out {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f61b.svg');
	}
	.lexical-emoji.tired {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f62b.svg');
	}
	.lexical-emoji.surprise {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f62e.svg');
	}
	.lexical-emoji.wink {
		background-image: url('https://cdn.jsdelivr.net/gh/twitter/twemoji@14.0.2/assets/svg/1f609.svg');
	}
	.emoji.ProseMirror-selectednode {
		border: 1px dashed rgba(0, 0, 0, 0.3333333333);
		border-radius: 2px;
	}
	.modal {
		overflow: hidden;
		position: fixed;
		top: 0;
		left: 0;
		z-index: 160;
		width: 100%;
		height: 100%;
		overflow: hidden;
		outline: 0;
		display: flex;
		align-items: center;
		justify-content: center;
		visibility: visible;
	}
	.modal.modal__local {
		position: absolute;
	}
	.modal.modal__right {
		align-items: center;
		justify-content: flex-end;
	}
	.modal.modal__right.modal__hide {
		left: 1000px;
	}
	.modal.modal__hide {
		opacity: 0;
		visibility: hidden;
		display: none;
	}
	.newmodal {
		overflow: hidden;
		position: fixed;
		top: 0;
		left: 0;
		z-index: 160;
		width: 100%;
		height: 100%;
		overflow: hidden;
		outline: 0;
		display: flex;
		opacity: 0;
		align-items: center;
		justify-content: center;
		visibility: visible;
		transform: translate(0, -1rem);
		transition: all 0.1s ease-out;
	}
	.modal.modal__hide .modal__overlay {
		opacity: 0;
		transition: opacity 100ms;
	}
	.newmodal__show.newmodal__overlay {
		opacity: 1;
	}
	.newmodal.newmodal__show {
		opacity: 1;
		transform: none;
	}
	.newmodal__overlay {
		z-index: 160;
		position: fixed;
		top: 0;
		left: 0;
		right: 0;
		bottom: 0;
		opacity: 0;
		background-color: rgba(0, 0, 0, 0.23);
		transition: all 0.15s linear;
		-webkit-backdrop-filter: none;
		backdrop-filter: none;
	}
	.modal__overlay {
		z-index: -1;
		position: absolute;
		top: 0;
		left: 0;
		right: 0;
		bottom: 0;
		background-color: rgba(0, 0, 0, 0.23);
		transition: opacity 0.15s linear;
	}
	.modal__container {
		overflow: hidden;
		overflow-x: hidden;
		overflow-y: auto;
		outline: 0;
		max-height: 90vh;
		display: flex;
		align-items: center;
		justify-content: center;
		box-shadow:
			rgba(0, 0, 0, 0) 0px 0px 0px 0px,
			rgba(0, 0, 0, 0) 0px 0px 0px 0px,
			rgba(0, 0, 0, 0.12) 0px 10px 40px 0px,
			rgba(0, 0, 0, 0.08) 0px 0px 16px 0px;
		border-radius: 10px;
	}
	.modal__container.modal__container__full {
		height: 100vh;
		max-height: 100vh;
	}
	.modal__container.modal__container__full .modal__background {
		border-radius: 0;
	}
	.modal__background {
		background: #ffffff;
		border-radius: 8px;
	}
	.modal__background.modal__background--no-border-radius {
		border-radius: 0;
	}
	.modal__background.modal__background--border-radius-left {
		border-top-left-radius: 8px;
		border-bottom-left-radius: 8px;
	}
	.modal_content {
		z-index: 160;
		background-color: #fff;
		margin: auto;
		width: 840px;
		border-radius: 5px;
	}
	.modal_content__header {
		position: relative;
		width: 100%;
		background: #fff;
		padding: 15px 20px;
		border-bottom: 1px solid #e9e9e9;
		font-size: 18px;
		font-weight: 500;
		border-radius: 8px 8px 0 0;
	}
	.modal_content__main {
		position: relative;
		width: 100%;
		padding: 20px 20px;
	}
	.modal_content__footer {
		border-radius: 0px 0px 8px 8px;
		background: #f8f9fa;
		padding: 10px 20px;
		border-top: 1px solid #e6e6e6;
		text-align: right;
	}
	.modal_content__icon_close {
		display: flex;
		align-items: center;
		cursor: pointer;
	}
	.modal.modal--left,
	.modal.modal--right {
		z-index: -999999;
		opacity: 0;
		align-items: center;
	}
	.modal.modal--right {
		justify-content: flex-end;
	}
	.modal.modal--left {
		justify-content: flex-start;
	}
	.modal.modal--left.modal--active,
	.modal.modal--right.modal--active {
		z-index: 160;
		opacity: 1;
	}
	.modal.modal--right .modal__background {
		left: 800px;
		transition: 0.3s;
	}
	.modal.modal--left .modal__background {
		left: -800px;
		transition: 0.3s;
	}
	.modal.modal--left.modal--active .modal__background,
	.modal.modal--right.modal--active .modal__background {
		left: 0;
	}
	.modal.modal--right.modal--active.modal--fadeout .modal__background {
		left: 800px;
	}
	.modal.modal--left.modal.--active.modal--fadeout .modal__background {
		left: -800px;
	}
	.modal.modal--right.modal--active.modal--fadeout .quickview__btn_close,
	.modal.modal--left.modal--active.modal--fadeout .quickview__btn_close {
		display: none;
	}
	.modal.modal--active ~ .modal.modal--active .modal__overlay {
		background-color: transparent;
	}
	.convo_tag__delete {
		opacity: 0.6;
	}
	.convo_tag__delete:hover {
		opacity: 1;
	}
	.convo_tag__container {
		background: white;
		margin: 5px 5px 5px 0;
		border-radius: 4px;
	}
	.convo_tag__container:only-child {
		margin: 0 5px 0 0;
	}
	.user_info_field_tags .convo_tag {
		margin-bottom: 2px;
		margin-top: 0;
		padding: 2px 5px;
		font-size: 15px;
		border-radius: 4px;
		font-weight: 400;
	}
	.user_info_field_tags .convo_tag.convo_tag__add_btn {
		border: 1px dashed #adb5bd;
		color: #adb5bd;
		line-height: 16px;
	}
	.user_info_field_tags .convo_tag.convo_tag__add_btn:hover {
		border: 1px dashed #343a40;
		color: #343a40;
	}
	.convo_tag {
		margin: 5px 5px 5px 0;
		display: inline-block;
		padding: 0px 5px;
		border-radius: 4px;
		background: #ffffff;
		white-space: nowrap;
		color: #555;
		font-size: 12px;
		font-weight: 400;
		line-height: 18px;
		cursor: pointer;
		user-select: none;
	}
	.convo_tag__title {
		white-space: nowrap;
		overflow: hidden;
		max-width: 150px;
		text-transform: uppercase;
		font-weight: 500;
		text-overflow: ellipsis;
	}
	.convo_tag.convo_tag__add_btn {
		border: 1px dashed #6c757d;
		color: #343a40;
		line-height: 16px;
	}
	.convo_tag.convo_tag__add_btn:hover {
		border: 1px dashed #000;
		color: #000;
	}
	.convo_tag.add_label_btn {
		background-color: #e9ecef;
		color: #495057;
		cursor: pointer;
		height: 20px;
	}
	.convo_tag.add_label_btn:hover {
		background-color: #dee2e6;
	}
	.convo_tags {
		display: flex;
		align-items: center;
		width: 100%;
		flex-wrap: nowrap;
	}
	.dropdown.convo_header__tag_dropdown__full {
		left: 0;
	}
	.convo_tags__more {
		position: relative;
		display: inline-block;
		line-height: 18px;
	}
	.convo_tags__more .convo_tags__dropdown {
		cursor: default;
		display: none;
		position: absolute;
		top: 80%;
		right: 0;
		background: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		padding: 10px;
		z-index: 10;
	}
	.convo_tags__more:hover .convo_tags__dropdown {
		display: block;
	}
	.tag {
		display: inline-block;
		padding: 0 0.5rem;
		border-radius: 4px;
		line-height: 1.5;
		font-size: 14px;
		background: #ffffff;
		border: 1px solid transparent;
		white-space: nowrap;
		color: #555;
		cursor: pointer;
		-webkit-user-select: none;
		-moz-user-select: none;
		-ms-user-select: none;
		user-select: none;
	}
	.tag.tag--lg {
		padding: 2px 8px;
	}
	.tag.tag--primary {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.tag.tag--warning {
		background: #ffc107;
		border-color: #ffc107;
	}
	.tag.tag--success {
		background: #19b600;
		border-color: #19b600;
		color: #333;
	}
	.tag.tag--danger {
		background: #ea3d2f;
		border-color: #ea3d2f;
		color: #fff;
	}
	.tag.tag--secondary {
		background: #6c757d;
		border-color: #6c757d;
		color: #fff;
	}
	.tag.tag--primary.tag--light {
		color: rgb(41, 116, 249);
		background: rgb(238, 244, 255);
		border-color: rgb(191, 213, 253);
	}
	.tag.tag--warning.tag--light {
		color: rgb(253, 174, 4);
		background: rgb(255, 249, 235);
		border-color: rgb(254, 231, 180);
	}
	.tag.tag--success.tag--light {
		color: rgb(3, 137, 47);
		background: rgb(235, 246, 238);
		border-color: rgb(179, 220, 193);
	}
	.tag.tag--danger.tag--light {
		color: rgb(252, 13, 6);
		background: rgb(255, 236, 235);
		border-color: rgb(254, 182, 180);
	}
	.tag.tag--secondary.tag--light {
		background: rgba(108, 117, 125, 0.1);
		border-color: rgba(108, 117, 125, 0.7);
		color: #6c757d;
	}
	.dropdown__item:hover .convo_tag {
		background: white !important;
	}
	.dropdown {
		z-index: 110;
		max-width: 350px;
		max-height: 350px;
		overflow-x: hidden;
		position: absolute;
		min-width: 200px;
		top: 100%;
		right: 0;
		background: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border-radius: 8px;
	}
	.dropdown.dropdown__right {
		right: unset;
		left: 0;
	}
	.dropdown.dropdown__up {
		top: unset;
		bottom: 100%;
	}
	.dropdown.dropdown__up.dropdown__full {
		top: unset;
		border-top-right-radius: 8px;
		border-top-left-radius: 8px;
		border-bottom-right-radius: 0;
		border-bottom-left-radius: 0;
	}
	.dropdown__item.dropdown__item_group {
		padding: 5px 0;
		margin: 0 10px;
		display: flex;
		font-size: 12px;
		align-items: center;
		cursor: default;
		font-weight: 500;
		text-transform: uppercase;
		color: #6c757d;
		border-top: 1px solid #dee2e6;
		background: #fff;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.dropdown__item.dropdown__item_group:first-child {
		border-top: none;
	}
	.dropdown__item.dropdown__item_group:hover {
		color: #6c757d;
		background: #fff;
	}
	.dropdown__item {
		padding: 8px 10px;
		flex-shrink: 0;
		display: flex;
		align-items: center;
		cursor: pointer;
		background: #fff;
		color: #000;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		font-size: initial;
		font-weight: initial;
	}
	.dropdown__item:first-child {
		padding-top: 11.6px;
	}
	.dropdown__item:last-child {
		padding-bottom: 11.6px;
	}
	.dropdown__item:hover {
		color: white;
		background: #0d6efd;
	}
	.dropdown__item:hover .convo_header__dropdown_icon {
		color: white;
	}
	.dropdown__item.dropdown__item__hover-light:hover {
		background: #e9ecef;
		color: initial;
	}
	.dropdown__item.dropdown__item__hover-light:hover.dropdown__item__hover-light.no_hover:hover {
		background-color: #fff;
		color: initial;
	}
	.dropdown__item.dropdown__item__hover-light.active {
		background: #e9ecef;
		color: initial;
	}
	.dropdown__item__text {
		overflow: hidden;
		font-size: 13px;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.dropdown__item.dropdown__item__selected {
		color: white;
		background: #0d6efd;
	}
	.dropdown__item.dropdown__item__thin {
		padding: 5px 10px;
		font-size: 14px;
	}
	.dropdown__item.dropdown__item__disabled {
		color: #ced4da;
		cursor: default;
	}
	.dropdown__item.dropdown__item__disabled .convo_header__dropdown_icon {
		stroke: #e9ecef;
	}
	.dropdown__item.dropdown__item__disabled:hover {
		color: #ced4da;
		stroke: #ced4da;
		background: #fff;
	}
	.dropdown__item.dropdown__item__disabled:hover .convo_header__dropdown_icon {
		stroke: #e9ecef;
	}
	input.form-control.dropdown__input {
		background: #fff;
		cursor: pointer;
		padding-right: 40px;
	}
	.dropdown__input_container {
		max-width: 300px;
		position: relative;
	}
	.dropdown_link__container {
		display: inline-block;
		position: relative;
		max-width: 100%;
	}
	.dropdown_link__selected {
		cursor: pointer;
		padding-top: 1px;
		border-bottom: 1px dashed #6c757d;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		display: inline;
	}
	.dropdown_link__selected:hover {
		color: #0d6efd;
		border-bottom: 1px dashed #0d6efd;
	}
	.dropdown.dropdown__full {
		border-top-left-radius: 0px;
		border-top-right-radius: 0px;
		top: 110%;
		width: 100%;
		max-width: 100%;
	}
	.dropdown__input__more {
		cursor: pointer;
		position: absolute;
		top: 8px;
		right: 10px;
		fill: #343a40;
		stroke: #343a40;
	}
	.dropdown__input-search-container {
		padding: 10px;
		background-color: #f8f9fa;
		flex: 1;
	}
	.dropdown__content-container {
		max-height: 300px;
		overflow: auto;
	}
	.dropdown__item__with_desc {
		padding: 5px 10px;
		flex-shrink: 0;
		align-items: center;
		cursor: pointer;
		background: #fff;
		color: #000;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		font-size: initial;
		font-weight: initial;
	}
	.dropdown__item__with_desc:first-child {
		padding-top: 5.8px;
	}
	.dropdown__item__with_desc:last-child {
		padding-bottom: 5.8px;
	}
	.dropdown__item__with_desc:hover {
		color: white;
		background: #0d6efd;
	}
	.dropdown__item__with_desc:hover .convo_header__dropdown_icon {
		color: white;
	}
	.dropdown__item__with_desc:hover .dropdown__item__desc {
		color: white;
	}
	.dropdown__item__with_desc.dropdown__item__hover-light:hover {
		background: #e9ecef;
		color: initial;
	}
	.dropdown__item__with_desc.dropdown__item__hover-light.active {
		background: #e9ecef;
		color: initial;
	}
	.dropdown__item__desc {
		overflow: hidden;
		color: #999;
		text-overflow: ellipsis;
		white-space: nowrap;
		line-height: 1;
	}
	.dropdown__item__with_desc.dropdown__item__selected {
		color: white;
		background: #0d6efd;
	}
	.dropdown__item__with_desc.dropdown__item__selected .convo_header__dropdown_icon {
		color: white;
	}
	.dropdown__item__with_desc.dropdown__item__selected .dropdown__item__desc {
		color: white;
	}
	.dropdown_input {
		width: 100%;
		display: flex;
		align-items: center;
		height: 36px;
		max-height: 100%;
		padding: 0.375rem 2.1rem 0.375rem 0.55rem;
		font-size: 16px;
		font-weight: 400;
		line-height: 1.5;
		color: #495057;
		background-color: #fff;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%236c757d' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
		background-repeat: no-repeat;
		background-position: right 0.55rem center;
		background-size: 16px 12px;
		border: 1px solid #cacaca;
		border-radius: 0.5rem;
		appearance: none;
		cursor: pointer;
		overflow: hidden;
	}
	.dropdown_input:hover {
		border-color: #6c757d;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
		outline: 0;
		color: #000;
	}
	.dropdown_input.danger {
		border-color: #ea3d2f;
	}
	.dropdown_input.danger:hover {
		border-color: #ea3d2f;
	}
	.dropdown_input.dropdown_input__small {
		min-height: unset;
		padding: 4px 8px;
		line-height: 21px;
		border-radius: 4px;
		font-size: 14px;
		height: auto;
		padding-right: 25px;
		background-position: right 5px center;
	}
	.dropdown_input.dropdown_input__small.form-control {
		height: 31px;
	}
	.dropdown_input.is-invalid {
		border-color: #ea3d2f;
		padding-right: calc(1.5em + 0.75rem);
	}
	.dropdown_input_placeholder {
		color: #adb5bd;
	}
	.dropdown_item_img {
		width: 24px;
		height: 24px;
		object-fit: cover;
		border-radius: 4px;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.dropdown_item {
		padding: 8px 10px;
		cursor: pointer;
		background-color: #fff;
		position: relative;
	}
	.dropdown_item.active {
		background-color: #e9ecef;
	}
	.dropdown_item.checked {
		background-color: #0d6efd;
		color: #fff;
	}
	.dropdown_item.checked .dropdown_item_text {
		color: #fff;
	}
	.dropdown_item.checked .dropdown_item_subtext {
		color: #fff;
	}
	.dropdown_item.dropdown_item__bold.checked {
		background-color: rgba(13, 110, 253, 0.2);
	}
	.dropdown_item.dropdown_item__bold.checked .dropdown_item_text {
		color: #495057;
	}
	.dropdown_item.dropdown_item__bold.checked .dropdown_item_subtext {
		color: #6c757d;
	}
	.dropdown_item.dropdown_item__bold.active {
		background-color: #0d6efd;
		color: #fff;
	}
	.dropdown_item.dropdown_item__bold.active .dropdown_item_text {
		color: #fff;
	}
	.dropdown_item.dropdown_item__bold.active .dropdown_item_subtext {
		color: #fff;
	}
	.dropdown_item.dropdown_item__disabled {
		pointer-events: none;
		opacity: 0.6;
	}
	.dropdown_item.dropdown_item_wide {
		padding: 10px;
		font-size: 16px;
	}
	.dropdown_item_subtext {
		color: #6c757d;
	}
	.dropdown_item_cotainer {
		max-height: 230px;
		overflow: auto;
	}
	.dropdown_filter_container {
		padding: 5px 10px;
		background-color: whitesmoke;
	}
	.dropdown_filter_input_container {
		position: relative;
	}
	.form-control.dropdown_filter_input {
		padding: 3px 25px;
		font-size: 13px;
		min-height: 27px;
	}
	.form-control.dropdown_filter_input:active,
	.form-control.dropdown_filter_input:focus,
	.form-control.dropdown_filter_input:hover {
		outline: none;
	}
	.dropdown_filter_input_search_icon {
		color: #6c757d;
		position: absolute;
		top: 50%;
		left: 8px;
		transform: translateY(-50%);
	}
	.dropdown_filter_input_x_icon {
		position: absolute;
		top: 50%;
		right: 8px;
		transform: translateY(-50%);
		cursor: pointer;
		padding: 2px;
		background: #dee2e6;
		stroke: #fff;
		border-radius: 50%;
		stroke-width: 3px;
		transition: all 150ms ease-out;
	}
	.dropdown_filter_input_x_icon:hover {
		background: #adb5bd;
	}
	.dropdown_link_selected {
		display: inline;
		cursor: pointer;
		padding-top: 1px;
		border-bottom: 1px dashed #aaa;
	}
	.dropdown_link_selected:hover {
		color: #0d6efd;
		border-bottom: 1px dashed #0d6efd;
	}
	.dropdown_input_border_left_none {
		border-left: none;
	}
	.dropdown_input_border_left_radius_none {
		border-top-left-radius: 0;
		border-bottom-left-radius: 0;
	}
	.dropdown_input_border_right_none {
		border-right: none;
	}
	.dropdown_input_border_right_radius_none {
		border-top-right-radius: 0;
		border-bottom-right-radius: 0;
	}
	.dropdown_input.disabled {
		cursor: default;
		background: #e9ecef;
		pointer-events: none;
	}
	.dropdown_input.disabled:hover {
		border: 1px solid #cacaca;
	}
	.hover_dropdown {
		z-index: 1200;
		background-color: #fff;
		border: 1px solid #dee2e6;
		box-shadow:
			0 0 0 1px rgba(0, 0, 0, 0.02),
			0 4px 12px rgba(0, 0, 0, 0.05);
		border-radius: 8px;
		visibility: hidden;
		position: relative;
	}
	.hover_dropdown.is-primary {
		background-color: #0d6efd;
		color: #fff;
	}
	.hover_dropdown.active {
		visibility: visible;
	}
	.hover_dropdown.bottom-center:after {
		position: absolute;
		bottom: 100%;
		left: calc(50% - 8px);
		border: solid transparent;
		border-bottom-color: white;
		border-width: 8px;
	}
	.hover_dropdown.bottom-center:before {
		position: absolute;
		bottom: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.bottom-left:after {
		position: absolute;
		bottom: 100%;
		left: var(--edge);
		border: solid transparent;
		border-bottom-color: white;
		border-width: 8px;
	}
	.hover_dropdown.bottom-left:before {
		position: absolute;
		bottom: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.bottom-right:after {
		position: absolute;
		bottom: 100%;
		right: var(--edge);
		border: solid transparent;
		border-bottom-color: white;
		border-width: 8px;
	}
	.hover_dropdown.bottom-right:before {
		position: absolute;
		bottom: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.top-center:after {
		position: absolute;
		top: 100%;
		left: calc(50% - 8px);
		border: solid transparent;
		border-top-color: white;
		border-width: 8px;
	}
	.hover_dropdown.top-center:before {
		position: absolute;
		top: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.top-left:after {
		position: absolute;
		top: 100%;
		left: var(--edge);
		border: solid transparent;
		border-top-color: white;
		border-width: 8px;
	}
	.hover_dropdown.top-left:before {
		position: absolute;
		top: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.top-right:after {
		position: absolute;
		top: 100%;
		right: var(--edge);
		border: solid transparent;
		border-top-color: white;
		border-width: 8px;
	}
	.hover_dropdown.top-right:before {
		position: absolute;
		top: 100%;
		left: 0;
		width: 100%;
		height: 16px;
		background-color: transparent;
	}
	.hover_dropdown.left-bottom:after {
		position: absolute;
		left: 100%;
		top: var(--edge);
		border: solid transparent;
		border-left-color: white;
		border-width: 8px;
	}
	.hover_dropdown.left-bottom:before {
		position: absolute;
		top: 0;
		left: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.hover_dropdown.left-top:after {
		position: absolute;
		left: 100%;
		bottom: var(--edge);
		border: solid transparent;
		border-left-color: white;
		border-width: 8px;
	}
	.hover_dropdown.left-top:before {
		position: absolute;
		top: 0;
		left: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.hover_dropdown.left-center:after {
		position: absolute;
		left: 100%;
		bottom: calc(50% - 8px);
		border: solid transparent;
		border-left-color: white;
		border-width: 8px;
	}
	.hover_dropdown.left-center:before {
		position: absolute;
		top: 0;
		left: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.hover_dropdown.right-bottom:after {
		position: absolute;
		right: 100%;
		top: var(--edge);
		border: solid transparent;
		border-right-color: white;
		border-width: 8px;
	}
	.hover_dropdown.right-bottom:before {
		position: absolute;
		top: 0;
		right: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.hover_dropdown.right-top:after {
		position: absolute;
		right: 100%;
		bottom: var(--edge);
		border: solid transparent;
		border-right-color: white;
		border-width: 8px;
	}
	.hover_dropdown.right-top:before {
		position: absolute;
		top: 0;
		right: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.hover_dropdown.right-center:after {
		position: absolute;
		right: 100%;
		bottom: calc(50% - 8px);
		border: solid transparent;
		border-right-color: white;
		border-width: 8px;
	}
	.hover_dropdown.right-center:before {
		position: absolute;
		top: 0;
		right: 100%;
		width: 16px;
		height: 100%;
		background-color: transparent;
	}
	.emoji_picker_dropdown_emojis {
		padding: 0 10px;
		display: grid;
		grid-gap: 10px;
		grid-template-columns: repeat(8, 1fr);
	}
	.emoji_picker_dropdown_emoji_item {
		cursor: pointer;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 4px;
		height: 24px;
	}
	.emoji_picker_dropdown_emoji_item:hover {
		background-color: #e9ecef;
	}
	.dropdown-trigger {
		display: inline-block;
	}
	.dropdown_input.dropdown_input__no_border {
		border: none;
		outline: none;
	}
	.dropdown_input.dropdown_input__light {
		background-color: #f3f3f3;
		border-color: #f3f3f3;
	}
	.dropdown_input.dropdown_input__light.dropdown_input__success {
		color: #19b600;
		background-color: #d4edda;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%2319b600' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
	}
	.dropdown_input.dropdown_input__light.dropdown_input__primary {
		color: #0d6efd;
		background-color: #dceaff;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%230d6efd' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
	}
	.dropdown_input.dropdown_input__success {
		color: #fff;
		background-color: #19b600;
		background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23ffffff' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
	}
	.dropdown_item__seperator {
		margin-top: 5px;
		margin-bottom: 5px;
		height: 1px;
		background-color: #dee2e6;
	}
	.search_dropdown_input {
		padding: 5px 10px;
		display: flex;
		align-items: center;
		position: relative;
	}
	.dropdown2 {
		z-index: 200;
		position: absolute;
		background: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border-radius: 8px;
	}
	.dropdown2_inner {
		width: 100%;
	}
	.dropdown2_inner_header {
		padding: 0 15px;
		overflow: hidden;
		height: 50px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
	}
	.dropdown2_inner_content {
		flex: 1;
		overflow-x: hidden;
		overflow-y: auto;
		max-height: 400px;
	}
	.dropdown2_inner_content.sub_step {
		max-height: 350px;
	}
	.dropdown2_inner_content.sub_step.static_height {
		height: 350px;
	}
	.dropdown2_inner_content.static_height {
		height: 400px;
	}
	.dropdown2_item {
		padding: 6px 15px;
		cursor: pointer;
		display: flex;
	}
	.dropdown2_item:hover {
		background-color: #f8f9fa;
	}
	.dropdown2_item_title {
		font-weight: 500;
	}
	.dropdown2_item_img_wrapper {
		width: 24px;
		height: 24px;
		overflow: hidden;
		border-radius: 4px;
		margin-right: 10px;
	}
	.dropdown2_item_img_wrapper img {
		object-fit: cover;
		width: 100%;
		height: 100%;
	}
	.dropdown2_item_icon_wrapper {
		width: 24px;
		height: 24px;
		margin-right: 10px;
		display: flex;
		align-items: center;
	}
	.dropdown2_item_icon_wrapper .icon-tabler {
		width: 20px;
		height: 20px;
	}
	.dropdown_container_custom_inner {
		height: 100%;
	}
	.toaster {
		display: flex;
		align-items: center;
		padding: 10px 15px;
		box-shadow:
			rgba(67, 90, 111, 0.3) 0px 0px 1px,
			rgba(67, 90, 111, 0.47) 0px 8px 10px -4px;
		border-radius: 5px;
	}
	.toaster__content {
		padding: 2px 15px;
		min-width: 300px;
		width: 100%;
	}
	.toaster__icon_status__success {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/e184faeb4a754aeb41f6.svg);
		background-repeat: no-repeat;
	}
	.toaster__icon_status__warning,
	.toaster__icon_status__hellobar {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/05bbf83a501a3201d2d8.svg);
		background-repeat: no-repeat;
	}
	.toaster__icon_status__error {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/f72eea8f892ea55bd1a7.svg);
		background-repeat: no-repeat;
	}
	.toaster__border__success {
		background: #2fa84f;
	}
	.toaster__border__warning,
	.toaster__border__hellobar {
		background: #f3aa18;
	}
	.toaster__border__hellobar {
		white-space: nowrap;
	}
	.toaster__border__error {
		background: #ea3d2f;
	}
	.toaster__title {
		font-weight: 500;
		color: #ffffff;
	}
	.toaster__descrption {
		font-weight: nomal;
		color: #ffffff;
	}
	.toaster__icon_status {
		width: 25px;
		height: 20px;
	}
	.toaster__iconclose {
		color: #ffffff;
		cursor: pointer;
		width: 20px;
		height: 20px;
	}
	.noti_message_item_wrapper {
		padding: 15px;
		width: 360px;
		overflow: hidden;
		margin: -20px 0;
	}
	.noti_message_item_wrapper:last-child {
		margin-bottom: 0;
	}
	.noti_message_item_wrapper.overlap {
		cursor: pointer;
	}
	.noti_message_item {
		width: 100%;
		display: flex;
		padding: 12px 16px;
		background-color: #fff;
		border-radius: 16px;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
		position: relative;
	}
	.noti_message_item.danger {
		background-color: #ea3d2f;
		color: #fff;
	}
	.noti_message_item.danger .noti_message_item_icon {
		color: #ea3d2f;
	}
	.noti_message_item.danger .noti_message_item_primary_btn {
		background-color: rgba(0, 0, 0, 0.25);
	}
	.noti_message_item.danger .noti_message_item_primary_btn:hover {
		background-color: rgba(0, 0, 0, 0.35);
	}
	.noti_message_item.success {
		background-color: #333;
		color: #eee;
	}
	.noti_message_item.success .noti_message_item_icon {
		color: #333;
	}
	.noti_message_item.success .noti_message_item_primary_btn {
		background-color: rgba(0, 0, 0, 0.25);
	}
	.noti_message_item.success .noti_message_item_primary_btn:hover {
		background-color: rgba(0, 0, 0, 0.35);
	}
	.noti_message_item.warning {
		background-color: #ffaa00;
		color: black;
	}
	.noti_message_item.warning .noti_message_item_icon {
		color: #ffaa00;
	}
	.noti_message_item.warning .noti_message_item_primary_btn {
		background-color: rgba(0, 0, 0, 0.25);
	}
	.noti_message_item.warning .noti_message_item_primary_btn:hover {
		background-color: rgba(0, 0, 0, 0.35);
	}
	.noti_message_item_icon_wrapper {
		flex-shrink: 0;
		width: 20px;
		height: 20px;
		margin-right: 10px;
		border-radius: 50%;
		background-color: #fff;
		display: flex;
		align-items: center;
		justify-content: center;
		position: relative;
		top: 2px;
	}
	.noti_message_item_icon_wrapper.big {
		width: 32px;
		height: 32px;
		top: 0;
	}
	.noti_message_item_icon_wrapper.big .noti_message_item_icon {
		width: 24px;
		height: 24px;
		stroke-width: 2;
	}
	.noti_message_item.success .noti_message_item_icon_wrapper {
		background-color: #19b600;
		color: white;
	}
	.noti_message_item.warning .noti_message_item_icon_wrapper {
		background-color: black;
		color: white;
	}
	.noti_message_item_icon {
		width: 14px;
		height: 14px;
		stroke-width: 2.5;
	}
	.noti_message_item_content {
		flex: 1;
		overflow: hidden;
	}
	.noti_message_item_buttons {
		margin-top: 10px;
		display: flex;
		align-items: center;
		font-size: 14px;
	}
	.noti_message_item_primary_btn {
		background-color: #0d6efd;
		border-radius: 4px;
		padding: 4px 12px;
		color: #fff;
		margin-right: 8px;
		font-weight: 500;
		cursor: pointer;
	}
	.noti_message_item_primary_btn:hover {
		background-color: shade-color(#0d6efd, 2);
	}
	.noti_message_item_secondary_btn {
		cursor: pointer;
		color: #0d6efd;
	}
	.noti_message_item_secondary_btn:hover {
		background-color: shade-color(#0d6efd, 2);
	}
	.noti_message_item_close_btn {
		flex-shrink: 0;
		margin-left: 5px;
		width: 24px;
		height: 24px;
		cursor: pointer;
		border-radius: 50%;
		background-color: rgba(0, 0, 0, 0.2);
		display: flex;
		align-items: center;
		justify-content: center;
		position: relative;
		color: #6c757d;
		top: 2px;
	}
	.noti_message_item_close_btn:hover {
		color: #495057;
		background-color: rgba(0, 0, 0, 0.4);
	}
	.noti_message_item.warning .noti_message_item_close_btn,
	.noti_message_item.success .noti_message_item_close_btn,
	.noti_message_item.danger .noti_message_item_close_btn {
		background-color: rgba(0, 0, 0, 0.25);
		color: #fff;
	}
	.noti_message_item.warning .noti_message_item_close_btn:hover,
	.noti_message_item.success .noti_message_item_close_btn:hover,
	.noti_message_item.danger .noti_message_item_close_btn:hover {
		background-color: rgba(0, 0, 0, 0.35);
		color: #fff;
	}
	.noti_message_item_img_wrapper {
		width: 50px;
		flex-shrink: 0;
		margin-right: 10px;
	}
	.noti_message_item_img {
		width: 100%;
		object-fit: cover;
	}
	.noti_message_item_wrapper.overlap .noti_message_item:before {
		content: '';
		position: absolute;
		top: 6px;
		left: 6px;
		z-index: -1;
		width: 100%;
		height: 100%;
		background: #fff;
		border-radius: 8px;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
	}
	.noti_message_item_wrapper.overlap.overlap_double .noti_message_item:after {
		content: '';
		position: absolute;
		top: 12px;
		left: 12px;
		z-index: -2;
		width: 100%;
		height: 100%;
		background: #fff;
		border-radius: 8px;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
	}
	.noti_message_item_overdue_task_desc {
		display: -webkit-box;
		-webkit-box-orient: vertical;
		-webkit-line-clamp: 2;
		overflow: hidden;
		white-space: pre-wrap;
		font-size: 14px;
	}
	.noti-msg-list-enter-active {
		transition: all 0.3s;
	}
	.noti-msg-list-leave-active {
		transition: all 0.3s;
		position: absolute;
	}
	.noti-msg-list-enter,
	.noti-msg-list-leave-to {
		opacity: 0;
		transform: translateY(100px);
	}
	.noti_message_clear_all_btn.btn {
		margin-left: 15px;
		margin-top: -10px;
		padding-left: 12px;
		padding-right: 12px;
		opacity: 0.8;
		transition: 0.2s;
		pointer-events: auto;
		border-radius: 15px;
		font-weight: 500;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
	}
	.noti_message_clear_all_btn.btn.hidden {
		opacity: 0;
		pointer-events: none;
		display: none;
	}
	.avatar__online {
		position: absolute;
		background: #02ca37;
		border: 1px solid #b2fa57;
		border-radius: 50%;
		right: 0;
		bottom: 0;
	}
	.avatar {
		overflow: hidden;
		flex-shrink: 0;
	}
	.avatar_group {
		display: flex;
		align-items: center;
		flex-shrink: 0;
	}
	.avatar_group__item {
		margin-right: 3px;
	}
	.avatar_group__item:first-child {
		margin-right: 0;
	}
	.avatar_group__item_overlap:not(:nth-last-child(1)) {
		margin-left: -6px;
	}
	.avatar_group__item_overlap.avatar_group__item_overlap__24:not(:nth-last-child(1)) {
		margin-left: -10px;
	}
	.avatar_group__items {
		display: flex;
		flex-direction: row-reverse;
		align-items: center;
	}
	.avatar_group__item img {
		height: 50px;
	}
	.avatar_group__item_collapse {
		height: 50px;
		width: 50px;
		margin-left: 3px;
		text-align: center;
		line-height: 50px;
		border: 1px dashed #bbb;
		box-sizing: border-box;
		border-radius: 3px;
		box-shadow: 3px 0px 0px #ffffff;
	}
	.avatar_group__item_collapse__20 {
		font-size: 10px;
	}
	.avatar_group__item_collapse__16 {
		font-size: 8px;
	}
	.user_avatar_blur {
		filter: grayscale(1);
	}
	.loading {
		flex: 1;
		align-items: center;
		justify-content: center;
		display: flex;
		flex-direction: column;
	}
	.cursor-loading-overlay {
		position: fixed;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		opacity: 0;
		z-index: 999999;
		cursor: wait;
	}
	.loading-wrapper {
		position: absolute;
		top: 0;
		left: 0;
		right: 0;
		bottom: 0;
		z-index: 10;
		background-color: rgba(255, 255, 255, 0.5);
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.input_search {
		position: relative;
		display: flex;
		align-items: center;
	}
	.input_search__icon_search {
		position: absolute;
		left: 10px;
		margin-top: -2px;
		color: #6c757d;
	}
	.input_search__icon_close {
		position: absolute;
		right: 10px;
		cursor: pointer;
		width: 16px;
		height: 16px;
		padding: 2px;
		background: #dee2e6;
		stroke: #fff;
		border-radius: 50%;
		stroke-width: 3px;
		transition: all 150ms ease-out;
	}
	.input_search__icon_close:hover {
		background: #adb5bd;
	}
	input.input_search__input {
		padding-left: 30px;
		padding-right: 30px;
	}
	input.input_search__input.input_search__input__active {
		border: solid 1px transparent;
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.input_search__icon_loading {
		position: absolute;
		right: 10px;
	}
	.tab {
		display: flex;
		border-bottom: 1px solid #dadce0;
		margin-bottom: 10px;
	}
	.tab.tab__right {
		justify-content: flex-end;
	}
	.tab.tab__light .tab__item {
		font-weight: normal;
	}
	.tab__item {
		display: flex;
		align-items: flex-end;
		position: relative;
		margin-bottom: -1px;
		padding: 10px 0 5px 0;
		cursor: pointer;
		user-select: none;
		margin-right: 20px;
		color: #6c757d;
		font-weight: 500;
	}
	.tab__item:hover {
		color: #343a40;
	}
	.tab__item:after {
		content: '';
		position: absolute;
		left: 50%;
		transform: translate(-50%, 0);
		bottom: 0;
		width: 50%;
		border-bottom: 1px solid #dadce0;
		transition: all ease 250ms;
	}
	.tab__item:last-child {
		margin-right: 0;
	}
	.tab__item.tab__item__lg {
		font-size: 18px;
	}
	.tab__item.tab__item__secondary {
		font-weight: 400;
	}
	.tab__item.tab__item__secondary.tab__item__active:after {
		border-bottom-color: #6c757d;
	}
	.tab__item.tab__item__active {
		color: #000;
	}
	.tab__item.tab__item__active:after {
		width: 100%;
		border-bottom: 2px solid #0d6efd;
		transition: width ease 150ms;
	}
	.live_container {
		display: flex;
		background: #f7f5f2;
		flex-direction: column;
		height: 100%;
		overflow: hidden;
	}
	.live_box {
		border-bottom: 1px solid #eeeeee;
		padding-bottom: 5px;
		margin-top: 15px;
	}
	.live_box__empty_body {
		display: flex;
		flex-direction: column;
		align-items: center;
		padding: 40px 0;
	}
	.live_box__header {
		margin-left: 15px;
		display: flex;
		align-items: center;
		margin-right: 15px;
		font-size: 17px;
		font-weight: 700;
	}
	.live_box_table {
		height: 100%;
		background: white;
		border-radius: 5px;
		padding-top: 15px;
		border: 1px solid #eeeeee;
		border-bottom: 1px solid #eeeeee;
		padding-bottom: 5px;
	}
	.live_box_table .live_box__header {
		border-bottom: 1px solid #eeeeee;
		margin: 0 10px;
		padding: 5px 10px;
		font-weight: 400;
	}
	.live_box__row {
		margin: 0 20px;
		padding: 10px 0;
		display: flex;
		justify-content: space-between;
		border-bottom: 1px solid #eeeeee;
		align-items: center;
	}
	.live_box__row:last-child {
		border-bottom: none;
	}
	.live_box__row.live_box__row__clickable {
		margin: 0 10px;
		padding: 10px;
		cursor: pointer;
	}
	.live_box__row.live_box__row__clickable:hover {
		background: whitesmoke;
	}
	.live_box__col {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		margin-left: 10px;
	}
	.live_box__col:first-child {
		margin-left: 0;
	}
	.live_view__row.live_view__row__hover {
		cursor: pointer;
	}
	.live_view__row.live_view__row__hover:hover {
		background: #e9ecef;
	}
	div.live_view__row.live_view__row__selected {
		background: #ced4da;
	}
	.live_view__row {
		display: flex;
		background: white;
		justify-content: space-between;
		border-bottom: 1px solid #eeeeee;
		align-items: center;
	}
	.live_view__header {
		display: flex;
		background: white;
		justify-content: space-between;
		border-bottom: 1px solid #e5e5e5;
		text-transform: uppercase;
		font-size: 14px;
		font-weight: 500;
		border-top: 1px solid #dfdfdf;
		align-items: center;
	}
	.live_view__col {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		padding-left: 10px;
		margin-top: 10px;
		margin-bottom: 10px;
		width: 30px;
		min-width: 20px;
	}
	.live_view__col.live_view__col__fullname {
		display: flex;
		width: 120px;
		align-items: center;
	}
	.live_view__col.live_view__col__device {
		display: flex;
		width: 100px;
		align-items: center;
	}
	.live_view__col.live_view__col__url {
		flex: 1;
	}
	.live_view__col.live_view__col__ip {
		cursor: default;
		width: 190px;
		align-items: center;
	}
	.live_view__col.live_view__col__location {
		width: 170px;
		align-items: center;
	}
	.live_view__col.live_view__col__source {
		display: flex;
		width: 160px;
		gap: 8px;
		align-items: center;
	}
	.live_view__col.live_view__col__action {
		cursor: default;
		width: 168px;
		align-items: center;
	}
	.live_view__owner_avatar {
		display: flex;
		width: 28px;
		flex-shrink: 0;
		align-items: center;
	}
	.live_view__hello_button {
		flex-shrink: 0;
	}
	/*
  border: 1px solid #D8D8D8;
  		background: #fff;
  		box-shadow: 0px 4px 16px rgba(0, 0, 0, 0.1);
  */
	td.live_dropdown_container {
		position: relative;
		overflow: unset;
	}
	.live_dropdown {
		position: absolute;
		min-width: 200px;
		max-width: 100%;
		overflow: hidden;
		z-index: 2;
		top: 100%;
		right: 0;
		box-shadow: 0px 4px 16px rgba(0, 0, 0, 0.1);
		border-radius: 8px;
		border-top-right-radius: 0;
	}
	.live_dropdown.live_dropdown__viewing {
		width: 100%;
	}
	.live_dropdown__item {
		font-weight: normal;
		padding: 5px 10px;
		display: block;
		align-items: center;
		cursor: pointer;
		background: #fff;
		position: relative;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.live_dropdown__item:first-child {
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
		padding-top: 6px;
	}
	.live_dropdown__item:last-child {
		border-bottom-left-radius: 8px;
		border-bottom-right-radius: 8px;
		padding-bottom: 6px;
	}
	.live_dropdown__item:hover {
		color: white;
		background: #0d6efd;
	}
	.live_dropdown__item:hover .convo_header__dropdown_icon {
		color: white;
	}
	.live_dropdown__item.live_dropdown__item__no_select:hover {
		color: unset;
		background: #fff;
	}
	.live_dropdown__item.live_dropdown__item__viewing {
		display: flex;
	}
	.live_dropdown__item__loading {
		position: absolute;
		top: 15px;
		right: 20px;
	}
	.live_filter__button_x {
		color: #adb5bd;
		stroke: #adb5bd;
		cursor: pointer;
	}
	.live_filter__button_x:hover {
		stroke: #000;
		color: #000;
	}
	.live_filter__header {
		color: #495057;
		display: flex;
		align-items: center;
		font-weight: 500;
	}
	.live_filter__header.live_filter__header__clickable {
		cursor: pointer;
	}
	.live_filter__header.live_filter__header__clickable:hover {
		color: #000;
	}
	.live_view__user_name {
		color: #000;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.live_view__user_email {
		color: #6c757d;
		font-size: smaller;
	}
	.live_filter__viewing_filter_text {
		color: #0d6efd;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		max-width: 150px;
	}
	.live_filter__orderby {
		display: flex;
		position: relative;
		cursor: pointer;
		align-items: center;
		color: #6c757d;
		stroke: #6c757d;
	}
	.live_filter__orderby:hover {
		color: #000;
		stroke: #000;
	}
	.live_view__empty {
		display: block;
		margin: 40px auto;
	}
	.live_view__loading {
		padding-top: 40px;
	}
	.live_view__table {
		width: 100%;
	}
	.live_view__viewing_url {
		color: #6c757d;
		font-size: 14px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.live_view__viewing_url:hover {
		color: #000;
	}
	.live_view__viewing_title {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.live_number__total {
		font-size: 48px;
		color: #19b600;
		font-weight: 600;
		padding: 10px;
	}
	.live_view__result_count {
		align-items: center;
		display: flex;
	}
	.live_view__order_by {
		align-items: center;
		display: flex;
	}
	.live_view__user_online {
		flex-shrink: 0;
		display: inline-block;
		align-items: center;
		color: #00a808;
		text-transform: lowercase;
	}
	.live_view__upgrade {
		display: flex;
		align-items: center;
		background: linear-gradient(5.28deg, #f98006 34.25%, #fa681f 65.75%);
		height: 60px;
		color: #fff;
		justify-content: center;
	}
	.live_line {
		padding: 3px 15px;
	}
	.live_line .live_line__progress {
		display: flex;
		align-items: center;
		flex-shrink: 0;
		flex-wrap: nowrap;
	}
	.live_line .live_line__action {
		overflow: hidden;
		display: none;
	}
	.live_line:hover {
		background: whitesmoke;
	}
	.live_line:hover .live_line__progress {
		display: none;
	}
	.live_line:hover .live_line__action {
		display: flex;
		align-items: center;
		flex-shrink: 0;
		flex-wrap: nowrap;
	}
	.live_sidebar {
		border-top: 1px solid #dfdfdf;
		border-right: 1px solid #dfdfdf;
		height: 100%;
		display: flex;
		flex-direction: column;
		max-width: 350px;
		background: white;
		overflow-y: hidden;
		flex: 1;
	}
	.live_sidebar.live_sidebar__disabled {
		filter: grayscale(1);
	}
	.live_progress {
		background: gray;
		height: 100%;
		width: 0px;
		transition: width 2s linear;
	}
	.live_line_title {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		font-size: 15px;
		margin-right: 10px;
		margin-top: 2px;
		margin-bottom: 2px;
		cursor: pointer;
	}
	.live_list-move,
	.live_list-enter-active,
	.live_list-leave-active {
		transition: all 0.5s ease;
	}
	.live_list-enter-from,
	.live_list-leave-to {
		opacity: 0;
		transform: translateX(30px);
	}
	.live_view__col:hover .live_hidden_icon {
		visibility: visible;
	}
	.live_view__col .live_hidden_icon {
		visibility: hidden;
	}
	.live_view__row.live_view__row__active {
		background: #fafffa;
	}
	.live_view__row.live_view__row__inactive {
		background: whitesmoke;
	}
	.report_number_metrics {
		display: flex;
	}
	.report_number_metric {
		margin-right: 40px;
	}
	.report_number_metric:last-child {
		margin-right: 0;
	}
	.report_number_metric__label {
		border-bottom: 2px solid #e9ecef;
		width: fit-content;
	}
	.report_number_metric__number {
		font-size: 30px;
		display: flex;
		align-items: center;
		font-weight: 400;
	}
	.report_number_metric__trend {
		font-size: 14px;
		margin-left: 10px;
		font-weight: normal;
	}
	.report_number_metric__trend.report_number_metric__trend__up {
		color: #19b600;
	}
	.report_number_metric__trend.report_number_metric__trend__down {
		color: #ea3d2f;
	}
	.report_number_metric__trend.report_number_metric__success {
		color: #19b600;
	}
	.report_number_metric__trend.report_number_metric__failure {
		color: #ea3d2f;
	}
	.report_user_table__row {
		display: flex;
		border-left: 1px solid #e9ecef;
		border-right: 1px solid #e9ecef;
		border-top: 1px solid #e9ecef;
		align-items: center;
		padding: 5px 10px;
	}
	.report_user_table__row:first-child {
		background: #e9ecef;
		font-weight: 500;
		border-top-left-radius: 5px;
		border-top-right-radius: 5px;
	}
	.report_user_table__row:first-child .report_user_table__channel_number {
		font-size: 15px;
	}
	.report_user_table__row:last-child {
		border-bottom-left-radius: 5px;
		border-bottom-right-radius: 5px;
		border-bottom: 1px solid #e9ecef;
	}
	.report_user_table__channel_name {
		display: flex;
		align-items: center;
		flex-shink: 0;
	}
	.report_user_table {
		border-radius: 4px;
		flex: 1;
		min-width: 300px;
	}
	.report_user_table__channel_numbers {
		flex: 1;
		justify-content: flex-end;
		display: flex;
	}
	.report_user_table__channel_number {
		width: 135px;
		display: flex;
		margin-left: 20px;
		align-items: center;
		font-size: 16px;
	}
	.report__section {
		display: flex;
		margin-top: 20px;
	}
	.report_user_filters {
		display: flex;
	}
	.report_user_filter {
		margin-right: 30px;
		min-width: 200px;
	}
	.report__label {
		font-size: 20px;
		margin-bottom: 10px;
		margin-top: 20px;
	}
	.report__main {
		padding: 20px;
	}
	.report__channel_source {
		display: flex;
		position: relative;
		align-items: center;
		margin-right: 20px;
	}
	.report__channel_source_img {
		width: 20px;
		height: 20px;
		display: block;
		border-radius: 4px;
		margin-right: 5px;
	}
	.report__channel_source_type_img {
		position: absolute;
		width: 16px;
		height: 16px;
		border: 2px solid #fff;
		border-radius: 50%;
		bottom: -4px;
		right: -2px;
	}
	.report_user_wrapper {
		flex: 1;
		margin-right: 40px;
		position: relative;
	}
	.report_user_wrapper:last-child {
		margin-right: 0;
	}
	@media only screen and (max-width: 1280px) {
		.report_user_wrapper {
			width: 100%;
			margin-right: 0;
			margin-bottom: 20px;
			flex: unset;
		}
		.report_user_wrapper:last-child {
			margin-bottom: 0;
		}
		.report__section_tables {
			flex-wrap: wrap;
		}
	}
	.subiz_print_logo {
		display: none;
		opacity: 0.8;
		width: 80px;
		margin-bottom: 10px;
	}
	@media only print {
		body,
		.root,
		.root__body,
		.root_content,
		.root_content_inner,
		.main,
		.setting,
		.setting__main {
			overflow: visible !important;
		}
		@page {
			size: portrait;
		}
		.subiz_print_logo {
			display: block;
			margin-left: 20px;
		}
		.header_bar {
			display: none;
		}
		.global_email_button {
			display: none;
		}
		.global_help_button {
			display: none;
		}
		.global_call_button {
			display: none;
		}
		.root__header {
			display: none;
		}
		.report__main {
			width: 100%;
		}
		.sidebar {
			display: none !important;
		}
		.recent_users {
			display: none !important;
			border: none !important;
		}
		.sidebar_setting {
			display: none !important;
		}
		.report_user_wrapper {
			width: 100%;
			margin-right: 0;
			margin-bottom: 20px;
			flex: unset;
		}
		.report_user_wrapper:last-child {
			margin-bottom: 0;
		}
		.report__section_tables {
			flex-wrap: wrap;
		}
	}
	.report_user_table__channel_number_detail {
		margin-left: 10px;
		opacity: 0;
		transition: 0.2s;
	}
	.report_user_table__row:hover .report_user_table__channel_number_detail {
		opacity: 1;
	}
	.report_user_table__row:not(:first-child):hover {
		background-color: #f8f9fa;
	}
	.report_agent_table {
		width: 100%;
		overflow: auto;
		border-radius: 5px;
		border: 1px solid #dee2e6;
	}
	.report_agent_table_row {
		display: flex;
		border-bottom: none;
		width: fit-content;
		min-width: 100%;
	}
	.report_agent_table_row:first-child .report_agent_table_cell {
		background-color: #e9ecef;
		font-weight: 500;
		border-top: none;
	}
	.report_agent_table_row:not(:first-child):hover .report_agent_table_cell {
		background-color: #f8f9fa;
	}
	.report_agent_table_cell {
		background-color: #fff;
		padding: 5px 10px;
		display: flex;
		align-items: center;
		flex-shrink: 0;
		border-top: 1px solid #dee2e6;
		overflow: hidden;
	}
	.report_agent_table_sales_col {
		width: 105px;
	}
	.report_agent_table_order_col {
		width: 105px;
	}
	.report_agent_table_agent_col {
		width: 180px;
		position: sticky;
		left: 0;
		z-index: 9;
	}
	.report_agent_table_agent_col:after {
		position: absolute;
		top: 0;
		right: 5px;
		bottom: -1px;
		width: 5px;
		transform: translate(100%);
		transition: box-shadow 0.3s;
		content: '';
		pointer-events: none;
	}
	.report_agent_table_agent_col.blur:after {
		box-shadow: inset 5px 0 4px -4px rgba(0, 0, 0, 0.1);
	}
	.report_agent_table_great_convo_col {
		flex: 1;
		min-width: 215px;
	}
	.report_agent_table_first_reply_col {
		flex: 1;
		min-width: 230px;
	}
	.report_agent_table_messages_col {
		flex: 1;
		min-width: 100px;
	}
	.report_agent_table_replied_convo_col {
		flex: 1;
		min-width: 165px;
	}
	.report_agent_table_duration_col {
		flex: 1;
		min-width: 180px;
	}
	.report_user_table_product_image {
		width: 24px;
		height: 24px;
		border-radius: 5px;
	}
	.report_new_wrapper {
		width: 100%;
		height: 100%;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		border-right: 1px solid #cecece;
	}
	.report_new_wrapper .report_new_header {
		background-color: #fff;
		border-bottom: solid 1px #cecece;
		flex-shrink: 0;
		padding: 10px 20px;
		z-index: 10;
	}
	.report_new_wrapper .report_new_header .date_filter {
		width: 500px;
		display: flex;
		flex-wrap: nowrap;
		justify-content: space-between;
	}
	.report_new_wrapper .report_new_header .date_filter button {
		width: 80px;
	}
	.report_new_wrapper .report_new_body {
		background-color: #fff;
		height: fit-content;
		overflow: auto;
		padding-top: 15px;
	}
	.report_new_wrapper .report_new_body .report_new_session {
		width: 830px;
		margin: auto;
		padding: 0 20px 60px 20px;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_session_header {
		margin-bottom: 20px;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_session_header .header_title {
		font-size: 24px;
		font-weight: 700;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_session_header .filter {
		display: flex;
		background-color: rgba(168, 203, 254, 0.35);
		padding: 2px 5px;
		border-radius: 3px;
		width: fit-content;
		max-width: 400px;
		align-items: center;
		justify-content: space-between;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_session_metric .report_number {
		font-size: 30px;
		font-weight: 500;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_counter {
		border-collapse: collapse;
		vertical-align: text-top;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_counter .report_new_counter_item {
		width: 50%;
		padding: 10px 15px;
		border: solid 1px #cecece;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.report_new_counter_label {
		font-size: 18px;
		font-weight: 500;
		line-height: 24px;
		margin-top: 5px;
		margin-bottom: 15px;
		display: flex;
		justify-content: space-between;
	}
	.report_new_wrapper .report_new_body .report_new_session .report_new_counter .report_new_counter_item .counter_item {
		justify-content: space-between;
		align-items: center;
		margin: 10px 0;
		width: 360px;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.item_label {
		width: 170px;
		margin-right: 5px;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.item_qty {
		color: #0265ff;
		margin-right: 10px;
		width: 50px;
		font-weight: 400;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.report-actions {
		flex: 1;
		display: none;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.report-actions
		.btn__sm,
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.report-actions
		.btn__switch_sm
		> .btn,
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item
		.report-actions
		.btn__group_sm
		> .btn {
		width: 24px;
		height: 24px;
		padding: 0;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item:hover
		.report-actions {
		display: flex;
		justify-content: space-around;
	}
	.report_new_wrapper
		.report_new_body
		.report_new_session
		.report_new_counter
		.report_new_counter_item
		.counter_item:hover
		.hide {
		display: none;
	}
	.ticket_report_box {
		border: 1px solid #dee2e6;
		padding: 12px 20px;
		margin-right: 30px;
		margin-bottom: 30px;
		position: relative;
		width: calc(50% - 15px);
	}
	.ticket_report_box:nth-child(2) {
		margin-right: 0;
	}
	.ticket_report_box_row {
		display: flex;
		align-items: center;
		margin-bottom: 8px;
	}
	.ticket_report_box_row:last-child {
		margin-bottom: 0;
	}
	.search__item {
		user-select: none;
		flex-shrink: 0;
		width: 100%;
		cursor: pointer;
		display: flex;
		align-items: center;
		overflow: hidden;
		border-radius: 4px;
		padding: 6px 10px;
		overflow: hidden;
		word-break: break-all;
		white-space: nowrap;
		text-overflow: ellipsis;
	}
	.search__item:hover {
		background: #eee;
	}
	.search__item.search__item__active {
		background: #eee8ff;
	}
	.search__item.search__item__suggestion:hover {
		color: #0d6efd;
	}
	.search__item.search__item__suggestion:hover .suggestion_prefix,
	.search__item.search__item__suggestion:hover .suggestion_suffix {
		color: #0d6efd;
	}
	.suggestion_icon {
		padding-left: 5px;
		padding-top: 1px;
		background: #e0e0e0;
		border-radius: 50%;
		margin-right: 10px;
		width: 26px;
		height: 26px;
		color: #333;
	}
	.suggestion_prefix {
		font-weight: 500;
	}
	.search__user_info {
		font-size: 14px;
		overflow: hidden;
		word-break: break-all;
		white-space: nowrap;
		text-overflow: ellipsis;
	}
	.search__user_username {
		font-size: 15px;
		overflow: hidden;
		display: flex;
	}
	.search__body {
		padding: 10px;
		position: relative;
		display: flex;
		flex-direction: column;
		flex: 1;
		overflow: auto;
		height: 100%;
		max-height: 500px;
		min-height: 250px;
	}
	.search__highlight {
		background: #ffc107;
		color: #000;
	}
	.search__convo_text {
		overflow: hidden;
	}
	.search__loading {
		position: absolute;
		inset: 0;
		z-index: 2;
		display: flex;
		align-items: center;
		justify-content: center;
		background: rgba(0, 0, 0, 0.0392156863);
	}
	.search__convo_avatar {
		display: block;
		position: relative;
	}
	.search__convo_channel {
		width: 16px;
		height: 16px;
		position: absolute;
		bottom: 0px;
		right: -5px;
		background: #fff;
		border-radius: 50%;
		z-index: 2;
		display: flex;
		justify-content: center;
		align-items: center;
	}
	.search__convos_channel_img {
		width: 12px;
		height: 12px;
	}
	.search_modal.search_modal__show {
		opacity: 1;
		visibility: visible;
		color: #212529;
	}
	.search_count {
		display: inline-block;
		padding: 3px 6px;
		font-size: 0.9em;
		font-weight: 500;
		line-height: 1;
		text-align: center;
		white-space: nowrap;
		vertical-align: baseline;
		border-radius: 5px;
		background-color: #f2f2f2;
		margin-left: 6px;
		color: #929292;
	}
	.search_modal {
		opacity: 0;
		visibility: hidden;
		overflow: hidden;
		position: absolute;
		top: 43px;
		left: 0px;
		z-index: 110;
		overflow: hidden;
		width: 420px;
		outline: 0;
		align-items: center;
		justify-content: center;
		box-shadow:
			rgba(0, 0, 0, 0.1) -1px 5px 8px,
			rgba(0, 0, 0, 0.1) 7px 17px 16px,
			rgba(0, 0, 0, 0.12) 4px 33px 32px;
		border-radius: 15px;
		border-top-left-radius: 0;
		border-top-right-radius: 0;
		background: #fff;
		border-right: 1px solid #d5d5d5;
		transition: all 150ms ease-out;
	}
	.search_modal_search_icon {
		z-index: 113;
		position: absolute;
		color: rgba(255, 255, 255, 0.5333333333);
		left: 20px;
		top: 18px;
	}
	.header_bar_search_input_container {
		align-self: center;
		position: relative;
		width: 100%;
		margin-right: 15px;
		transition: width 100ms ease-out;
		padding: 10px;
	}
	.header_bar_search_input_container.header_bar_search_input_container__long .search_modal_clear_btn {
		display: flex;
	}
	.header_bar_search_input_container.header_bar_search_input_container__long .search_modal_search_icon {
		color: #000;
	}
	.form-control.header_bar_search_input {
		background: rgba(255, 255, 255, 0.1294117647);
		z-index: 112;
		width: 100%;
		position: relative;
		padding-left: 38px;
		height: 32px;
		min-height: 32px;
	}
	.form-control.header_bar_search_input:active,
	.form-control.header_bar_search_input:focus,
	.form-control.header_bar_search_input:hover {
		background: rgba(255, 255, 255, 0.2);
	}
	.search_modal_clear_btn {
		display: none;
		z-index: 113;
		position: absolute;
		color: #888;
		right: 12px;
		top: 12px;
		border-radius: 50%;
		background: transparent;
		cursor: pointer;
		padding: 5px;
		transition: all 150ms ease-out;
		align-items: center;
		justify-content: center;
	}
	.search_modal_clear_btn:hover {
		color: #000;
	}
	.detail_rule__trigger_desc {
		align-items: center;
		color: #6c757d;
	}
	.form-label {
		margin-top: 10px;
		margin-bottom: 5px;
		font-size: 15px;
		display: block;
	}
	.campaign-design--button-action.campaign-design--button-action--error {
		border: 1px solid #ff3f1d;
		color: #ff3f1d;
	}
	.campaign-design--url-open-url-url {
		vertical-align: text-bottom;
		display: inline-block;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.campaign-design--button-action {
		display: flex;
		align-items: center;
		padding: 5px 10px;
		background: white;
		border: 2px solid transparent;
		cursor: pointer;
		position: relative;
		background: #fff8e3;
		margin-right: 5px;
		margin-bottom: 5px;
		max-width: 100%;
	}
	.campaign-design--button-action-open-url {
		display: inline-block;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.campaign-design--url-open-url {
		white-space: nowrap;
		margin-right: 5px;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.campaign-design--button-action.campaign-design---add-action-button {
		border-style: dashed;
		border-width: 2px;
		cursor: pointer;
		display: inline-block;
		position: relative;
		user-select: none;
		padding: 5px;
	}
	.campaign-design--button-action.campaign-design---add-action-button:hover {
		border-color: #495057;
	}
	.campaign-design---button-actions {
		position: relative;
		display: flex;
		flex-wrap: wrap;
		max-width: 262px;
	}
	.campaign-design--url-edit--hide {
		display: none;
	}
	.campaign-design--url-edit {
		position: absolute;
		bottom: -40px;
		left: 0px;
		width: 268px;
		padding: 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		transform: translateY(-4px);
		user-select: none;
		background-color: #fff;
		border-radius: 7px;
		z-index: 10;
	}
	.campaign-design--url-edit-button {
		margin-top: 12px;
	}
	/* ========== Campaign Design Color Picker ======= */
	.campaign-design-color-picker {
		display: inline-block;
		vertical-align: bottom;
		margin-left: 5px;
		position: relative;
		float: right;
	}
	.campaign-design-color-picker__picker {
		position: absolute !important;
		z-index: 10;
		top: 20px;
		right: 0px;
	}
	.campaign-design-color-picker__picker--hide {
		display: none;
	}
	/* ==================== SECTION ============ */
	.campaign_target__remove_condition_btn {
		cursor: pointer;
		stroke: #6c757d;
		outline: none;
	}
	.campaign_target__remove_condition_btn:hover {
		stroke: #000;
	}
	.campaign_type_radio {
		width: 330px;
		margin-right: 20px;
		margin-bottom: 20px;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		display: flex;
		cursor: pointer;
		padding: 12px 15px;
	}
	.campaign_type_radio.active {
		border-color: #0d6efd;
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.campaign_type_radio:nth-child(2n) {
		margin-right: 0;
	}
	.campaign_type_radio_img {
		width: 32px;
		height: 32px;
		object-fit: cover;
	}
	.campaign_item_row {
		height: 55px;
	}
	.campaign_edit_design {
		display: flex;
		overflow: hidden;
		width: 100%;
		height: 100%;
		position: relative;
	}
	.campaign_edit_design_messages {
		flex: 1;
		padding-top: 30px;
		padding-bottom: 30px;
		display: flex;
		justify-content: center;
		background-color: #f5f5f5;
		overflow-y: auto;
		position: relative;
	}
	.campaign_edit_design_message_box.campaign_edit_design_message_box__real {
		background-color: #fff;
		border-style: solid;
		margin-bottom: 0;
	}
	.campaign_edit_design_message_box_header {
		padding: 8px 20px;
		display: flex;
		align-items: center;
		border-bottom: 1px solid #dee2e6;
	}
	.campaign_edit_design_message_box_content {
		padding: 10px 20px;
	}
	.campaign_edit_design_message_box_seperator_line_text {
		position: absolute;
		top: 50%;
		left: calc(50% + 10px);
		transform: translateY(-50%);
		display: flex;
		align-items: center;
	}
	.campaign_edit_design_message_box_seperator {
		height: 48px;
		position: relative;
		width: 100%;
		display: flex;
		flex-direction: column;
		align-items: center;
	}
	.campaign_edit_design_message_box_seperator.has_content {
		height: 60px;
	}
	.campaign_edit_design_message_box_seperator_box {
		padding: 2px 10px;
		border-radius: 9999px;
		background-color: #fff;
	}
	.campaign_edit_design_message_box_seperator_line {
		margin-top: 5px;
		margin-bottom: 5px;
		flex: 1;
		width: 2px;
		background-color: #d4d4d4;
	}
	.campaign_edit_design_message_box {
		width: 320px;
		border-radius: 8px;
		position: relative;
		border: 1px dashed #dee2e6;
		background: rgb(236, 236, 236);
		cursor: pointer;
		margin-bottom: 20px;
		transition: all 150ms ease-out;
	}
	.campaign_edit_design_message_box:hover {
		border-color: #888;
		background-color: white;
	}
	.campaign_edit_design_message_box.active {
		border-width: 1px;
		border-style: solid;
		background-color: #fff;
		border-color: #0d6efd;
		box-shadow: 0 0 8px #0d6efd;
	}
	.campaign_edit_design_sidebar {
		width: 540px;
		display: flex;
		flex-direction: column;
		height: 100%;
		overflow: hidden;
		flex-shrink: 0;
		border-left: 1px solid #dee2e6;
	}
	.campaign_edit_design_sidebar_header {
		padding: 12px 20px;
		height: 56px;
		border-bottom: 1px solid #dee2e6;
		align-items: center;
		display: flex;
	}
	.campaign_edit_design_sidebar_content {
		flex: 1;
		overflow: auto;
		padding: 12px 20px;
	}
	.campaign_edit_design_sidebar_content .message_editor.message_editor__html .message_editor__input.ql-container {
		max-height: unset;
		height: unset;
		min-height: unset;
		flex: 1;
		overflow: hidden;
	}
	.campaign_edit_design_sidebar_footer {
		padding: 12px 20px;
		border-top: 1px solid #dee2e6;
		align-items: center;
		display: flex;
	}
	.campaign_edit_design_sidebar_channel_radio {
		border-radius: 8px;
		border: 1px solid #dee2e6;
		padding: 10px 15px;
		padding-left: 11px;
		margin-bottom: 15px;
		cursor: pointer;
	}
	.campaign_edit_design_sidebar_channel_radio.active {
		border-color: #0d6efd;
		box-shadow: 0 0 0 1px #0d6efd;
		opacity: 1;
	}
	.campaign_edit_design_sidebar_channel_radio.disabled {
		cursor: initial;
		opacity: 0.7;
	}
	.campaign_edit_design_sidebar_channel_radio.disabled .campaign_edit_design_sidebar_channel_radio_img {
		filter: grayscale(1);
	}
	.campaign_design_timming_week_days .form-check-inline {
		width: 120px;
	}
	.campaign_design_timming_week_days .form-check-inline:nth-child(3n) {
		margin-right: 0;
	}
	.campaign_edit_design_sidebar_channel_radio_img_wrapper {
		width: 32px;
		flex-shrink: 0;
		display: flex;
		justify-content: center;
	}
	.campaign_edit_design_sidebar_channel_radio_img {
		width: 24px;
		align-self: flex-start;
	}
	.campaign_segment_body {
		display: flex;
		flex: 1;
		overflow: hidden;
		width: 100%;
		height: 100%;
	}
	.campaign_segment_section {
		margin-bottom: 20px;
	}
	.campaign_segment_cout {
		margin-left: 40px;
		padding: 25px;
		width: 250px;
		height: 290px;
		background: #ffffff;
		border: 1px solid #e4e4e4;
		border-radius: 5px;
	}
	.option_select_user_campaign {
		width: 530px;
		height: 70px;
		flex-direction: row;
		justify-content: center;
		align-items: center;
		background: #ffffff;
		border: 1px solid #e2e2e2;
		border-radius: 6px;
		padding: 0 20px;
		margin-bottom: 15px;
	}
	.option_select_user_campaign:hover {
		cursor: pointer;
		border: 1px solid #0d6efd;
	}
	.option_select_user_campaign:last-child {
		margin-bottom: 0;
	}
	.campaign_edit_report {
		flex: 1;
		height: 100%;
		overflow: hidden;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.campaign_edit_report_tab {
		padding-left: 20px;
		padding-right: 20px;
		flex-shrink: 0;
		align-items: center;
		display: flex;
	}
	.campaign_edit_report_tab.tab {
		margin-bottom: 0;
	}
	.campaign_edit_report_container {
		padding: 20px;
		overflow-y: auto;
		overflow-x: hidden;
		flex: 1;
		background-color: #fafafa;
	}
	.campaign_edit_report_left {
		flex: 8;
		overflow: hidden;
		margin-right: 20px;
	}
	.campaign_edit_report_right {
		flex: 3;
		overflow: hidden;
	}
	.campaign_report_card {
		border-radius: 8px;
		border: 1px solid #dee2e6;
		background-color: #fff;
	}
	.campaign_report_card_header {
		padding: 8px 15px;
		border-bottom: 1px solid #dee2e6;
		font-weight: 500;
	}
	.campaign_report_card_content {
		padding: 10px 15px;
	}
	.campaign_report_card_content_label {
		width: 140px;
		display: flex;
		align-items: center;
		flex-shrink: 0;
		margin-right: 15px;
	}
	.campaign_report_card_header_dot.dot {
		width: 16px;
		height: 16px;
		border-radius: 4px;
		margin-top: 0;
	}
	.campaign_report_error_message_row.item-row {
		border-bottom: none;
		border-top: 1px solid #dee2e6;
	}
	.campaign_report_error_message_row.item-row.item-row__header {
		border-bottom: 1px solid #dee2e6;
	}
	.campaign_report_error_message_row.item-row:not(.item-row__header) {
		cursor: pointer;
	}
	.campaign_report_error_message_row.item-row:not(.item-row__header):hover {
		background-color: #f8f9fa;
	}
	.telesale_campaign_modal_content {
		overflow: hidden;
		display: flex;
		height: 100%;
	}
	.telesale_campaign_modal_flow {
		flex: 1;
		overflow-y: auto;
		padding: 12px 20px;
	}
	.telesale_campaign_modal_flow_item {
		border: 2px dashed #dee2e6;
		margin-bottom: 10px;
		padding: 8px 15px;
		cursor: pointer;
		font-size: 14px;
		border-radius: 5px;
		position: relative;
	}
	.telesale_campaign_modal_flow_item.active {
		border-color: #0d6efd;
	}
	.telesale_campaign_modal_flow_item:last-child {
		margin-bottom: 0;
	}
	.telesale_campaign_modal_edit {
		padding: 12px 20px;
		width: 280px;
		border-left: 1px solid #dee2e6;
		flex-shrink: 0;
		overflow-y: auto;
	}
	.campaign_telesale_execute {
		padding: 20px;
		overflow: hidden;
		width: 100%;
		height: 100%;
		display: flex;
		flex-direction: column;
	}
	.campaign_telesale_execute_inner {
		flex: 1;
		display: flex;
		overflow: hidden;
	}
	.campaign_telesale_execute_list_entries_wrapper {
		flex-shrink: 0;
		width: 400px;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.campaign_telesale_execute_list_entries_wrapper.full {
		width: 100%;
	}
	.campaign_telesale_execute_list_entries {
		flex: 1;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		overflow: hidden;
		display: flex;
		background-color: #fff;
		flex-direction: column;
	}
	.campaign_telesale_execute_list_entries_header {
		flex-shrink: 0;
		padding: 0px 15px;
		padding-left: 0;
		border-bottom: 1px solid #dee2e6;
		display: flex;
	}
	.campaign_telesale_execute_list_entries_header .tab {
		margin-bottom: 0;
		border-bottom: none;
	}
	.campaign_telesale_execute_list_entries_header .tab__item {
		margin-right: 15px;
	}
	.campaign_telesale_execute_list_entries_header .tab__item:last-child {
		margin-right: 0;
	}
	.campaign_telesale_execute_list_entries_content {
		flex: 1;
		overflow-y: scroll;
		position: relative;
	}
	.campaign_telesale_execute_list_entries_footer {
		padding: 8px 15px;
		display: flex;
		align-items: center;
		flex-shrink: 0;
		border-top: 1px solid #dee2e6;
	}
	.campaign_telesale_call_entry_item {
		padding: 8px 15px;
		padding-left: 0;
		background-color: #fff;
		cursor: pointer;
		position: relative;
	}
	.campaign_telesale_call_entry_item.read {
		background-color: #eaeaea;
	}
	.campaign_telesale_call_entry_item.checked,
	.campaign_telesale_call_entry_item.read.checked {
		background-color: #b9d5ff;
	}
	.campaign_telesale_call_entry_item.active,
	.campaign_telesale_call_entry_item.read.active,
	.campaign_telesale_call_entry_item.checked.active {
		background-color: #0d6efd;
		border-color: #0d6efd;
		color: #fff;
		opacity: 1;
	}
	.campaign_telesale_call_entry_item.is_next_call {
		background-color: #eeffeb;
	}
	.campaign_telesale_call_entry_item.soft_selected:after {
		content: '';
		position: absolute;
		background-color: #0d6efd;
		left: 0;
		top: 0;
		bottom: 0;
		width: 6px;
	}
	.campaign_telesale_call_entry_item.item_calling {
		background-color: #19b600;
		color: #fff;
	}
	.campaign_telesale_call_entry_item.item_calling:after {
		z-index: -1;
	}
	.campaign_telesale_execute_entry_detail {
		flex: 1;
		overflow: hidden;
		display: flex;
	}
	.campaign_telesale_execute_entry_detail_header {
		flex-shrink: 0;
		display: flex;
		overflow: hidden;
		border-bottom: 1px solid #dee2e6;
	}
	.campaign_telesale_execute_entry_detail_user_header {
		display: flex;
		align-items: center;
		font-weight: 500;
		font-size: 18px;
		width: 361px;
		flex-shrink: 0;
		border-left: 1px solid #dee2e6;
		padding: 0 20px;
	}
	.campaign_telesale_execute_entry_detail_wrapper {
		flex: 1;
		overflow: hidden;
		margin-left: 20px;
		border: 1px solid #dee2e6;
		background-color: #fff;
		display: flex;
		flex-direction: column;
		border-radius: 8px;
		position: relative;
	}
	.campaign_telesale_call_entry_detail_form {
		display: flex;
		flex-direction: column;
		overflow: hidden;
		flex: 1;
	}
	.campaign_telesale_call_entry_detail_form_header {
		display: flex;
		align-items: center;
		padding: 10px 20px;
		flex: 1;
		overflow: hidden;
	}
	.campaign_telesale_call_entry_detail_form_footer {
		padding: 12px 20px;
		display: flex;
		align-items: center;
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.campaign_telesale_call_entry_detail_form_content {
		flex: 1;
		overflow: auto;
		padding: 15px 20px;
		position: relative;
	}
	.campaign_telesale_call_entry_detail_user {
		flex-shrink: 0;
		border-left: 1px solid #dee2e6;
		overflow-y: hidden;
		display: flex;
		flex-direction: column;
	}
	.campaign_telesale_call_entry_detail_user_header {
		padding: 12px 20px;
		border-bottom: 1px solid #dee2e6;
		flex-shrink: 0;
		height: 50px;
	}
	.campaign_item {
		padding: 5px 10px;
		background-color: #f6f6f6;
		border: 1px solid #ededed;
		border-radius: 8px;
		margin-top: 10px;
		margin-bottom: 10px;
		margin-right: 10px;
		cursor: pointer;
	}
	.campaign_item:hover {
		border: 1px solid #bdbdbd;
	}
	.campaign_item__header {
		display: flex;
		overflow: hidden;
		align-items: center;
	}
	.campaign_design__loading_label {
		opacity: 0.6;
		position: absolute;
		bottom: 20px;
		left: 20px;
		display: flex;
		align-items: center;
		padding: 5px 10px;
		color: white;
		background: rgba(0, 0, 0, 0.5333333333);
		border-radius: 8px;
	}
	.campaign_design__nuser {
		display: flex;
		align-items: center;
		margin-top: 5px;
		position: absolute;
		top: 6px;
		right: 20px;
	}

	.broadcast_import_type_radio {
		width: 600px;
		padding: 20px 40px;
		display: flex;
		align-items: center;
		cursor: pointer;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		background-color: #fff;
		margin-bottom: 30px;
		transition: 0.15s;
	}
	.broadcast_import_type_radio:last-child {
		margin-bottom: 0;
	}
	.broadcast_import_type_radio:hover {
		background-color: #fafafa;
		border-color: #888;
	}
	.survey_result_item_container {
		width: 360px;
		margin-right: 30px;
		margin-bottom: 30px;
		overflow: hidden;
	}
	.survey_result_item_container:nth-child(3n) {
		margin-right: 0;
	}
	.telesale_field_design_box {
		position: relative;
		border: 1px dashed #dee2e6;
		border-left: 0;
		border-right: 0;
		background: #fff;
		cursor: pointer;
		transition: all 150ms ease-out;
	}
	.telesale_field_design_box:after {
		content: '';
		position: absolute;
		top: -1px;
		left: 0;
		bottom: -1px;
		width: 0px;
		z-index: 1;
		background-color: #0d6efd;
		transition: all 150ms ease-out;
	}
	.telesale_field_design_box:hover {
		border-color: #888;
		background-color: #fff;
	}
	.telesale_field_design_box.active:after {
		width: 5px;
	}
	.campaign_telesale_execute_wrapper {
		display: flex;
		width: 100%;
		height: 100%;
		overflow: hidden;
		position: relative;
		background-color: #fafafa;
	}
	.my_activities_grid {
		overflow: hidden;
		display: grid;
		grid-gap: 5px;
		grid-template-columns: repeat(10, 1fr) 30px;
	}
	.my_activities_grid_item {
		position: relative;
		padding-top: 100%;
	}
	.my_activities_grid_item_inner {
		border-radius: 4px;
		border: 1px solid #dee2e6;
		background-color: #ebedf0;
		position: absolute;
		inset: 0;
	}
	.my_activities_grid_item_inner.active {
		border-color: #495057;
	}
	.my_activities_grid_calendar_label {
		font-size: 12px;
		line-height: 1;
		display: flex;
		align-items: center;
		justify-content: flex-end;
	}
	.campaign_telesale_next_call_card {
		background-color: #fff;
		flex-shrink: 0;
	}
	.campaign_telesale_next_call_card_inner {
		padding: 12px 0;
		display: flex;
	}
	.campaign_telesale_next_call_card_section {
		padding: 0px 20px;
		border-right: 1px solid #e3e3e3;
	}
	.campaign_telesale_next_call_card_section:last-child {
		border-right: 0;
	}
	.campaign_telesale_next_call_card_section_title {
		font-size: 12px;
		font-weight: 500;
		text-transform: uppercase;
	}
	.campaign_telesale_next_call_card_section_value {
		font-size: 20px;
		font-weight: 500;
	}
	.telesale_script_field_box {
		padding: 10px 15px;
		border: 2px dashed #dee2e6;
		border-radius: 8px;
		margin-bottom: 10px;
		white-space: pre-wrap;
	}
	.telesale_script_field_box.disabled {
		border: 2px solid #f6f6f6;
		background-color: #f6f6f6;
	}
	.outbound_call__field {
		display: flex;
		margin: 5px 0;
		flex-direction: row;
		align-items: center;
		flex: 1 1 0;
	}
	.outbound_call__field_title {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		min-width: 110px;
		color: #777;
		margin-right: 10px;
		align-items: center;
		flex-shrink: 0;
		align-self: flex-start;
	}
	.outbound_call__field_content {
		align-items: center;
		flex-shrink: 0;
	}
	.campaign_telesale_execute_list_entries_row {
		display: flex;
		cursor: pointer;
	}
	.campaign_telesale_execute_list_entries_row.header {
		cursor: auto;
		font-size: 13px;
		color: #6c757d;
		text-transform: uppercase;
		font-weight: 500;
	}
	.campaign_telesale_execute_list_entries_row:not(.header):hover .campaign_telesale_execute_list_entries_cell {
		background-color: #f8f9fa;
	}
	.campaign_telesale_execute_list_entries_cell {
		padding: 8px 10px;
		border-bottom: 1px solid #dee2e6;
		flex-shrink: 0;
		overflow: hidden;
		flex-grow: 1;
		overflow: hidden;
		width: 150px;
	}
	.campaign_telesale_execute_list_entries_cell.entry_customer {
		width: 200px;
		max-width: 200px;
		padding-left: 5px;
	}
	.campaign_telesale_execute_list_entries_cell.entry_calls_count {
		width: 100px;
		max-width: 100px;
	}
	.campaign_telesale_execute_list_entries_cell.entry_recorded {
		width: 100px;
		max-width: 100px;
	}
	.campaign_telesale_execute_list_entries_cell.entry_duration {
		width: 110px;
		max-width: 110px;
	}
	.campaign_telesale_execute_list_entries_cell.entry_cb {
		width: 40px;
		max-width: 40px;
		padding-left: 15px;
		display: flex;
		align-items: center;
	}
	.campaign_telesale_execute_list_entries_cell.entry_cb input[type='checkbox'] {
		margin: 0;
	}
	.campaign_telesale_entry_checkbox_wrapper {
		width: 45px;
		display: flex;
		align-items: center;
		cursor: pointer;
		padding-left: 15px;
	}
	.campaign_telesale_entry_checkbox_wrapper input[type='checkbox'] {
		margin: 0;
	}
	.call_entry_item_status_wrapper {
		flex-shrink: 0;
	}
	.call_entry_item_actions_wrapper {
		display: none;
		align-items: center;
		flex-shrink: 0;
	}
	.campaign_telesale_call_entry_item:hover .call_entry_item_status_wrapper {
		display: none;
	}
	.campaign_telesale_call_entry_item:hover .call_entry_item_actions_wrapper {
		display: flex;
	}
	.campaign_telesale_call_entry_item.active .call_entry_item_actions_btn:hover {
		background-color: shade-color(#0d6efd, 4);
	}
	.call_entry_item_actions_btn {
		width: 28px;
		height: 28px;
		background-color: transparent;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 4px;
		cursor: pointer;
		margin-right: 5px;
	}
	.call_entry_item_actions_btn:last-child {
		margin-right: 0;
	}
	.call_entry_item_actions_btn:hover {
		background-color: #e9ecef;
	}
	.list_entries_filters {
		padding-top: 10px;
		padding-left: 15px;
		display: flex;
		flex-wrap: wrap;
		border-bottom: 1px solid #dee2e6;
	}
	a[href^='http'],
	a[href^='https'] {
		text-decoration: underline;
	}
	a[href^='https'].btn,
	a[href^='https'].action,
	a[href^='http'].btn,
	a[href^='http'].action {
		text-decoration: none;
	}
	.link,
	.message_event_action_link,
	.onboarding_row_ignore_link,
	.onboarding_row.done .onboarding_row_cta {
		cursor: pointer;
		color: #0d6efd;
		stroke: #0d6efd;
		text-decoration: underline;
	}
	.link:hover,
	.message_event_action_link:hover,
	.onboarding_row_ignore_link:hover,
	.onboarding_row.done .onboarding_row_cta:hover {
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
		stroke: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.link.action,
	.action.message_event_action_link,
	.action.onboarding_row_ignore_link,
	.onboarding_row.done .action.onboarding_row_cta {
		text-decoration: none;
	}
	.link.link__secondary,
	.message_event_action_link,
	.onboarding_row_ignore_link,
	.onboarding_row.done .onboarding_row_cta {
		color: #6c757d;
		stroke: #6c757d;
	}
	.link.link__secondary:hover,
	.message_event_action_link:hover,
	.onboarding_row_ignore_link:hover,
	.onboarding_row.done .onboarding_row_cta:hover {
		color: #343a40;
		stroke: #343a40;
	}
	.link.link__primary,
	.link__primary.message_event_action_link,
	.link__primary.onboarding_row_ignore_link,
	.onboarding_row.done .link__primary.onboarding_row_cta {
		color: #0d6efd;
		stroke: #0d6efd;
	}
	.link.link__primary:hover,
	.link__primary.message_event_action_link:hover,
	.link__primary.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__primary.onboarding_row_cta:hover {
		color: shade-color(#0d6efd, 4);
		stroke: shade-color(#0d6efd, 4);
	}
	.link.link__success,
	.link__success.message_event_action_link,
	.link__success.onboarding_row_ignore_link,
	.onboarding_row.done .link__success.onboarding_row_cta {
		color: #19b600;
		stroke: #19b600;
	}
	.link.link__success:hover,
	.link__success.message_event_action_link:hover,
	.link__success.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__success.onboarding_row_cta:hover {
		color: shade-color(#19b600, 2);
		stroke: shade-color(#19b600, 2);
	}
	.link.link__danger,
	.link__danger.message_event_action_link,
	.link__danger.onboarding_row_ignore_link,
	.onboarding_row.done .link__danger.onboarding_row_cta {
		color: #ea3d2f;
		stroke: #ea3d2f;
	}
	.link.link__danger:hover,
	.link__danger.message_event_action_link:hover,
	.link__danger.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__danger.onboarding_row_cta:hover {
		color: shade-color(#ea3d2f, 4);
		stroke: shade-color(#ea3d2f, 4);
	}
	.link.link__light,
	.link__light.message_event_action_link,
	.link__light.onboarding_row_ignore_link,
	.onboarding_row.done .link__light.onboarding_row_cta {
		color: #adb5bd;
		stroke: #adb5bd;
	}
	.link.link__light:hover,
	.link__light.message_event_action_link:hover,
	.link__light.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__light.onboarding_row_cta:hover {
		color: #495057;
		stroke: #495057;
	}
	.link.link__white,
	.link__white.message_event_action_link,
	.link__white.onboarding_row_ignore_link,
	.onboarding_row.done .link__white.onboarding_row_cta {
		color: #dee2e6;
		stroke: #dee2e6;
	}
	.link.link__white:hover,
	.link__white.message_event_action_link:hover,
	.link__white.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__white.onboarding_row_cta:hover {
		color: #fff;
		stroke: #fff;
	}
	.link.link__underline:hover,
	.link__underline.message_event_action_link:hover,
	.link__underline.onboarding_row_ignore_link:hover,
	.onboarding_row.done .link__underline.onboarding_row_cta:hover {
		text-decoration: underline;
	}
	.link.dropdown_link_selected,
	.dropdown_link_selected.message_event_action_link,
	.dropdown_link_selected.onboarding_row_ignore_link,
	.onboarding_row.done .dropdown_link_selected.onboarding_row_cta {
		border-bottom: none;
		text-decoration: none;
	}
	.confirm_popup {
		width: 350px;
		position: relative;
		max-height: 600px;
		overflow: auto;
		background: #fff;
		padding: 20px;
		padding-top: 10px;
		display: flex;
		flex-direction: column;
	}
	.confirm_popup__header {
		display: flex;
		border-bottom: 1px solid #eee;
		justify-content: space-between;
		padding: 0 0 10px 0;
		font-size: 20px;
		align-items: center;
	}
	.confirm_popup__body {
		padding-top: 10px;
	}
	.confirm_popup__footer {
		display: flex;
		justify-content: flex-end;
		margin-top: 20px;
	}
	.confirm-popup {
		width: 350px;
		max-height: 400px;
		display: flex;
		flex-direction: column;
		position: relative;
		border-radius: 4px;
	}
	.confirm-popup__head {
		padding: 10px 15px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		font-weight: 500;
		font-size: 1rem;
		background: #f8f9fa;
		border-top-left-radius: 4px;
		border-top-right-radius: 4px;
	}
	.confirm-popup__body {
		padding: 15px;
		font-size: 0.875rem;
		display: flex;
		flex: 1;
	}
	.confirm-popup__foot {
		background: #f8f9fa;
		display: flex;
		justify-content: flex-end;
		font-size: 0.875rem;
		padding: 10px 15px;
		border-top: 1px solid #dee2e6;
		border-bottom-left-radius: 4px;
		border-bottom-right-radius: 4px;
	}
	.confirm-popup__icon {
		margin-right: 10px;
		width: 32px;
		height: 32px;
	}
	.confirm-popup__icon.icon--primary {
		stroke: #0d6efd;
	}
	.confirm-popup__icon.icon--danger {
		stroke: #ea3d2f;
	}
	.confirm-popup__icon.icon--warning {
		stroke: #ffc107;
	}
	.confirm-popup__icon.icon--success {
		stroke: #19b600;
	}
	.confirm-popup__icon.icon--info {
		stroke: #17a2b8;
	}
	.main {
		display: flex;
		overflow: auto;
		position: relative;
		flex: 1;
		display: flex;
		justify-content: space-between;
	}
	.setting {
		display: flex;
		flex: 1;
		flex-direction: column;
		height: 100%;
		overflow-y: auto;
	}
	.setting_table .sbz_table_row .sbz_table_cell:first-child {
		padding-left: 30px;
	}
	.setting_table .sbz_table_row .sbz_table_cell:last-child {
		padding-right: 30px;
	}
	.setting_container {
		padding: 25px 30px;
	}
	.setting__main {
		position: relative;
		display: flex;
		flex: 1;
		flex-direction: column;
		min-width: 1px;
		min-height: 100%;
		height: 100%;
		overflow-y: auto;
		overflow-x: hidden;
	}
	.setting__title {
		font-size: 20px;
		font-weight: 600;
		color: #0d6efd;
		margin-bottom: 20px;
	}
	.setting_general_label {
		margin-top: 20px;
		margin-bottom: 5px;
	}
	.general_setting__logo {
		position: relative;
		width: 150px;
		height: 150px;
	}
	.general_setting__logo_url {
		position: absolute;
		width: 100%;
		height: 100%;
		border-radius: 10px;
		border: 2px solid #e0e0e0;
		top: 50%;
		left: 50%;
		transform: translate(-50%, -50%);
	}
	.general_setting__logo_background {
		position: absolute;
		text-align: center;
		width: 100%;
		height: 100%;
		background: rgba(0, 0, 0, 0.72);
		border-radius: 10px;
		visibility: hidden;
	}
	.general_setting__logo:hover .general_setting__logo_background {
		visibility: visible;
	}
	.general_setting__logo_background {
		color: #fff;
		font-size: 10px;
		cursor: pointer;
	}
	.general_setting_icon_social {
		position: absolute;
		padding-left: 30px;
	}
	.list_template_table {
		min-width: 400px;
	}
	.list_template_table .list_template_table__name {
		width: 35%;
		white-space: nowrap;
		text-overflow: ellipsis;
		overflow: hidden;
		min-width: 100px;
		max-width: 200px;
	}
	.list_template_table .list_template_table__type {
		width: 15%;
	}
	.list_template_table .list_template_table__shortcut {
		width: 30%;
		white-space: nowrap;
		text-overflow: ellipsis;
		overflow: hidden;
		min-width: 100px;
		max-width: 200px;
	}
	.list_template_table .list_template_table__scope {
		width: 10%;
	}
	.list_template_table .list_template_table__action {
		width: 10%;
	}
	.my_profile__logo {
		position: relative;
		width: 100px;
		height: 100px;
		display: flex;
		justify-content: center;
		align-items: center;
	}
	.my_profile__logo_url {
		position: absolute;
		max-width: 100%;
		max-height: 100%;
		border-radius: 10px;
		top: 50%;
		left: 50%;
		transform: translate(-50%, -50%);
	}
	.notification_setting__dnd {
		font-size: 16px;
		display: flex;
		margin-left: 10px;
		font-weight: normal;
		position: relative;
		cursor: pointer;
		color: #6c757d;
		stroke: #6c757d;
	}
	.notification_setting__dnd .dropdown {
		color: #000;
	}
	.notification_setting__dnd:hover {
		color: #000;
		stroke: #000;
	}
	.notification_setting__container {
		margin-top: 10px;
		border: 1px solid #ddd;
		border-radius: 5px;
		display: flex;
		justify-content: space-between;
		padding: 20px;
	}
	.notification_setting__title {
		font-weight: 500;
	}
	.notification_setting {
		margin: 30px;
		max-width: 600px;
		padding: 10px 30px;
	}
	.notification_setting__section {
		margin-top: 30px;
		font-size: 20px;
		display: flex;
		justify-content: space-between;
	}
	.endchat_setting_tab__channel_icon {
		width: 18px;
	}
	.setting_footer {
		display: flex;
		border-top: 1px solid #e5e5e5;
		padding: 10px 30px;
		opacity: 1;
		transition: all 150ms ease-out;
		overflow: hidden;
		visibility: visible;
	}
	.setting_footer.setting_footer__hidden {
		height: 0px;
		padding-top: 0;
		padding-bottom: 0;
		visibility: hidden;
	}
	.setting {
		height: 100%;
		display: flex;
		flex-direction: column;
	}
	.setting_body {
		flex: 1;
		overflow: auto;
		margin: 20px 40px;
	}
	.sidebar_setting {
		background-color: #f7f5f2;
		border-right: 1px solid rgba(166, 145, 113, 0.2);
		z-index: 1;
		display: flex;
		flex-direction: column;
		flex-shrink: 0;
		min-width: 240px;
		max-width: 270px;
		overflow-y: auto;
		padding-bottom: 30px;
	}
	.sidebar_setting__menu {
		margin-left: 30px;
		padding-top: 20px;
		font-weight: 500;
	}
	.sidebar_setting__menu_profile {
		text-align: center;
		padding: 30px 10px;
		border-bottom: 1px #ddd solid;
	}
	.sidebar_setting__menu_label {
		color: #838d94;
		font-weight: 500;
		font-size: 15px;
		text-transform: uppercase;
		word-wrap: break-word;
		cursor: pointer;
	}

	.sidebar_setting__sub_menu {
		display: flex;
		flex-direction: column;
		margin-left: 30px;
		color: #212529;
	}
	.sidebar_setting__sub_menu_label {
		padding-bottom: 2px;
		padding-top: 2px;
		cursor: pointer;
		color: #212529;
		display: flex;
		align-items: center;
	}
	.item-row.item-row__disabled {
		opacity: 0.6;
	}
	.item-row {
		border-bottom: 1px solid #dee2e6;
		display: flex;
		padding: 10px 0;
		align-items: center;
		transition: all 150ms ease-out;
	}
	.item-row:not(.iten-row__header):hover {
		background-color: whitesmoke;
	}
	.item-row:hover .item-row__musthover {
		visibility: visible;
	}
	.item-row.item-row__hot {
		background: #fff8ef;
	}
	.item-row__musthover {
		visibility: hidden;
	}
	.item-row.item-row__header {
		user-select: none;
		font-size: 12px;
		font-weight: 500;
		text-transform: uppercase;
		color: #6c757d;
	}
	.item-row.item-row__header:hover {
		background-color: transparent;
	}
	.webhook_code {
		overflow: auto;
		background: whitesmoke;
		padding: 10px;
		border-radius: 5px;
		white-space: pre-wrap;
		font-size: 14px;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		position: relative;
	}
	.webhook_code:hover .webhook_code_copy_icon {
		display: block;
	}
	.webhook_code_copy_icon {
		position: absolute;
		top: 15px;
		right: 15px;
		display: none;
		cursor: pointer;
	}
	.fanpage-settings-sidebar {
		height: 100%;
		width: 600px;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.fanpage-settings-sidebar__head {
		display: flex;
		align-items: center;
		padding: 10px 30px;
		border-bottom: 1px solid #dee2e6;
	}
	.fanpage-settings-sidebar__body.fanpage-settings-sidebar__body__disabled {
		opacity: 0.5;
		pointer-events: none;
		user-select: none;
	}
	.fanpage-settings-sidebar__body {
		padding: 20px 30px;
		flex-shrink: 0;
		flex: 1;
		overflow-y: auto;
	}
	.fanpage-settings-sidebar__foot {
		display: flex;
		align-items: center;
		padding: 10px 30px;
		border-top: 1px solid #dee2e6;
		opacity: 0;
		pointer-events: none;
	}
	.fanpage-settings-sidebar__foot.active {
		opacity: 1;
		pointer-events: auto;
	}
	.fanpage-settings-sidebar__title {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.fanpage-settings-sidebar__section {
		margin-bottom: 30px;
	}
	.fanpage-settings-sidebar__section:last-child {
		margin-bottom: 0;
	}
	.fanpage-settings-sidebar__section-title {
		font-weight: 500;
		display: flex;
		align-items: center;
	}
	.fanpage-settings-sidebar__section-head {
		display: flex;
		align-items: center;
		margin-bottom: 10px;
	}
	.fanpage-settings-sidebar__section-subtitle {
		color: #6c757d;
		max-width: 80%;
	}
	.fanpage-settings-sidebar__form {
		margin-bottom: 20px;
	}
	.fanpage-settings-sidebar__form:last-child {
		margin-bottom: 0;
	}
	.fanpage-settings-sidebar__form-head {
		display: flex;
		align-items: center;
	}
	.fanpage-settings-sidebar__form-title {
		line-height: 1.3;
		display: flex;
		user-select: none;
		align-items: center;
		margin-bottom: 0;
	}
	.fanpage-settings-sidebar__form-subtitle {
		color: #6c757d;
		margin-top: 5px;
	}
	.fanpage-settings-sidebar__form-content {
		margin-top: 10px;
		margin-left: 28px;
	}



	.calendar_dot__row {
		display: flex;
		flex-wrap: wrap;
		width: 150px;
	}
	.calendar_dot {
		width: 12px;
		height: 12px;
		margin-right: 2px;
		margin-bottom: 2px;
		background-color: #eeeeef;
		border: 1px solid #dadada;
		border-radius: 2px;
		cursor: pointer;
	}
	.calendar_dot.disabled {
		opacity: 0;
		pointer-events: none;
	}
	.calendar_dot.small {
		margin-right: 0;
		margin-bottom: 0;
	}
	.calendar_dot.up {
		background-color: #5ec278;
		border-color: #2fa84f;
	}
	.calendar_dot.up.white {
		background-color: #fff;
	}
	.calendar_dot.down {
		background-color: #ff5a4d;
		border-color: #ea3d2f;
	}
	.calendar_dot.down.white {
		background-color: #fff;
	}
	.calendar_dot.decreased {
		background-color: #cddc39;
		border-color: #adb930;
	}
	.calendar_dot.decreased.white {
		background-color: #fff;
	}

	.lang_textarea {
		border: 0;
		resize: none;
		border-radius: 5px;
		background: #e9ecef;
		margin: 3px;
		flex: 1;
		flex-shrink: 0;
	}

	.lang_textarea:hover,
	.lang_textarea:focus,
	.lang_textarea:active {
		background: #dee2e6;
	}

	.lang_setting__locale {
		display: flex;
		align-items: center;
		font-size: 16px;
		margin-right: 20px;
		user-select: none;
		cursor: pointer;
		color: #333;
	}
	.lang_setting__locale:hover {
		color: #000;
		filter: none;
	}
	.lang_edit_body {
		padding: 0;
		display: flex;
		flex: 1;
		flex-direction: column;
		overflow: hidden;
	}
	.setting_lang_add {
		width: 470px;
		height: 600px;
		position: relative;
		overflow: auto;
		background: white;
		display: flex;
		flex-direction: column;
	}
	.lang_edit_footer {
		background: #f8f8f8;
		padding: 10px 20px;
		padding-right: 28px;
		display: flex;
		border-top: 1px solid #dfdfdf;
		justify-content: flex-end;
	}

	.lang_textarea.lang_textarea__dirty {
		background: #fffac9;
	}

	.lang_textarea.lang_textarea__dirty:hover,
	.lang_textarea.lang_textarea__dirty:focus,
	.lang_textarea.lang_textarea__dirty:active {
		background: #fff6a1;
	}
	.rule_sublabel {
		font-weight: 500;
		font-size: 16px;
	}
	.device_row.device_row__expired {
		background-color: #ffe8e8;
	}
	.device_row {
		display: flex;
		margin-top: 10px;
		background: #f5f5f5;
		transition: background 150ms;
		border-radius: 5px;
		align-items: center;
		padding: 10px 20px;
	}
	.device_row .device_row__end_btn {
		opacity: 0;
	}
	.device_row:hover .device_row__end_btn {
		opacity: 1;
	}
	.device_row.device_row__loggingout {
		background: #ffeeee;
	}
	.setting_section_label {
		font-size: 19px;
		margin-top: 20px;
	}
	.profile_show_password {
		background: white;
		font-size: 14px;
		height: 26px;
		width: 40px;
		text-align: center;
		display: block;
		margin-left: auto;
		margin-right: 3px;
		color: #495057;
		margin-top: -28px;
		cursor: pointer;
	}
	.outgoing_email_type_radio_box {
		border-radius: 8px;
		flex: 1;
		overflow: hidden;
		margin-bottom: 20px;
		border: 1px solid #dee2e6;
		padding: 12px 20px;
		display: flex;
		cursor: pointer;
	}
	.outgoing_email_type_radio_box.active {
		border-color: #0d6efd;
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.outgoing_email_type_radio_box:last-child {
		margin-bottom: 0;
	}
	.email_step_picture {
		max-width: 100%;
		max-height: 220px;
		border: 1px solid #dbdbdb;
		border-radius: 8px;
	}
	.dns_record_name {
		word-break: break-word;
		width: 100%;
		white-space: pre-wrap;
	}

	.setting_perm_type .perm_type_setting_option {
		height: 40px;
	}
	.perm_setting_title {
		font-size: 18px;
		font-weight: 600;
	}
	.perm_setting_item_container {
		border: 1px solid #dee2e6;
		border-radius: 4px;
		padding: 10px 20px;
		margin: 10px 0px;
	}
	.perm_setting_item_container .perm_setting_item_header {
		display: flex;
		padding-right: 8px;
		padding-bottom: 4px;
		align-items: center;
		justify-content: space-between;
	}
	.perm_setting_item_container .perm_setting_item_header_title {
		font-size: 16px;
		font-weight: 600;
	}
	.perm_setting_item_container .perm_setting_item_content {
		display: flex;
		align-items: center;
		justify-content: space-between;
		padding: 4px 0px;
	}
	.perm_setting_item_container .perm_setting_item_label {
		display: flex;
		align-items: center;
		font-weight: 600;
		max-width: 60%;
	}
	.perm_setting_item_container .perm_setting_dropdown {
		border: none;
		height: 30px;
		padding-right: 30px;
		font-weight: 500;
		background-position: top 10px right 0.75rem;
	}
	.perm_setting_item_container .selected_all {
		font-weight: 600;
		color: #0d6efd;
	}
	.container_focus {
		border: 0.5px solid #c3c7cb;
	}
	.disable_setting_perm {
		pointer-events: none;
	}
	.setting_ticket_type_menu_wrapper {
		display: flex;
		align-items: center;
		overflow: hidden;
		padding-right: 10px;
		padding: 2px 0;
		color: #495057;
	}
	.setting_ticket_type_menu_wrapper:hover,
	.setting_ticket_type_menu_wrapper.active {
		color: #0d6efd;
	}
	.setting_ticket_type_menu_wrapper:hover .sidebar_setting__sub_menu_label,
	.setting_ticket_type_menu_wrapper.active .sidebar_setting__sub_menu_label {
		color: #0d6efd;
	}
	.setting_ticket_type_menu_caret {
		color: #6c757d;
	}
	.reply_editor .ProseMirror {
		border: 1px solid #cacaca;
		border-radius: 0.25rem;
		padding: 5px 10px;
		min-height: var(--editor-height);
	}
	.reply_editor p {
		margin: 0;
	}
	.reply_actions {
		display: flex;
		justify-content: end;
		padding: 8px 0px;
	}
	.email_satisfy_title .ProseMirror {
		outline: none;
		min-height: 30px;
	}
	.email_satisfy_title .ProseMirror .ProseMirror-widget {
		opacity: 0.5;
	}
	.invite_agent_body {
		padding: 0 20px;
	}
	.invite_agent_footer {
		padding: 12px 20px;
		display: flex;
		align-items: center;
	}
	.invite_agent_link {
		border: 1px solid #dfdfdf;
		border-radius: 4px;
		padding: 8px 10px;
		line-height: 19px;
	}
	.form_invite_agent_container {
		height: 100%;
		flex: 1;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.form_invite_agent_container.email {
		border-top: 1px solid #dee2e6;
		height: 100%;
	}

	.zns_template_com_wrapper {
		padding: 10px 15px;
		background-color: rgba(192, 192, 192, 0.15);
		margin-bottom: 15px;
	}
	.zns_template_com_actions {
		display: none;
		align-items: center;
	}
	.zns_template_com_wrapper:hover .zns_template_com_actions {
		display: flex;
	}
	.zns_preview_card {
		border-radius: 8px;
		background: #fff;
		padding: 16px;
	}
	.zns_preview_card_title {
		font-size: 16px;
		color: #343436;
		font-weight: 500;
	}
	.zns_preview_card_otp {
		font-size: 20px;
		color: #343436;
		font-weight: 700;
	}
	.zns_preview_card_paragraph {
		font-size: 14px;
		color: #69686d;
		margin-top: 8px;
	}
	.zns_preview_card_table {
		font-size: 14px;
		color: #69686d;
		margin-top: 12px;
	}
	.zns_preview_card_table_row {
		display: flex;
		margin-bottom: 5px;
	}
	.zns_preview_card_table_row:last-child {
		margin-bottom: 0;
	}
	.zns_preview_card_table_row_title {
		flex: 2;
		margin-right: 10px;
	}
	.zns_preview_card_table_row_content {
		flex: 3;
		font-weight: 500;
		color: #343a40;
	}
	.zns_preview_card.dark_mode {
		background: #212325;
	}
	.zns_preview_card.dark_mode .zns_preview_card_paragraph {
		color: #bdbbc3;
	}
	.zns_preview_card.dark_mode .zns_preview_card_table {
		color: #bdbbc3;
	}
	.zns_preview_card.dark_mode .zns_preview_card_title,
	.zns_preview_card.dark_mode .zns_preview_card_table_row_content,
	.zns_preview_card.dark_mode .zns_preview_card_otp {
		color: #fff;
	}
	.zns_logo_select_box {
		width: 240px;
		height: 100px;
		padding: 30px 15px !important;
		margin-right: 20px;
		margin-bottom: 20px;
		overflow: hidden;
		position: relative;
	}
	.zns_logo_select_box.selected {
		border-color: #0d6efd;
		box-shadow: inset 0 0 0 1px #0d6efd;
	}
	.product_import_uploadable_div.zns_logo_select {
		width: 240px;
		height: 100px;
	}
	.zns_logo_select_box_actions {
		position: absolute;
		top: 10px;
		right: 10px;
		display: none;
		z-index: 1;
	}
	.zns_logo_select_box:hover .zns_logo_select_box_actions {
		display: flex;
	}

	.endchat_emails_input_wrapper .ti-input {
		border-radius: 0.5rem;
	}
	.instant_noti__menu {
		user-select: none;
		cursor: default;
		color: #000;
		stroke: #000;
		display: flex;
		flex-direction: column;
		position: absolute;
		width: 340px;
		left: 10px;
		top: 50px;
		background: white;
		overflow: auto;
		border-radius: 8px;
		z-index: 110;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border: 1px solid #c6c6c6;
	}
	.instant_noti__noti {
		overflow: hidden;
		display: flex;
		min-height: 58px;
		align-items: center;
		cursor: pointer;
	}
	.instant_noti__menu_head {
		margin: 0 0 0 0;
		padding: 10px 20px 0 20px;
		display: flex;
		background: #f7f5f4;
		justify-content: space-between;
		flex-shrink: 0;
	}
	.instant_noti__menu_head__title {
		font-size: 18px;
		font-weight: 500;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.instant_noti__menu_body {
		overflow: auto;
		padding: 0 0 10px 10px;
		flex: 1;
	}
	.instant_noti__time {
		color: #343a40;
		font-size: 12px;
	}
	.instant_noti__popup_noti-item {
		position: relative;
		user-select: none;
		margin-bottom: 0;
		background: white;
		backdrop-filter: blur(66px);
		width: 100%;
		box-shadow: 0 2px 12px rgba(0, 0, 0, 0.2);
		padding: 10px;
		border-radius: 8px;
		cursor: pointer;
		color: #000;
		transition: all 0.2s;
		margin-bottom: 5px;
	}
	.instant_noti__popup_noti-item:last-child {
		margin-bottom: 0;
	}
	.instant_noti__popup_noti-enter,
	.instant_noti__popup_noti-leave-to {
		opacity: 0;
		transform: translateX(-50px);
	}
	.instant_noti__popup_noti-leave-active {
		position: absolute;
	}
	.instant_noti__popup {
		position: fixed;
		z-index: 170;
		bottom: 60px;
		left: 40px;
		width: 320px;
		color: unset;
	}
	.instant_noti__popup:hover {
		color: unset;
	}
	.instant_noti__popup:hover .instant_noti__popup_btns {
		display: flex;
		opacity: 1;
	}
	.instant_noti__icon {
		display: table;
		position: relative;
		margin-right: 10px;
	}
	.instant_noti__icon_type {
		position: absolute;
		right: 7px;
		bottom: -4px;
		padding: 3px;
		width: 25px;
		height: 25px;
		background: #ffc107;
		border: 2px solid white;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 50%;
		stroke: #fff;
		color: #fff;
	}
	.instant_noti__icon_type.instant_noti__icon_type__orange {
		background: #f3aa18;
	}
	.instant_noti__icon_type.instant_noti__icon_type__red {
		background: #ea3d2f;
	}
	.instant_noti__icon_type.instant_noti__icon_type__yellow {
		background: #ffc107;
	}
	.instant_noti__icon_type.instant_noti__icon_type__blue {
		background: #0d6efd;
	}
	.instant_noti__icon_type.instant_noti__icon_type__green {
		background: #19b600;
	}
	.instant_noti__popup_item_content {
		flex: 1;
	}
	.instant_noti__icon_type.order_noti__icon {
		width: 28px;
		height: 28px;
		border: 0px solid white;
		right: -10px;
		padding: 5px;
		bottom: -5px;
	}
	.instant_noti__noti.in_list_noti {
		padding: 5px 10px;
		border-radius: 5px;
	}
	.instant_noti__noti.in_list_noti:hover {
		background: whitesmoke;
	}
	.instant_noti__noti_body {
		line-height: 1.3;
		overflow: hidden;
	}
	.bill__invoice__iframe {
		transform: scale(0.6);
		transform-origin: 0 0;
	}
	.bill__invoice__iframe.frame--big {
		transform: scale(0.75);
	}
	.subscription-root {
		margin-top: 0;
		width: 100%;
		height: 100%;
		overflow-y: auto;
		background: #f8f9fa;
		padding-bottom: 20px;
	}
	.credit_box {
		margin-top: 10px;
		padding: 10px 15px;
		background-color: #fff;
		border-radius: 7px;
		position: relative;
		border: 2px solid #dee2e6;
		cursor: pointer;
		display: flex;
		align-items: center;
		overflow: hidden;
	}
	.credit_balance_box {
		margin-top: 10px;
		padding: 10px 15px;
		background-color: whitesmoke;
		border-radius: 7px;
		position: relative;
		align-items: center;
		overflow: hidden;
		width: 200px;
	}
	.credit_balance_box_balance {
		font-size: 20px;
		font-weight: 50px;
		margin-top: 5px;
		font-weight: 500;
	}
	.credit_box_name {
		text-transform: uppercase;
		font-weight: 500;
		font-size: 13px;
		color: #666;
		flex: 1;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.credit_box:hover {
		border-color: #555;
	}
	.credit_box.credit_box__active {
		border-color: #0d6efd;
	}
	.payment_box {
		padding: 30px;
		display: flex;
		flex-direction: column;
		background-color: #fff;
		border-radius: 7px;
		position: relative;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1);
	}
	table.invoices__table {
		border: none;
	}
	table.invoices__table tr:last-child td {
		border-bottom: none;
	}
	table.invoices__table thead tr:hover {
		background: transparent;
	}
	.invoices__table thead th,
	.invoices__table tbody td {
		width: auto;
		padding: 12px 8px;
		vertical-align: middle;
	}
	.invoices__table thead th {
		font-weight: 500;
	}
	.invoices__table thead th.money {
		text-align: right;
	}
	.invoices__table tbody td.money {
		font-size: 18px;
		font-weight: 300;
		text-align: right;
	}
	.invoice-detail {
		position: relative;
		padding-top: 0;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.invoice-detail__bg {
		min-width: 600px;
		padding-top: 0;
	}
	.invoice-detail__action {
		background-color: #fff;
		padding: 0.5rem 0;
		justify-content: space-between;
		align-items: center;
		flex-shrink: 0;
		display: flex;
		flex: 1;
	}
	.invoice-detail__bank {
		background-color: #e9ecef;
		padding: 12px;
		font-size: 14px;
		border-radius: 3px;
	}
	.invoice-detail__bank code {
		font-size: 14px;
	}
	.invoice-detail__container {
		max-height: 500px;
		overflow-x: hidden;
		overflow-y: auto;
	}
	.payment__dropdown {
		align-items: center;
		width: 100%;
	}
	.cycle__radio {
		margin-bottom: 5px;
	}
	.cycle__radio:last-child {
		margin-bottom: 0;
	}
	.subscription_info_card {
		padding: 10px 15px;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		flex: 1;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.subscription_info_card.danger {
		background-color: #ea3d2f;
		color: #fff;
	}
	.subscription_info_card:first-child {
		margin-right: 40px;
	}
	.subscription_info_card_title {
		font-weight: 500;
		font-size: 20px;
	}
	.subscription_info_card_subtitle {
		font-size: 14px;
		height: 52px;
	}
	.subscription_info_card_payment_status {
		display: flex;
		align-items: center;
		font-weight: 600;
		font-size: 14px;
	}
	.subscription_info_card_payment_status.done {
		color: #19b600;
	}
	.subscription_info_card_payment_status.warning {
		color: #ffc107;
	}
	.subscription_info_card_process_section {
		font-size: 14px;
		display: flex;
		flex-direction: column;
		height: 35px;
	}
	.subscription_info_card_process_section .progress {
		height: 10px;
		margin-top: auto;
	}
	.subscription_info_card_price {
		font-size: 20px;
		font-weight: 500;
	}
	.subscription_info_card_price.success {
		color: #19b600;
	}
	.subscription_info_card_cta_section {
		margin-top: 15px;
		display: flex;
		justify-content: flex-end;
	}
	.subscription_info_card_cta_section .btn {
		font-weight: 500;
		padding-left: 15px;
		padding-right: 15px;
	}
	.subscription_info_card.danger .subscription_info_card_price {
		color: #fff;
	}
	.subscription_info_card.danger .subscription_info_card_price.success {
		color: #fff;
	}
	.subscription_info_card.danger .subscription_info_card_process_section .progress-bar {
		background-color: #fff;
	}
	.subscription_info_card.danger .subscription_info_card_cta_section .btn.btn__white {
		color: #ea3d2f;
		border-color: transparent;
	}
	.subscription_info_card.danger .subscription_info_card_cta_section .btn.btn__outline_white:hover {
		color: #ea3d2f;
	}
	.payment_modal_qr_card {
		width: 200px;
		border: 1px solid #dee2e6;
		flex-shrink: 0;
		margin-right: 20px;
		border-radius: 8px;
		display: flex;
		flex-direction: column;
		justify-content: center;
		padding: 0 15px;
	}
	.payment_modal_bank_info_card {
		flex: 1;
		background-color: whitesmoke;
		padding: 10px 15px;
		border-radius: 8px;
	}
	.payment_modal_note_container {
		width: 100%;
		margin-top: 20px;
		border-radius: 8px;
		background-color: #fff6e3;
		padding: 15px;
	}
	.payment_modal_edit_amount_actions {
		display: flex;
		position: absolute;
		top: 50%;
		right: 10px;
		line-height: 1;
		transform: translateY(-50%);
	}
	.trial_subscription_page_header {
		text-align: center;
		margin: 0 30px 30px 30px;
	}
	.trial_subscription_page_header_text {
		font-size: 32px;
		font-weight: 700;
	}
	.plan_tab {
		display: flex;
		align-items: center;
		background-color: #f6f6f6;
		border-radius: 999px;
		gap: 4px;
		padding: 4px;
	}
	.plan_tab_item {
		padding: 3px 10px;
		cursor: pointer;
		font-size: 14px;
		line-height: 20px;
		border-radius: 9999px;
		text-align: center;
		font-weight: 500;
		color: #6c757d;
	}
	.plan_tab_item.active {
		background-color: #fff;
		color: #212529;
	}
	.plan_tab_item.active:hover {
		background: #fff;
	}
	.plan_tab_item:hover {
		color: #212529;
		background-color: #fefefe;
	}
	.trial_subscription_page {
		padding: 30px 0;
	}
	.trial_subscription_page_left_col {
		width: 300px;
		margin-right: 40px;
		flex-shrink: 0;
	}
	.trial_subscription_draft_invoice_box {
		padding: 0 20px;
		border: 1px solid #dee2e6;
		overflow: hidden;
		border-radius: 8px;
		background-color: #fff;
		position: relative;
	}
	.trial_subscription_draft_invoice_box_header {
		padding: 20px 0;
		border-bottom: 1px solid #dee2e6;
	}
	.trial_subscription_draft_invoice_box_body {
		padding: 20px 0;
	}
	.trial_subscription_draft_invoice_box_footer {
		padding: 20px 0;
		border-top: 1px solid #dee2e6;
	}
	.trial_subscription_draft_invoice_box_plan_img {
		width: 48px;
		height: 48px;
		flex-shrink: 0;
		margin-right: 15px;
	}
	.compare_package {
		max-width: 1200px;
		margin: 20px auto;
	}
	.package_list {
		display: flex;
	}
	.package_item_container {
		flex: 1;
		margin-right: 40px;
		display: flex;
		flex-direction: column;
	}
	.package_item_container:last-child {
		margin-right: 0;
	}
	.package_item_container .package_item {
		height: 220px;
		padding: 20px;
		text-align: center;
		display: flex;
		flex-direction: column;
		align-items: center;
		background-color: #fff;
		border: 1px solid #dee2e6;
		border-radius: 8px;
	}
	.package_item_container .package_item_info {
		margin-top: 30px;
		display: flex;
		flex-direction: column;
		align-items: start;
		padding-left: 20px;
		gap: 3px;
	}
	.package_item_container.disabled {
		opacity: 0.7;
		pointer-events: none;
		filter: grayscale(1);
	}
	.package_item_desc {
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
		overflow: hidden;
		text-overflow: ellipsis;
		word-wrap: break-word;
	}
	.contact_support_subs {
		margin: 0 auto;
		width: 370px;
		padding: 30px 10px 10px 10px;
	}
	.discount_tag {
		border-radius: 6px;
		font-size: 14px;
		padding: 4px 8px;
		color: #19b600;
		background-color: #baffaf;
		font-weight: 700;
	}
	.trial_subscription_left_container {
		flex: 3;
		background-color: #fff;
		border-right: 1px solid #dee2e6;
		height: 100%;
		overflow-x: hidden;
		overflow-y: auto;
		padding: 30px 40px;
	}
	.trial_subscription_right_container {
		flex: 2;
		height: 100%;
		overflow: hidden;
		padding: 40px;
	}
	.promote_plan_card {
		background-color: #fff;
		border: 1px solid #dee2e6;
		margin-right: 50px;
		padding: 20px 30px;
		border-radius: 8px;
		display: flex;
		flex-direction: column;
	}
	.promote_plan_card:last-child {
		margin-right: 0;
	}
	.promote_plan_card.primary {
		background-color: #ecefff;
		border-color: #ecefff;
	}
	.promote_plan_card_title {
		font-weight: 500;
		font-size: 18px;
	}
	.promote_plan_card_subtitle {
		color: #6c757d;
		max-width: 270px;
	}
	.promote_plan_card_price {
		font-weight: 500;
		font-size: 40px;
	}
	.promote_plan_card_price_unit {
		font-size: 14px;
		color: #6c757d;
	}
	.buy_more_btn {
		border: 1px dashed #6c757d;
	}
	.buy_more_btn_wrapper:hover {
		border-color: #343a40;
	}
	.new_sub_modal_cart_plan_box.sbz_radio_box,
	.new_sub_modal_cart_plan_box.zns_logo_select_box {
		display: block;
		flex: 1;
		padding: 12px 20px;
	}
	.new_sub_modal_cart_plan_box_title {
		color: #212529;
		margin-bottom: 5px;
	}
	.new_sub_modal_cart_plan_box_price {
		font-weight: 700;
		font-size: 24px;
		color: #212529;
	}
	.new_sub_modal_cart_plan_box.active .new_sub_modal_cart_plan_box_title {
		color: #0d6efd;
	}
	.rule__assign {
		padding: 0;
		display: flex;
		flex-direction: column;
		margin-top: 10px;
		margin-bottom: 30px;
	}
	.rule__minus-icon {
		outline: none;
		transition: all 0.1s ease;
		width: 20px;
		height: 20px;
		cursor: pointer;
		margin-left: 5px;
		position: absolute;
		stroke: #adb5bd;
		top: 10px;
		right: 15px;
		z-index: 15;
	}
	.rule__minus-icon:hover {
		stroke: #343a40;
	}
	.rule__assign__label__title {
		font-size: 20px;
		font-weight: 500;
	}
	.rule__assign__switch {
		margin-top: 10px;
	}
	.rule__assign__tooltip {
		vertical-align: text-top;
		width: 16px;
		height: 16px;
		margin-left: 5px;
		stroke: #6c757d;
	}
	.rule__assign__tooltip:hover {
		stroke: #343a40;
	}
	.add-rule__dropdown:hover {
		background-color: #e9ecef;
		color: #212529;
	}
	.rule_channel_img {
		width: 20px;
		height: 20px;
		margin-right: 5px;
	}
	.rule__actions-bar {
		background-color: #fff;
		width: 100%;
		flex-shrink: 0;
		border-top: 1px solid #e5e5e5;
		display: flex;
		flex-direction: column;
		transition: 0.3s;
	}
	.rule__actions-bar__content {
		margin-left: 40px;
		margin-top: 10px;
		margin-bottom: 10px;
		width: 600px;
		max-width: 100%;
	}
	.rule_assign_strategy {
		margin-bottom: 10px;
		border: 1px solid #e9ecef;
		padding: 10px;
		border-radius: 5px;
	}
	.rule_assign_strategy.rule_assign_strategy__active {
		border-color: #adb5bd;
	}
	.rule_assign_strategy__detail {
		margin-left: 28px;
	}
	.rule_assign_strategy__label {
		user-select: none;
		padding-left: 10px;
	}
	.rule_assign_strategy__header {
		display: flex;
		align-items: center;
	}
	.rule_assign_strategy__header .form-check-input {
		flex-shrink: 0;
		margin-top: -2px;
	}
	.rule__container {
		min-height: 100%;
		width: 100%;
		overflow: hidden;
		display: flex;
		align-items: center;
		flex-direction: column;
		background-color: #f8f9fa;
	}
	.rule__content_wrap {
		overflow: auto;
		width: 100%;
		display: flex;
		flex-direction: column;
		flex: 1;
		background: #fff;
	}
	.rule__content {
		width: 600px;
		padding-left: 40px;
		padding-top: 25px;
	}
	.detail_rule__title {
		color: #495057;
		font-weight: 500;
		margin-bottom: 5px;
	}
	.detail_rule__box {
		position: relative;
		border-radius: 5px;
		display: flex;
		margin-bottom: 10px;
		flex-direction: column;
		padding: 15px;
		background: #f2f7fb;
	}
	.detail_rule__box.detail_rule__box--choosen {
		background-color: tint-color(#ffc107, 8);
		border-radius: 0;
	}
	.detail_rule__box.detail_rule__box--choosen .rule__minus-icon {
		opacity: 0;
	}
	.detail_rule__box:last-child {
		margin-bottom: 0;
	}
	.detail_rule__trigger_desc {
		user-select: none;
		align-items: center;
		color: #6c757d;
	}
	.detail_rule {
		max-width: 100%;
	}
	.detail_rule__channel_condition {
		display: flex;
		align-items: center;
	}
	.all_channel_icon {
		stroke: #19b600;
		width: 20px;
		margin-right: 5px;
	}
	.rule_list__table {
		margin-top: 10px;
		display: flex;
		flex-direction: column;
		flex: 1;
		width: 100%;
		overflow: auto;
	}
	.rule_list__table_empty {
		display: flex;
		flex-direction: column;
		flex: 1;
		align-items: center;
		justify-content: center;
		color: #6c757d;
	}
	.rule_list__table_header {
		border-top: 1px solid #e5e5e5;
		background: #f8f9fa;
		font-weight: 500;
	}
	.rule_list__table_body {
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.rule_list__table_row__wrap {
		display: flex;
		flex: 1;
		flex-direction: column;
	}
	.rule_list__table_row__dragging_last {
		opacity: 0;
		flex-grow: 1;
		margin: 0;
		padding: 0;
		display: flex;
		flex: 1;
	}
	.rule_list__table_row.rule_list__table_row__dragging {
		margin-top: -1px;
		background: #e9ecef;
		opacity: 0.8;
		height: 46px;
	}
	.rule_list__table_row {
		display: flex;
		align-items: center;
		justify-content: space-between;
		position: relative;
		border-bottom: 1px solid #e5e5e5;
		border-left: 1px solid #e5e5e5;
		border-right: 1px solid #e5e5e5;
		user-select: none;
	}
	.rule_list__rule_detail {
		padding: 10px;
		width: 100%;
		display: flex;
		align-items: center;
	}
	.rule_list__order_number {
		cursor: grab;
		display: flex;
		align-items: center;
		width: 20px;
		opacity: 0.3;
	}
	.rule_list__order_number:hover {
		opacity: 0.7;
	}
	.rule_list__rule_name {
		flex: 1;
		align-items: center;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.rule_list__agent_group_icon {
		display: flex;
		align-items: center;
		justify-content: center;
		width: 24px;
		height: 24px;
		background: #fff;
		border: 1px solid #e9ecef;
		border-radius: 50%;
		margin-right: 10px;
		color: #0d6efd;
	}
	.rule_list__rule_channel {
		width: 22%;
		overflow: hidden;
	}
	.rule_list__rule_assign_to {
		display: flex;
		align-items: center;
		width: 22%;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.rule_list__status {
		width: 10%;
	}
	.rule_list__action {
		cursor: pointer;
		width: 10%;
		min-width: 150px;
		display: flex;
		justify-content: flex-end;
	}
	.rule_list__action__link {
		padding: 0 5px;
		position: relative;
		display: flex;
		align-items: center;
	}
	.rule_list__action__link:last-child {
		padding-right: 0;
		border-right: none;
	}
	.rule_list__action__link:not(:last-child):before {
		position: absolute;
		content: '';
		width: 2px;
		height: 2px;
		border-radius: 50%;
		background-color: #adb5bd;
		right: 0;
		top: 50%;
		transform: translate(50%, -50%);
	}
	.rule_list__library {
		display: flex;
		padding-top: 10px;
		flex-wrap: wrap;
		margin: 0 auto;
	}
	.rule_list__library_item {
		display: flex;
		align-items: center;
		flex-direction: column;
		width: 350px;
		border: 1px solid #ced4da;
		border-radius: 5px;
		margin-right: 10px;
		margin-top: 10px;
		padding: 20px;
		box-shadow: 0 2px 3px rgba(0, 0, 0, 0.2);
	}
	.rule_list__library_icon_item {
		padding: 20px;
		border-radius: 5px;
	}
	.rule_list__library_item:hover {
		cursor: pointer;
		background: #e9ecef;
	}
	.detail_rule__custime_time__disabled {
		pointer-events: none;
		opacity: 0.4;
		filter: grayscale(1);
	}
	.detail_rule__custime_time__disabled:hover {
		opacity: 1;
	}
	.rule-cond__card {
		display: flex;
		justify-content: space-between;
		align-items: center;
		padding: 10px;
		margin-right: 20px;
		margin-bottom: 10px;
		width: 280px;
		border: 1px solid #dee2e6;
		border-radius: 4px;
		min-height: 70px;
	}
	.rule-cond__card:nth-child(even) {
		margin-right: 0;
	}
	.rule-cond__card.rule-cond__card--disabled {
		opacity: 0.65;
		pointer-events: none;
	}
	.rule-conds__select {
		display: flex;
		flex-wrap: wrap;
		margin-top: 10px;
	}
	.rule-cond__card__content {
		align-self: flex-start;
		padding-right: 10px;
	}
	.rule-cond__card__text {
		margin-bottom: 5px;
		font-size: 1rem;
	}
	.rule-cond__card__sub {
		font-size: 0.875rem;
		color: #adb5bd;
	}
	.rule-cond__card__action {
		cursor: pointer;
		display: flex;
		align-items: center;
		border: 1px solid #dee2e6;
		justify-content: center;
		padding: 5px;
		border-radius: 4px;
	}
	.cond-select__wrapper {
		overflow: auto;
		width: 300px;
		height: 100%;
		position: relative;
		padding: 20px;
	}
	.modal.modal__right.cond-select__modal .modal__background {
		transition: 0.3s;
		transform: translateX(400px);
	}
	.modal.modal__right.cond-select__modal.cond-select__modal--active .modal__background {
		transform: translateX(0);
	}
	.modal.modal__right.cond-select__modal {
		z-index: -99999;
		opacity: 0;
	}
	.modal.modal__right.cond-select__modal.cond-select__modal--active {
		z-index: 1050;
		opacity: 1;
	}
	.cond-select__section {
		margin-bottom: 8px;
	}
	.cond-select__title {
		font-size: 1rem;
		font-weight: 500;
	}
	.cond-select__item {
		display: flex;
		padding: 8px;
		color: #212529;
		align-items: center;
		cursor: pointer;
		position: relative;
	}
	.cond-select__item svg {
		stroke: #212529;
	}
	.cond-select__item.cond-select__item--disabled {
		cursor: default;
		opacity: 0.35;
		width: fit-content;
	}
	.cond-select__item:hover {
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.cond-select__item:hover svg {
		stroke: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.detail_rule__source {
		margin-bottom: 5px;
		display: flex;
		position: relative;
		align-items: center;
	}
	.detail_rule__source_img {
		width: 30px;
		height: 30px;
		display: block;
		border-radius: 4px;
		margin-right: 10px;
	}
	.detail_rule__remove_condition_btn {
		outline: none;
		transition: all 0.1s ease;
		stroke: #adb5bd;
		border-radius: 50%;
		cursor: pointer;
		margin-left: 10px;
		z-index: 100;
	}
	.detail_rule__remove_condition_btn:hover {
		stroke: #343a40;
	}
	.detail_rule__source_type_img {
		position: absolute;
		width: 18px;
		height: 18px;
		border: 3px solid #fff;
		border-radius: 50%;
		bottom: -2px;
		right: 3px;
	}
	.rule-cond__add__btn {
		display: inline-flex;
		align-items: center;
		padding: 5px 10px;
		border: 1px dashed #0d6efd;
		border-radius: 4px;
	}
	.rule-cond__add__btn:hover {
		border-color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.cond-select__header {
		font-size: 1.25rem;
		margin-bottom: 15px;
	}
	.detail_rule__offline_icon {
		width: 16px;
		fill: #adb5bd;
		stroke: #000;
		margin-top: -4px;
		margin-right: 5px;
	}
	.rule__navigation__icon {
		width: 16px;
		height: 16px;
		margin-bottom: 2px;
		margin-left: -4px;
	}
	.rule-list {
		padding: 20px 40px;
		max-width: 100%;
		position: relative;
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.rule_channel_type {
		display: flex;
	}
	.rule_channel_type_card {
		border: 2px solid #ddd;
		flex: 1;
		border-radius: 8px;
		padding: 10px 15px;
		cursor: pointer;
	}
	.rule_channel_type_card:hover {
		border: 2px solid #aaa;
	}
	.rule_channel_type_card.rule_channel_type_card__active {
		border: 2px solid #0d6efd;
	}
	.list_rule_table .sbz_table_cell.cell_grip {
		padding-left: 10px;
		padding-right: 0;
		width: 30px;
	}
	.agents_picker__dropdown {
		cursor: default;
		bottom: 100%;
		width: 250px;
		top: auto;
		right: auto;
		display: flex;
		flex-direction: column;
		height: 300px;
		max-height: 300px;
	}
	.agents_picker__dropdown_agents {
		flex: 1;
		overflow: auto;
	}
	.agents_picker__agent {
		margin-left: 5px;
		display: flex;
		position: relative;
		cursor: pointer;
	}
	.agents_picker__agent:hover .agents_picker__agent__remove_btn {
		height: 20px;
		width: 20px;
		opacity: 1;
		transition: all 0.1s ease;
		right: -5px;
		top: 0;
	}
	.agents_picker__agent__remove_btn {
		outline: none;
		transition: all 0.1s ease;
		height: 0px;
		width: 0px;
		opacity: 0;
		position: absolute;
		stroke: #495057;
		background-color: #fff;
		border-radius: 50%;
		cursor: pointer;
		padding: 2px;
		right: 5px;
		top: 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.agents_picker__filter {
		padding: 10px;
		flex-shrink: 0;
	}
	.agents_picker__add_btn {
		display: flex;
		align-items: center;
		justify-content: center;
		width: 40px;
		height: 40px;
		border-radius: 100%;
		user-select: none;
		background: #f8f9fa;
		border: 1px dashed #adb5bd;
		cursor: pointer;
		transition: all 0.1s ease;
	}
	.agents_picker__add_btn:hover {
		background: #fff;
		border: 1px dashed #6c757d;
	}
	.agents_picker__add_btn:hover .agents_picker__add_btn_icon {
		stroke: #6c757d;
	}
	.agents_picker__add_btn.agents_picker__add_btn__sm {
		width: 26px;
		height: 26px;
	}
	.agents_picker__add_btn_icon {
		stroke: #adb5bd;
	}
	.channel_picker__channel {
		display: flex;
		position: relative;
		cursor: pointer;
		user-select: none;
	}
	.channel_picker__channel:hover .channel_picker__channel__remove_btn {
		height: 20px;
		width: 20px;
		opacity: 1;
		transition: all 0.1s ease;
		right: 2px;
		top: -3px;
	}
	.channel_picker__channel.channel_picker__channel__disabled {
		opacity: 0.5;
		filter: grayscale(100%);
	}
	.channel_picker__channel.channel_picker__channel__disabled:hover {
		filter: grayscale(0%);
		opacity: 0.7;
	}
	.channel_picker__channel__remove_btn {
		outline: none;
		transition: all 0.1s ease;
		height: 0px;
		width: 0px;
		opacity: 0;
		position: absolute;
		stroke: #495057;
		background-color: #fff;
		border-radius: 50%;
		cursor: pointer;
		padding: 2px;
		right: 5px;
		top: 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		z-index: 100;
	}
	.location_picker__locations {
		display: flex;
		flex-wrap: wrap;
	}
	.location_picker__location {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		max-width: 230px;
		margin-right: 5px;
		margin-bottom: 5px;
		background: tint-color(#ffc107, 8);
		padding: 0 5px;
		display: flex;
		align-items: center;
		border-radius: 4px;
	}
	.location_picker__remove_location_btn {
		margin-left: 5px;
		cursor: pointer;
		stroke: #6c757d;
		outline: none;
	}
	.location_picker__remove_location_btn:hover {
		stroke: #000;
	}
	.location_picker__empty_img {
		width: 150px;
		opacity: 0.4;
	}
	.lead-head__title {
		color: #555;
		padding-left: 20px;
		flex-shrink: 0;
		margin-bottom: 5px;
		font-weight: 400;
		margin-right: 0px;
		pointer-events: none;
		user-select: none;
		font-size: 20px;
	}
	.lead-actions__tags {
		display: flex;
		flex-wrap: wrap;
		align-items: center;
	}
	.lead-filter-tag {
		height: 36px;
		cursor: pointer;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		margin-right: 8px;
		margin-bottom: 8px;
		padding: 4px 12px;
		display: flex;
		align-items: center;
		border-radius: 4px;
		background-color: #ebf6ff;
		color: shade-color(#0d6efd, 8);
	}
	.lead-filter-tag__remove {
		cursor: pointer;
		margin-left: 5px;
		width: 16px;
		height: 16px;
		stroke: shade-color(#0d6efd, 8);
	}
	.lead-filter-tag__remove:hover {
		stroke: #495057;
	}
	.lead-add-filter-btn {
		margin-bottom: 8px;
		border: 1px dashed #0d6efd;
		color: #0d6efd;
		display: flex;
		align-items: center;
		align-self: flex-start;
		flex-shrink: 0;
		min-width: 140px;
		justify-content: center;
	}
	.lead-add-filter-btn:hover {
		border-color: rgb(1.5532786885, 76.887295082, 187.9467213115);
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.lead-add-filter-btn__icon {
		margin-right: 5px;
		width: 16px;
		height: 16px;
	}
	.lead-action-btn {
		border: 1px solid #dee2e6;
		background-color: #fff;
		display: flex;
		align-items: center;
		align-self: flex-start;
	}
	.lead-action-btn:hover {
		background-color: rgba(33, 33, 33, 0.02);
		border-color: #adb5bd;
	}
	.lead-action-btn__icon {
		width: 18px;
		height: 18px;
	}
	.lead-actions__paginate {
		display: flex;
		align-items: center;
		justify-content: flex-end;
		font-size: 1rem;
		flex-shrink: 0;
		align-self: flex-start;
		min-width: 130px;
	}
	.lead-filter {
		width: 500px;
		border-top-left-radius: 8px !important;
		border-bottom-left-radius: 8px !important;
		padding: 0;
		height: 100%;
		position: relative;
		display: flex;
		flex-direction: column;
	}
	.lead-filter__head {
		padding: 18px 25px;
		font-size: 1rem;
		font-weight: 500;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
	}
	.lead-filter__back {
		color: #0d6efd;
		margin-left: -4px;
		cursor: pointer;
	}
	.lead-filter__back:hover {
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.lead-filter__content {
		display: flex;
		padding: 25px;
		width: 100%;
		overflow: hidden;
		min-height: calc(100% - 150px);
		position: relative;
	}
	.lead-filter__tab {
		width: 100%;
		flex-shrink: 0;
		overflow: auto;
		transition: 0.3s;
		position: relative;
	}
	.lead-filter__tab.lead-filter__tab--inactive {
		left: -600px;
	}
	.lead-filter__tab:last-child {
		left: 1000px;
		z-index: 1;
		background-color: #fff;
	}
	.lead-filter__tab:last-child.lead-filter__tab--active {
		left: -100%;
	}
	.lead-filter__preset {
		padding: 8px 4px;
		cursor: pointer;
		border-radius: 4px;
		display: flex;
		align-items: center;
	}
	.lead-filter__preset-icon {
		margin-right: 15px;
		width: 24px;
		height: 24px;
		opacity: 0.55;
	}
	.lead-filter__preset:hover .lead-filter__preset-name,
	.lead-filter__preset.preset--active .lead-filter__preset-name {
		color: #0d6efd;
	}
	.lead-filter__preset:hover .lead-filter__preset-value,
	.lead-filter__preset.preset--active .lead-filter__preset-value {
		color: shade-color(#0d6efd, 2);
	}
	.lead-filter__preset-name {
		font-weight: 500;
	}
	.lead-filter__preset-value {
		color: #6c757d;
		font-size: 14px;
		margin-top: 2px;
	}
	.lead-filter__preset-check-icon {
		margin-left: auto;
		width: 24px;
		height: 24px;
		stroke: #0d6efd;
	}
	.lead-filter__form {
		margin: 0 auto 15px;
		border: 1px solid #adb5bd;
		border-radius: 4px;
		max-width: 460px;
	}
	.lead-filter__form:last-child {
		margin-bottom: 0;
	}
	.lead-filter__form-head {
		display: flex;
		align-items: center;
		justify-content: space-between;
		padding: 5px 10px;
	}
	.lead-filter__form-title {
		font-weight: 500;
	}
	.lead-filter__form-delete {
		margin-left: 5px;
		cursor: pointer;
		stroke: #495057;
		width: 16px;
		height: 16px;
	}
	.lead-filter__form-delete:hover {
		stroke: #212529;
	}
	.lead-filter__form-content {
		border-top: 1px solid #dee2e6;
		padding: 10px 10px;
	}
	.lead-filter__add-cond {
		position: relative;
		margin: 10px auto;
		max-width: 460px;
	}
	.lead-filter__add-cond-btn {
		padding: 5px 10px;
		border: 1px dashed;
		border-radius: 4px;
	}
	.lead-filter__add-cond-dropdown {
		display: flex;
		flex-direction: column;
	}
	.lead-filter__add-cond-dropdown-input {
		padding: 10px;
	}
	.lead-filter__add-cond-dropdown-content {
		display: flex;
		flex-direction: column;
		flex: 1 1 0%;
		min-height: 150px;
		max-height: 300px;
		overflow: auto;
	}
	.lead-filter__foot {
		display: flex;
		align-items: center;
		margin-top: auto;
		padding: 18px 25px;
		border-top: 1px solid #dee2e6;
	}
	.lead__export-head {
		display: flex;
		border-bottom: 1px solid #eeeeee;
		justify-content: space-between;
		padding: 0 0 10px 0;
		font-size: 20px;
		font-weight: 500;
		align-items: center;
	}
	.lead_table__channel_source_img {
		width: 22px;
		height: 22px;
		display: block;
		border-radius: 4px;
		margin-right: 5px;
	}
	.lead_table__channel_source_type_img {
		position: absolute;
		width: 16px;
		height: 16px;
		border: 2px solid #fff;
		border-radius: 50%;
		bottom: -4px;
		right: -2px;
	}
	.lead-filter__tags-input .ti-input {
		padding: 5px;
		border-radius: 4px;
	}
	.lead-filter__tags-input .ti-input .ti-tag {
		margin: 0;
		margin-right: 5px;
		border-radius: 4px;
		background-color: #ebf6ff;
		color: shade-color(#0d6efd, 8);
	}
	.lead-filter__tags-input .ti-input .ti-tag:hover {
		background-color: #e0f1ff;
	}
	.lead-filter__tags-input .ti-item.ti-selected-item {
		background-color: #e0f1ff;
		color: shade-color(#0d6efd, 8);
	}
	.tab.lead {
		margin-bottom: 0;
	}
	.tab__item.lead {
		padding-top: 6px;
		padding-bottom: 14px;
	}
	.tab__item.tab__item__active.lead {
		color: #0d6efd;
	}
	.lead_mgr {
		display: flex;
		overflow: hidden;
		position: relative;
		display: flex;
		flex-direction: column;
		flex: 1;
	}
	.lead_footer {
		padding: 0 10px;
		height: 36px;
		border-top: 1px solid #dee2e6;
		align-items: center;
		flex-shrink: 0;
		display: flex;
	}
	.lead_mgr__header {
		background: whitesmoke;
		padding: 13px 0px 0 0px;
	}
	.lead_sidebar {
		height: 100%;
		width: 400px;
		display: flex;
		flex-direction: column;
		position: relative;
		border-left: 1px solid #dee2e6;
	}
	.lead_sidebar__body {
		flex-shrink: 0;
		flex: 1;
		overflow-y: auto;
	}
	.lead_sidebar__head {
		display: flex;
		align-items: center;
		padding: 10px 20px;
		border-bottom: 1px solid #dee2e6;
	}
	.lead_sidebar__footer {
		display: flex;
		align-items: center;
		padding: 10px 20px;
		border-top: 1px solid #dee2e6;
	}
	.lead_condition_section {
		padding: 10px 20px;
		border-bottom: 1px solid #dee2e6;
	}
	.lead_condition_section__title {
		font-weight: 500;
	}
	.lead_condition_x {
		margin-left: auto;
		width: 18px;
		height: 18px;
		cursor: pointer;
		padding: 3px;
		background: #dbdbdb;
		border-radius: 50%;
		stroke-width: 3;
		color: #fff;
	}
	.lead_condition_x:hover {
		background: #da2e22;
		color: white;
	}
	.lead_tag_input.vue-tags-input {
		margin-top: 10px;
		background: #324652;
		max-width: unset;
		/* the selected item in the autocomplete layer, should be highlighted */
		/* style the placeholders color across all browser */
		/* default styles for all the tags */
		/* we defined a custom css class in the data model, now we are using it to style the tag */
		/* the styles if a tag is invalid */
		/* if the user input is invalid, the input color should be red */
		/* if a tag or the user input is a duplicate, it should be crossed out */
	}
	.lead_tag_input.vue-tags-input .ti-new-tag-input {
		margin-top: -2px;
		background: transparent;
		color: black;
	}
	.lead_tag_input.vue-tags-input .ti-input {
		min-height: 39px;
		border-radius: 5px;
		transition: border-bottom 200ms ease;
	}
	.lead_tag_input.vue-tags-input li.ti-new-tag-input-wrapper {
		margin: 0;
		margin-bottom: 2.5px;
		margin-top: 2.5px;
	}
	.lead_tag_input.vue-tags-input li.ti-new-tag-input-wrapper .ti-new-tag-input {
		font-size: 16px;
		width: 0px;
	}
	.lead_tag_input.vue-tags-input input.ti-tag-input {
		font-size: 16px;
		margin-top: -2px;
	}
	.lead_tag_input.vue-tags-input .ti-icon-undo {
		display: none;
	}
	.lead_tag_input.vue-tags-input .ti-autocomplete {
		background: white;
		border-bottom-left-radius: 5px;
		border-bottom-right-radius: 5px;
		border: 1px solid #cacaca;
		border-top: none;
	}
	.lead_tag_input.vue-tags-input .ti-item {
		padding-top: 5px;
		padding-bottom: 5px;
		padding-left: 5px;
	}
	.lead_tag_input.vue-tags-input .ti-item div {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
	}
	.lead_tag_input.vue-tags-input .ti-item.ti-selected-item {
		background: #d4eafe;
		color: black;
	}
	.lead_tag_input.vue-tags-input ::-webkit-input-placeholder {
		color: #a4b1b6;
	}
	.lead_tag_input.vue-tags-input ::-moz-placeholder {
		color: #a4b1b6;
	}
	.lead_tag_input.vue-tags-input :-ms-input-placeholder {
		color: #a4b1b6;
	}
	.lead_tag_input.vue-tags-input :-moz-placeholder {
		color: #a4b1b6;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-invalid {
		color: #750000;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-invalid .ti-icon-close {
		color: #fff0f0;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-invalid .ti-icon-close:hover {
		color: white;
	}
	.lead_tag_input.vue-tags-input .ti-icon-close {
		padding-top: 1px;
		color: #abb8ff;
	}
	.lead_tag_input.vue-tags-input .ti-icon-close:hover {
		color: black;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-editing {
		background: #fffbde;
	}
	.lead_tag_input.vue-tags-input .ti-tag {
		display: flex;
		align-items: center;
		border-radius: 7px;
		background: #ebf6ff;
		font-size: 16px;
		color: #010d75;
		position: relative;
		margin: 0;
		margin-right: 5px;
		cursor: pointer;
		margin-top: 2.5px;
		margin-bottom: 2.5px;
	}
	.lead_tag_input.vue-tags-input .ti-tag:hover {
		background: #e0f1ff;
	}
	.lead_tag_input.vue-tags-input .ti-tag .ti-tag-center {
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		max-width: 200px;
	}
	.lead_tag_input.vue-tags-input .ti-tag.custom-class {
		background: transparent;
		border: 1px solid #ebde6e;
		color: #ebde6e;
		margin-right: 4px;
		border-radius: 0px;
		font-size: 13px;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-invalid {
		background-color: #ffcaba;
	}
	.lead_tag_input.vue-tags-input .ti-tag.ti-invalid:hover {
		background-color: #ffbaaa;
	}
	.lead_tag_input.vue-tags-input .ti-new-tag-input.ti-valid {
		color: #010d75;
	}
	.lead_tag_input.vue-tags-input .ti-duplicate span,
	.lead_tag_input.vue-tags-input .ti-new-tag-input.ti-duplicate {
		text-decoration: line-through;
	}
	.lead_tag_input.vue-tags-input li.ti-tag.ti-deletion-mark {
		background: #ffd7d7;
		color: #750000;
	}
	.lead_tag_input.vue-tags-input .ti-tag .ti-actions i {
		font-size: 16px;
	}
	.pin__off {
		cursor: pointer;
		color: #aaa;
	}
	.pin__off:hover {
		color: #777;
	}
	.pin__active {
		cursor: pointer;
		color: #f3aa18;
	}
	.pin__disabled {
		color: #ddd;
		cursor: not-allowed;
	}
	.view_select_lead_edit_btn {
		opacity: 0.3;
		margin-top: -2px;
		cursor: pointer;
		text-align: center;
	}
	.view_select_lead_edit_btn:hover {
		opacity: 1;
	}
	.lead_edit_btn {
		margin-left: 8px;
		opacity: 0.1;
		margin-top: -2px;
		trasition: opacity 250ms;
	}
	.tab__item:hover .lead_edit_btn {
		opacity: 0.5;
	}
	.tab__item:hover .lead_edit_btn:hover {
		opacity: 1;
	}
	.lead__table {
		background: white;
		min-width: 100%;
	}
	.lead__table tr:first-child:hover {
		background: white;
	}
	.lead__table tr:hover {
		background: #f0f0f0;
	}
	.lead__table tr th {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		height: 44px;
		border-bottom: 1px solid #dee2e6;
	}
	.lead__table tr th:first-child {
		padding-left: 15px;
	}
	.lead__table tr td {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		padding-left: 5px;
		padding-right: 5px;
		border-bottom: 1px solid #dee2e6;
	}
	.lead__table tr td:first-child {
		padding-left: 15px;
	}
	.lead__table tr:hover .lead_column__fullname {
		cursor: pointer;
		text-decoration: underline;
		color: #0d6efd;
	}
	.lead__table tr:hover .lead_column__fullname_preview_btn {
		display: block;
	}
	.lead__table tr:last-child td {
		border-bottom: 1px solid white;
	}
	.column_select_column {
		display: flex;
		padding-left: 26px;
		padding-right: 10px;
		align-items: center;
	}
	.column_select_column .column_select_swap_icon {
		opacity: 0;
	}
	.column_select_column:hover {
		background: whitesmoke;
	}
	.column_select_column:hover .column_select_swap_icon {
		opacity: 1;
	}
	.column_select_swap_icon {
		cursor: pointer;
		color: #999;
		width: 15px;
		height: 15px;
		margin-left: 5px;
		margin-right: 5px;
	}
	.column_select_swap_icon:hover {
		color: #444;
	}
	.lead_column_header {
		padding-left: 5px;
		padding-right: 5px;
		cursor: pointer;
		background: white;
	}
	.lead_column_header:hover {
		background: #eee;
	}
	.lead_view_select_label {
		background: #f7f7f7;
		padding: 5px 10px;
		font-size: 14px;
		cursor: default;
		color: #888;
	}
	.lead_column__fullname {
		width: 200px;
		overflow: hidden;
	}
	.lead_column__fullname_preview_btn {
		display: none;
		margin-left: 10px;
	}
	.lead_condition_section.lead_condition_section__disabled {
		pointer-events: none;
		opacity: 0.6;
	}
	.lead_mgr_wrapper {
		width: 100%;
		height: 100%;
		overflow: hidden;
		display: flex;
	}
	.lead_mgr_sidebar {
		width: 220px;
		flex-shrink: 0;
		background-color: #f7f5f2;
		padding: 20px;
		border-right: 1px solid rgba(166, 145, 113, 0.2);
	}
	.lead_mgr_sidebar_section {
		margin-bottom: 20px;
	}
	.lead_mgr_sidebar_section:last-child {
		margin-bottom: 0;
	}
	.lead_mgr_sidebar_section_title {
		text-transform: uppercase;
		font-weight: 500;
		color: #999999;
		font-size: 14px;
		margin-bottom: 5px;
	}
	.lead_mgr_sidebar_item {
		display: flex;
		align-items: center;
		cursor: pointer;
		margin-bottom: 5px;
	}
	.lead_mgr_sidebar_item:last-child {
		margin-bottom: 0;
	}
	.lead_mgr_sidebar_item:hover .lead_mgr_sidebar_item_text {
		color: #0d6efd;
	}
	.lead_mgr_sidebar_item.active .lead_mgr_sidebar_item_text {
		color: #0d6efd;
		font-weight: 500;
	}
	.lead_mgr_sidebar_item.active .lead_mgr_sidebar_item_badge {
		color: #0d6efd;
		background-color: rgba(13, 110, 253, 0.15);
	}
	.lead_mgr_sidebar_item_text {
		flex: 1;
		color: #343a40;
		margin-right: 10px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		display: flex;
		align-items: center;
	}
	.lead_mgr_sidebar_item_badge {
		flex-shrink: 0;
		font-size: 13px;
		color: #6c757d;
		background-color: #e9ecef;
		border-radius: 4px;
		font-weight: 500;
		padding: 0px 5px;
	}
	.lead_mgr_sidebar_item_badge:hover {
		background-color: unset;
	}
	.lead_mgr_sidebar_item_badge_unedit {
		flex-shrink: 0;
		font-size: 12px;
		color: #6c757d;
		background-color: #e9ecef;
		border-radius: 4px;
		padding: 0px 5px;
	}
	.lead_table__id {
		width: 55px;
		flex-shrink: 0;
		font-size: 12px;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #888;
	}
	.lead_table__scroll_left .lead_table__row.sticky_col {
		background-color: #fff;
	}
	.lead_table__scroll_left .lead_table__row.sticky_col.no_scroll:after {
		box-shadow: none;
	}
	.lead_table__scroll_left .lead_table__row.sticky_col:after {
		display: none;
		box-shadow: inset 5px 0 4px -4px rgba(0, 0, 0, 0.1);
	}
	.new_lead_tabe .lead_table__row {
		height: auto;
		min-height: 44px;
		padding-top: 8px;
		padding-bottom: 8px;
	}
	.lead_table__row {
		display: flex;
		align-items: center;
		flex-shrink: 0;
		overflow: hidden;
		height: 40px;
		border-bottom: 1px solid rgba(0, 0, 0, 0.0745098039);
		border-right: 1px solid rgba(0, 0, 0, 0.0745098039);
		padding: 0 3px;
		flex-grow: 1;
	}
	.lead_table__row.sticky_col {
		z-index: 1;
		position: sticky;
		left: 0;
	}
	.lead_table__row.sticky_col:after {
		position: absolute;
		top: 0;
		right: 5px;
		bottom: -1px;
		width: 5px;
		transform: translate(100%);
		transition: box-shadow 0.3s;
		content: '';
		pointer-events: none;
	}
	.lead_table__row.sticky_col.blur {
		background-color: #fff;
	}
	.lead_table__row.sticky_col.blur:after {
		box-shadow: inset 5px 0 4px -4px rgba(0, 0, 0, 0.1);
	}
	.lead_table__row:first-child {
		padding-left: 10px;
	}
	.lead_table__row:last-child {
		padding-right: 10px;
	}
	.lead_table__row.lead_table__header {
		font-size: 13px;
		color: #6f6f6f;
		height: 40px;
		text-transform: uppercase;
		font-weight: 500;
		border-top: 1px solid #eaeaea;
	}
	.lead_mgr_header {
		display: flex;
		align-items: center;
		padding: 20px 10px 10px 10px;
	}
	.lead_mgr_filers {
		padding: 0 10px;
		padding-bottom: 5px;
		display: flex;
		flex-wrap: wrap;
	}
	.lead_mgr_filter_wrapper {
		margin-right: 10px;
		margin-bottom: 10px;
		position: relative;
		height: 36px;
	}
	.lead_mgr_filter_wrapper .order_filter_input {
		height: 100%;
	}
	.lead_header_action_icon {
		cursor: pointer;
		color: #0d6efd;
	}
	.lead_header_action_icon:hover {
		color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.lead_mgr_sidebar_shrink_icon {
		margin-left: auto;
	}
	.lead_mgr_sidebar.shrink {
		width: 40px;
		padding: 20px 0;
	}
	.lead_mgr_sidebar.shrink .lead_mgr_sidebar_header_title {
		display: none;
	}
	.lead_mgr_sidebar.shrink .lead_mgr_sidebar_section {
		display: none;
	}
	.lead_mgr_sidebar.shrink .lead_mgr_sidebar_shrink_icon {
		margin-left: 8px;
	}
	.lead_table__row_row {
		display: flex;
		width: fit-content;
		min-width: 100%;
	}
	.lead_table__row_row:hover .lead_table__row {
		background-color: #f3f9ff;
	}
	.lead_table__row_row.header:hover .lead_table__row {
		background-color: inherit;
	}
	.lead_table__row_row.header {
		cursor: auto;
	}
	.lead_table {
		display: flex;
		height: 100%;
		flex-direction: column;
		flex: 1;
		overflow: hidden;
		position: relative;
	}
	.user_attr_star {
		cursor: pointer;
		color: #999;
	}
	.user_attr_star.active {
		color: #ffc107;
	}
	.user_attr_star.active path:last-child {
		fill: #ffeb3b;
	}
	.lead_mgr_views {
		padding-left: 10px;
		padding-right: 10px;
		display: flex;
		align-items: center;
	}
	.lead_mgr_views .date-range-input {
		font-size: 14px;
	}
	.lead_mgr_views .tab {
		border-bottom: none;
		margin-bottom: 0;
	}
	.lead_mgr_views .tab__item {
		margin-right: 10px;
		max-width: 150px;
		overflow: hidden;
		display: inline-flex;
		align-items: center;
		padding: 10px 5px;
	}
	.lead_mgr_views .tab__item .order_list_tab_badge {
		top: 0;
		opacity: 1;
	}
	.lead_mgr_views .tab__item.has_actions .lead_view_tab_action_icon {
		position: absolute;
		top: 50%;
		transform: translate(-50%, -50%);
		left: 50%;
		opacity: 0;
		user-select: none;
	}
	.lead_mgr_views .tab__item.tab__item__active {
		background: #f3f8ff;
	}
	.lead_mgr_views .tab__item.has_actions.tab__item__active .lead_view_tab_action_icon {
		opacity: 1;
	}
	.lead_mgr_views .tab__item.has_actions.tab__item__active .order_list_tab_badge {
		opacity: 0;
	}
	.lead_mgr_views .dropdown_container > div {
		overflow: hidden;
	}
	.lead_mgr_views .tab__item__active {
		color: #0d6efd;
	}
	.lead_mgr_views .tab__item__active .order_list_tab_badge {
		top: 0;
		color: #0d6efd;
		background-color: #cce5ff;
	}
	.lead_table.lead_table__wide .lead_table__row {
		padding-left: 10px;
		padding-right: 10px;
	}
	.lead_table__row_row.checked .lead_table__row {
		background-color: #ecefff;
	}
	div.lead_table__row_row.clicked .lead_table__row {
		background-color: #eee;
	}
	.lead_remove_user_progress_modal {
		background-color: #495057;
		position: fixed;
		bottom: 20px;
		right: 80px;
		color: #fff;
		display: flex;
		align-items: center;
		width: 300px;
		z-index: 999;
		padding: 8px 15px;
		border-radius: 9999px;
	}
	.lead_add_user_modal_field {
		margin-bottom: 15px;
	}
	.lead_add_user_modal_field:last-child {
		margin-bottom: 0;
	}
	.new_lead_mgr_sidebar_item {
		margin-left: -8px;
		margin-right: -8px;
		padding: 5px 8px;
		padding-right: 3px;
		border-radius: 5px;
		display: flex;
		align-items: center;
		cursor: pointer;
	}
	.new_lead_mgr_sidebar_item:hover {
		color: #343a40;
	}
	.new_lead_mgr_sidebar_item.active {
		background-color: #495057;
		color: #fff;
	}
	.new_lead_mgr_sidebar_item.active .lead_mgr_sidebar_item_badge {
		background-color: #495057;
		color: #fff;
	}
	.new_lead_mgr_sidebar_item.active .lead_mgr_sidebar_item_badge_unedit {
		background-color: #495057;
		color: #fff;
	}
	.new_lead_mgr_sidebar_item.active_light {
		background-color: #dee2e6;
	}
	.lead_mgr_footer {
		display: flex;
		align-items: center;
		height: 42px;
		position: relative;
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
		padding-left: 10px;
		padding-right: 10px;
	}
	.new_lead_mgr_sidebar {
		width: 300px;
		flex-shrink: 0;
		background-color: #f7f5f2;
		padding: 0;
		border-right: 1px solid rgba(166, 145, 113, 0.2);
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.new_lead_mgr_sidebar_header {
		padding: 10px 15px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		height: 44px;
	}
	.new_lead_mgr_sidebar_content {
		flex: 1;
		overflow: auto;
		padding: 10px 15px;
		position: relative;
	}
	.send_bulk_email_modal_wrapper {
		width: 100%;
		height: 100%;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.send_bulk_email_modal_footer {
		padding: 0px 15px;
		display: flex;
		height: 46px;
		align-items: center;
		flex-shrink: 0;
		border-top: 1px solid #dee2e6;
	}
	.send_bulk_email_modal_body {
		flex: 1;
		display: flex;
		overflow: hidden;
	}
	.send_bulk_email_modal_receivers {
		width: 280px;
		flex-shrink: 0;
		display: flex;
		flex-direction: column;
		border-left: 1px solid #dee2e6;
	}
	.send_bulk_email_modal_content_header {
		height: 48px;
		padding: 0 15px;
		align-items: center;
		display: flex;
		flex-shrink: 0;
		border-bottom: 1px solid #dee2e6;
	}
	.send_bulk_email_modal_email_content {
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.send_bulk_email_modal_email_content .message_editor.message_editor__html {
		flex: 1;
		border: none;
		overflow: hidden;
	}
	.send_bulk_email_modal_email_content .email_header__from {
		margin-left: 15px;
	}
	.send_bulk_email_modal_email_content .email_header__subject {
		margin-left: 15px;
		margin-right: 15px;
		border-bottom: 0;
	}
	.send_bulk_email_modal_email_content .email_header {
		border-bottom: 1px solid #dee2e6;
	}
	.send_bulk_email_modal_receiver_item {
		display: flex;
		align-items: center;
		padding: 8px 15px;
	}
	.segment_setting_icon {
		position: absolute;
		top: -1px;
		right: 0;
		text-align: center;
		visibility: hidden;
	}
	.segment_setting_icon:hover {
		visibility: visible;
	}
	.new_lead_mgr_sidebar_item.view_item:hover .segment_setting_icon {
		visibility: visible;
	}
	.new_lead_mgr_sidebar_item.view_item:hover .lead_mgr_sidebar_item_badge {
		width: 20px;
		height: 20px;
	}
	.lead_mgr_sidebar_item_badge:hover .segment_setting_icon {
		visibility: visible;
	}
	.lead_mgr_sidebar_item_badge:hover .segment_numberic {
		visibility: hidden;
	}
	.new_lead_mgr_sidebar_content_sync {
		background-color: #6c757d;
		color: #fff;
		font-size: 12px;
		height: 18px;
		display: flex;
		align-items: center;
		justify-content: center;
		width: 100%;
		position: absolute;
		top: 0;
		left: 0;
	}
	.lead_table .lead_table__row.select_input {
		padding: 0;
	}
	.lead_table .lead_table__row.select_input select {
		width: 100%;
		height: 100%;
		padding: 10px;
		outline: none;
		border-color: transparent;
		background-color: transparent;
	}
	.error-main {
		padding: 0 40px;
	}
	.error-logo {
		text-align: center;
		padding-top: 25px;
	}
	.error-body {
		display: flex;
		flex-direction: column;
		justify-content: center;
		align-items: center;
	}
	.error-content {
		padding-top: 80px;
		padding-bottom: 60px;
		text-align: center;
	}
	.error-content__image {
		padding: 0 10px;
	}
	.error-content__image img {
		width: 100%;
	}
	.error-content__title {
		margin-top: 25px;
		font-size: 17px;
		line-height: 22px;
		color: shade-color(#0d6efd, 8);
		font-weight: 700;
	}
	.error-content__description {
		margin-top: 7px;
		font-size: 16px;
		line-height: 20px;
		color: #6c757d;
	}
	.error-buttons {
		display: flex;
		justify-content: space-between;
		align-items: center;
	}
	.error-btn-download {
		display: block;
		width: calc(50% - 3.5px);
	}
	.error-btn-download img {
		width: 100%;
	}
	.pagination {
		display: flex;
	}
	.pagination_btn {
		padding: 2px 8px;
		margin-left: 5px;
		background: transparent;
		color: #000;
		cursor: pointer;
		border-radius: 4px;
		border: 2px solid transparent;
		text-align: center;
	}
	.pagination_btn:hover {
		color: #0d6efd;
	}
	.pagination_btn:first-child {
		margin-left: 0px;
	}
	.pagination_btn.pagination_btn__active {
		border: 2px solid #0d6efd;
		font-weight: bold;
		color: #0d6efd;
	}
	.pagination_btn.pagination_btn__disabled {
		opacity: 50%;
		pointer-events: none;
		cursor: default;
	}
	.pagination_btn.pagination_navigator {
		border: none;
		display: flex;
		align-items: center;
	}
	.pagination_btn.pagination_navigator:first-child {
		padding-left: 0;
	}
	.pagination_btn.pagination_navigator:last-child {
		padding-right: 0;
		margin-left: 0;
	}
	.bot_edit {
		height: 100%;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		max-width: 100%;
	}
	.bot_edit__body {
		background: white;
		flex: 1;
		overflow: auto;
		position: relative;
	}
	.bot_build {
		user-select: none;
		position: relative;
		width: 100%;
		margin-bottom: 100px;
		height: 100%;
		overflow: auto;
		background-color: #e6e1da;
	}
	.bot_add_action_btn {
		color: rgba(0, 0, 0, 0.2);
		font-size: 15px;
		display: flex;
		font-weight: 600;
		align-items: center;
		justify-content: center;
		border-radius: 5px;
		width: 18px;
		height: 18px;
		border: 2px solid rgba(0, 0, 0, 0.2);
		background: transparent;
		cursor: pointer;
		transition:
			color 0.15s,
			border-color 0.15s;
	}
	.bot_add_action_btn:hover {
		color: #444;
		border-color: #444;
	}
	.bot_add_action_btn.bot_add_action_btn__orange:hover {
		color: #f3aa18;
		border-color: #f3aa18;
	}
	.bot_add_action_btn:hover {
		color: #0d6efd;
		border-color: #0d6efd;
	}
	.bot_remove_action_btn:hover {
		color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.bot_main {
		flex: 1;
		position: relative;
		overflow: hidden;
	}
	.bot_zoom_control {
		position: absolute;
		bottom: 20px;
		left: 20px;
		z-index: 10;
		display: flex;
		align-items: center;
	}
	.btn.bot_zoom_btn {
		padding: 0;
		display: flex;
		align-items: center;
		justify-content: center;
		width: 32px;
		height: 32px;
	}
	.bot_hline {
		height: 2px;
		width: 15px;
		background: rgba(0, 0, 0, 0.1019607843);
	}
	.bot_line {
		flex-shrink: 0;
		width: 24px;
		height: 2px;
		background: rgba(0, 0, 0, 0.1019607843);
	}
	.bot_line.bot_line__error {
		background: transparent;
		height: 40px;
	}
	.bot_line.bot_line__short {
		height: 10px;
	}
	.bot_line.bot_line__very_short {
		height: 2px;
	}
	.bot_condition {
		border-radius: 5px;
		z-index: 3;
		max-width: 320px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.bot_condition.bot_condition__orange {
		background: #f3aa18;
		color: #fff;
		padding: 3px 10px;
	}
	.bot_condition.bot_condition__green {
		background: #19b600;
		color: #fff;
		padding: 3px 10px;
	}
	.bot_condition.bot_condition__yellow {
		background: #777;
		color: #fff;
		padding: 3px 10px;
	}
	.bot_condition.bot_condition__else {
		background: #bbb;
		color: #fff;
		padding: 3px 10px;
	}
	.bot_message_text {
		white-space: pre-wrap;
		border-radius: 10px;
		border-top-right-radius: 0;
		border-bottom-left-radius: 0;
		word-break: break-word;
		position: relative;
		padding: 5px 10px;
		overflow: auto;
		display: inline-block;
		border: 1px solid #addaff;
		color: #000;
		background: #e9f8ff;
	}
	.bot_message_text a {
		color: #0d6efd;
	}
	.bot-sidebar {
		height: 100%;
		width: 400px;
		display: flex;
		flex-direction: column;
		position: relative;
		border-left: 1px solid #e5e5e5;
	}
	.bot-sidebar__head {
		display: flex;
		align-items: center;
		padding: 10px 30px;
		border-bottom: 1px solid #dee2e6;
	}
	.bot-sidebar__head-title {
		font-weight: 500;
		font-size: 1rem;
		margin-right: 20px;
	}
	.bot-sidebar__head-back {
		cursor: pointer;
		stroke: #adb5bd;
		margin-left: -8px;
		margin-right: 5px;
	}
	.bot-sidebar__head-back:hover {
		stroke: #212529;
	}
	.bot-sidebar__body {
		padding: 20px 30px;
		flex-shrink: 0;
		flex: 1;
		overflow-y: auto;
	}
	.bot-sidebar__foot {
		height: 63px;
		flex-shrink: 0;
		display: flex;
		align-items: center;
		padding: 10px 30px;
		border-top: 1px solid #dee2e6;
		margin-top: auto;
	}
	.bot-sidebar__actions {
		display: flex;
		flex-wrap: wrap;
		justify-content: space-between;
		margin-bottom: 10px;
	}
	.bot-sidebar__action {
		margin-bottom: 10px;
		padding-right: 5px;
		display: flex;
		flex: 1;
		width: 200px;
		min-width: 150px;
		overflow: hidden;
		word-break: break-word;
		align-items: center;
		cursor: pointer;
	}
	.bot-sidebar__action:hover .bot-sidebar__action-text {
		color: #000;
	}
	.bot-sidebar__action.action--disabled {
		opacity: 0.4;
	}
	.bot-sidebar__action.action--disabled:hover {
		cursor: default;
	}
	.bot-sidebar__action.action--disabled:hover .bot-sidebar__action-text {
		color: unset;
	}
	.bot-sidebar__action-title {
		color: #495057;
		margin-bottom: 10px;
		font-weight: 500;
	}
	.bot-sidebar__action-icon {
		width: 30px;
		height: 30px;
		border-radius: 5px;
		margin-right: 10px;
		background-color: #e9ecef;
		flex-shrink: 0;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	div.bot-sidebar__action-icon__tasks_remind {
		background-color: #ffce6f;
	}
	div.bot-sidebar__action-icon__language {
		background-color: #ffce6f;
	}
	div.bot-sidebar__action-icon__selling {
		background-color: #f6deff;
	}
	div.bot-sidebar__action-icon__conversation_settings {
		background-color: #deebff;
	}
	div.bot-sidebar__action-icon__user {
		background-color: #ffdede;
	}
	div.bot-sidebar__action-icon__bot_flow_control {
		background-color: #fff2a9;
	}
	div.bot-sidebar__action-icon__bot_integrate_with_other_systems {
		background-color: #ecffde;
	}
	.bot-sidebar__action-text {
		color: #495057;
	}
	.bot-sidebar__tab {
		display: none;
	}
	.bot-sidebar__tab.tab--active {
		display: blo;
	}
	.bot-form {
		margin-bottom: 20px;
	}
	.bot-form.bot-form--mb-lg {
		margin-bottom: 50px;
	}
	.bot-form.bot-form--mb-sm {
		margin-bottom: 15px;
	}
	.bot-form.bot-form--mb-none {
		margin-bottom: 0;
	}
	.bot-form__help {
		display: flex;
		margin-top: 5px;
		align-items: center;
		color: #adb5bd;
		cursor: pointer;
		font-size: 14px;
	}
	.bot-form__help:hover {
		color: #495057;
	}
	.bot-message-edit {
		position: absolute;
		width: 32px;
		height: 32px;
		border-radius: 50%;
		box-shadow: 0 2px 5px rgba(0, 0, 0, 0.15);
		border: 1px solid #dee2e6;
		right: 22px;
		top: -16px;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		background-color: #fff;
		z-index: 5;
	}
	.bot-message-delete {
		position: absolute;
		width: 24px;
		height: 24px;
		border-radius: 50%;
		border: 1px solid #dee2e6;
		right: -10px;
		top: -10px;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		background-color: #fff;
		z-index: 5;
	}
	.bot-message-delete__icon {
		width: 14px;
		height: 14px;
		stroke-width: 2;
		stroke: #adb5bd;
	}
	.bot-message-delete:hover .bot-message-delete__icon {
		stroke: #495057;
	}
	.bot-add-message-btn {
		display: flex;
		align-items: center;
		font-size: 1rem;
	}
	.bot-add-message-btn__icon {
		width: 18px;
		height: 18px;
		stroke: #0d6efd;
		margin-right: 5px;
		margin-bottom: 2px;
	}
	.bot-add-message__drop-icon {
		width: 32px;
		height: 32px;
		background: shade-color(#0d6efd, 4);
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 4px;
		margin-right: 10px;
	}
	.bot-form__label {
		user-select: none;
		margin-bottom: 5px;
		font-weight: 500;
		display: flex;
		align-items: center;
	}
	.bot-form__label.label--light {
		font-size: 0.875rem;
		color: #495057;
	}
	.bot-form__desc {
		margin-bottom: 5px;
		color: #495057;
	}
	.bot-response {
		margin-bottom: 20px;
		font-size: 1rem;
		font-weight: 500;
	}
	.bot-textarea {
		cursor: text;
		position: relative;
		border: 1px solid #cacaca;
		background-color: #fff;
		border-radius: 4px;
		display: flex;
		flex-wrap: wrap;
	}
	.bot-textarea.is-invalid {
		border-color: #ea3d2f;
	}
	.bot-textarea:hover {
		border-color: #646464;
	}
	.bot-textarea:hover .bot-textarea__actions {
		opacity: 1;
	}
	.bot-textarea__actions {
		display: flex;
		position: relative;
		margin: 0;
		padding: 5px 10px;
		white-space: nowrap;
		justify-content: flex-end;
		width: 100%;
		margin-top: auto;
		opacity: 0;
		transition: opacity 150ms ease;
	}
	.bot-textarea__action-icon {
		stroke: #495057;
	}
	.bot-textarea__action-icon:hover {
		stroke: #000;
	}
	.bot-textarea__action-item {
		cursor: pointer;
		position: relative;
		padding: 2px 4px;
		line-height: 1;
		margin-right: 5px;
	}
	.bot-textarea__action-item.item--active {
		background-color: #e9ecef;
		box-shadow: 0 0 0 1px #adb5bd;
		border-radius: 4px;
	}
	.bot-textarea__dropdown {
		display: flex;
		flex-direction: column;
		z-index: 20;
		position: absolute;
		top: calc(100% + 5px);
		left: 0;
		min-width: 250px;
		background: #fff;
		border-radius: 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		padding: 20px;
	}
	.bot-textarea__dropdown.dropdown--has-arrow:before {
		position: absolute;
		content: '';
		top: -8px;
		width: 16px;
		height: 16px;
		background-color: #fff;
		transform: rotate(45deg);
		border: 1px solid transparent;
		border-top-color: #dee2e6;
		border-left-color: #dee2e6;
	}
	.bot-textarea__dropdown.dropdown--right.dropdown--has-arrow:before {
		right: 15px;
	}
	.quick-response-input .vue-tags-input .ti-input {
		border-radius: 0;
		padding: 5px;
	}
	.quick-response-input .vue-tags-input.ti-focus .ti-input {
		border-color: #646464;
	}
	.quick-response-input .vue-tags-input .ti-input .ti-tag {
		padding: 5px 10px;
		font-size: 0.875rem;
		margin: 2px 5px 2px 0;
		border-radius: 4px;
		background-color: #ebf6ff;
		color: shade-color(#0d6efd, 8);
	}
	.quick-response-input .vue-tags-input .ti-input .ti-tag:hover {
		background-color: #e0f1ff;
	}
	.quick-response-input .vue-tags-input .ti-new-tag-input {
		font-size: 0.875rem;
	}
	.quick-response-input .vue-tags-input .ti-item.ti-selected-item {
		background-color: #e0f1ff;
		color: shade-color(#0d6efd, 8);
	}
	.bot-list {
		padding: 20px;
		padding-bottom: 50px;
		height: 100%;
		max-width: 100%;
		position: relative;
		flex: 1;
		overflow: auto;
		display: flex;
		flex-direction: column;
	}
	.bot-list__head {
		display: flex;
		margin-bottom: 20px;
	}
	.bot-list__head-title {
		margin-bottom: 5px;
		font-weight: 500;
		line-height: 1.25;
		font-size: 1.5rem;
	}
	.bot-list__head-subtitle {
		font-size: 0.875rem;
		color: #495057;
	}
	.bot-list__table {
		position: relative;
		width: 100%;
		display: flex;
		flex-direction: column;
	}
	.bot-list__table-row {
		width: 100%;
		display: flex;
		flex-wrap: nowrap;
	}
	.bot-list__table-cell {
		flex: 1;
		background-color: #fff;
		border-top: 1px solid #dee2e6;
		padding: 10px;
		white-space: nowrap;
		align-items: center;
		display: flex;
		overflow: hidden;
	}
	.bot-list__table-cell.cell--header {
		background-color: #f8f9fa;
		font-weight: 500;
	}
	.bot_target {
		padding: 30px 0;
		flex: 1;
	}
	.bot_target__wrapper {
		max-width: 700px;
	}
	.bot_target_section {
		margin-bottom: 30px;
	}
	.bot_target_section_title {
		font-size: 18px;
		font-weight: 500;
		color: #343a40;
	}
	.bot_target_section_desc {
		color: #6c757d;
	}
	.bot_target_trigger {
		display: flex;
	}
	.bot_target_add_link {
		display: flex;
		align-items: center;
		margin-top: 5px;
	}
	.bot_target_add_link__icon {
		width: 16px;
		height: 16px;
		margin-right: 5px;
	}
	.bot_target_add_trigger {
		top: 40px;
		left: 0px;
	}
	.bot_target_add_trigger__dropdown_item.dropdown__item {
		display: block;
	}
	.bot_target_add_trigger__item_desc {
		white-space: pre-wrap;
		color: #6c757d;
	}
	.bot_target_add_trigger__dropdown_item:hover .bot_target_add_trigger__item_desc {
		color: #fff;
	}
	.bot_target_add_trigger__item_title {
		white-space: pre-wrap;
		font-weight: 500;
	}
	.bot__assign__tooltip {
		width: 16px;
		height: 16px;
		margin-left: 5px;
		margin-top: -2px;
		color: #6c757d;
	}
	.bot-triggers .bot-cond__add__btn {
		margin-left: 0;
	}
	.bot_target_trigger {
		padding: 0 0 10px 0;
		display: flex;
		flex-direction: row-reverse;
		justify-content: space-between;
		align-items: center;
	}
	.bot-trigger__item {
		background-color: #fff;
		border-radius: 4px;
		overflow: hidden;
		margin-bottom: 15px;
	}
	.bot-trigger__item:last-child {
		margin-bottom: 0;
	}
	.bot_trigger__title {
		font-weight: 500;
	}
	.bot-trigger__item-desc {
		color: #6c757d;
	}
	.bot-trigger__item-body {
		padding: 0 20px 10px 20px;
		padding-left: 0;
		padding-bottom: 0;
	}
	.bot-trigger__item-body--none {
		display: none;
	}
	.bot-trigger__item-body textarea {
		width: 100%;
		resize: none;
		border: solid 1px #bfbfbf;
		border-radius: 4px;
		padding: 10px;
	}
	.condition_section_content .bot_target_trigger {
		padding: 0;
		border: none;
		margin: 0;
	}
	/*
   * Bot Conditions
   */
	.bot_graph_branching_section {
		display: flex;
		align-items: center;
		justify-content: center;
		position: relative;
	}
	.bot_build_back_btn {
		cursor: pointer;
		display: flex;
		align-items: center;
		padding: 0 20px;
		height: 100%;
	}
	.bot_build_back_btn:hover {
		color: #0d6efd;
	}
	/*
   * Select Bot Template Popup
   */
	.bot-create__popup {
		height: 700px;
		position: relative;
		width: 800px;
		display: flex;
		flex-direction: column;
		max-height: 90vh;
		overflow: hidden;
	}
	.bot-create__close {
		position: absolute;
		text-align: right;
		top: 10px;
		right: 10px;
	}
	.bot-create__title {
		margin-top: 30px;
		text-align: center;
		font-size: 30px;
	}
	.bot-create__desc {
		text-align: center;
		color: #808080;
		margin: 0 80px 50px 80px;
	}
	.bot-create__category_title {
		font-size: 26px;
		font-weight: 500;
		margin-left: 50px;
	}
	.bot-create__category_desc {
		margin-left: 50px;
		font-size: 15px;
	}
	.bot-create__list {
		margin-top: 20px;
		margin-left: 40px;
		display: flex;
		flex: 1;
		position: relative;
		flex-wrap: wrap;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__1 {
		background: #001757;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__2 {
		background: #0b358e;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__3 {
		background: #ee6f57;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__4 {
		background: #fdca40;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__5 {
		background: #8d91c7;
	}
	.bot-create__item-body-bg.bot-create__item-body-bg__6 {
		background: #b0daf1;
	}
	.bot-create__item {
		border-radius: 10px;
		flex-shrink: 0;
		width: 300px;
		cursor: pointer;
		position: relative;
		background: #fff;
		overflow: hidden;
		margin-bottom: 30px;
		margin-left: 10px;
		margin-right: 10px;
		height: 350px;
		box-shadow: 0px 3px 8px rgba(0, 0, 0, 0.1);
	}
	.bot-create__item:hover {
		box-shadow: 0px 3px 8px rgba(0, 0, 0, 0.2);
	}
	.bot-create__item:hover {
		border-color: #0d6efd;
	}
	.bot-create__item-avatar {
		position: absolute;
		z-index: 3;
		border-radius: 50%;
		border: 5px solid #fff;
		background: #fff;
		left: 20px;
		top: 60px;
		width: 60px;
		height: 60px;
		margin: 0;
		overflow: hidden;
	}
	.bot-create__item-tag {
		z-index: 5;
		font-size: 12px;
		position: absolute;
		right: 20px;
		background: white;
		top: 20px;
		border-radius: 5px;
		box-shadow: 0 0 5px rgba(0, 0, 0, 0.25);
		padding: 5px 10px;
		display: flex;
		align-items: center;
	}
	.bot-create__item-avatar img {
		max-width: 100%;
		max-width: 100%;
		object-fit: cover;
	}
	.bot-create__item-template-name {
		font-weight: 600;
		font-size: 18px;
	}
	.bot-create__item-body {
		padding-left: 20px;
		background: #fff;
		height: 130px;
		margin-top: 90px;
		padding: 40px 20px 10px 20px;
		background: transparent;
		height: 130px;
		position: relative;
		background: #fff;
	}
	.bot-create__item-body-bg {
		position: absolute;
		top: 0;
		left: 0;
		right: 0;
		height: 100px;
	}
	.bot-create__item-desc {
		color: #808080;
	}
	.bot-create__item input {
		display: none;
	}
	.bot-setting {
		width: 100%;
	}
	.bot-setting-section {
		margin-bottom: 50px;
	}
	.bot-setting-section:last-child {
		margin-bottom: 0;
	}
	.bot-setting__wrapper {
		padding: 20px 40px;
		max-width: 700px;
	}
	.bot-setting__avatar {
		display: flex;
		align-items: center;
	}
	.bot-setting__avatar-thumb {
		width: 130px;
		height: 130px;
		border-radius: 10px;
		overflow: hidden;
		margin-right: 20px;
		position: relative;
		cursor: pointer;
		border: solid 1px #bfbfbf;
	}
	.bot-setting__avatar-overlay {
		position: absolute;
		top: 80%;
		left: 0;
		width: 100%;
		height: 20%;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: rgba(0, 0, 0, 0.5);
		color: #fff;
		font-size: 14px;
		cursor: pointer;
		text-align: center;
	}
	.bot-setting__avatar-icon {
		stroke: #fff;
		width: 18px;
		height: 18px;
		margin-right: 5px;
	}
	.bot-setting__avata-input {
		padding: 20px;
		border: solid 1px #bfbfbf;
		border-radius: 4px;
		width: 100%;
	}
	.bot-setting__avatar-thumb img {
		width: 130px;
		height: 130px;
		object-fit: cover;
	}
	.bot-setting__form {
		display: flex;
		margin-top: 15px;
		align-items: center;
		padding-top: 15px;
		border-top: solid 1px #bfbfbf;
	}
	.bot-setting__form-label {
		margin-bottom: 2px;
	}
	.bot-setting__form-input {
		flex: 1;
	}
	.bot-setting__form-input input {
		width: 100%;
		height: 42px;
		border: solid 1px #bfbfbf;
		border-radius: 4px;
		padding: 0 15px;
	}
	.bot-setting__avatar-list {
		display: flex;
		align-items: center;
		text-align: center;
		flex-wrap: wrap;
		margin-top: 10px;
		max-height: 500px;
		overflow: auto;
	}
	.bot-setting__avatar-item {
		margin-right: 15px;
		margin-bottom: 15px;
		cursor: pointer;
		border: solid 1px transparent;
		border-radius: 8px;
		width: 60px;
		height: 60px;
		position: relative;
		transition: 0.2s;
	}
	.bot-setting__avatar-item:hover {
		box-shadow: 0 0 5px rgba(0, 0, 0, 0.25);
		transform: translateY(-1px);
	}
	.bot-setting__avatar-item.item--no-hover:hover {
		box-shadow: none;
		transform: translateY(0px);
	}
	.bot-setting__avatar-item--active {
		box-shadow: 0 0 5px rgba(0, 0, 0, 0.25);
	}
	.bot-setting__avatar-item-thumb {
		width: 100%;
		height: 100%;
		border-radius: 8px;
		overflow: hidden;
	}
	.bot-setting__avatar-item-thumb img {
		max-width: 100%;
		max-height: 100%;
		object-fit: cover;
	}
	.bot_edit_header {
		border-bottom: 1px solid #e5e5e5;
		display: flex;
		align-items: center;
		background: #fff;
		align-items: center;
		height: 50px;
		padding-right: 20px;
		flex-shrink: 0;
	}
	.bot_edit_header__name {
		overflow: hidden;
		word-break: break-all;
		white-space: nowrap;
		text-overflow: ellipsis;
		margin-left: 10px;
		font-weight: 600;
		font-size: 15px;
		flex: 1;
		margin-right: 20px;
	}
	.bot-setting__popup {
		width: 700px;
		position: relative;
		padding: 20px;
	}
	.bot-setting__popover::after {
		opacity: 0;
		top: 30px;
		left: -9px;
	}
	.bot-setting__popover-title {
		font-weight: 600;
		margin-bottom: 10px;
	}
	.bot-setting__popover-section:not(:first-child) {
		padding-top: 20px;
		margin-top: 20px;
		border-top: solid 1px #dee2e6;
	}
	.bot_list__table_empty {
		color: #6c757d;
		text-align: center;
		padding-top: 40px;
	}
	.bot_list__table_empty .bot-create__list {
		max-width: 650px;
		margin: 0 auto;
	}
	.bot-list__table-cell-icon {
		width: 16px;
		height: 16px;
	}
	.bot-setting__title {
		font-size: 16px;
		margin-bottom: 5px;
		font-weight: 500;
		color: #000;
	}
	.bot-setting__form-group {
		margin-bottom: 25px;
	}
	.bot_edit__main {
		display: flex;
		overflow: hidden;
		flex: 1;
		width: 100%;
		height: 100%;
	}
	.bot_step.bot_step__collapsed {
		width: 40px;
	}
	.bot_step {
		width: 240px;
		padding: 10px 10px;
		z-index: 1;
		border-right: 1px solid #e5e5e5;
	}
	.bot_step__item {
		padding-top: 5px;
		padding-bottom: 5px;
		margin-top: 5px;
		margin-bottom: 5px;
		border-radius: 8px;
		padding-left: 10px;
		padding-right: 10px;
		cursor: pointer;
		flex-shrink: 0;
		user-select: none;
	}
	.bot_step__item:hover {
		background: #e9ecef;
	}
	.bot_step__item::after {
		content: none;
	}
	.bot_step__item.bot_step__item--disabled {
		cursor: not-allowed;
		opacity: 0.55;
	}
	.bot_step__item.bot_step__item--disabled:hover {
		background: transparent;
	}
	.bot_step__title {
		display: flex;
		align-items: center;
	}
	.bot_step__index {
		margin-right: 10px;
		color: #6c757d;
	}
	.bot_step__item.bot_step__item--active {
		background: #e9ecef;
	}
	.bot_step__item.bot_step__item--active .bot_step__title {
		font-weight: 500;
	}
	.bot_step__item.bot_step__item--active .bot_step__index {
		color: #495057;
	}
	.bot_step__item.bot_step__item--active .bot_step__desc {
		color: #0d6efd;
	}
	.bot_step__desc {
		margin-left: 36px;
		margin-top: 2px;
		font-weight: 400;
		font-size: 15px;
	}
	.btn__back_to_bot_list {
		border: solid 1px #808080;
	}
	.bot-sidebar__body.bot-sidebar__widget_error {
		display: flex;
		align-items: center;
		justify-content: center;
		flex-direction: column;
		overflow: hidden;
		padding: 0;
	}
	.bot-sidebar__widget_body {
		display: flex;
		align-items: center;
		flex: 1;
		overflow: hidden;
		padding: 0;
	}
	.bot_widget {
		width: 400px;
		overflow: hidden;
		background: white;
		flex-shrink: 0;
		z-index: 9;
		flex-direction: column;
		display: flex;
		border-left: 1px solid #e5e5e5;
		transition: all 100ms ease;
	}
	.bot-setting__name {
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.bot-setting__current-avatar {
		width: 100%;
	}
	.bot-setting__current-avatar--active {
		box-shadow: 0 0 10px rgba(0, 0, 0, 0.3);
	}
	.bot-setting__popover {
		width: 600px;
	}
	.bot-setting__upload {
		margin: 0;
		width: 100%;
		height: 100%;
		display: flex;
		align-items: center;
		justify-content: center;
		flex-direction: column;
		cursor: pointer;
		border-radius: 8px;
		font-size: 14px;
		stroke: #808080;
		outline: none;
		box-shadow: 0 0 0 1px #dee2e6;
	}
	.bot-setting__upload:hover {
		border-color: #0d6efd;
	}
	.bot-setting__upload-icon {
		stroke: #808080;
	}
	.bot-textarea__insert-var {
		position: absolute;
		top: 5px;
		right: 5px;
	}
	.bot-textarea__insert-var-button {
		line-height: 1;
		cursor: pointer;
		padding: 5px;
		border-radius: 4px;
		border: 1px solid transparent;
		background-color: transparent;
		outline: none;
		font-size: 0.675rem;
		font-weight: 600;
		letter-spacing: 1px;
	}
	.bot-textarea__insert-var-button.button--active {
		border-color: #dee2e6;
		background-color: #f8f9fa;
	}
	.bot_graph_end_section {
		display: flex;
		flex-shrink: 0;
		align-items: center;
		justify-content: center;
	}
	.bot_graph_action.bot_graph_action__bot_end {
		cursor: default;
	}
	.bot-report {
		padding: 20px 40px;
		display: flex;
		flex-direction: column;
		height: 100%;
	}
	.bot-report-convos {
		flex: 1 0 auto;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.bot-statistic-box {
		position: relative;
		border: 1px solid #dee2e6;
		border-radius: 4px;
		display: flex;
		flex-direction: column;
	}
	.bot-statistic-box__head {
		display: flex;
		width: 100%;
		padding: 10px 20px;
		border-bottom: 1px solid #dee2e6;
	}
	.bot-statistic-box__body {
		min-height: 300px;
		flex: 1 0 auto;
		padding: 20px;
		display: flex;
	}
	.bot-statistic-overview-box {
		margin: 2px 0;
		padding: 0 20px;
		border-right: 1px solid #dee2e6;
	}
	.bot-statistic-overview-box:first-child {
		padding-left: 0;
	}
	.bot-statistic-overview-box:last-child {
		border: none;
	}
	.bot-statistic-overview-box__title {
		font-size: 0.75rem;
		line-height: 1;
	}
	.bot-statistic-overview-box__value {
		font-weight: 600;
		font-size: 1.125rem;
		line-height: 22px;
	}
	.bot-convos-btn {
		border: 1px solid #dee2e6;
		background-color: #fff;
		display: flex;
		align-items: center;
	}
	.bot-convos-btn:hover {
		background-color: rgba(33, 33, 33, 0.02);
		border-color: #adb5bd;
	}
	.bot_quick_replies {
		display: flex;
		flex-wrap: wrap;
	}
	.devider-line {
		margin-top: 15px;
		margin-bottom: 15px;
		font-size: 1rem;
		font-weight: 400;
		text-align: center;
		position: relative;
		line-height: 1;
		text-transform: uppercase;
		letter-spacing: 1px;
		color: #adb5bd;
	}
	.devider-line:before {
		content: '';
		position: absolute;
		width: 100%;
		height: 1px;
		left: 0;
		z-index: -1;
		top: 50%;
		background-color: #dee2e6;
	}
	.bot-message__image-overlay {
		position: absolute;
		bottom: 0;
		left: 0;
		width: 100%;
		height: 24px;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: rgba(0, 0, 0, 0.5);
		color: #fff;
		font-size: 14px;
		cursor: pointer;
		text-align: center;
		border-bottom-left-radius: 4px;
		border-bottom-right-radius: 4px;
		overflow: hidden;
		padding: 0 4px;
	}
	.bot-message__image-overlay:hover {
		color: rgba(255, 255, 255, 0.8);
	}
	.bot-create__item-pro {
		position: absolute;
		z-index: 3;
		left: 61px;
		top: 95px;
		margin: 0;
		overflow: hidden;
		background: #ffc107;
		font-size: 10px;
		padding: 0 5px;
		border-radius: 3px;
		color: #fff;
	}
	.bot-create__item-pro-star {
		width: 12px;
		height: 12px;
		stroke: #ffc107;
		margin-right: 5px;
		margin-bottom: 2px;
		fill: #ffc107;
	}
	.bot_create__cards {
		display: flex;
		justify-content: center;
		flex: 1;
	}
	.bot_create__template_container {
		display: flex;
		flex: 1;
		overflow: hidden;
		width: 100%;
	}
	.bot_create__templates {
		padding-right: 10px;
		max-width: 700px;
		flex: 1;
		display: flex;
		overflow: auto;
		align-items: center;
		flex-shrink: 0;
		justify-content: space-between;
		flex-wrap: wrap;
		padding-bottom: 10px;
	}
	.bot-create__avatar-thumb {
		width: 100px;
		margin: auto;
		border-radius: 50%;
		overflow: hidden;
		position: relative;
		cursor: pointer;
	}
	.bot_create__preview {
		border-radius: 8px;
		flex: 1;
		overflow: hidden;
	}
	.bot_create__template__overlay {
		opacity: 0;
		position: absolute;
		left: 0;
		right: 0;
		top: 0;
		height: 200px;
		background: rgba(0, 0, 0, 0.4666666667);
		border-radius: 10px;
	}
	.bot_create__template__img {
		width: 200px;
		height: 200px;
		object-fit: cover;
		border-radius: 10px;
	}
	.bot_create__template {
		overflow: hidden;
		flex-shrink: 0;
		position: relative;
		margin: 0 13px 30px 13px;
		width: 200px;
		cursor: pointer;
		height: 280px;
		background: white;
		transition: all 100ms;
		color: #6c757d;
	}
	.bot_create__template:hover {
		color: #343a40;
		border-color: #000;
	}
	.bot_create__template:hover .bot_create__template__overlay {
		opacity: 1;
	}
	.bot_create__card {
		width: 300px;
		display: flex;
		cursor: pointer;
		padding: 30px;
		border: 2px solid #dee2e6;
		border-radius: 8px;
		margin: 10px;
		height: 300px;
		background: white;
		transition: all 100ms;
		color: #6c757d;
	}
	.bot_create__card:hover {
		color: #343a40;
		border-color: #0d6efd;
	}
	.bot_create__template__title {
		font-weight: 500;
		margin-top: 10px;
		color: #000;
	}
	.bot_create__card__title {
		font-size: 22px;
		color: #000;
		margin-top: 30px;
		margin-bottom: 10px;
	}
	.bot-create__body {
		display: flex;
		flex-direction: column;
		justify-content: center;
		height: 100%;
	}
	.bot-create__back_btn__icon {
		color: #fff;
		fill: lightgray;
		margin-right: 5px;
	}
	.bot-create__footer {
		display: flex;
		justify-content: center;
		padding: 20px 0;
	}
	.bot-create__back_btn {
		justify-content: center;
		cursor: pointer;
		display: flex;
		align-items: center;
		color: gray;
		width: 150px;
	}
	.bot-create__back_btn:hover {
		color: black;
	}
	.bot-create__back_btn:hover .bot-create__back_btn__icon {
		fill: gray;
	}
	.bot-triggers__tab-content {
		padding: 20px;
		border: 1px solid #dee2e6;
	}
	.bot-trigger-methods {
		display: flex;
		margin-bottom: 10px;
		align-items: center;
	}
	.bot-trigger-method-box {
		display: flex;
		align-items: center;
		justify-content: center;
		position: relative;
		flex-direction: column;
		width: 180px;
		height: 120px;
		padding: 15px;
		border: 1px solid #0d6efd;
		border-radius: 4px;
		cursor: pointer;
		margin-right: 15px;
		color: #6c757d;
	}
	.bot-trigger-method-box.method--active {
		background-color: rgba(2, 101, 255, 0.1);
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.bot-trigger-method-box__cb {
		position: absolute;
		top: 10px;
		right: 15px;
	}
	.bot-clone-page {
		width: 100%;
		height: 100%;
		position: fixed;
		top: 0;
		left: 0;
		background-color: #fff;
		z-index: 999999;
	}
	.bot-warning-icon {
		width: 18px;
		height: 18px;
		fill: #ffc107;
		stroke: #fff;
	}
	.bot-warning-content {
		position: absolute;
		width: 200px;
		top: 100%;
		right: 0;
		background: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border-radius: 8px;
		display: flex;
		flex-direction: column;
		padding: 10px 15px;
		display: none;
		z-index: 99;
		white-space: normal;
	}
	.bot-warning-container {
		position: relative;
	}
	.bot-warning-container:hover .bot-warning-content {
		display: block;
	}
	.bot-warning-container:hover:after {
		content: '';
		position: absolute;
		top: 0;
		left: -10px;
		background-color: transparent;
		width: 150px;
		height: 25px;
	}
	.bot-template-hero {
		color: #fff;
		text-align: center;
		padding-top: 200px;
		padding-bottom: 100px;
		position: relative;
		background-image:
			linear-gradient(180deg, rgba(0, 23, 87, 0.75), rgba(0, 23, 87, 0.75)), url(https://app.subiz.com.vn/dashboard-v4/public/c014587da4f81d66dc77.jpg);
		background-position:
			0 0,
			30% 30%;
		background-size: auto, cover;
	}
	.bot-template-hero__title {
		font-weight: 600;
		font-size: 3rem;
		line-height: 1.25;
		margin-bottom: 5px;
	}
	.bot-template-hero__subtitle {
		font-size: 1.125rem;
		line-height: 2rem;
		font-weight: 400;
		max-width: 1;
	}
	.bot-template-content {
		padding: 20px 0;
	}
	.bot-template-container {
		max-width: 1140px;
		margin: auto;
	}
	.bot-template-section {
		padding-top: 30px;
		padding-bottom: 30px;
		position: relative;
	}
	.bot-template-section.section--light {
		background-color: #f8f9fa;
	}
	.bot-template-section-title {
		font-weight: 600;
		font-size: 2.25rem;
		line-height: 3rem;
	}
	.bot-template-section-title.title--bold {
		font-weight: 400;
		font-size: 1.75rem;
	}
	.bot-template-list {
		display: flex;
		flex-wrap: wrap;
		margin: 0 -10px;
	}
	.bot-template-list__col {
		flex: 0 0 25%;
		max-width: 25%;
	}
	.bot-template-card {
		padding: 0 10px;
		display: flex;
		flex-direction: column;
		margin-bottom: 30px;
	}
	.bot-template-card__thumb {
		width: 100%;
		height: 260px;
		position: relative;
		border-radius: 4px;
		overflow: hidden;
	}
	.bot-template-card__thumb:hover .bot-template-card__thumb-overlay {
		opacity: 1;
		pointer-events: all;
	}
	.bot-template-card__thumb-img {
		width: 100%;
		height: 100%;
		object-fit: cover;
	}
	.bot-template-card__thumb-overlay {
		width: 100%;
		height: 100%;
		position: absolute;
		top: 0;
		left: 0;
		display: flex;
		justify-content: center;
		align-items: center;
		opacity: 0;
		pointer-events: none;
		background-color: rgba(0, 0, 0, 0.6);
	}
	.bot-template-card__name {
		margin-top: 5px;
		margin-bottom: 0;
		font-weight: 500;
		font-size: 1.125rem;
		line-height: 2rem;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.bot-template-card__desc {
		font-size: 1rem;
		line-height: 1.5;
	}
	.bot-template-images {
		display: flex;
		flex: 1 0 700px;
		align-items: center;
		overflow-x: auto;
		padding: 20px 0px;
		user-select: none;
	}
	.bot-template-img {
		display: block;
		margin: 0 20px;
		height: 500px;
		width: 300px;
		border-radius: 4px;
		max-width: 100%;
		position: relative;
		flex-shrink: 0;
		overflow: hidden;
		box-shadow: 11px 3px 30px 0 rgba(0, 0, 0, 0.13);
	}
	.bot-template-image-add {
		border: 2px dashed;
		display: flex;
		justify-content: center;
		align-items: center;
		cursor: pointer;
		min-width: 300px;
		background-color: #fff;
		max-width: 300px;
	}
	.bot-template-image-add:hover {
		background-color: #f8f9fa;
	}
	.bot-template-img__actions {
		position: absolute;
		left: 0;
		bottom: 0;
		width: 100%;
		background-color: rgba(0, 0, 0, 0.25);
		color: #fff;
		display: flex;
		justify-content: center;
		padding: 10px 0;
	}
	.bot-template-img__action {
		cursor: pointer;
		width: 16px;
		height: 16px;
	}
	.bot-template-img__action:hover {
		color: #e9ecef;
	}
	.bot-template-tab {
		padding: 0 10px;
		font-size: 1.25rem;
	}
	.bot-template-tab-content {
		display: flex;
		margin-top: 20px;
	}
	.bot-template-description {
		flex: 0 0 50%;
		padding-right: 50px;
	}
	.bot-template-features {
		margin-left: 100px;
		flex: 1;
		display: flex;
		flex-direction: column;
		justify-content: center;
	}
	.bot-template-feature-item {
		padding: 10px;
		background-color: #f8f9fa;
		border-bottom: 1px solid #dee2e6;
		font-weight: 500;
		border: 1px solid #dee2e6;
		border-bottom: none;
		display: flex;
		align-items: center;
	}
	.bot-template-feature-item:first-child {
		border-top-left-radius: 8px;
		border-top-right-radius: 8px;
	}
	.bot-template-feature-item:last-child {
		border-bottom-left-radius: 8px;
		border-bottom-right-radius: 8px;
		border-bottom: 1px solid #dee2e6;
	}
	.bot-template-feature-item__actions {
		margin-left: auto;
	}
	.bot-template-feature-item__action {
		width: 14px;
		height: 14px;
	}
	.bot-template-support {
		padding: 20px;
		border-radius: 4px;
		border: 1px solid #dee2e6;
	}
	.bot-template-faqs {
		margin-top: 30px;
	}
	.bot-template-faqs__title {
		font-size: 1.25rem;
		font-weight: 600;
		line-height: 2rem;
		margin-bottom: 5px;
	}
	.bot-template-faqs__row {
		display: flex;
		flex-wrap: wrap;
		margin-left: -10px;
		margin-right: -10px;
	}
	.bot-template-faqs__col {
		padding: 0 10px;
		flex: 0 0 50%;
		margin-bottom: 20px;
	}
	.bot-template-hero__edit-thumb {
		position: absolute;
		top: 20px;
		right: 20px;
		cursor: pointer;
	}
	.bot-template-navbar {
		position: absolute;
		top: 0;
		width: 100%;
		padding: 15px 0;
		color: #fff;
		background-color: rgba(0, 23, 87, 0.5);
		z-index: 1;
	}
	.bot-template-navbar__links {
		margin-left: auto;
		display: flex;
		align-items: center;
	}
	.bot-template-navbar__item {
		margin-right: 10px;
		color: #e9ecef;
		font-weight: 500;
		padding: 10px;
	}
	.bot-template-navbar__item:hover {
		color: #fff;
	}
	.bot-template-footer {
		width: 100%;
		background-color: #212529;
		padding: 15px 0;
	}
	.bot-template-footer__logo {
		width: 110px;
		height: 30px;
	}
	.bot-template-footer__copyright {
		color: #ecf0f1;
	}
	.bot-template-footer__link {
		margin-left: 10px;
		width: 24px;
		height: 24px;
		border-radius: 4px;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: #7f7f7f;
	}
	.bot-template-footer__link:hover {
		background-color: #fff;
	}
	.bot-template-footer__link svg {
		fill: #212529;
		stroke-width: 1;
		width: 14px;
		height: 14px;
		stroke: #212529;
	}
	.bot-template {
		display: flex;
		flex: 1;
		flex-direction: column;
		overflow: auto;
		height: 100%;
	}
	.bot-template-tags {
		max-width: 600px;
		margin: auto;
		display: flex;
		flex-wrap: wrap;
		justify-content: center;
		margin-top: 50px;
		margin-bottom: -80px;
	}
	.bot-template-tag {
		border-radius: 10px;
		padding-left: 10px;
		padding-right: 10px;
		margin: 0 5px 10px;
		cursor: pointer;
	}
	.bot-template-tag:hover {
		background-color: #dee2e6;
	}
	.bot-template-actions {
		padding: 30px 0;
		width: 100%;
		background-color: #f8f9fa;
	}
	.bot-template-created-by {
		margin-top: 10px;
		margin-bottom: 15px;
		font-size: 1.75rem;
		font-weight: 400;
	}
	.bot-template-faqs__head {
		flex: 1 0 33.33%;
		padding-right: 20px;
	}
	.bot-template-faqs__icon {
		width: 56px;
		height: 56px;
		background-color: #0d6efd;
		margin-bottom: 10px;
		border-radius: 50%;
		color: #fff;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.bot-template__paragraph {
		font-size: 1rem;
	}
	.bot-template-newsletter__bg {
		margin-right: 60px;
	}
	.bot-template-newsletter {
		display: flex;
		flex-direction: column;
		justify-content: center;
		flex: 1;
	}
	.bot-template-introduce {
		max-width: 350px;
		margin-right: 40px;
		display: flex;
		flex-direction: column;
		justify-content: center;
	}
	.bot-template-features-images {
		display: flex;
	}
	.bot-template-features-images__col {
		display: flex;
		flex-direction: column;
		margin-right: 40px;
	}
	.bot-template-features-images__col:last-child {
		margin-top: 40px;
	}
	.bot-conditions {
		padding: 20px 40px;
		max-width: 700px;
	}
	.bot-conditions-section {
		margin-top: 15px;
	}
	.bot-conditions-section:first-child {
		margin-top: 30px;
	}
	.bot-conditions-card {
		width: 100%;
		position: relative;
		border: 1px solid #dee2e6;
		border-radius: 4px;
	}
	.bot-conditions-card__content {
		position: relative;
		padding: 20px 20px;
	}
	.bot-conditions-card__content.condition--negative {
		background-color: #f8f9fa;
		border-bottom-right-radius: 4px;
		border-bottom-left-radius: 4px;
	}
	.bot-conditions-card__content.condition--negative .bot-conditions-card__title {
		border-top-color: transparent;
		border-right-color: transparent;
		background-color: #f8f9fa;
	}
	.bot-conditions-card__title {
		position: absolute;
		top: -18px;
		left: -1px;
		background: #fff;
		padding: 5px 20px 0;
		font-weight: 500;
		color: #6c757d;
		border: 1px solid #dee2e6;
		border-top-right-radius: 4px;
		border-top-left-radius: 4px;
		border-bottom: none;
	}
	.bot-conditions-card__title:after {
		content: '';
		position: absolute;
		background-color: inherit;
		width: 10px;
		height: 10px;
		bottom: 0;
		right: -1px;
	}
	.bot-conditions-card__cell {
		margin-right: 20px;
		display: flex;
		flex-direction: column;
	}
	.bot-conditions-card__cell:last-child {
		margin-right: 0;
	}
	.bot-template-features__img {
		width: 300px;
		height: 300px;
		margin-bottom: 20px;
		border-radius: 8px;
		box-shadow: 0 5px 20px rgba(0, 0, 0, 0.15);
	}
	.bot-template-features__item {
		margin-bottom: 20px;
		font-size: 1rem;
	}
	.bot-template-features__item:last-child {
		margin-bottom: 0;
	}
	.bot-template-features__items {
		margin-top: 20px;
		margin-bottom: 30px;
	}
	.bot-conditions-devider {
		padding: 8px 0 8px 6px;
		font-size: 12px;
		color: #adb5bd;
		width: fit-content;
		position: relative;
		line-height: 1;
	}
	.bot-conditions-devider:before {
		content: '';
		left: 10px;
		top: 0;
		position: absolute;
		height: 4px;
		width: 1px;
		background-color: #adb5bd;
	}
	.bot-conditions-devider:after {
		content: '';
		left: 10px;
		bottom: 0;
		position: absolute;
		height: 4px;
		width: 1px;
		background-color: #adb5bd;
	}
	.bot-conditions-devider.devider--lg {
		padding: 15px 0 15px 6px;
		font-size: 1rem;
	}
	.bot-conditions__title {
		font-size: 1.25rem;
		color: #000;
		margin-bottom: 0;
		line-height: 1.2;
		font-weight: 500;
	}
	.bot-conditions__subtitle {
		color: #495057;
		margin-bottom: 10px;
	}
	.bot-conditions__seperator-line {
		width: 1px;
		height: 40px;
		margin-left: 25px;
		line-height: 40px;
		background-color: #dee2e6;
	}
	.bot-conditions__seperator-line.line--short {
		height: 20px;
		line-height: 20px;
	}
	.bot-conditions__seperator-line.line--small {
		height: 30px;
		line-height: 30px;
		font-size: 12px;
		margin-left: 15px;
	}
	.bot-conditions__seperator-text {
		background: #fff;
		color: #adb5bd;
		left: -5px;
		position: relative;
		padding: 2px 0;
	}
	.bot-conditions__btn {
		display: inline-flex;
		align-items: center;
		padding: 5px 10px;
		border: 1px dashed #0d6efd;
		border-radius: 4px;
	}
	.bot-conditions__btn:hover {
		border-color: rgb(1.5532786885, 76.887295082, 187.9467213115);
	}
	.bot-conditions-card__remove {
		top: 15px;
		right: 15px;
		position: absolute;
		color: #adb5bd;
		cursor: pointer;
		width: 16px;
		height: 16px;
		outline: none;
	}
	.bot-conditions-card__remove:hover {
		color: #495057;
	}
	.bot-run-options {
		margin-bottom: 30px;
	}
	.bot-run-option__box {
		padding: 10px 15px;
		border: 1px solid #dee2e6;
		border-radius: 8px;
		margin-bottom: 10px;
	}
	.bot-run-option__box:last-child {
		margin-bottom: 0;
	}
	.bot-run-option__box.box--active {
		border: 1px solid #0d6efd;
	}
	.bot-run-option__head {
		display: flex;
		align-items: center;
	}
	.bot-run-option__label {
		margin-bottom: 0;
		margin-left: 10px;
		cursor: pointer;
	}
	.bot-run-option__content {
		padding-top: 10px;
		padding-left: 26px;
	}
	.bot-cond-url-row {
		display: flex;
		align-items: center;
		position: relative;
		margin-bottom: 5px;
	}
	.bot-cond-url-row:before {
		content: '';
		position: absolute;
		right: 100%;
		top: 50%;
		width: 13px;
		height: 1px;
		background-color: #dee2e6;
	}
	.bot-cond-url-inputs {
		margin-top: 5px;
		padding-left: 15px;
		position: relative;
	}
	.bot-cond-url-inputs:before {
		content: '';
		position: absolute;
		left: 2px;
		bottom: 10px;
		width: 1px;
		height: calc(100% - 10px);
		background-color: #dee2e6;
	}
	.bot-cond-url__add-btn {
		width: 20px;
		height: 20px;
		background-color: #fff;
		border-radius: 50%;
		border: 1px dashed #dee2e6;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
	}
	.bot-run-option__channel {
		margin-bottom: 10px;
	}
	.bot-run-option__channel:last-child {
		margin-bottom: 0;
	}
	.bot-call-btn-editor {
		position: relative;
		border: 1px solid #cacaca;
		border-radius: 4px;
		padding: 20px;
	}
	.bot-list__table-body.bot-list__table-body__empty {
		display: flex;
		flex-direction: column;
		align-items: center;
	}
	.bot_graph_action {
		cursor: pointer;
		display: flex;
		align-items: center;
		border: 1px solid transparent;
		width: 180px;
		flex-shrink: 0;
		padding: 2px 15px;
		border-radius: 30px;
		height: 40px;
		background: #fff;
		position: relative;
	}
	.bot_graph_action.bot_graph_action_cta_btn {
		background: transparent;
		border: 1px dashed #6c757d;
	}
	.bot_graph_action.bot_graph_action_cta_btn:hover {
		border-color: #000;
	}
	.bot_graph_ai_row {
		padding-top: 50px;
	}
	.bot_graph_ai_row:first-child {
		padding-top: 0;
	}
	.bot_graph_action_llm__add {
		position: relative;
	}
	.bot_graph_action_llm__add:before {
		content: '';
		position: absolute;
		top: -70px;
		bottom: 8px;
		left: -14px;
		width: 2px;
		background: rgba(0, 0, 0, 0.1019607843);
	}
	.bot_graph_action_llm {
		position: relative;
	}
	.bot_graph_action_llm:before {
		content: '';
		position: absolute;
		top: -70px;
		bottom: 18px;
		left: -15px;
		width: 2px;
		background: rgba(0, 0, 0, 0.1019607843);
	}
	.bot_graph_action_llm:hover .bot_graph_action_llm_x {
		display: block;
	}
	.bot_graph_action_llm_x {
		display: none;
	}
	.bot_graph_action.bot_graph_action__jump {
		background: #394960;
		color: white;
		width: 160px;
	}
	.bot_graph_action.bot_graph_action__error {
		background: #ea3d2f !important;
		color: white !important;
		-webkit-box-shadow: 0px 0px 16px 4px #ea3d2f !important;
		-moz-box-shadow: 0px 0px 16px 4px #ea3d2f !important;
		box-shadow: 0px 0px 16px 4px #ea3d2f !important;
	}
	div.bot_graph_action.bot_graph_action__jump_to {
		-webkit-box-shadow: 0px 0px 16px -4px #ffc107;
		-moz-box-shadow: 0px 0px 16px -4px #ffc107;
		box-shadow: 0px 0px 16px -4px #ffc107;
	}
	.bot_graph_action.bot_graph_action__passed {
		background: #19b600;
		color: white;
	}
	div.bot_graph_action.bot_graph_action__active.bot_graph_action__active_run {
		background: #19b600;
		color: white;
		-webkit-box-shadow: 0px 0px 16px 4px #19b600;
		-moz-box-shadow: 0px 0px 16px 4px #19b600;
		box-shadow: 0px 0px 16px 4px #19b600;
	}
	div.bot_graph_action.bot_graph_action__active {
		position: relative;
		background: #0d6efd;
		color: white;
	}
	div.bot_graph_action.bot_graph_action__active::after {
		top: -15px;
		left: -15px;
		width: 210px;
		height: 70px;
		content: '';
		z-index: 1;
		border-radius: 70px;
		position: absolute;
	}
	.bot_graph_action__icon {
		margin-right: 10px;
		width: 20px;
		height: 20px;
		display: block;
	}
	.bot_graph_action__name {
		overflow: hidden;
		font-size: 14px;
		text-overflow: ellipsis;
		white-space: nowrap;
		font-weight: 500;
		flex: 1;
		display: block;
	}
	.bot_condition_label {
		max-width: 150px;
		height: 24px;
		display: block;
		align-items: center;
		flex-shrink: 0;
		line-height: 1;
		background: #ffeeba;
		color: #333;
		font-size: 13px;
		border-radius: 0px;
		border-bottom-right-radius: 10px;
		border-top-right-radius: 10px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		padding: 6px 10px 0 5px;
		cursor: pointer;
	}
	.bot_condition_label.bot_condition_label__fallback {
		background: #394960;
		color: white;
	}
	.bot_condition_label.bot_condition_label__undefined {
		background: #f44336;
		color: white;
	}
	.bot_graph_action_container {
		z-index: 0;
		position: relative;
		display: flex;
		align-items: center;
	}
	.bot_graph_action_container:hover .bot_graph_action_menu {
		opacity: 1;
		visibility: visible;
	}
	.bot_graph_action_sub {
		display: none;
		position: absolute;
		top: -26px;
		z-index: -1;
		color: rgba(0, 0, 0, 0.2666666667);
		margin-left: 35px;
		user-select: none;
		pointer-events: none;
		width: 170px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		font-size: 14px;
	}
	.bot_graph_action_menu {
		opacity: 0;
		visibility: hidden;
		position: absolute;
		padding: 0;
		left: 50%;
		margin-left: 10px;
		top: -45px;
		transition:
			opacity 500ms,
			visibility 800ms;
	}
	.bot_graph_action_menu_container {
		background: white;
		left: -50%;
		justify-content: center;
		display: flex;
		align-items: center;
		padding: 0 10px;
		position: relative;
		border-radius: 8px;
		box-shadow: 0px 0px 19px -8px rgba(0, 0, 0, 0.2666666667);
	}
	.bot_graph_action_menu__item {
		cursor: pointer;
		width: 34px;
		height: 34px;
		padding: 8px 5px;
		opacity: 0.7;
	}
	.bot_graph_action_menu__item:hover {
		opacity: 1;
	}
	.bot_graph_add_menu {
		position: absolute;
		background: white;
		width: 250px;
		z-index: 10;
		border-radius: 10px;
		box-shadow: 2px 2px 5px rgba(0, 0, 0, 0.15);
		height: 350px;
		overflow: hidden;
		display: flex;
		flex-direction: column;
		visibility: visible;
		transition:
			opacity 100ms,
			visibility 200ms;
	}
	.bot_graph_add_menu__header {
		padding: 10px;
		display: flex;
		align-items: center;
		justify-content: space-between;
		border-bottom: 1px solid #ddd;
	}
	.bot_graph_add_menu.bot_graph_add_menu__hidden {
		opacity: 0;
		visibility: hidden;
	}
	.bot_graph_analytic_badge {
		background: #fff;
		position: absolute;
		top: 20px;
		left: 20px;
		display: flex;
		align-items: center;
		color: #6c757d;
		padding: 5px 15px;
		border-radius: 10px;
		box-shadow: 0 0 8px 3px rgba(0, 0, 0, 0.15);
		z-index: 99;
	}
	.add_user_label_btn {
		margin: 5px 5px 5px 0;
		display: inline-block;
		padding: 0 5px;
		font-size: 12px;
		line-height: 18px;
		border: 1px dashed #0d6efd;
		color: #0d6efd;
		cursor: pointer;
		position: relative;
	}
	.add_user_label_btn:hover {
		border-color: shade-color(#0d6efd, 2);
		color: shade-color(#0d6efd, 2);
	}
	.create_bot_modal_wrapper {
		width: 800px;
		height: 600px;
		overflow: hidden;
		position: relative;
	}
	.create_bot_modal_inner {
		position: absolute;
		top: 0;
		left: 0;
		height: 100%;
		width: 100%;
		display: flex;
		transition: 0.2s;
	}
	.create_bot_modal_sidebar {
		width: 200px;
		padding: 20px;
		border-right: 1px solid #dee2e6;
		background-color: #f8f9fa;
		flex-shrink: 0;
	}
	.create_bot_modal_sidebar_link {
		cursor: pointer;
	}
	.create_bot_modal_sidebar_link:hover {
		color: #000;
	}
	.create_bot_modal_sidebar_link.active {
		color: #000;
		font-weight: 600;
	}
	.create_bot_modal_content {
		flex: 1;
		padding: 20px;
		overflow: auto;
		display: flex;
		flex-direction: column;
	}
	.create_bot_modal_content.wide {
		padding-left: 40px;
		padding-right: 40px;
	}
	.create_bot_modal_templates {
		width: 100%;
		display: grid;
		grid-gap: 20px;
		grid-template-columns: repeat(2, 1fr);
	}
	.create_bot_template_card {
		border-radius: 8px;
		border: 2px solid #dee2e6;
		cursor: pointer;
		padding: 15px 20px;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.create_bot_template_card:hover {
		border-color: #0d6efd;
	}
	.create_bot_template_card:hover .create_bot_template_btn {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.create_bot_template_card:hover .create_bot_template_btn:hover {
		background-color: shade-color(#0d6efd, 4);
	}
	.create_bot_template_avatar {
		width: 40px;
		height: 40px;
		border-radius: 50%;
		flex-shrink: 0;
		object-fit: cover;
	}
	.create_bot_template_channel_img {
		width: 13px;
		height: 13px;
		margin-right: 5px;
	}
	.create_bot_template_channel_img.md {
		width: 16px;
		height: 16px;
		margin-right: 8px;
	}
	.create_bot_template_channel_img.lg {
		width: 20px;
		height: 20px;
		margin-right: 10px;
	}
	.create_bot_template_channel_img:last-child {
		margin-right: 0;
	}
	.create_bot_modal_widget_wrapper {
		width: 350px;
		flex-shrink: 0;
		border-left: 1px solid #dee2e6;
		background-color: #f8f9fa;
		display: flex;
		align-items: center;
		justify-content: center;
		flex-direction: column;
	}
	.create_bot_modal_widget_header {
		background-color: #fff;
		display: flex;
		align-items: center;
		padding: 15px 20px;
		flex-shrink: 0;
		border-bottom: 1px solid #dee2e6;
		width: 100%;
	}
	.create_bot_modal_widget {
		flex: 1;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.bot-textarea {
		cursor: text;
		position: relative;
		border: 1px solid #cacaca;
		border-radius: 4px;
		display: flex;
		flex-wrap: wrap;
	}
	.bot-textarea .bot-textarea__input {
		font-family: unset;
		font-size: unset;
		width: 100%;
		overflow: auto;
		max-height: 300px;
		min-height: unset;
	}
	.bot-textarea .bot-textarea__input .ProseMirror {
		overflow: auto;
		word-break: break-word;
		line-height: 1.42;
		height: 100%;
		outline: 0;
		overflow-y: auto;
		padding: 12px 15px;
		tab-size: 4;
		text-align: left;
		white-space: pre-wrap;
		word-wrap: break-word;
	}
	.bot-textarea .bot-textarea__input .ProseMirror p {
		margin: 0;
		padding: 0;
		counter-reset: list-1 list-2 list-3 list-4 list-5 list-6 list-7 list-8 list-9;
	}
	.bot-textarea .bot-textarea__input .ProseMirror a {
		cursor: pointer !important;
	}
	.bot_agent_reply_time_dropdown {
		display: inline;
	}
	.aiagent_bot_setting_wrapper {
		width: 500px;
	}
	.aiagent_bot_setting_main {
		margin: 20px;
		padding: 10px;
		padding-top: 0;
		padding-bottom: 50px;
	}
	.aiagent_bot_setting_section {
		padding: 20px 25px;
		border-radius: 8px;
		border: 1px solid #efefef;
		background: white;
	}
	.aiagent_bot_setting_label {
		font-size: 20px;
		opacity: 0.8;
		margin-bottom: 5px;
		margin-top: 20px;
	}
	.qna_drawer_answer_editor.prose_email_editor {
		flex: 1;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.qna_drawer_answer_editor.prose_email_editor .ProseMirror {
		max-height: unset;
		flex: 1;
		min-height: 400px;
	}
	.prose_email_editor.is-invalid .prosee_email_editor_toolbar {
		border-color: #ea3d2f;
	}
	.prose_email_editor.is-invalid .ProseMirror {
		border-color: #ea3d2f;
	}
	.prose_email_editor.is-invalid .ProseMirror:hover {
		border-color: #ea3d2f;
	}
	.prose_email_editor.is-invalid .ProseMirror:focus {
		border-color: #ea3d2f;
	}
	.ai_testcase_sidebar {
		width: 280px;
		flex-shrink: 0;
		overflow: auto;
		border-right: 1px solid #dee2e6;
	}
	.ai_testcase_sidebar_item {
		cursor: pointer;
		border-bottom: 1px solid #dee2e6;
		background-color: #fff;
		padding: 12px 20px;
	}
	.ai_testcase_sidebar_item:hover {
		background-color: #ececec;
	}
	.ai_testcase_sidebar_item.active {
		background-color: #f0f7ff;
	}
	.ai_testcase_sidebar_item.active:hover {
		background-color: #f0f7ff;
	}
	.ai_testcase_detail {
		width: 100%;
		height: 100%;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.ai_testcase_detail_header {
		flex-shrink: 0;
		border-bottom: 1px solid #dee2e6;
		padding: 12px 20px;
	}
	.ai_testcase_detail_content {
		flex: 1;
		overflow: auto;
		padding: 15px 20px;
	}
	.ai_testcase_content_wrapper {
		width: 100%;
		height: 100%;
		overflow: hidden;
		margin-top: 20px;
		border-top: 1px solid #dee2e6;
	}
	.ai_testcase_detail_history {
		border-left: 1px solid #dee2e6;
		overflow: auto;
		flex: 1;
		padding: 20px;
	}
	.ai_evaluate_history_table .sbz_common_table_header {
		overflow: hidden;
	}
	.ai_evaluate_history_table .sbz_common_table_content {
		overflow: hidden;
	}
	.ai_evaluate_history_table .sbz_table_row .sbz_table_cell:first-child {
		padding-left: 0;
	}
	.ai_evaluate_history_table .sbz_table_row .sbz_table_cell:last-child {
		padding-right: 0;
	}
	.ai_welcome_message_editor .bot-textarea .bot-textarea__input .ProseMirror {
		padding: 5px 10px;
	}
	.ai_welcome_message_editor.in_drawer .bot-textarea .bot-textarea__input {
		min-height: 60px;
	}
	.agent-avatar__upload {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		border-radius: 4px;
		background-color: rgba(0, 0, 0, 0.5);
		color: rgba(255, 255, 255, 0.8);
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		opacity: 0;
		z-index: 7;
	}
	.agent-avatar__upload-container {
		position: relative;
	}
	.agent-avatar__upload-container:hover .agent-avatar__upload {
		opacity: 1;
	}
	.drawer {
		position: absolute;
		top: 0;
		right: -800px;
		z-index: 100;
		height: 100%;
		outline: 0;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.drawer.drawer__local {
		position: absolute;
	}
	.drawer__background {
		background: #ffffff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.06),
			0px 4px 32px rgba(0, 0, 0, 0.06),
			0px 8px 64px rgba(0, 0, 0, 0.08);
		border-radius: 0px;
		height: 100%;
		overflow: auto;
	}
	.drawer__background.drawer__background__simple {
		background: #fff;
		box-shadow: none;
		border-radius: 0;
	}
	.drawer_content {
		z-index: 160;
		background-color: #fff;
		margin: auto;
		width: 840px;
		border-radius: 5px;
	}
	.drawer_content__header {
		position: relative;
		height: 50px;
		width: 100%;
		background: #1890ff;
		color: #fff;
		padding: 0 30px;
		line-height: 46px;
		font-size: 16px;
		font-weight: 700;
		border-radius: 2px 2px 0 0;
	}
	.drawer_content__main {
		position: relative;
		width: 100%;
		padding: 20px 40px;
	}
	.drawer_content__footer {
		border-top: 1px #ddd solid;
		border-radius: 0px 0px 3px 3px;
		padding: 10px 25px;
		text-align: right;
	}
	.drawer.drawer--right {
		z-index: -999999;
		opacity: 0;
		align-items: center;
	}
	.drawer.drawer--right {
		right: 0;
		justify-content: flex-end;
		margin-right: 0px;
	}
	.drawer.drawer--right.drawer--active {
		z-index: 100;
		opacity: 1;
	}
	.drawer.drawer--right .drawer__background {
		right: 0;
		border-left: 1px solid #dddddd;
	}
	.drawer.drawer--right.drawer--active.drawer--fadeout .drawer__background {
		transform: translateX(1800px);
	}
	.drawer__btn_close {
		align-self: start;
		flex-shrink: 0;
		margin-right: 10px;
		margin-top: 10px;
		border-radius: 50%;
		height: 40px;
		width: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		background: #fff;
		cursor: pointer;
		position: absolute;
		top: 0;
		left: -50px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.06),
			0px 4px 32px rgba(0, 0, 0, 0.06),
			0px 8px 64px rgba(0, 0, 0, 0.08);
	}
	.drawer.drawer--right.drawer--active.drawer--fadeout .drawer__btn_close {
		display: none;
	}
	.btn__switch {
		position: relative;
		display: inline-flex;
		vertical-align: middle;
	}
	.btn__switch > .btn {
		-webkit-box-shadow: inset 0 2px 3px rgba(0, 0, 0, 0.3);
		box-shadow: inset 0 2px 3px rgba(0, 0, 0, 0.3);
		padding: 0.1rem 0.5rem;
		font-size: 14px;
		border-radius: 4px;
		position: relative;
		flex: 1 1 auto;
	}
	.btn__switch > .btn:hover,
	.btn__switch > .btn:focus,
	.btn__switch > .btn:active,
	.btn__switch > .btn.active {
		z-index: 1;
	}
	.btn__switch > .btn.btn__outline_primary {
		-webkit-box-shadow: none;
		box-shadow: none;
	}
	.btn__switch > .btn.btn__outline_primary:hover {
		background: #fff;
		color: #0d6efd;
	}
	.btn__switch > .btn.btn__outline_secondary {
		-webkit-box-shadow: none;
		box-shadow: none;
	}
	.btn__switch > .btn.btn__outline_secondary:hover {
		background: #fff;
		color: #000;
	}
	.btn__switch > .btn:not(:first-child),
	.btn__switch > .btn__switch:not(:first-child) {
		margin-left: -1px;
	}
	.btn__switch > .btn:not(:last-child):not(.dropdown__toggle),
	.btn__switch > .btn__switch:not(:last-child) > .btn {
		border-top-right-radius: 0;
		border-bottom-right-radius: 0;
	}
	.btn__switch > .btn:not(:first-child),
	.btn__switch > .btn__switch:not(:first-child) > .btn {
		border-top-left-radius: 0;
		border-bottom-left-radius: 0;
	}
	.btn__switch.btn__switch__light .btn {
		border: 0;
		border-radius: 2px;
		-webkit-box-shadow: none;
		box-shadow: none;
		border: 1px solid transparent;
	}
	.btn__switch.btn__switch__light .btn:hover {
		border: 1px solid #e9ecef;
	}
	.btn__switch.btn__switch__white.btn__switch__xs {
		background-color: whitesmoke;
	}
	.btn__switch.btn__switch__white.btn__switch__xs.btn__switch__xs {
		border-radius: 0.2rem;
	}
	.btn__switch.btn__switch__white.btn__switch__xs.btn__switch__xs .btn:not(:last-child):not(.dropdown__toggle) {
		border-top-left-radius: 0.2rem;
		border-bottom-left-radius: 0.2rem;
	}
	.btn__switch.btn__switch__white.btn__switch__xs.btn__switch__xs .btn:not(:first-child):not(.dropdown__toggle) {
		border-top-right-radius: 0.2rem;
		border-bottom-right-radius: 0.2rem;
	}
	.btn__switch.btn__switch__white.btn__switch__xs .btn {
		box-shadow: none;
		display: flex;
		align-items: center;
		justify-content: center;
		margin-right: 1px;
	}
	.btn__switch.btn__switch__white.btn__switch__xs .btn:last-child {
		margin-right: 0;
	}
	.btn__switch.btn__switch__white.btn__switch__xs .btn__white {
		pointer-events: none;
		box-shadow: rgba(0, 0, 0, 0.09) 0px 1px 4px;
		cursor: auto;
	}
	.btn__switch.btn__switch__white.btn__switch__xs .btn__white:hover,
	.btn__switch.btn__switch__white.btn__switch__xs .btn__white:focus,
	.btn__switch.btn__switch__white.btn__switch__xs .btn__white:active {
		background-color: #fff;
	}
	.color_picker__colors {
		display: flex;
		flex-wrap: wrap;
		cursor: pointer;
	}
	.color_picker__color {
		flex-shrink: 0;
		margin-right: 5px;
		width: 20px;
		height: 20px;
		margin-bottom: 5px;
		border-radius: 50%;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #fff;
	}
	.color_picker__icon {
		transition: 0.3s;
		opacity: 0;
	}
	.color_picker__color.color_picker__color__custom {
		position: relative;
	}
	.widget-website {
		overflow-y: auto;
	}
	.widget-website__head {
		margin-bottom: 15px;
	}
	.widget-website-platform {
		border: 1px solid #dee2e6;
		border-radius: 8px;
		margin-bottom: 15px;
	}
	.widget-website-platform:last-child {
		margin-bottom: 0;
	}
	.widget-website-platform__head {
		display: flex;
		align-items: center;
		padding: 10px 20px;
		cursor: pointer;
	}
	.widget-website-platform__img {
		max-height: 50px;
		object-fit: cover;
		margin-right: 10px;
	}
	.widget-website-platform__nav-icon {
		margin-left: auto;
		transition: 0.3s;
		width: 24px;
		height: 24px;
	}
	.widget-website-platform.active .widget-website-platform__nav-icon {
		transform: rotate(90deg);
	}
	.widget-website-platform__body {
		padding: 15px;
		border-top: 1px solid #dee2e6;
	}
	.subiz-code__container {
		max-height: 150px;
		overflow-y: auto;
		position: relative;
		background: #f8f9fa;
		white-space: pre-wrap;
		border-radius: 4px;
	}
	.subiz-code {
		font-family: monospace;
		padding: 15px;
		padding-right: 115px;
	}
	.subiz-code__copy {
		position: absolute;
		top: 15px;
		right: 15px;
	}
	.widget-website-platform__step {
		border-radius: 50%;
		display: flex;
		font-weight: 700;
		background-color: tint-color(#0d6efd, 8);
		display: flex;
		align-items: center;
		justify-content: center;
		padding: 2px;
		margin-right: 10px;
		width: 18px;
		height: 18px;
		font-size: 12px;
	}
	.widget-form-settings__section {
		margin-bottom: 30px;
		display: flex;
		font-size: 14px;
		max-width: 550px;
	}
	.widget-form-settings__section:last-child {
		margin-bottom: 0;
	}
	.widget-form-settings__sw {
		margin-right: 15px;
		align-self: flex-start;
	}
	.widget-form-settings__section-title {
		line-height: 1;
		font-size: 15px;
	}
	.widget-form-settings__section-subtitle {
		margin-top: 2.5px;
		color: #6c757d;
	}
	.widget-form-settings__form {
		padding-top: 10px;
	}
	.widget-form-settings__field {
		margin-bottom: 10px;
		padding: 10px;
		border-radius: 4px;
		background-color: rgba(192, 192, 192, 0.15);
	}
	.widget-form-settings__field.ghost {
		opacity: 0.7;
	}
	.widget-form-settings__field:last-child {
		margin-bottom: 0;
	}
	.widget-form-settings__group-list {
		display: flex;
		flex-direction: column;
	}
	.widget-form-settings__chat-group {
		display: flex;
		align-items: center;
		margin-left: 15px;
		margin-bottom: 5px;
		position: relative;
	}
	.widget-form-settings__chat-group:before {
		content: '';
		position: absolute;
		left: -15px;
		top: calc(50% - 40px);
		width: 10px;
		height: 40px;
		border-left: 1px solid #ced4da;
		border-bottom: 1px solid #ced4da;
		border-bottom-left-radius: 3px;
	}
	.widget-form-settings__chat-group.group--first:before {
		height: 15px;
		top: calc(50% - 15px);
	}
	.widget-form-settings__chat-group.group--add {
		width: fit-content;
		position: relative;
		color: #6c757d;
		cursor: pointer;
		margin-left: 14px;
		border: 1px dashed;
		width: 20px;
		height: 20px;
		background-color: #fff;
		border-radius: 50%;
		justify-content: center;
	}
	.widget-form-settings__chat-group.group--add:hover {
		color: #495057;
	}
	.widget-chat-btn__item {
		width: 60px;
		height: 60px;
		margin-right: 20px;
		margin-bottom: 20px;
		cursor: pointer;
		border-radius: 0;
		display: flex;
		justify-content: center;
		align-items: center;
	}
	.widget-chat-img-btn__item {
		width: 200px;
		height: 125px;
		margin-right: 40px;
		margin-bottom: 40px;
		cursor: pointer;
		border-radius: 0;
	}
	.widget-chat-img-btn__item.small {
		width: 180px;
		height: 115px;
		margin-right: 30px;
		margin-bottom: 30px;
	}
	.widget-chat-btn-select__title {
		display: flex;
		align-items: center;
		position: sticky;
		top: 0;
		z-index: 100;
		cursor: pointer;
		width: 100%;
		background-color: #fff;
	}
	.widget-display-settings__form {
		margin-bottom: 15px;
		max-width: 550px;
	}
	.widget-display-settings__title {
		font-weight: 500;
		font-size: 15px;
	}
	.widget-form-settings__input {
		max-width: 180px;
	}
	.widget-form-settings__radio,
	.widget-form-settings__checkbox {
		width: 14px;
		height: 14px;
	}
	.widget-display-settings-lang {
		display: flex;
	}
	.widget-display-settings-lang__radio {
		border: 1px solid #ced4da;
		max-width: 250px;
		flex: 1;
		padding: 5px 10px;
		background-color: #fff;
		border-left: none;
		cursor: pointer;
	}
	.widget-display-settings-lang__radio:first-child {
		border-top-left-radius: 8px;
		border-bottom-left-radius: 8px;
		border-left: 1px solid #ced4da;
	}
	.widget-display-settings-lang__radio:first-child.active {
		box-shadow: none;
	}
	.widget-display-settings-lang__radio:last-child {
		border-top-right-radius: 8px;
		border-bottom-right-radius: 8px;
	}
	.widget-display-settings-lang__radio.active {
		background-color: rgba(164, 200, 255, 0.15);
		border-color: tint-color(#0d6efd, 8);
		box-shadow: -1px 0 0 0 tint-color(#0d6efd, 8);
	}
	.web-plugin-list {
		padding: 20px;
		padding-bottom: 50px;
		max-height: 100%;
		overflow: auto;
	}
	.wp-create {
		height: 100%;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		max-width: 100%;
	}
	.wp-create__header {
		border-bottom: 1px solid #d5d5d5;
		display: flex;
		align-items: center;
		overflow: hidden;
		background: #fff;
		align-items: center;
		height: 50px;
		padding: 0 20px;
		padding-left: 0;
		flex-shrink: 0;
		z-index: 101;
	}
	.wp-create__main {
		display: flex;
		overflow: hidden;
		flex: 1;
		width: 100%;
		height: 100%;
		background-color: #fff;
	}
	.wp-create__templates {
		padding: 20px;
		padding-right: 10px;
		padding-top: 30px;
		display: flex;
		flex-direction: column;
		overflow: auto;
	}
	.popup_template_card {
		width: 300px;
		cursor: pointer;
		text-align: center;
		overflow: hidden;
	}
	.popup_template_card.card__sm {
		width: 200px;
	}
	.popup_template_card.card__lg {
		width: 400px;
	}
	.popup_template_card__content {
		height: 100%;
		display: flex;
		flex-direction: column;
	}
	.popup_template_card__thumb {
		overflow: hidden;
		position: relative;
	}
	.popup_template_card__desc {
		border-top: none;
		font-weight: bold;
		padding: 10px 0 10px 0;
		text-align: left;
		font-size: 16px;
	}
	.wp-preview__desktop-layout {
		overflow: hidden;
		position: relative;
		width: 100%;
		height: 100%;
		background-color: #f5f7fa;
	}
	.wp-create .bounce-leave-active {
		animation: bounce-in 0.1s reverse;
	}
	.wp-edit-preview {
		flex: 1;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		background-image: linear-gradient(
			45deg,
			#fafafa 25%,
			#ffffff 25%,
			#ffffff 50%,
			#fafafa 50%,
			#fafafa 75%,
			#ffffff 75%,
			#ffffff 100%
		);
		background-size: 56.57px 56.57px;
	}
	.wp-edit-preview__bar {
		background: white;
		height: 50px;
		display: flex;
		flex-shrink: 0;
		align-items: center;
		padding: 0 20px;
		border-bottom: 1px solid #d5d5d5;
		justify-content: space-between;
		position: relative;
	}
	.wp-conditions {
		padding: 20px 40px;
		max-width: 620px;
	}
	.wp-conditions-section {
		margin-bottom: 40px;
	}
	.wp-conditions-section__title {
		margin-bottom: 15px;
		font-size: 20px;
		font-weight: 500;
		line-height: 1.2;
	}
	.wp-conditions-section__subtitle {
		font-size: 15px;
		color: #6c757d;
		font-weight: normal;
		margin-top: 5px;
	}
	.wp-conditions-card {
		background-color: #fff;
		border: 1px solid #dee2e6;
		margin-bottom: 10px;
	}
	.wp-conditions-card__head {
		display: flex;
		justify-content: space-between;
		font-weight: 500;
		padding: 15px 20px;
	}
	.wp-conditions-card__icon {
		width: 20px;
		margin-right: 10px;
	}
	.wp-conditions-card__body {
		margin-top: -5px;
		padding: 0 20px 15px;
	}
	.wp-conditions-card__body.negative {
		background-color: #f8f9fa;
		border-bottom-left-radius: 8px;
		border-bottom-right-radius: 8px;
	}
	.wp_design_sidebar {
		flex-shrink: 0;
		width: 400px;
		display: flex;
		flex-direction: column;
		border-left: 1px solid #d5d5d5;
		overflow: hidden;
		position: relative;
	}
	.wp_design_sidebar.is_domain_setting {
		width: 500px;
	}
	.wp_sidebar__wrapper {
		position: absolute;
		width: 100%;
		height: 100%;
		top: 0;
		left: 0;
		transition: all ease-out 150ms;
	}
	.wp_sidebar__body {
		position: relative;
		width: 100%;
		height: 100%;
		overflow: hidden;
		background: white;
		display: flex;
		flex-direction: column;
	}
	.wp_sidebar__header {
		border-bottom: 1px solid #d5d5d5;
		height: 50px;
		padding: 10px 20px;
		display: flex;
		align-items: center;
	}
	.wp_sidebar__footer {
		border-top: 1px solid #d5d5d5;
		height: 50px;
		padding: 10px 20px;
		display: flex;
		align-items: center;
		justify-content: flex-end;
	}
	.wp_sidebar__content {
		overflow: auto;
		flex: 1;
	}
	.wp_sidebar__section {
		padding: 0 20px 0 20px;
		margin-bottom: 20px;
	}
	.wp_sidebar__divider {
		border-top: 1px solid #d5d5d5;
		width: 100%;
	}
	.wp_sidebar__button {
		padding: 10px;
		border: 1px solid lightgray;
		border-radius: 4px;
		width: 100%;
		position: relative;
		padding-right: 40px;
		cursor: pointer;
		transition: all ease-out 150ms;
	}
	.wp_sidebar__button .wp_sidebar__button_icon {
		position: absolute;
		right: 15px;
		top: 50%;
		transform: translateY(-50%);
		width: 20px;
		height: 20px;
		transition: all ease-out 150ms;
		stroke: #adb5bd;
	}
	.wp_sidebar__button:hover {
		border-color: #0d6efd;
	}
	.wp_sidebar__button:hover .wp_sidebar__button_icon {
		stroke: #0d6efd;
		right: 10px;
	}
	.wp_name_editor {
		display: flex;
		align-items: center;
	}
	.wp_name_editor__toggle {
		margin-left: 10px;
		cursor: pointer;
		opacity: 0;
		transition: 0.15s;
		pointer-events: none;
	}
	.wp_name_editor:hover .wp_name_editor__toggle {
		opacity: 1;
		pointer-events: all;
		transition: 0s;
	}
	.popup_image {
		overflow: hidden;
		border-radius: 3px;
		align-items: center;
		width: 110px;
		height: 140px;
		display: flex;
		margin-bottom: 10px;
		margin-right: 10px;
		cursor: pointer;
		position: relative;
		transition: all ease-out 150ms;
		background-color: #f0f0f0;
	}
	.popup_image:hover {
		background-color: #eee;
		border-color: #000;
	}
	.popup_image:hover .popup_component_icon {
		background: #eaeaea;
	}
	.popup_image:hover .popup_component__delete_btn {
		opacity: 1;
	}
	.popup_image:nth-child(3n) {
		margin-right: 0;
	}
	.popup_component {
		overflow: hidden;
		border-radius: 3px;
		align-items: center;
		display: flex;
		border: 1px solid transparent;
		margin-bottom: 10px;
		cursor: pointer;
		position: relative;
		transition: all ease-out 150ms;
	}
	.popup_component:hover .popup_component_icon {
		background: #eaeaea;
	}
	.popup_component:hover .popup_component__delete_btn {
		opacity: 1;
	}
	.popup_component.dragging {
		opacity: 0.2;
	}
	.popup_component.dropable {
		border: 1px dashed #adb5bd;
		height: 1px;
	}
	.popup_component.focused {
		background-color: tint-color(#ffc107, 8);
	}
	.popup_component__text_blur {
		color: #6c757d;
	}
	.popup_component_icon {
		flex-shrink: 0;
		margin-right: 10px;
		cursor: grabbing;
		padding: 10px;
		border-radius: 5px;
		background: #f0f0f0;
		width: 40px;
		height: 40px;
		user-select: none;
	}
	.popup_component_image {
		width: 100%;
		height: 100%;
		object-fit: contain;
		user-select: none;
		pointer-events: none;
	}
	.wp_sidebar__label {
		font-weight: 500;
		margin-top: 20px;
		margin-bottom: 5px;
	}
	.popup_component_button {
		border-radius: 3px;
		align-items: center;
		display: flex;
		border: 1px solid lightgray;
		padding: 5px;
		cursor: pointer;
		transition: all ease-out 150ms;
	}
	.popup_component_button:hover {
		border-color: #000;
	}
	/* ========== Campaign Design Color Picker ======= */
	.wp_color_picker {
		display: flex;
		align-items: center;
		position: relative;
	}
	.wp_color_picker__icon {
		width: 18px;
		height: 18px;
	}
	.wp_color_picker__preview {
		cursor: pointer;
	}
	.wp_color_picker__picker {
		position: absolute !important;
		z-index: 10;
		top: 20px;
		left: 0px;
	}
	.wp_color_picker__picker.wp_color_picker__picker__right {
		left: -200px;
	}
	.wp_color_picker__picker.wp_color_picker__picker__up {
		top: -190px;
		left: 20px;
	}
	.wp_color_picker__picker__hide {
		display: none;
	}
	.wp_sidebar__tabs {
		display: flex;
		margin-top: -20px;
		margin-left: -20px;
		margin-right: -20px;
	}
	.wp_sidebar__tab {
		flex: 1;
		background-color: #f8f9fa;
		color: #6c757d;
		border-bottom: 1px solid #dee2e6;
		font-size: 16px;
		padding: 15px 0;
		border-right: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
	}
	.wp_sidebar__tab:last-child {
		border-right: none;
	}
	.wp_sidebar__tab.active {
		border-bottom: 1px solid #fff;
		background-color: #fff;
	}
	.size_picker__input {
		outline: none;
		color: #495057;
		border: none;
		text-align: center;
		background: transparent;
		padding: 0;
		position: absolute;
		width: 44px;
	}
	.size_picker__input:hover,
	.size_picker__input:active {
		outline: none;
	}
	.size_picker__content {
		background: white;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.size_picker {
		position: relative;
		padding: 30px 70px;
		border-radius: 5px;
		background: whitesmoke;
	}
	.position_picker {
		position: relative;
		background: #f8f8f8;
		padding: 30px 70px;
	}
	.position_picker__cell {
		cursor: pointer;
		border-radius: 2px;
		transition: all ease-out 200ms;
		background: #e9ecef;
		margin: 3px;
		text-align: center;
		height: 40px;
	}
	.position_picker__cell:hover {
		background: #ced4da;
	}
	.position_picker__cell.position_picker__cell__active {
		background: #6c757d;
	}
	.position_picker__cell.position_picker__cell__disabled {
		background: #f8f9fa;
		cursor: not-allowed;
	}
	.style_input__wrapper {
		position: relative;
	}
	.style_input.form-control {
		padding-right: 30px;
	}
	.style_input__unit {
		position: absolute;
		top: 50%;
		right: 10px;
		transform: translateY(-50%);
		font-size: 12px;
		color: #6c757d;
	}
	.style_form {
		display: flex;
		align-items: center;
		margin-bottom: 15px;
	}
	.style_form:last-child {
		margin-bottom: 0;
	}
	.style_form__label {
		font-size: 13px;
		color: #6c757d;
		font-size: 13px;
		color: #6c757d;
		width: 80px;
	}
	.popup_img_lib__categories {
		display: flex;
		flex-direction: column;
		width: 111px;
		box-shadow: 1px 0 0 #dee2e6;
	}
	.popup_img_lib__category {
		cursor: pointer;
		color: #adb5bd;
		max-width: 100%;
		white-space: nowrap;
		overflow: hidden;
		text-overflow: ellipsis;
		padding: 5px 0;
		padding-left: 20px;
	}
	.popup_img_lib__category:first-child {
		padding-top: 20px;
	}
	.popup_img_lib__category:hover,
	.popup_img_lib__category.active {
		color: #495057;
	}
	.popup_img_lib {
		display: flex;
		max-height: 100%;
		flex-wrap: wrap;
		flex: 1;
		overflow: auto;
		padding-left: 20px;
		padding-top: 20px;
		padding-right: 5px;
		align-self: flex-start;
	}
	.popup_img_lib__item {
		width: 120px;
		height: 140px;
		border-radius: 4px;
		margin-right: 10px;
		background-size: contain;
		margin-bottom: 10px;
		cursor: pointer;
		background-repeat: no-repeat;
		position: relative;
		background-position: center center;
		border: 2px solid white;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.popup_img_lib__item:nth-child(2n) {
		margin-right: 0;
	}
	.popup_img_lib__item.selected {
		border: 4px solid #0d6efd;
	}
	.popup_img_lib__item:hover .popup_img_lib__item_author {
		opacity: 1;
	}
	.popup_img_lib__item_author {
		border-top-left-radius: 4px;
		font-size: 10px;
		position: absolute;
		bottom: 0;
		right: 0;
		background: #555;
		color: white;
		padding: 0 5px;
		opacity: 0;
		transition: all 150ms ease-out;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		max-with: 100%;
	}
	.popup_img_lib__item_author a {
		color: white;
	}
	.popup_img_lib__item_author:hover {
		background: #222;
	}
	.popup_img_lib__item_author:hover a {
		color: white;
		text-decoration: underline;
	}
	.position_picker__input {
		outline: none;
		color: #495057;
		border: none;
		text-align: center;
		background: transparent;
		padding: 0;
		position: absolute;
		width: 44px;
	}
	.position_picker__input:hover,
	.position_picker__input:active {
		outline: none;
	}
	.position_picker_box {
		width: 22px;
		height: 22px;
		border-radius: 2px;
		border: 1px solid #ccc;
		position: relative;
		margin-right: 10px;
		cursor: pointer;
	}
	.position_picker_box:last-child {
		margin-right: 0;
	}
	.position_picker_box.active {
		border: 1px solid #0d6efd;
	}
	.position_picker_box.active .position_picker_box__insider {
		background-color: #0d6efd;
	}
	.position_picker_box__insider {
		position: absolute;
		background-color: #ccc;
	}
	.position_picker_box__insider.fullscreen {
		top: 0;
		bottom: 0;
		right: 0;
		left: 0;
	}
	.position_picker_box__insider.full_right {
		top: 0;
		bottom: 0;
		right: 0;
		width: 50%;
	}
	.position_picker_box__insider.more_right {
		top: 0;
		bottom: 0;
		right: 0;
		width: 65%;
	}
	.position_picker_box__insider.full_left {
		top: 0;
		bottom: 0;
		left: 0;
		width: 50%;
	}
	.position_picker_box__insider.more_left {
		top: 0;
		bottom: 0;
		left: 0;
		width: 65%;
	}
	.position_picker_box__insider.full_top {
		top: 0;
		right: 0;
		left: 0;
		height: 38%;
	}
	.position_picker_box__insider.more_top {
		top: 0;
		right: 0;
		left: 0;
		height: 50%;
	}
	.position_picker_box__insider.left_inside {
		top: 0;
		bottom: 0;
		right: 0;
		left: 0;
	}
	.position_picker_box__insider.left_inside:before {
		position: absolute;
		content: '';
		top: 3px;
		left: 0;
		bottom: 3px;
		width: 9px;
		background: #fff !important;
	}
	.position_picker_box__insider.right_inside {
		top: 0;
		bottom: 0;
		right: 0;
		left: 0;
	}
	.position_picker_box__insider.right_inside:before {
		position: absolute;
		content: '';
		top: 3px;
		right: 0;
		bottom: 3px;
		width: 9px;
		background: #fff !important;
	}
	.position_picker_box__insider.fullscreen_inside {
		top: 0;
		bottom: 0;
		right: 0;
		left: 0;
	}
	.position_picker_box__insider.fullscreen_inside:before {
		position: absolute;
		content: '';
		top: 3px;
		right: 3px;
		bottom: 3px;
		left: 3px;
		background: #fff !important;
	}
	.button_component_container {
		margin-left: 24px;
		margin-top: 10px;
		margin-bottom: 20px;
		transition:
			height ease-out 100ms,
			opacity ease-out 200ms;
		opacity: 1;
		max-height: 500px;
	}
	.button_component_container.button_component_container__hidden {
		transition:
			height ease-out 200ms,
			opacity ease-out 100ms;
		opacity: 0;
		overlay: hidden;
		max-height: 0px;
		overflow: hidden;
	}
	.wp_setting_btn {
		float: right;
		width: 18px;
		stroke-width: 1.5px;
		height: 18px;
		border-radius: 50%;
		color: #999;
		cursor: pointer;
		transition: all ease-out 150ms;
	}
	.wp_setting_btn:hover {
		transform: rotate(30deg);
		color: #0d6efd;
	}
	.wp_countdown {
		margin-bottom: 10px;
		margin-left: 24px;
		margin-top: 20px;
		display: block;
	}
	.wp_countdown.wp_countdown__hidden {
		display: none;
	}
	.popup_option__drag {
		cursor: grabbing;
		user-select: none;
		color: #adb5bd;
		position: absolute;
		top: 50%;
		left: 5px;
		transform: translateY(-50%);
		opacity: 0;
	}
	.popup_option_input__wrapper:hover .popup_option__drag {
		opacity: 1;
	}
	.popup_option__remove {
		position: absolute;
		right: 8px;
		top: 50%;
		transform: translateY(-50%);
		cursor: pointer;
		color: #adb5bd;
	}
	.popup_option__remove:hover {
		color: #495057;
	}
	.popup_option__buttons {
		position: absolute;
		top: -14px;
		left: 0;
		opacity: 0;
		display: flex;
		box-shadow: 0 4px 10px rgba(25, 25, 25, 0.15);
		border-radius: 10px;
		overflow: hidden;
	}
	.popup_option__action_btn {
		width: 24px;
		height: 20px;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #adb5bd;
		background-color: #fff;
		cursor: pointer;
	}
	.popup_option__action_btn:hover {
		color: #495057;
	}
	.popup_option__action_btn.disabled {
		pointer-events: none;
		background-color: #f8f9fa;
		color: #ced4da;
	}
	.popup_option_input__wrapper:hover .popup_option__buttons {
		opacity: 1;
	}
	.popup_option__input {
		padding-right: 15px;
	}
	.popup_option_input__wrapper {
		margin-bottom: 10px;
		position: relative;
	}
	.popup_option_input__wrapper:last-child {
		margin-bottom: 0;
	}
	.wp__font_sizes {
		max-height: 170px;
		overflow: auto;
		width: 100%;
	}
	.wp__font_size_item {
		padding: 2px 10px;
		cursor: pointer;
	}
	.wp__font_size_item:hover {
		background: #e9ecef;
	}
	.wp__font_size_item.wp__font_size_item__active {
		background: #666;
		color: #fff;
	}
	.popup_component__text {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
	}
	.popup_field_component {
		display: flex;
		align-items: center;
		margin-bottom: 5px;
		padding: 5px 0;
		cursor: pointer;
		background-color: #f8f9fa;
		background-color: #fff;
		border-radius: 4px;
		transition: 0.3s ease;
		position: relative;
		overflow: hidden;
	}
	.popup_field_component.dragging {
		background-color: #e9ecef;
	}
	.popup_field_component__drag {
		width: 15px;
		height: 100%;
		top: 0;
		left: 3px;
		cursor: grabbing;
		position: absolute;
		display: flex;
		align-items: center;
		justify-content: center;
		transition: 0.3s ease;
		user-select: none;
		color: #6c757d;
	}
	.popup_field_component:hover .popup_field_component__arrow {
		opacity: 1;
	}
	.flip-list-move {
		transition: transform 0.15s;
	}
	.wp__used_icon {
		width: 10px;
		fill: #0d6efd;
		stroke: none;
		margin-top: -2px;
	}
	.wp__unused_icon {
		width: 10px;
		fill: #dee2e6;
		stroke: none;
		margin-top: -2px;
	}
	.wp__btn {
		background: #dee2e6;
		width: 70px;
		height: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 5px;
	}
	.plugin_icon {
		width: 18px;
		color: #dee2e6;
		cursor: pointer;
		transition: color 150ms ease-out;
		margin-right: 5px;
	}
	.plugin_icon:hover {
		color: #adb5bd;
	}
	.plugin_icon.plugin_icon__active {
		color: #19b600;
	}
	.plugin_icon.plugin_icon__active:hover {
		color: #1b7f35;
	}
	.website-chatbot-sidebar {
		height: 100%;
		width: 500px;
		max-width: 80vw;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.website-chatbot-sidebar-label {
		margin-top: 20px;
		margin-bottom: 10px;
		font-size: 16px;
		font-weight: bold;
		display: flex;
		align-items: center;
	}
	.bot_boxs {
		display: flex;
		flex-wrap: wrap;
		justify-content: space-between;
		overflow: auto;
		padding: 0 20px;
	}
	.bot_box {
		border: 2px solid lightgray;
		border-radius: 5px;
		padding: 10px;
		margin: 10px 0;
		width: 220px;
		display: flex;
		flex-direction: column;
		align-items: center;
		justify-content: center;
	}
	.bot_box:hover {
		border-color: #0d6efd;
	}
	.bot-box__table-cell {
		flex: 1;
		background-color: #fff;
		padding: 10px;
		white-space: nowrap;
		align-items: center;
		display: flex;
		overflow: hidden;
	}
	.popup_component__delete_btn {
		opacity: 0;
		transition: all 150ms ease-out;
		background: white;
		position: absolute;
		top: 10px;
		right: 0;
		color: #343a40;
		cursor: pointer;
		height: 15px;
		width: 15px;
	}
	.popup_component__delete_btn:hover {
		color: #ea3d2f;
	}
	.popup_image_edit__image {
		overflow: hidden;
		align-items: center;
		justify-content: center;
		display: flex;
		margin-bottom: 10px;
		position: relative;
	}
	.wp_create__sidebar {
		padding-top: 20px;
		margin-right: 30px;
		width: 220px;
		flex-shrink: 0;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		background: #f5f5f5;
	}
	.wp_create__category_item {
		padding: 5px 20px;
		font-size: 16px;
		cursor: pointer;
	}
	.wp_create__category_item.active {
		color: #0d6efd;
		font-weight: 500;
	}
	.wp_create__category_item:last-child {
		border-bottom: none;
	}
	.wp_create__keyword_tag {
		margin-right: 8px;
		margin-bottom: 6px;
		padding: 2px 6px;
		border-radius: 4px;
		background-color: #f8f9fa;
		cursor: pointer;
		font-size: 10px;
		display: flex;
		align-items: center;
		border: 1px solid #dee2e6;
	}
	.popup_template__buttons {
		opacity: 0;
		position: absolute;
		top: 50%;
		left: 50%;
		transform: translate(-50%, -50%);
		display: flex;
		flex-direction: column;
	}
	.popup_template_card:hover .popup_template__buttons {
		opacity: 1;
	}
	.popup_template_card:hover .popup_template_card__thumb_overlay {
		opacity: 1;
	}
	.wp_edit_preview__zoom_buttons {
		position: absolute;
		top: 50%;
		transform: translateY(-50%);
		right: 15px;
	}
	.wp_sample_profile_img {
		width: 32px;
		height: 32px;
		border-radius: 50%;
		margin-right: 7px;
		margin-bottom: 7px;
		user-select: none;
	}
	.wp_sample {
		font-weight: 500;
		text-transform: capitalize;
	}
	.wp_sample_profile_upload {
		border: 2px dashed #ced4da;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 50%;
		width: 32px;
		height: 32px;
		cursor: pointer;
		background-size: 100% 100%;
	}
	.wp_sample_profile_upload:hover {
		border-color: #adb5bd;
	}
	.wp_notif_background_overlay {
		z-index: 0;
		position: absolute;
		top: 0;
		left: 0;
		bottom: 0;
		right: 0;
		background: #0d6efd;
		opacity: 0;
	}
	.wp_notif_background {
		position: relative;
		display: flex;
		justify-content: center;
		margin-top: 10px;
		padding: 2px;
		border: 2px solid transparent;
		cursor: pointer;
		width: 170px;
		height: 57px;
		display: flex;
		align-items: center;
		overflow: hidden;
	}
	.wp_notif_background:hover .wp_notif_background_overlay {
		opacity: 0.2;
	}
	.wp_notif_background:hover .wp_notif_background_upload_icon {
		opacity: 1;
	}
	.wp_notif_background.wp_notif_background__active {
		border-color: #0d6efd;
	}
	.wp_notif_background_img {
		width: 100%;
		height: 100%;
		object-fit: cover;
	}
	.wp_notif_backgrounds {
		display: flex;
		flex-wrap: wrap;
		justify-content: space-between;
	}
	.wp_notif_background_upload_icon {
		width: 26px;
		height: 26px;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 50%;
		padding: 2px;
		background: #fff;
		z-index: 1;
		opacity: 0.5;
	}
	.wp_sample_profile {
		position: relative;
	}
	.wp_sample_profile:hover .wp_sample_profile__x {
		opacity: 1;
	}
	.wp_sample_profile__x {
		background: white;
		border-radius: 50%;
		box-shadow: 0 10px 30px rgba(0, 0, 0, 0.15);
		opacity: 0;
		position: absolute;
		top: 0;
		right: 0;
		display: flex;
		align-items: center;
		justify-content: center;
		width: 18px;
		color: #aaa;
		stroke: #aaa;
		height: 18px;
		cursor: pointer;
	}
	.wp_sample_profile__x:hover {
		color: #000;
		stroke: #000;
	}
	.popup_template_card__thumb_overlay {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		background-color: rgba(0, 0, 0, 0.65);
		opacity: 0;
	}
	.popup_template__category_section {
		margin-bottom: 30px;
	}
	.popup_template__category_section:last-child {
		margin-bottom: 0;
	}
	.popup_template__category_title {
		font-size: 26px;
		font-weight: 500;
		margin-bottom: 20px;
		color: #0d6efd;
	}
	.popup_template__img_wrapper {
		width: 320px;
		height: 200px;
		padding-right: 20px;
		margin-bottom: 20px;
		flex-shrink: 0;
	}
	.popup_template__row {
		display: flex;
		flex-wrap: wrap;
	}
	.popup_size_input_unit {
		position: absolute;
		top: 0;
		right: 0;
		cursor: pointer;
		font-size: 12px;
		width: 22px;
		height: 100%;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #6c757d;
		user-select: none;
	}
	.popup_size_input_unit:hover {
		color: #495057;
	}
	.popup_size_input {
		padding-right: 25px;
		max-width: 100px;
	}
	.popup_com_dropdown_section {
		padding-top: 10px;
		padding-bottom: 10px;
		padding-left: 20px;
	}
	.popup_com_dropdown_divider {
		height: 1px;
		width: 100%;
		background: #d5d5d5;
		opacity: 0.7;
	}
	.popup_com_dropdown_section__title {
		font-size: 13px;
		text-transform: uppercase;
		color: #6c757d;
		margin-bottom: 8px;
		font-weight: 500;
	}
	.popup_com_dropdown_section__content {
		display: flex;
		flex-wrap: wrap;
	}
	.popup_com_dropdown__item {
		margin-right: 10px;
		margin-bottom: 10px;
		font-size: 13px;
		display: flex;
		justify-content: center;
		align-self: flex-start;
		align-items: center;
		flex-direction: column;
		text-align: center;
		width: 58px;
		cursor: pointer;
	}
	.popup_com_dropdown__item:hover .popup_component_icon {
		background: #eaeaea;
	}
	.popup_com_dropdown__item:hover .popup_com_dropdown__item_icon {
		background: #e6fcff;
	}
	.popup_com_dropdown__item_icon {
		width: 40px;
		height: 40px;
		border-radius: 5px;
		user-select: none;
		background: #f0f0f0;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.wp_status_text {
		display: flex;
		font-size: 12px;
		line-height: 1;
	}
	.wp_status_text:hover .wp_status_text__action {
		opacity: 1;
		pointer-events: auto;
	}
	.wp_status_text__action {
		opacity: 0;
		pointer-events: none;
		color: #6c757d;
	}
	.wp_status_text__action:hover {
		color: #495057;
		text-decoration: underline;
	}
	.wp_screen_display {
		background-color: #f5f7fa;
		min-width: 1024px;
		width: 100%;
		height: 100%;
		max-height: 100%;
		position: absolute;
		top: 50%;
		left: 50%;
		transform: translate(-50%, -50%);
	}
	.wp_screen_display.mobile {
		width: 375px;
		height: 720px;
		min-width: unset;
	}
	.wp_introduction {
		margin: 10px auto 0;
		max-width: 1140px;
	}
	.wp_introduction_section {
		display: flex;
		width: 100%;
	}
	.wp_introduction_section__left {
		margin-right: 30px;
		max-width: 650px;
		flex: 1;
		display: flex;
		flex-direction: column;
		justify-content: center;
	}
	.wp_introduction_section__right {
		margin-left: 30px;
		max-width: 650px;
		flex: 1;
		display: flex;
		flex-direction: column;
		justify-content: center;
	}
	.wp_introduction_section__title {
		font-size: 32px;
		font-weight: 700;
		margin-bottom: 15px;
	}
	.wp_introduction_section__paragraph {
		font-size: 16px;
	}
	.wp_intro_cta_btn {
		width: fit-content;
		font-weight: 500;
		padding-left: 20px;
		padding-right: 20px;
	}
	.wp_lang_alert {
		padding-right: 5px;
		position: relative;
	}
	.wp_lang_alert:hover .wp_lang_alert__content {
		display: block;
	}
	.wp_lang_alert__content {
		z-index: 99;
		min-width: 250px;
		position: absolute;
		top: 0;
		left: 18px;
		background: #fff;
		border-radius: 4px;
		box-shadow: 0 10px 30px rgba(0, 0, 0, 0.15);
		display: none;
	}
	.wp_lang_alert__head {
		padding: 5px 10px;
		font-weight: 500;
	}
	.wp_lang_alert__item {
		padding: 5px 10px;
		padding-left: 15px;
		cursor: pointer;
	}
	.wp_lang_alert__item:hover {
		background-color: #f8f9fa;
	}
	.i18n-tabs {
		display: flex;
		flex-wrap: wrap;
		position: relative;
		top: 1px;
		z-index: 5;
		left: 1px;
		font-size: 14px;
	}
	.i18n-input__wrapper.focus .i18n-tab__item {
		border-bottom-color: #646464;
	}
	.i18n-input__wrapper.focus .i18n-tab__item.active {
		border-color: #646464;
		box-shadow: -1px 0 0 0 #646464;
	}
	.i18n-tab__item {
		padding: 2.5px 10px;
		color: #adb5bd;
		background-color: #f8f9fa;
		border: 1px solid #cacaca;
		border-left: none;
		box-shadow: -1px 0 0 0 #cacaca;
		cursor: pointer;
		min-width: 80px;
		display: flex;
		align-items: center;
		justify-content: space-between;
	}
	.i18n-tab__item:first-child {
		border-top-left-radius: 4px;
	}
	.i18n-tab__item:last-child {
		border-top-right-radius: 4px;
	}
	.i18n-tab__item.active {
		background-color: #fff;
		color: #495057;
		border-bottom: none;
		z-index: 2;
	}
	.i18n-tab__item.active .flag-icon {
		filter: grayscale(0);
	}
	.i18n-tab__item .flag-icon {
		filter: grayscale(0.35);
	}
	.i18n-input {
		position: relative;
	}
	.i18n-input .form-control {
		border-top-left-radius: 0;
		border-top-right-radius: 0;
	}
	.i18n-tab__item-delete {
		opacity: 0;
		transition: 0.3s;
	}
	.i18n-tab__item:hover .i18n-tab__item-delete {
		opacity: 1;
	}
	.accounts {
		padding-top: 10px;
		border-right: 1px solid whitesmoke;
		flex-shrink: 0;
		overflow-y: scroll;
		position: relative;
		flex: 1;
		display: flex;
		flex-direction: column;
		height: 100%;
	}
	.account_item.account_item__inactive {
		background: whitesmoke;
	}
	.account_item.account_item__inactive:hover {
		background: #f1f7ff;
	}
	.account_item.account_item__selected {
		background: #dceaff;
	}
	.account_item.account_item__selected:hover {
		background: #ccdaef;
	}
	.account_item {
		cursor: pointer;
		border-bottom: 1px solid whitesmoke;
		display: flex;
		padding: 10px 20px;
		background: white;
	}
	.account_item:hover {
		background: #f1f7ff;
	}
	.account_item__desc {
		flex: 1;
		overflow: hidden;
		margin-left: 15px;
	}
	.column {
		overflow: hidden;
	}
	.acc_credit_box {
		background: rgba(255, 193, 7, 0.1254901961);
		padding: 6px 8px;
		display: flex;
		border-radius: 5px;
		align-items: center;
		margin-right: 5px;
		margin-top: 5px;
	}
	.acc_sidebar {
		width: 400px;
		display: flex;
		flex-direction: column;
		overflow-x: hidden;
		overflow-y: auto;
		background: #f7f5f2;
		border-left: 1px solid rgba(166, 145, 113, 0.2);
		padding-top: 15px;
		padding-bottom: 15px;
		padding-left: 20px;
	}
	.acc_sidebar_label {
		font-weight: 500;
		display: flex;
		align-items: center;
		margin-top: 18px;
	}
	.user_label__delete {
		opacity: 0.6;
	}
	.user_label__delete:hover {
		opacity: 1;
	}
	.user_label__container {
		background: white;
		margin: 5px 5px 5px 0;
		border-radius: 4px;
	}
	.user_label__container:only-child {
		margin: 0 5px 0 0;
	}
	.user_label {
		margin: 1px 5px 1px 0;
		display: inline-flex;
		align-items: center;
		padding: 2px 5px;
		border-radius: 10px;
		font-size: 13px;
		font-weight: 500;
		background: #f0f0f0;
		white-space: nowrap;
		color: #000;
	}
	.user_label__title {
		white-space: nowrap;
		line-height: 16px;
		overflow: hidden;
		max-width: 150px;
		text-overflow: ellipsis;
	}
	.user_label.user_label__add_btn {
		border: 1px dashed #6c757d;
		color: #343a40;
	}
	.user_label.user_label__add_btn:hover {
		border: 1px dashed #000;
		color: #000;
	}
	.user_labels {
		display: flex;
		align-items: center;
		width: 100%;
		flex-wrap: wrap;
	}
	.dropdown.convo_header__tag_dropdown__full {
		left: 0;
	}
	.dropdown.convo_header__tag_dropdown__full .dropdown__item.dropdown__item__thin {
		padding: 2px 10px;
	}
	.dropdown.convo_header__tag_dropdown__full .dropdown__item:hover {
		color: white;
		background: #c4d0e6;
	}
	.user_label.hover_to_filter:hover .user_label_icon {
		display: none;
	}
	.user_label.hover_to_filter:hover .user_label_filter_icon {
		display: block;
	}
	.user_label_filter_icon {
		display: none;
	}
	.product-page {
		display: flex;
		flex-direction: column;
		overflow: hidden;
		width: 100%;
		height: 100%;
	}
	.product_list_pagination {
		display: flex;
		align-items: center;
		padding: 10px;
		border-top: 1px solid #dee2e6;
		margin-top: auto;
	}
	.product_filter_sidebar {
		width: 220px;
		height: 100%;
		overflow: auto;
		padding: 8px 20px;
		flex-shrink: 0;
		border: 1px solid #dee2e6;
		border-right: none;
		border-bottom: none;
		background-color: whitesmoke;
	}
	.product_table_header_row {
		background-color: #fff;
		border-top: 1px solid #dee2e6;
	}
	.product_table_td_container {
		overflow: auto;
		max-height: 100%;
		background-color: #fff;
	}
	.product_preview_card__head {
		font-size: 14px;
		display: flex;
		overflow: hidden;
		align-items: center;
		justify-content: space-between;
		padding-bottom: 7px;
	}
	.product_preview_card {
		width: 260px;
		background: #fff;
		padding: 10px;
		box-shadow: 0 15px 40px rgba(0, 0, 0, 0.15);
		border-radius: 5px;
		font-size: 13px;
		cursor: initial;
		color: #495057;
		z-index: 99;
	}
	.product_preview_card_title {
		font-size: 15px;
		font-weight: 500;
		line-height: 1.25;
	}
	.product_preview_card_description {
		font-size: 13px;
		color: #6c757d;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: pre-wrap;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
	}
	.product_preview_card_image {
		width: 100%;
		height: 150px;
		border-radius: 5px;
		overflow: hidden;
		margin-bottom: 10px;
		border: 1px solid #dee2e6;
		overflow: hidden;
	}
	.product_price_edit_text {
		cursor: pointer;
	}
	.product_price_edit_text:hover {
		text-decoration: underline;
	}
	.product_price_edit_input {
		padding: 0;
		border: none;
		outline: none;
		max-width: 60px;
		background: transparent;
		text-align: right;
	}
	.product_stock_edit_input {
		padding: 0;
		border: none;
		outline: none;
		max-width: 40px;
		background: transparent;
		text-align: right;
	}
	.product_table_row {
		cursor: pointer;
	}
	.product_table_row:hover {
		background-color: #f8f9fa;
	}
	.product_table_row.expandable {
		cursor: pointer;
	}
	.product_table_row.item-row {
		padding: 6px 0;
	}
	.variant_row_seperator.first:before {
		height: 36px;
		top: -14px;
	}
	.variant_row_seperator {
		position: relative;
		height: 32px;
	}
	.variant_row_seperator:before {
		content: '';
		width: 1px;
		height: calc(100% + 13px);
		top: -28px;
		left: calc(50% - 1px);
		background-color: #6c757d;
		position: absolute;
	}
	.variant_row_seperator:after {
		content: '';
		width: 50%;
		height: 1px;
		top: 50%;
		left: calc(50% - 1px);
		background-color: #6c757d;
		position: absolute;
	}
	/* Chrome, Safari, Edge, Opera */
	input.product_price_edit_input::-webkit-outer-spin-button,
	input.product_price_edit_input::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	/* Firefox */
	input.product_price_edit_input[type='number'] {
		-moz-appearance: textfield;
	}
	.product_edit_main {
		display: flex;
		flex-direction: column;
		overflow: auto;
		flex: 1;
		width: 100%;
		height: 100%;
		background-color: #fff;
	}
	.product_tab_content {
		overflow: auto;
	}
	.product_edit_left_col {
		flex: 3;
		margin-right: 60px;
	}
	.product_edit_right_col {
		flex: 3;
	}
	.product_edit_container {
		max-width: 900px;
		margin: 0 auto;
		margin-top: 24px;
		margin-bottom: 20px;
	}
	.product_edit_header {
		font-weight: 500;
		font-size: 16px;
	}
	.product_edit_images_grid {
		display: grid;
		grid-gap: 10px;
		grid-template-columns: repeat(3, 1fr);
		position: absolute;
		inset: 0;
	}
	.product_edit_image__first {
		grid-column-start: 1;
		grid-column-end: span 2;
		grid-row-start: 1;
		grid-row-end: span 2;
	}
	.product_edit_media_upload {
		width: 100%;
		border-radius: 5px;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		position: absolute;
		inset: 0;
		color: #adb5bd;
		background-color: #f8f9fa;
	}
	.product_edit_media_upload:hover {
		background-color: #e9ecef;
	}
	.product_edit_media_upload a {
		color: #adb5bd;
	}
	.product_edit_media_upload a:hover {
		color: #6c757d;
	}
	.product_media_wrapper {
		position: relative;
		width: 100%;
		font-size: 13px;
	}
	.product_media_wrapper:before {
		content: '';
		display: block;
		padding-top: 40%;
	}
	.product_media_wrapper.ratio_1_1:before {
		padding-top: 100%;
	}
	.product_media_wrapper.ratio_2_1:before {
		padding-top: 50%;
	}
	.product_media_wrapper.ratio_4_3:before {
		padding-top: 75%;
	}
	.product_media_wrapper.ratio_16_9:before {
		padding-top: 56.25%;
	}
	.product_media_wrapper.ratio_3_1:before {
		padding-top: 33.33%;
	}
	.product_edit_section_seperator {
		margin-top: 40px;
		margin-bottom: 40px;
	}
	.product_edit_sub_title {
		color: #6c757d;
		font-size: 14px;
	}
	.product_edit_price_unit {
		font-size: 12px;
		position: absolute;
		top: 50%;
		transform: translateY(-50%);
		right: 10px;
		color: #adb5bd;
	}
	input.product_edit_price_input::-webkit-outer-spin-button,
	input.product_edit_price_input::-webkit-inner-spin-button {
		-webkit-appearance: none;
		margin: 0;
	}
	/* Firefox */
	input.product_edit_price_input[type='number'] {
		-moz-appearance: textfield;
	}
	.product_edit_price_input {
		padding-right: 32px;
	}
	.product_edit_image_item {
		position: absolute;
		inset: 0;
		overflow: hidden;
		border-radius: 5px;
		box-shadow: 0 0 0 1px #dee2e6;
	}
	.product_edit_image_img {
		width: 100%;
		height: 100%;
	}
	.product_edit_image_item_loading {
		position: absolute;
		inset: 0;
		z-index: 2;
		background-color: rgba(255, 255, 255, 0.65);
		display: flex;
		align-items: center;
		justify-content: center;
		pointer-events: none;
	}
	.product_edit_image_item_overlay {
		position: absolute;
		right: 5px;
		top: 5px;
		z-index: 1;
		opacity: 0;
		pointer-events: none;
	}
	.product_edit_image_item:hover .product_edit_image_item_overlay {
		opacity: 1;
		pointer-events: auto;
	}
	.product_edit_image_item_actions {
		display: flex;
		padding-top: 5px;
		padding-bottom: 5px;
		padding-right: 5px;
		padding-left: 5px;
		align-items: center;
		user-select: none;
	}
	.product_edit_image_item_action_icon {
		color: #fff;
		cursor: pointer;
		user-select: none;
	}
	.product_edit_image_item_action_icon:hover {
		color: #e9ecef;
	}
	.product_category_select_wrap {
		position: relative;
		border: 1px solid #dee2e6;
		overflow: hidden;
	}
	.product_category_select_container {
		width: 1300px;
		display: flex;
		position: relative;
		transition: 0.3s;
	}
	.product_category_select_column {
		flex: 1;
		flex-shrink: 0;
		overflow: hidden;
		height: 320px;
		overflow: auto;
		border-right: 1px solid #dee2e6;
	}
	.product_category_select_column:last-child {
		border-right: none;
	}
	.product_category_select_item {
		display: flex;
		align-items: center;
		color: #6c757d;
		padding: 8px 15px;
		cursor: pointer;
	}
	.product_category_select_item:hover {
		background-color: #f8f9fa;
	}
	.product_category_select_item.selected {
		background-color: #0d6efd;
		color: #fff;
	}
	.product_category_select_nav {
		position: absolute;
		width: 32px;
		height: 32px;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 50%;
		background-color: #ced4da;
		color: #fff;
		top: 50%;
		transform: translateY(-50%);
		box-shadow: 0 15px 50px rgba(0, 0, 0, 0.15);
		z-index: 99;
		cursor: pointer;
	}
	.product_category_select_nav:hover {
		background-color: #adb5bd;
	}
	.product_category_select_nav.left {
		left: 0;
	}
	.product_category_select_nav.right {
		right: 0;
	}
	.product_edit_limit_container {
		width: 900px;
		margin: 0 auto;
	}
	.product_edit_actions_bar {
		border-top: 1px solid #dee2e6;
		background-color: #fff;
		height: 50px;
		z-index: 101;
		display: flex;
		align-items: center;
		padding-right: 8px;
	}
	.product_import_dropzone {
		height: 250px;
		border: 2px dashed #dee2e6;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: #fff;
		cursor: pointer;
		color: #6c757d;
		border-radius: 5px;
	}
	.product_import_dropzone:hover {
		background-color: #f8f9fa;
	}
	.product_edit_additional_images_grid {
		display: grid;
		grid-template-columns: auto auto auto;
		grid-gap: 10px;
	}
	.product_import_sidebar {
		width: 250px;
		flex-shrink: 0;
		padding: 30px 0;
		background: #f7f5f2;
		border-right: 1px solid rgba(166, 145, 113, 0.2);
	}
	.product_import_sidebar_item {
		padding: 5px 20px;
		display: flex;
		align-items: center;
		cursor: pointer;
		color: #555;
	}
	.product_import_sidebar_item.active {
		color: #0d6efd;
		font-weight: bold;
	}
	.product_import_sidebar_item:hover {
		color: #0d6efd;
	}
	.product_import_sidebar_item_img {
		width: 18px;
		height: 18px;
		margin-right: 10px;
		object-fit: contain;
	}
	.product_import_container {
		padding: 20px;
		flex: 1;
		height: 600px;
		overflow: hidden;
	}
	.product_edit_label {
		margin-top: 20px;
		font-weight: 500;
	}
	.product_import_content {
		padding: 30px;
		height: 100%;
		display: flex;
		flex-direction: column;
		position: relative;
		overflow: auto;
	}
	.product_import_step {
		display: flex;
		align-items: center;
		padding: 5px 0;
	}
	.product_import_step_number {
		width: 20px;
		height: 20px;
		margin-right: 10px;
		border-radius: 50%;
		display: flex;
		justify-content: center;
		align-items: center;
		line-height: 1;
		background-color: #e9ecef;
		font-weight: 500;
		font-size: 14px;
	}
	.product_import_upload_zone {
		width: 100%;
		flex: 1;
		display: flex;
		align-items: center;
		justify-content: center;
		min-height: 50px;
	}
	.product_import_uploadable_div {
		height: 250px;
		border: 2px dashed #dee2e6;
		color: #6c757d;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		border-radius: 8px;
	}
	.product_import_uploadable_div:hover {
		background-color: rgba(245, 245, 245, 0.4);
		border-color: #adb5bd;
	}
	.product_import_error {
		background-color: tint-color(#ffc107, 8);
		border-radius: 8px;
		padding: 10px 20px;
		display: flex;
		max-height: 172px;
		overflow: auto;
	}
	.product_res_container {
		display: block;
		overflow-y: scroll;
		height: 100%;
		padding-left: 10px;
		padding-right: 10px;
	}
	.product_res {
		border-radius: 5px;
		position: relative;
		display: flex;
		overflow: hidden;
		width: 100%;
		height: 65px;
		padding: 10px;
		background: #f2f2f2;
		margin-bottom: 5px;
		cursor: pointer;
	}
	.product_res__price {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		color: #6c757d;
	}
	.product_res.product_res__active {
		background: #6c757d;
		color: white;
	}
	.product_res.product_res__active .product_res__status {
		background: #6c757d;
	}
	.product_res.product_res__active .product_res__price {
		color: white;
	}
	.product_res.product_res__active:hover {
		background: #6c757d;
		color: white;
	}
	.product_res.product_res__active:hover .product_res__status {
		background: #6c757d;
	}
	.product_res__status {
		position: absolute;
		bottom: 7px;
		width: 16px;
		height: 16px;
		left: 37px;
		border-radius: 50%;
		background: #f2f2f2;
		padding: 3px;
	}
	.product_res__dot {
		border-radius: 50px;
		width: 100%;
		height: 100%;
		background: #bebebe;
	}
	.product_res__dot.product_res__dot__success {
		background: #19b600;
	}
	.product_res:hover {
		background: #e2e2e2;
	}
	.product_res:hover .product_res__status {
		background: #e2e2e2;
	}
	.product_res__img {
		width: 40px;
		height: 40px;
		margin-right: 10px;
		border-radius: 5px;
		flex-shrink: 0;
		display: block;
		object-fit: cover;
	}
	.product_select__col {
		background: white;
		overflow: auto;
		flex-shrink: 0;
		border-right: 1px solid #e5e5e5;
		overflow: hidden;
		min-height: 200px;
	}
	.product_select__label {
		font-weight: 500;
		margin: 40px 0 10px 0;
		color: #6c757d;
	}
	.product_sel__img {
		height: 240px;
		overflow: hidden;
		width: 100%;
		object-fit: contain;
		border-radius: 8px;
	}
	.product_sel {
		padding-left: 10px;
		height: 100%;
		overflow: auto;
	}
	.product_sel__title {
		margin-top: 15px;
		margin-bottom: 10px;
		font-size: 16px;
		display: flex;
		align-items: center;
	}
	.product_sel__name {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		margin-top: 10px;
		font-weight: 500;
		font-size: 16px;
		align-items: center;
	}
	.product_sel__cat {
		margin-top: 15px;
		margin-bottom: 10px;
		color: #6c757d;
	}
	.product_sel__price {
		color: #19b600;
		font-weight: 500;
	}
	.product_sel__label {
		font-weight: 500;
		margin-top: 10px;
	}
	.product_sel__subtitle {
		font-size: 14px;
		color: #6c757d;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		white-space: pre-wrap;
		overflow: hidden;
	}
	.product_sel_gallery_ele {
		height: 100px;
		width: 50%;
		padding-right: 5px;
		padding-left: 0;
		display: block;
		overflow: hidden;
		margin-bottom: 10px;
		position: relative;
	}
	.product_sel_gallery_ele:nth-child(2n) {
		padding-left: 5px;
		padding-right: 0;
	}
	.product_sel_gallery_ele__img {
		background: whitesmoke;
		border-radius: 6px;
		width: 100%;
		height: 100%;
		object-fit: contain;
	}
	.product_sel_gallery_ele_send_btn {
		cursor: pointer;
		opacity: 0;
		position: absolute;
		font-size: 12px;
		padding: 4px 10px;
		right: 10px;
		top: 10px;
		border-radius: 4px;
	}
	.product_sel_gallery_ele:hover .product_sel_gallery_ele_send_btn {
		opacity: 0.5;
	}
	.product_sel_gallery_ele:hover .product_sel_gallery_ele_send_btn:hover {
		opacity: 1;
	}
	.product_sel__prop {
		display: flex;
		padding: 2px 0;
		overflow: hidden;
	}
	.product_sel__avalability_tag {
		top: 10px;
		font-size: 11px;
		left: 10px;
		padding: 2px 5px;
		border-radius: 5px;
		background: rgba(0, 0, 0, 0.6666666667);
		color: white;
		display: flex;
		align-items: center;
	}
	.product_select_modal {
		padding: 0;
		z-index: 99;
		width: 40%;
		margin-bottom: 10px;
		position: fixed;
		bottom: 38px;
		right: 15vw;
	}
	.product_select_modal .product_select_body {
		border-radius: 10px;
		border-top: 1px solid #d5d5d5;
		border-bottom: 1px solid #d5d5d5;
		transition: height 120ms ease-out;
		height: 540px;
		display: flex;
		overflow: auto;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
	}
	.product_select_close {
		cursor: pointer;
		font-size: 12px;
		top: -25px;
		right: 0;
		border-radius: 7px;
		background: rgba(85, 85, 85, 0.8666666667);
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		color: #fff;
		position: absolute;
		display: flex;
		align-items: center;
		padding: 3px 10px;
		justify-content: center;
	}
	.product_select_close:hover {
		background: #000;
	}
	.product_select_modal__hide {
		padding-top: 0;
		margin-bottom: 0px;
	}
	.product_select_modal__hide .product_select_body {
		border-top: 0px;
		border-bottom: 0px;
		margin-bottom: 0px;
		height: 0px;
		box-shadow: none;
	}
	.product_select_modal__hide .product_select_close {
		display: none;
	}
	.product_select_body.product_select_body__preview {
		border-top: none;
		border-bottom: none;
		display: flex;
		background: white;
	}
	.product_back_btn {
		position: absolute;
		top: 28px;
		left: 10px;
		cursor: pointer;
		color: #343a40;
	}
	.product_back_btn:hover {
		color: #0d6efd;
	}
	/* Hide scrollbar for Chrome, Safari and Opera */
	.product_table_th_container::-webkit-scrollbar {
		display: none;
	}
	/* Hide scrollbar for IE, Edge and Firefox */
	.product_table_th_container {
		-ms-overflow-style: none; /* IE and Edge */
		scrollbar-width: none; /* Firefox */
		overflow: auto;
	}
	.product_variant_menu_link {
		display: flex;
		align-items: center;
		margin-left: 15px;
	}
	.product_variant_menu_text {
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
		overflow: hidden;
		text-overflow: ellipsis;
		font-size: 13px;
		color: #6c757d;
	}
	.product_variant_menu_link.active .product_variant_menu_text {
		color: #0d6efd;
	}
	.product_variant_menu_link:hover .product_variant_menu_text {
		color: #0d6efd;
	}
	.product_variant_menu_img {
		width: 32px;
		height: 32px;
		margin-right: 10px;
		flex-shrink: 0;
		object-fit: cover;
		border-radius: 5px;
		overflow: hidden;
	}
	.product_variant_menu_add_variant_img {
		width: 32px;
		height: 32px;
		display: flex;
		align-items: center;
		justify-content: center;
		border: 1px dashed #6c757d;
		margin-right: 10px;
		color: #6c757d;
		border-radius: 5px;
	}
	.product_variant_menu_link.active .product_variant_menu_add_variant_img {
		border-color: #0d6efd;
		color: #0d6efd;
	}
	.product_variant_menu_link:hover .product_variant_menu_add_variant_img {
		border-color: #0d6efd;
		color: #0d6efd;
	}
	.collection_products_container {
		flex: 1;
		border: 1px solid #dee2e6;
		display: flex;
		overflow: hidden;
		min-height: 356px;
	}
	.collection_products_left {
		flex: 1;
		border-right: 1px solid #dee2e6;
		overflow: auto;
		position: relative;
		display: flex;
		flex-direction: column;
	}
	.collection_products_right {
		width: 200px;
		flex-shrink: 0;
		padding: 10px 20px;
		background-color: #f8f9fa;
		overflow: auto;
	}
	.collection_product_item {
		padding: 5px 0;
		display: flex;
		align-items: center;
	}
	.collection_product_item.clickable {
		cursor: pointer;
		color: #6c757d;
	}
	.collection_product_item.clickable:hover {
		color: #495057;
	}
	.collection_product_item_img {
		width: 32px;
		height: 32px;
		object-fit: cover;
		margin-right: 10px;
		border-radius: 5px;
	}
	.collection_product_item_text {
		overflow: hidden;
		white-space: nowrap;
		text-overflow: ellipsis;
		flex: 1;
	}
	.collection_products_search_wrapper {
		flex: 1;
		overflow: auto;
		padding: 10px 20px;
		position: relative;
	}
	.collection_main_products_container {
		flex: 1;
		border: 1px solid #dee2e6;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.collection_main_products_wrapper {
		flex: 1;
		overflow: auto;
		padding: 10px 20px;
		position: relative;
		min-height: 356px;
		overflow: hidden;
	}
	.import_product_preview_table {
		width: 100%;
		overflow: auto;
		font-size: 13px !important;
		margin-bottom: 20px;
		flex: 1;
	}
	.product_table_image {
		width: 32px;
		height: 32px;
		flex-shrink: 0;
		object-fit: cover;
		border-radius: 5px;
	}
	.product_table_image.small {
		width: 24px;
		height: 24px;
	}
	.edit_product_modal_sidebar {
		width: 250px;
		flex-shrink: 0;
		display: flex;
		flex-direction: column;
		border-right: 1px solid rgba(166, 145, 113, 0.2);
		background-color: #fafafa;
	}
	.edit_product_modal_sidebar_item {
		display: flex;
		padding: 10px 20px;
		align-items: center;
		cursor: pointer;
		font-size: 16px;
		color: #666;
	}
	.edit_product_modal_sidebar_item.active {
		background-color: #f0f7ff;
		color: #0d6efd;
	}
	.edit_product_modal_sidebar_item:hover {
		color: #0d6efd;
	}
	.edit_product_modal_sidebar_step.edit_product_modal_sidebar_step__active {
		color: white;
		background: #0d6efd;
	}
	.edit_product_modal_sidebar_step {
		width: 24px;
		height: 24px;
		margin-right: 10px;
		border-radius: 5px;
		background-color: rgba(0, 0, 0, 0.0509803922);
		display: flex;
		align-items: center;
		justify-content: center;
		line-height: 1;
		font-size: 13px;
		font-weight: 500;
		color: #495057;
	}
	.edit_product_modal_content {
		padding: 0;
		height: 680px;
		display: flex;
		flex-direction: column;
		overflow: hidden;
		flex: 1;
		position: relative;
	}
	.edit_product_modal_content_inner {
		padding: 30px;
		flex: 1;
		overflow: auto;
	}
	.product_variant_table_add_image {
		color: #6c757d;
		width: 100%;
		height: 32px;
		justify-content: center;
		align-items: center;
		display: flex;
		cursor: pointer;
		background-color: #e9ecef;
	}
	.product_variant_table_add_image:hover {
		color: #495057;
	}
	.product_variant_table_preview_image {
		width: 160px;
		height: 160px;
		position: absolute;
		background: #fff;
		padding: 10px;
		border: 1px solid #dee2e6;
		box-shadow: 0 15px 40px rgba(0, 0, 0, 0.15);
		border-radius: 5px;
		z-index: 99;
		cursor: initial;
	}
	.variant_table_image_plus {
		position: absolute;
		width: 16px;
		height: 16px;
		border-radius: 50%;
		background-color: #19b600;
		color: #fff;
		box-shadow: 0 3px 6px 0 rgba(0, 0, 0, 0.15);
		top: 0;
		right: 0;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.edit_product_modal_footer {
		padding: 12px 30px;
		display: flex;
		align-items: center;
		margin-top: auto;
		border-top: 1px solid #e7e1d9;
	}
	.xcel-row.is-invalid .xcel {
		background-color: rgba(234, 61, 47, 0.0823529412);
	}
	.shopee_shop {
		display: flex;
		margin-bottom: 10px;
		margin-top: 10px;
		align-items: center;
		padding: 10px 20px;
		background: whitesmoke;
		max-width: 300px;
		border-radius: 5px;
	}
	.shopee_shop:hover {
		background: #ededed;
	}
	.shopee_shop__img {
		margin-right: 10px;
		height: 32px;
		width: 32px;
		object-fit: cover;
		border-radius: 5px;
	}
	table.preview_crawl_product_table {
		border: none;
	}
	table.preview_crawl_product_table td {
		padding: 8px 15px;
		max-width: 150px;
		min-width: 150px;
		text-overflow: ellipsis;
		overflow: hidden;
		white-space: nowrap;
	}
	table.preview_crawl_product_table thead td {
		font-weight: 500;
		border-top: none;
	}
	table.preview_crawl_product_table thead td:first-child {
		border-left: none;
	}
	table.preview_crawl_product_table thead td:last-child {
		border-right: none;
	}
	table.preview_crawl_product_table tbody td:first-child {
		border-left: none;
	}
	table.preview_crawl_product_table tbody td:last-child {
		border-right: none;
	}
	table.preview_crawl_product_table tbody tr:last-child {
		border-bottom: none;
	}
	table.preview_crawl_product_table tr td:nth-child(1) {
		min-width: unset;
		max-width: unset;
	}
	table.preview_crawl_product_table tr td:nth-child(3) {
		min-width: 80px;
	}
	table.preview_crawl_product_table tr td:nth-child(4) {
		min-width: 200px;
		max-width: 200px;
	}
	table.preview_crawl_product_table tr td:nth-child(6) {
		min-width: 200px;
		max-width: 200px;
	}
	.product_select_sidebar_item {
		padding: 6px 12px;
		border-radius: 8px;
		cursor: pointer;
	}
	.product_select_sidebar_item.in_group {
		padding-left: 31px;
	}
	.product_select_sidebar_item:hover {
		background-color: #dbe5f5;
	}
	.product_select_sidebar_item.active {
		background-color: #0d6efd;
		color: #fff;
		font-weight: 500;
		cursor: auto;
	}
	.product_select_sidebar_group_label {
		padding-left: 10px;
		padding-right: 10px;
		margin-top: 12px;
		margin-bottom: 2px;
		font-size: 14px;
		font-weight: 500;
		color: #6c757d;
		opacity: 0.7;
		display: flex;
		align-items: center;
	}
	.product_sel_product_item {
		border-color: #e5e5e5;
	}
	.product_sel_product_item:hover {
		border-color: #6c757d;
	}
	.product_sel_product_item.selected {
		border-color: #0d6efd;
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.product_sel_product_item.selected:hover .product_sel_product_item_info_btn_wrapper {
		display: block;
	}
	.product_sel_product_item_image {
		transition: 0.3s;
	}
	.product_sel_product_item_info_btn_wrapper {
		display: none;
	}
	.order-list-page {
		height: 100%;
		position: relative;
		display: flex;
		flex-direction: column;
		padding: 20px;
		flex: 1;
		overflow: hidden;
		padding-bottom: 0;
	}
	.order_list_content_card {
		margin-top: 10px;
		background-color: #fff;
		flex: 1;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.order_list_filter {
		display: flex;
		padding: 0;
		flex-wrap: wrap;
	}
	.order_list_table {
		flex: 1;
		overflow: hidden;
		display: flex;
		flex-direction: column;
		position: relative;
	}
	.order_list_pagination {
		padding: 10px;
		border-top: 1px solid #dee2e6;
		display: flex;
		align-items: center;
	}
	.order_list_table_container {
		overflow-y: scroll;
		overflow-x: auto;
		position: relative;
	}
	.order_list_th_container {
		overflow-x: hidden;
		overflow-y: scroll;
		flex-shrink: 0;
		border-bottom: 1px solid #dee2e6;
		/* Track */
	}
	.order_list_th_container::-webkit-scrollbar-track {
		background: #f0f0f0;
	}
	.order_list_th_container .order_cell {
		border: none;
		background: #eef0f4;
	}
	.order_cell {
		border-bottom: 1px solid #dee2e6;
		padding: 8px 0;
		overflow: hidden;
		display: flex;
		align-items: center;
		transition: background 0.3s;
	}
	.order_verify_col {
		width: 90px;
		flex-shrink: 0;
	}
	.order_cb_col {
		width: 35px;
		flex-shrink: 0;
		position: sticky;
		left: 0;
		z-index: 9;
		padding-left: 10px;
		padding-right: 10px;
		color: #6c757d;
	}
	.order_list_table_container .order_cb_col,
	.order_list_table_container .order_id_col {
		background-color: #fff;
	}
	.order_id_col {
		flex-shrink: 0;
		text-overflow: ellipsis;
		overflow: hidden;
		white-space: nowrap;
		width: 100px;
		padding-left: 10px;
		z-index: 9;
		padding-right: 10px;
		position: sticky;
		left: 35px;
	}
	.order_id_col:after {
		position: absolute;
		top: 0;
		right: 5px;
		bottom: -1px;
		width: 5px;
		transform: translate(100%);
		transition: box-shadow 0.3s;
		content: '';
		pointer-events: none;
	}
	.order_id_col.blur:after {
		box-shadow: inset 5px 0 4px -4px rgba(0, 0, 0, 0.1);
	}
	.order_list_table_container .order_id_col {
		cursor: pointer;
	}
	.order_created_col {
		min-width: 130px;
		flex: 1 0 0%;
	}
	.order_tag_col {
		min-width: 80px;
		flex: 1 0 0%;
	}
	.order_branch_col {
		flex: 1 0 0%;
		min-width: 120px;
		color: #6c757d;
	}
	.order_customer_col {
		flex: 1 0 0%;
		min-width: 100px;
	}
	.order_status_col {
		min-width: 130px;
		flex: 1 0 0%;
	}
	.order_payment_col {
		min-width: 140px;
		flex: 1 0 0%;
		flex-shrink: 0;
		padding-right: 10px;
	}
	.order_total_col {
		flex: 1 0 0%;
		min-width: 110px;
		justify-content: flex-end;
	}
	.order_agent_col {
		min-width: 120px;
		flex: 1 0 0%;
		flex-shrink: 0;
	}
	.order_phone_col {
		width: 110px;
		flex-shrink: 0;
	}
	.order_item_product_container {
		display: inline-flex;
		resize: none;
		padding: 0;
		padding-right: 10px;
		white-space: break-spaces;
		position: relative;
		font-weight: 500;
	}
	.order_item_product_container .product_preview_card {
		opacity: 0;
		visibility: hidden;
		transition:
			visibility 100ms,
			opacity 100ms ease-out;
		transition-delay: 150ms;
	}
	.order_item_product_img {
		width: 22px;
		height: 22px;
		border-radius: 4px;
	}
	.order_item_product_container:hover .product_preview_card {
		visibility: visible;
		transition:
			visibility 200ms,
			opacity 200ms ease-out;
		transition-delay: 400ms;
		opacity: 1;
	}
	.order_item_col {
		min-width: 200px;
		flex: 1 0 0%;
		padding-right: 10px;
		padding-left: 10px;
		flex-shrink: 0;
	}
	.order_due_date_col {
		width: 110px;
		flex-shrink: 0;
	}
	.order_shipping_address_col {
		width: 200px;
		flex-shrink: 0;
		padding-left: 10px;
		padding-right: 10px;
	}
	.order_pipeline_col {
		width: 130px;
		flex-shrink: 0;
	}
	.order_pipeline_stage_col {
		width: 110px;
		flex-shrink: 0;
	}
	.order_list_row {
		padding-top: 0;
		padding-bottom: 0;
		align-items: unset;
		cursor: pointer;
		border: none;
	}
	.order_list_row.item-row__header {
		cursor: initial;
	}
	.order_list_row.order_list_row__closed {
		background: whitesmoke;
		filter: grayscale(1);
	}
	.order_list_row.order_list_row__unread {
		font-weight: 600;
	}
	.order_list_row.order_list_row__cancelled {
		opacity: 0.75;
		filter: grayscale(1);
	}
	.order_list_row.just_created .order_cell {
		background-color: tint-color(#ffc107, 8) !important;
	}
	.order_list_table_container div.order_list_row.order_list_row__viewing .order_cell {
		background: #ecefff;
	}
	.order_list_table_container .order_list_row:hover .order_cell {
		background-color: #f8f9fa;
	}
	.order_list_row.order_list_row__checked {
		background: #eff8ff;
	}
	.order_list_row.order_list_row__checked:hover {
		background: #e0e9ef;
	}
	.order_list_row.order_row_draft .order_cell {
		background-color: #f8f9fa;
		opacity: 0.8;
	}
	.order_list_expand_filter {
		width: 300px;
		flex-shrink: 0;
		border-top: 1px solid #dee2e6;
		border-left: 1px solid #dee2e6;
	}
	.order_list_expand_filter_section {
		padding: 8px 15px;
		border-bottom: 1px solid #dee2e6;
	}
	.order-form-control {
		border: none;
		background: #f0f0f0;
		display: block;
		width: 100%;
		padding: 3px 10px;
		font-weight: 400;
		color: #000;
		background-clip: padding-box;
		border: none;
		border-radius: 4px;
		outline: none;
		transition: all 150ms ease-out;
	}
	.order-form-control:active {
		outline: none;
		background: #eaeaea;
	}
	.order-form-control:hover {
		background: #eaeaea;
	}
	.order_select_wrapper {
		position: relative;
	}
	.order_select {
		width: 100%;
		display: flex;
		align-items: center;
		border-radius: 0.5rem;
		appearance: none;
		cursor: pointer;
		overflow: hidden;
	}
	.order_select:hover {
		outline: 0;
	}
	.order_select.danger {
		border-color: #ea3d2f;
	}
	.order_select.danger:hover {
		border-color: #ea3d2f;
	}
	.order_select.order_select__disabled {
		cursor: default;
		background: #f2f2f2;
	}
	.order_select.order_select__disabled:hover {
		border: 1px solid #cacaca;
	}
	.order_select_input {
		border: none;
		position: absolute;
		top: 0px;
		left: 0px;
		right: 0px;
		width: 100%;
		bottom: 0px;
		border: none;
		outline: none;
		z-index: -1;
		background-color: transparent;
	}
	.order_select_input.focus {
		z-index: 1;
	}
	.field_select_wrapper {
		position: relative;
		width: 200px;
	}
	.field_select_wrapper .dropdown__item {
		font-size: 16px;
	}
	.order_select_placeholder {
		color: #adb5bd;
	}
	.order_status {
		text-transform: uppercase;
		background: black;
		color: white;
		display: inline-block;
		border-radius: 4px;
		padding: 6px 6px 4px 6px;
		line-height: 1;
		font-weight: 500;
		font-size: 12px;
	}
	.order_status.order_status__canceled {
		background: whitesmoke;
		color: #000;
	}
	.order_status.order_status__cancel {
		background: whitesmoke;
		color: #000;
	}
	.order_status.order_status__confirmed {
		background: #0d6efd;
		color: white;
	}
	.order_status.order_status__open {
		background: #0d6efd;
		color: white;
	}
	.order_status.order_status__processing {
		background: #17a2b8;
		color: white;
	}
	.order_status.order_status__shipping {
		background: #000;
		color: white;
	}
	.order_status.order_status__fullfilled {
		background: #19b600;
		color: white;
	}
	.order_status.order_status__hold {
		background: #ea3d2f;
		color: white;
	}
	.order_status.order_status__draft {
		background: #ffc107;
		color: white;
	}
	.order_status.order_status__new {
		background: #ffc107;
		color: white;
	}
	.table.order_detail_table {
		border: none;
		table-layout: fixed;
		width: 100%;
	}
	.table.order_detail_table th {
		padding: 0px 0px 8px 0;
		font-weight: 400;
		color: #aaa;
		border-bottom: 1px solid #e0e0e0;
	}
	.table.order_detail_table tr:hover {
		background: white;
	}
	.table.order_detail_table td {
		border-bottom: 1px solid #eee;
		padding: 7px 0px 7px 0px;
	}
	.order_list_filter_tag {
		background-color: #e9ecef;
		position: relative;
		border-radius: 4px;
		padding: 3px 8px;
		margin-right: 10px;
		display: flex;
		align-items: center;
	}
	.order_list_tab_badge {
		background-color: #e9ecef;
		font-size: 10px;
		color: #495057;
		font-weight: 500;
		padding: 4px;
		border-radius: 5px;
		margin-left: 5px;
		line-height: 1;
		position: relative;
		top: -1px;
	}
	.order_list_tab_badge.badge__danger {
		background-color: tint-color(#ea3d2f, 2);
		color: #fff;
	}
	.order_list_tab_badge.badge__warning {
		background-color: #f3aa18;
		color: #fff;
	}
	.order_history__entry {
		display: flex;
	}
	.order_history__entry__logo {
		width: 15px;
		flex-shrink: 0;
		text-align: center;
		position: relative;
		margin-right: 10px;
	}
	.order_history__vline {
		position: absolute;
		left: 4px;
		height: 100%;
		top: 0;
		width: 1px;
		border-left: 2px dotted lightgray;
		z-index: 1;
	}
	.order_history__entry_icon {
		width: 5px;
		height: 5px;
		padding: 5px;
		background: #ccc;
		margin-top: 7px;
		border-radius: 50%;
		z-index: 2;
	}
	.order_history_entry__body {
		flex: 1;
		overflow: hidden;
		margin-bottom: 15px;
	}
	.order_history__entry__time {
		margin-right: 5px;
		color: #6c757d;
		font-size: 13px;
		margin-bottom: 2px;
	}
	.table.order_print_table {
		border: none;
		table-layout: fixed;
		width: 100%;
	}
	.table.order_print_table th {
		padding: 5px 10px;
		border: none;
		font-size: 12px;
		font-weight: 500;
		text-transform: uppercase;
	}
	.table.order_print_table tr:hover {
		background: white;
	}
	.table.order_print_table td {
		padding: 5px 10px;
		border: none;
		border-bottom: 1px solid #dee2e6;
	}
	.filter_order_dropdown.dropdown {
		display: flex;
		flex-direction: column;
		width: 350px;
		right: -15px;
		overflow: unset;
	}
	.filter_order_dropdown_content {
		padding: 10px;
		min-width: 330px;
	}
	.filter_order_dropdown_footer {
		padding: 10px;
		text-align: right;
		background-color: #f8f9fa;
	}
	.filter_order_dropdown_row {
		display: flex;
		align-items: center;
		margin-bottom: 10px;
	}
	.filter_order_dropdown_row:last-child {
		margin-bottom: 0;
	}
	.fulfillment_modal_footer {
		padding: 15px 20px;
		border-top: 1px solid #dee2e6;
		display: flex;
		align-items: center;
	}
	.shipping_policy_template {
		margin-bottom: 10px;
		display: flex;
		align-items: center;
		font-size: 16px;
		color: #6c757d;
		cursor: pointer;
		padding: 8px 15px;
		border: 1px solid #dee2e6;
		border-radius: 5px;
	}
	.shipping_policy_template:last-child {
		margin-bottom: 0;
	}
	.shipping_policy_template:hover {
		color: #495057;
		border-color: #6c757d;
	}
	.shipping_policy_template_icon {
		margin-left: 5px;
		transition: 0.25s;
		width: 18px;
	}
	.shipping_policy_template:hover .shipping_policy_template_icon {
		transform: translateX(5px);
	}
	.order_modal__header_btn {
		cursor: pointer;
		stroke: #adb5bd;
		background: #f0f0f0;
		border-radius: 50%;
		width: 28px;
		height: 28px;
		margin-left: 10px;
		display: block;
		padding: 6px;
	}
	.order_modal__header_btn:hover {
		stroke: black;
		background: #e3e3e3;
	}
	.fulfillment_shipping_providers_container {
		border: 1px solid #dee2e6;
	}
	.fulfillment_shipping_provider {
		border-bottom: 1px solid #dee2e6;
		padding: 15px 20px;
		display: flex;
	}
	.fulfillment_shipping_provider:last-child {
		border-bottom: none;
	}
	.order_box {
		background: white;
		border-radius: 8px;
		padding: 12px 17px;
		margin-bottom: 15px;
	}
	.order_modal_container {
		overflow-x: hidden;
		max-width: 600px;
		width: 40vw;
		overflow-y: hidden;
		height: 100%;
		min-width: 520px;
		display: flex;
		flex-direction: column;
		background: #efefef;
	}
	.order_modal_container_body {
		overflow-y: scroll;
		flex: 1;
		padding: 10px 15px;
	}
	.order_input {
		border: none;
		outline: none;
		background: #f3f3f3;
		padding: 2px 2px 2px 8px;
		border-radius: 4px;
	}
	.order_input:hover,
	.order_input:focus,
	.order_input:active {
		background: #e8e8e8;
	}
	.order_input.order_input__calendar {
		position: relative;
	}
	.order_input.order_input__calendar:hover {
		cursor: pointer;
	}
	.order_box_title {
		margin-bottom: 5px;
		display: flex;
		color: #666;
	}
	.shipping_provider_table.table tr:hover td {
		background-color: #fff;
	}
	.shipping_provider_table.table tr td {
		vertical-align: middle;
	}
	.order_pos_select .dropdown_link_selected {
		border-bottom: none;
	}
	.order_pos_select .dropdown_link_selected:hover {
		border-bottom: none;
	}
	.shipping_detail_section {
		background-color: #fff;
		border-radius: 15px;
		padding: 20px;
		flex: 1;
		flex-shrink: 0;
		overflow: hidden;
	}
	.shipping_detail_label {
		font-size: 14px;
		color: #6c757d;
	}
	.shipping_status_icon {
		width: 15px;
		height: 15px;
		flex-shrink: 0;
	}
	.shipping_track_container {
		display: flex;
	}
	.shipping_tracker {
		display: flex;
		flex-direction: column;
		margin-right: 10px;
		position: relative;
	}
	.shipping_tracker:after {
		content: '';
		top: 10px;
		height: 100px;
		left: 1px;
		width: 50%;
		position: absolute;
		background-color: transparent;
		border-right: 2px dashed #dee2e6;
	}
	.shipping_tracker_arrival_icon {
		width: 12px;
		height: 12px;
		border-radius: 50%;
		border: 2px solid #dee2e6;
		position: relative;
		background-color: #fff;
		top: 4px;
		z-index: 1;
	}
	.shipping_tracker_destiantion_icon {
		width: 12px;
		height: 12px;
		border: 2px solid #dee2e6;
		position: relative;
		z-index: 1;
		top: 4px;
		background-color: #fff;
	}
	.shipping_track_content {
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.order_filter_input {
		white-space: nowrap;
		background-color: rgba(0, 0, 0, 0.062745098);
		padding: 5px 10px;
		border-radius: 4px;
		cursor: pointer;
		display: flex;
		align-items: center;
	}
	.order_filter_input:hover {
		background-color: rgba(0, 0, 0, 0.0941176471);
	}
	.order_filter_input.active {
		background-color: rgba(167.88, 202.8, 254.28, 0.35);
	}
	.order_filter_input .date-range-input {
		background-color: transparent;
		border: none;
		outline: none;
		padding: 0;
		min-height: unset;
	}
	.order_filter_input .date-range-input:focus,
	.order_filter_input .date-range-input:hover {
		border: none;
		outline: none;
	}
	.order_filter_input .force_display .date-range-input {
		border: 1px solid #cacaca;
		padding: 5px 10px;
	}
	.order_filter_input .force_display .date-range-input:focus,
	.order_filter_input .force_display .date-range-input:hover {
		border-color: initial;
	}
	.order_filter_x {
		width: 16px;
		height: 16px;
		background-color: #ced4da;
		cursor: pointer;
		line-height: 1;
		display: flex;
		justify-content: center;
		align-items: center;
		border-radius: 50%;
		color: #fff;
	}
	.order_filter_x:hover {
		background-color: #adb5bd;
		color: #f8f9fa;
	}
	.order_filter_search_input.input_search__input {
		background-color: #eee;
		border: none;
		outline: none;
	}
	.order_filter_search_input.input_search__input.active {
		background-color: rgba(167.88, 202.8, 254.28, 0.35);
	}
	.order_filter_search_input.input_search__input:focus,
	.order_filter_search_input.input_search__input:hover {
		border: none;
		outline: none;
	}
	.board-header-btn-divider {
		border-left: 1px solid rgba(0, 0, 0, 0.2392156863);
		float: left;
		height: 16px;
		margin: 8px;
	}
	.order_pipeline_select {
		background-color: #6c757d;
		color: #fff;
		box-shadow: inset 0 2px 3px rgba(0, 0, 0, 0.3);
		font-size: 14px;
		height: 29px;
	}
	.order_updates {
		position: relative;
		cursor: pointer;
		color: #888;
		display: flex;
		align-items: center;
	}
	.order_updates:hover {
		color: black;
	}
	.order_updates_count {
		position: absolute;
		bottom: -5px;
		right: -8px;
		font-size: 11px;
		font-weight: 600;
		line-height: 1;
		color: #fff;
		text-align: center;
		white-space: nowrap;
		vertical-align: baseline;
		border-radius: 50%;
		padding: 4px;
		min-width: 20px;
	}
	.order_noti {
		overflow: hidden;
		padding: 10px 10px;
		display: flex;
		align-items: center;
		border-radius: 6px;
		cursor: pointer;
		transition: background ease-out 500ms;
	}
	.order_noti:hover {
		transition: background ease-out 100ms;
		background: #eee;
	}
	.order_noti.order_noti__unread {
		transition: background ease-out 100ms;
		background: #dbefff;
	}
	.instant_noti__noti_content {
		-webkit-box-orient: vertical;
		-webkit-line-clamp: 3;
		display: -webkit-box;
		overflow: hidden;
	}
	.order_task_label {
		margin: 0;
		cursor: pointer;
		-webkit-box-orient: vertical;
		-webkit-line-clamp: 2;
		display: -webkit-box;
		overflow: hidden;
	}
	.order_task {
		display: flex;
		margin-top: 5px;
	}
	.dropdown_link_selected_full {
		width: 100%;
		display: flex;
		align-items: center;
		justify-content: space-between;
		color: #333;
	}
	.dropdown_link_selected_full:hover {
		color: black;
		border-bottom: none;
	}
	.order_modal__discount_modal {
		text-align: left;
		width: 250px;
		z-index: 110;
		position: absolute;
		top: 0px;
		right: 0;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border-radius: 8px;
		background: white;
		white-space: normal;
	}
	.order_modal__discount_modal__head {
		padding: 7px 20px;
		display: flex;
		align-items: center;
		border-bottom: 1px solid #eeeeee;
	}
	.order_modal__discount_modal__body {
		padding: 10px 20px;
		background: whitesmoke;
	}
	.user_preview_card__head {
		font-size: 14px;
		display: flex;
		overflow: hidden;
		align-items: center;
		justify-content: space-between;
		padding-bottom: 7px;
	}
	.user_preview_card {
		width: 260px;
		position: fixed;
		background: #fff;
		padding: 10px;
		border: 1px solid #dee2e6;
		box-shadow: 0 15px 40px rgba(0, 0, 0, 0.15);
		border-radius: 5px;
		z-index: 99;
		font-size: 13px;
		cursor: initial;
		color: #495057;
		margin-left: -200px;
	}
	.user_preview_card_title {
		font-size: 15px;
		font-weight: 500;
		line-height: 1.25;
	}
	.user_preview_card_image {
		width: 100%;
		height: 150px;
		border-radius: 5px;
		overflow: hidden;
		margin-bottom: 10px;
		border: 1px solid #dee2e6;
		overflow: hidden;
	}
	.user_order_container {
		position: relative;
	}

	.user_order_container .user_preview_card {
		opacity: 0;
		visibility: hidden;
		transition:
			visibility 100ms,
			opacity 100ms ease-out;
		transition-delay: 150ms;
	}

	.user_order_container:hover .user_preview_card {
		visibility: visible;
		transition:
			visibility 200ms,
			opacity 200ms ease-out;
		transition-delay: 400ms;
		opacity: 1;
	}
	.preview_order_modal {
		display: flex;
		overflow: hidden;
		width: 1000px;
		border-radius: 8px;
	}
	.preview_order_modal_sidebar {
		background: #424242;
		padding: 20px 30px;
		width: 250px;
		flex-shrink: 0;
	}
	.preview_order_modal_sidebar_item {
		padding: 5px 0;
		color: #a6a6a6;
		cursor: pointer;
		user-select: none;
	}
	.preview_order_modal_sidebar_item:hover {
		color: #e6e6e6;
	}
	.preview_order_modal_sidebar_item.active {
		color: #fff;
		font-weight: 500;
	}
	.preview_order_modal_content {
		height: 600px;
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.preview_order_modal_content_header {
		margin-bottom: 30px;
		margin-top: 40px;
		text-align: center;
		flex-shrink: 0;
	}
	.preview_order_modal_content_title {
		font-size: 24px;
		font-weight: 600;
	}
	.order_preview_body {
		position: absolute;
		top: 50%;
		left: 50%;
		transform: translate(-50%, -50%);
		opacity: 1;
		transition: all 250ms ease-out;
		transition-delay: 100ms;
	}
	.order_preview_body.order_preview_body__hidden {
		left: 500px;
		opacity: 0;
		transition: all 150ms ease-out;
	}
	.order_item_img {
		width: 24px;
		height: 24px;
		object-fit: cover;
		border-radius: 4px;
	}
	.order_modal_item_img {
		width: 22px;
		height: 22px;
		object-fit: cover;
		border-radius: 4px;
	}
	.order_tag {
		display: flex;
		align-items: center;
	}
	.order_tag_dot {
		width: 12px;
		height: 12px;
		border-radius: 4px;
	}
	.order_tag_text {
		margin-left: 5px;
		white-space: nowrap;
		overflow: hidden;
		max-width: 120px;
		text-overflow: ellipsis;
	}
	.order_tag_x {
		margin-left: 5px;
		cursor: pointer;
		visibility: hidden;
		display: flex;
		align-items: center;
	}
	.order_tag_x.loading {
		visibility: visible;
	}
	.order_tag:hover .order_tag_x {
		visibility: visible;
	}
	.order_internal_notes {
		padding: 5px 10px;
		margin: 0;
		font-size: 14px;
		border: none;
		background: #f3f3f3;
		border-radius: 6px;
		width: 100%;
	}
	.order_internal_notes:hover {
		outline: 0;
	}
	.order_internal_notes:active,
	.order_internal_notes:focus {
		outline: 0;
	}
	.order_label {
		position: absolute;
		top: 45px;
		right: 10px;
		z-index: 100;
		min-width: 90px;
		height: 28px;
		border: 2px dashed #ff980e;
		padding-left: 10px;
		padding-right: 10px;
		transform: rotate(23.3deg);
	}
	.order_label.draft {
		background-color: rgba(255, 249, 240, 0.8);
		border-color: #ff980e;
		color: #ff980e;
	}
	.order_label.unconfirmed {
		background-color: rgba(255, 249, 240, 0.8);
		border-color: #f3aa18;
		color: #f3aa18;
	}
	.order_label.cancelled {
		background-color: rgba(0, 0, 0, 0.05);
		color: #333;
		border-color: #8b8b8b;
	}
	.order_label_content {
		margin: 0;
		font-style: normal;
		font-weight: 600;
		font-size: 16px;
		line-height: 25px;
		text-align: center;
		text-align: center;
		cursor: default;
	}
	.order_modal_general_info_label {
		width: 70px;
		white-space: nowrap;
		font-size: 14px;
		overflow: hidden;
		margin-right: 8px;
		text-overflow: ellipsis;
		color: #6c757d;
		flex-shrink: 0;
	}
	.btn.order_add_payment_btn {
		background-color: #ff980e;
		color: #fff;
		width: 100%;
		font-weight: 500;
		border-radius: 6px;
	}
	.order_modal_item_row {
		width: 100%;
		display: flex;
		border-bottom: 1px solid #eee;
		padding: 7px 0;
	}
	.shipping_track_content_address {
		overflow: hidden;
		text-overflow: ellipsis;
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
	}
	.order_pipeline_card_description {
		white-space: pre-wrap;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
		overflow: hidden;
		font-size: 13px;
	}

	.taginput_container {
		width: 100%;
		padding: 0;
		padding-top: 4px;
		font-size: 16px;
		font-weight: 400;
		line-height: 1.5;
		color: #495057;
		background-color: #fff;
		background-clip: padding-box;
		border: 1px solid #cacaca;
		border-radius: 0.5rem;
		display: flex;
		flex-wrap: wrap;
	}
	.taginput_container.focus,
	.taginput_container:hover {
		color: #495057;
		background-color: #fff;
		border-color: #646464;
		outline: 0;
	}
	.taginput_container.is-invalid {
		color: #ea3d2f;
		border-color: #ea3d2f;
	}
	.taginput_tag {
		display: flex;
		align-items: center;
		border-radius: 4px;
		background-color: #e9ecef;
		line-height: 1.5;
		padding: 0 5px;
		font-size: 14px;
		margin-bottom: 4px;
		margin-left: 4px;
		max-width: 120px;
	}
	.taginput_tag.deletable {
		background-color: #ffd7d7;
	}
	.taginput_tag_text {
		flex: 1;
		overflow: hidden;
		white-space: nowrap;
		text-overflow: ellipse;
	}
	.taginput_input_wrapper {
		position: relative;
		flex: 1;
		padding-right: 5px;
	}
	.taginput_input {
		width: 100%;
		margin-bottom: 4px;
		margin-left: 6px;
		padding-top: 0;
		padding-bottom: 0;
		padding-right: 6px;
		min-width: 100px;
		border: none;
		box-shadow: none;
		outline: none;
		background-color: transparent;
	}
	.taginput_input::placeholder {
		color: #adb5bd;
	}
	.taginput_input:focus,
	.taginput_input :hover {
		border: none;
		box-shadow: none;
		outline: none;
	}
	input[type='range'].multirange {
		padding: 0;
		margin: 0;
		display: inline-block;
		vertical-align: top;
		-webkit-appearance: none; /* Override default CSS styles */
		appearance: none;
		width: 100%;
		height: 1px;
		background: lightgray;
	}
	input[type='range'].multirange::-moz-range-thumb {
		transform: scale(1); /* FF doesn't apply position it seems */
	}
	input[type='range'].multirange.original {
		position: absolute;
	}
	input[type='range'].multirange.original::-webkit-slider-thumb {
		position: relative;
		z-index: 2;
	}
	input[type='range'].multirange.original::-moz-range-thumb {
		z-index: 2;
	}
	input[type='range'].multirange::-moz-range-track {
		border-color: transparent; /* needed to switch FF to "styleable" control */
	}
	input[type='range'].multirange.middle {
		position: absolute;
		-webkit-appearance: none;
	}
	input[type='range'].multirange.middle:focus {
		outline: none;
	}
	input[type='range'].multirange.middle::-moz-range-thumb {
		position: relative;
		z-index: 1;
		height: 9px;
		width: var(--size);
		margin-top: 6px;
		margin-bottom: 6px;
		background: transparent;
		cursor: pointer;
		border: 0;
	}
	input[type='range'].multirange.middle::-webkit-slider-thumb {
		position: relative;
		z-index: 1;
		height: 9px;
		width: var(--size);
		margin-top: 6px;
		margin-bottom: 6px;
		background: transparent;
		-webkit-appearance: none;
		cursor: pointer;
	}
	input[type='range'].multirange.ghost {
		position: relative;
		background: var(--track-background);
		--track-background: linear-gradient(
				to right,
				transparent var(--low),
				var(--range-color) 0,
				var(--range-color) var(--high),
				transparent 0
			)
			no-repeat 0 9px / 100% 1px;
		--range-color: gray;
	}
	input[type='range'].multirange.ghost::-webkit-slider-runnable-track {
		background: var(--track-background);
	}
	input[type='range'].multirange.ghost::-moz-range-track {
		background: var(--track-background);
	}
	input[type='range'].multirange.ghost::-webkit-slider-thumb {
		position: relative;
		z-index: 2;
	}
	input[type='range'].multirange.ghost::-moz-range-thumb {
		z-index: 2;
	}
	.multirange::-webkit-slider-thumb {
		-webkit-appearance: none;
		appearance: none;
		width: 18px;
		height: 19px;
		border: 0;
		background: url(https://app.subiz.com.vn/dashboard-v4/public/1eaab372898467db4c1a.svg);
		cursor: pointer;
	}
	.multirange::-moz-range-thumb {
		-webkit-appearance: none;
		appearance: none;
		width: 18px;
		height: 19px;
		border: 0;
		background: url(https://app.subiz.com.vn/dashboard-v4/public/1eaab372898467db4c1a.svg);
		cursor: pointer;
	}
	.calendar {
		width: 100%;
		max-width: 360px;
		width: 250px;
		border-radius: 4px;
		overflow: hidden;
		padding-bottom: 10px;
		padding-left: 10px;
		padding-right: 10px;
		/*
    		padding: 5px;
    	 border: 1px solid rgba(101, 109, 119, 0.16);
    */
	}
	.calendar .calendar--nav {
		padding: 0px 5px 0px 5px;
		display: flex;
		align-items: center;
		color: black;
		font-weight: 500;
		justify-content: space-between;
		position: relative;
	}
	.calendar .calendar--nav a {
		cursor: pointer;
		line-height: 1;
		top: 16px;
		width: 30px;
		text-align: center;
		display: inline-block;
		color: rgba(255, 255, 255, 0.4);
		user-select: none;
	}
	.calendar .calendar--days {
		font-size: 0;
		white-space: initial;
	}
	.calendar .calendar--days span {
		width: 14.28571%;
		display: inline-block;
		text-align: center;
		user-select: none;
		cursor: pointer;
		margin: 1px 0;
		line-height: 30px;
		position: relative;
		font-size: 14px;
	}
	.calendar .calendar--days span:hover {
		background: whitesmoke;
	}
	.calendar .calendar--days span.label {
		text-transform: uppercase;
		font-weight: 700;
		color: rgba(0, 0, 0, 0.3);
		font-size: 14px;
		cursor: initial;
	}
	.calendar .calendar--days span.active {
		font-weight: 700;
		background-color: rgba(182, 112, 244, 0.2117647059);
		border-radius: 12px;
	}
	.calendar .calendar--days span.selected {
		font-weight: 700;
		background-color: #0d6dfa;
		color: white;
		border-radius: 12px;
	}
	.calendar .calendar--days span.muted {
		color: rgba(0, 0, 0, 0.3);
	}
	.calendar .calendar--days span.between {
		border-radius: 0;
	}
	.calendar .calendar--days span.start,
	.calendar .calendar--days span.between,
	.calendar .calendar--days span.end {
		background-color: var(--tblr-primary); /* #2f9792
background-color: #2f9792;*/
		color: #fff;
	}
	.calendar .calendar--days span.start.end {
		border-radius: 20px;
	}
	.calendar .calendar--days span.start {
		border-radius: 20px 0 0 20px;
	}
	.calendar .calendar--days span.end {
		border-radius: 0 20px 20px 0;
	}
	.calendar .calendar--days span.between:nth-child(7n):after,
	.calendar .calendar--days span.start:nth-child(7n):after {
		content: '';
		position: absolute;
		top: 0;
		bottom: 0;
		left: 100%;
		background-color: #0d6efd; /* #2f9792 */
		width: 20px;
	}
	.calendar .calendar--days span.between:nth-child(7n + 1):after,
	.calendar .calendar--days span.end:nth-child(7n + 1):after {
		content: '';
		position: absolute;
		top: 0;
		bottom: 0;
		right: 100%;
		background-color: #0d6efd;
		width: 20px;
	}
	.calendar .calendar--days span.start.end:after {
		display: none;
	}
	.calendar .calender-thin .calendar--days span {
		line-height: 20px;
	}
	.calendar .calender-thin .calendar--nav {
		padding-top: 0;
	}
	.calendar .calendar--days span.start,
	.calendar .calendar--days span.between,
	.calendar .calendar--days span.end {
		background-color: #0d6efd;
		color: #fff;
	}
	.calendar .calendar--day:hover {
		border-radius: 12px;
		background: rgba(33, 150, 243, 0.2392156863);
	}
	.calendar_shortcut {
		width: 100px;
		padding: 20px 0;
		background: #f7f7f7;
		border-right: 1px solid #e4e4e4;
	}
	.calendar_wrapper__top .calendar_container {
		border-bottom-left-radius: 0;
		border-bottom-right-radius: 0;
		border-top-left-radius: 10px;
		border-top-right-radius: 10px;
	}
	.calendar_container {
		position: absolute;
		z-index: 101;
		background: white;
		display: flex;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border-bottom-left-radius: 10px;
		border-bottom-right-radius: 10px;
		overflow: hidden;
	}
	.calendar_shortcut__item {
		cursor: pointer;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		padding: 3px 10px;
	}
	.calendar_shortcut__item:hover {
		background: #0d6efd;
		color: white;
	}
	.pipeline_stages_container {
		display: flex;
		flex: 1;
		width: 100%;
		overflow-y: auto;
	}
	.pipeline_stage_column {
		display: flex;
		flex-direction: column;
		width: 300px;
		margin-right: 20px;
		border-radius: 8px;
		overflow: hidden;
		flex-shrink: 0;
	}
	.pipeline_stage_column:last-child {
		margin-right: 0;
	}
	.pipeline_stage_header {
		display: flex;
		align-items: center;
		background-color: #e9ecef;
		padding: 10px;
		font-weight: 500;
	}
	.pipeline_stage_order_count {
		margin-left: 8px;
		padding: 2px 5px;
		line-height: 1;
		font-size: 10px;
		background-color: #ced4da;
		color: #495057;
		font-weight: 400;
		border-radius: 4px;
		align-self: center;
		flex-shrink: 0;
	}
	.pipeline_stage_order_total {
		margin-left: auto;
		text-transform: initial;
		font-size: 15px;
		font-weight: 400;
		flex-shrink: 0;
	}
	.pipeline_stage_dropzone {
		background-color: #eee;
		flex: 1;
		padding: 10px;
		overflow-y: auto;
	}
	.pipeline_stage_dropzone.dragin {
		background-color: #f3f3f3;
	}
	.pipeline_order_card {
		background-color: #fff;
		position: relative;
		border-radius: 8px;
		padding: 10px;
		margin-bottom: 10px;
		display: flex;
		align-items: center;
		transition: background 0.2s;
		cursor: pointer;
	}
	.pipeline_order_card.just-dragin {
		background-color: tint-color(#ffc107, 8);
	}
	.pipeline_order_card.dragging {
		opacity: 0.5;
		cursor: grabbing;
	}
	.pipeline_order_card:last-child {
		margin-bottom: 0;
	}
	.pipeline_order_card_content {
		flex: 1;
		margin-left: 10px;
		font-size: 14px;
		display: flex;
		flex-direction: column;
		height: 100%;
		width: 100%;
		overflow: hidden;
	}
	.pipeline_order_card_agent {
		border-radius: 50%;
		width: 20px;
		height: 20px;
		object-fit: cover;
	}
	.edit_pipeline_stage_bar {
		background: #e9ecef;
		margin-bottom: 15px;
	}
	.edit_pipeline_stage_bar:last-child {
		margin-bottom: 0;
	}
	.edit_pipeline_stage_bar_header {
		display: flex;
		align-items: center;
		padding: 10px;
	}
	.edit_pipeline_stage_bar_content {
		padding: 10px 20px;
		border-top: 1px solid #dee2e6;
	}
	.pipeline_order_card_due_date {
		display: flex;
		align-items: center;
		margin-left: auto;
		flex-shrink: 0;
		align-self: flex-end;
	}
	.pipeline_order_card_due_date.overdue {
		padding: 2px 6px;
		border-radius: 4px;
		background-color: rgba(255, 0, 0, 0.1);
		color: #ea3d2f;
		font-size: 12px;
	}
	.call_settings_sidebar {
		width: 500px;
		height: 100%;
		position: relative;
		overflow: hidden;
	}
	.call_settings_sidebar_inner {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		display: flex;
		flex-direction: column;
		transition: 0.3s;
	}
	.call_settings_sidebar_header {
		display: flex;
		align-items: center;
		padding: 10px 30px;
		border-bottom: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.call_settings_sidebar_body {
		flex: 1;
		overflow: auto;
		padding: 20px 20px;
	}
	.call_settings_sidebar_footer {
		display: flex;
		padding: 10px 30px;
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.call_settings_sidebar_agent_row {
		display: flex;
		align-items: center;
		padding: 2px 0;
		margin-bottom: 10px;
	}
	.call_settings_sidebar_agent_row .grab_icon {
		color: #adb5bd;
	}
	.call_settings_sidebar_section {
		border-radius: 8px;
		border: 1px solid #dee2e6;
		overflow: hidden;
		margin-top: 20px;
	}
	.call_settings_sidebar_section.checked {
		border: 2px solid #0d6efd;
	}
	.call_settings_sidebar_section_sw {
		position: relative;
		top: 3px;
	}
	.call_settings_sidebar_section_header {
		background: white;
		display: flex;
		padding: 15px;
	}
	.call_settings_sidebar_section_body {
		background: white;
		padding: 15px;
	}
	.call_settings_sidebar_section_body.action_body {
		padding-left: 40px;
		padding-top: 0;
		margin-top: -10px;
		border-top: none;
	}
	.call_settings_sidebar_menus_table {
		max-width: 500px;
		margin-top: 10px;
	}
	.call_settings_sidebar_menus_table_row {
		display: flex;
		margin-bottom: 10px;
	}
	.call_settings_sidebar_menus_table_row.header {
		font-size: 13px;
		color: #6c757d;
		text-transform: uppercase;
		font-weight: 500;
	}
	.call_settings_sidebar_menus_table_cell {
		display: flex;
		align-items: center;
	}
	.call_settings_sidebar_menus_table_cell.key_cell {
		width: 100px;
		flex-shrink: 0;
	}
	.call_settings_sidebar_menus_table_cell.action_cell {
		flex: 1;
		margin-left: 20px;
		margin-right: 10px;
	}
	.call_settings_sidebar_menus_table_cell.remove_cell {
		width: 20px;
		justify-content: flex-end;
		flex-shrink: 0;
	}
	.call_convo_card {
		width: 550px;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		box-shadow: 0 3px 8px #dee2e6;
		overflow: hidden;
		background-color: #fff;
	}
	.call_convo_card_header {
		display: flex;
		align-items: center;
		padding: 15px;
		border-bottom: 1px solid #dee2e6;
	}
	.call_convo_card_body {
		padding: 15px;
	}
	.call_convo_card_footer {
		display: flex;
		padding: 15px;
		background-color: #424156;
		color: #fff;
	}
	.call_convo_card_footer.ongoing {
		background-color: #19b600;
	}
	.call_convo_card_info_row {
		display: flex;
	}
	.call_convo_card_info_row_label {
		font-weight: 500;
		width: 150px;
		flex-shrink: 0;
	}
	.call_convo_card_info_row_content {
		flex: 1;
		overflow: hidden;
	}
	.call_convo_card_info_row {
		margin-bottom: 10px;
	}
	.call_convo_card_info_row:last-child {
		margin-bottom: 0;
	}
	.call_record_audio {
		display: flex;
		flex-direction: column;
	}
	.call_convo_card_audio_duration {
		font-size: 40px;
		font-weight: 200;
		line-height: 1;
	}
	.call_duration {
		font-size: 30px;
		font-weight: 500;
	}
	.call_modal_header {
		display: flex;
		padding: 5px 20px 0px 20px;
		align-items: center;
		font-family: 'Roboto';
		font-weight: 600;
		font-size: 16px;
		line-height: 19px;
		color: black;
	}
	.call_modal_input.form-control {
		font-size: 20px;
		border: 1px solid #f5f5f5;
		outline: none;
		border-radius: 4px;
		background-color: #f5f5f5;
		padding: 10px;
		padding-top: 25px;
		width: 100%;
		color: #000;
	}
	.call_modal_input.form-control:hover,
	.call_modal_input.form-control:focus {
		background-color: #f5f5f5;
		color: #000;
	}
	.call_modal_input.form-control.is-invalid {
		border-color: #ea3d2f;
	}
	.phone_fill_icon path:last-child {
		fill: currentColor;
	}
	.call_center_modal_header {
		font-size: 20px;
		font-weight: 500;
	}
	.call_center_modal_section_title {
		font-size: 16px;
		font-weight: 500;
	}
	.call_center_modal_section_subtitle {
		color: #6c757d;
	}
	.call_center_modal_section {
		margin-bottom: 25px;
	}
	.call_center_modal_info_input {
		padding: 5px 10px;
		background-color: #eee;
		border-radius: 5px;
		color: #6c757d;
		display: flex;
		align-items: center;
	}
	.call_center_modal_info_input.empty {
		padding-left: 0;
		background-color: #fff;
		font-style: italic;
	}
	.call_center_modal_step_bar {
		width: 50px;
		height: 6px;
		border-radius: 9999px;
		background-color: #eee;
		margin-right: 10px;
	}
	.call_center_modal_step_bar:last-child {
		margin-right: 0;
	}
	.call_center_modal_step_bar.active {
		background-color: #495057;
	}
	.call_center__confirm_continue_call_modal {
		width: 90%;
		height: 150px;
		background-color: white;
		padding: 10px;
		border-radius: 8px;
		flex-direction: column;
		justify-content: space-between;
		box-shadow:
			0px 0px 0px 0px,
			rgba(0, 0, 0, 0.22) 0px 10px 40px 0px,
			rgba(0, 0, 0, 0.17) 0px 0px 16px 0px;
	}
	.integrate_phone_number_sample {
		padding: 10px 15px;
		border-radius: 12px;
		background-color: #f8dcff;
		font-weight: 600;
		font-size: 24px;
		position: relative;
		transform: rotate(-5deg);
		display: flex;
		align-items: center;
		line-height: 1;
		align-self: center;
		margin-bottom: 30px;
		margin-top: 20px;
	}
	.integrate_phone_number_sample_icon {
		width: 28px;
		height: 28px;
		background-color: #917ccc;
		border-radius: 9999px;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #917ccc;
	}
	.integrate_phone_number_sample_icon .icon-tabler-phone path:last-child {
		fill: #f8dcff;
	}
	.integrate_phone_number_sample_done {
		width: 28px;
		height: 28px;
		background-color: #19b600;
		border: 2px solid #fff;
		border-radius: 9999px;
		color: #fff;
		display: flex;
		align-items: center;
		justify-content: center;
		position: absolute;
		bottom: -10px;
		right: -10px;
	}
	.greeting_audio_name_wrapper {
		margin-left: 10px;
		margin-right: 20px;
		display: flex;
		flex: 1;
		overflow: hidden;
		align-items: center;
		position: relative;
	}
	.greeting_audio_name_wrapper:hover .greeting_audio_name_edit_icon {
		display: block;
	}
	.greeting_audio_name_wrapper input.form-control {
		padding-right: 40px;
	}
	.greeting_audio_name_edit_icon {
		display: none;
	}
	.greeting_audio_name_edit_buttons {
		display: flex;
		position: absolute;
		top: 6px;
		right: 4px;
	}
	.choose_audio_modal_table .sbz_table_row .sbz_table_cell:first-child {
		padding-left: 0;
	}
	.choose_audio_modal_table .sbz_table_row .sbz_table_cell:last-child {
		padding-right: 0;
	}
	.audio_player_wrapper {
		display: inline-flex;
		align-items: center;
	}
	.audio_player_graphs {
		display: flex;
		align-items: center;
		position: relative;
		margin-left: 15px;
		height: 30px;
	}
	.audio_player_btn {
		width: 40px;
		height: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 50%;
		color: #fff;
		border: 3px solid #fff;
		cursor: pointer;
	}
	.audio_player_btn .icon-tabler-player-pause rect {
		fill: currentColor;
	}
	.audio_player_btn .icon-tabler-player-play path:last-child {
		fill: currentColor;
	}
	.audio_player_graph_wrapper {
		padding: 0 2px;
		height: 100%;
		display: flex;
		align-items: center;
		cursor: pointer;
	}
	.audio_player_graph_wrapper.active .audio_player_graph {
		background-color: #fff;
	}
	.audio_player_graph_wrapper.active .audio_player_graph.highlight {
		background-color: #19b600;
	}
	.audio_player_graph {
		width: 2px;
		border-radius: 6px;
		background-color: #adb5bd;
	}
	.audio_player_graph.highlight {
		width: 2px;
		border-radius: 9999px;
		background-color: shade-color(#19b600, 4);
	}
	.audio_player_wrapper.simple {
		min-width: 95px;
		padding: 3px 6px;
		padding-right: 12px;
		border-radius: 9999px;
		background-color: #e9ecef;
		cursor: pointer;
	}
	.audio_player_wrapper.simple .audio_player_btn {
		width: 20px;
		height: 20px;
		border: none;
		background-color: #353b49;
		color: #fff;
	}
	.audio_player_wrapper.simple.active {
		color: #fff;
		background-color: #0d6efd;
	}
	.audio_player_wrapper.simple.active .audio_player_btn {
		background-color: #fff;
		color: #0d6efd;
	}
	.global_audio_card {
		position: fixed;
		z-index: 1000;
		background-color: #33395e;
		color: #fff;
		right: 40px;
		bottom: 40px;
		border-radius: 8px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		display: none;
		align-items: center;
		padding: 15px;
	}
	.global_audio_card.active {
		display: flex;
	}
	.global_audio_card_header {
		display: flex;
		font-size: 18px;
		padding: 15px;
	}
	.global_audio_card_x_button {
		background-color: #fff;
		color: #495057;
		border-radius: 8px;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
		position: absolute;
		top: -28px;
		right: 0;
		padding: 3px 10px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		background-color: #33395e;
		color: #fff;
	}
	.global_audio_card_x_button:hover {
		background-color: #495057;
	}
	.global_audio_rails {
		width: 100%;
		height: 5px;
		position: relative;
		background-color: rgba(255, 255, 255, 0.7);
		cursor: pointer;
	}
	.global_audio_progress {
		height: 100%;
		position: absolute;
		top: 0;
		left: 0;
		background-color: #fff;
	}
	.global_audio_actions {
		flex-shrink: 0;
		display: flex;
		align-items: center;
	}
	.global_audio_time {
		flex-shrink: 0;
		font-size: 13px;
		margin-left: 10px;
	}
	.global_audio_actions .icon-tabler-player-play path:last-child {
		fill: currentColor;
	}
	.global_audio_actions .icon-tabler-player-pause rect {
		fill: currentColor;
	}
	.global_audio_slider {
		width: 100%;
		-webkit-appearance: none; /* Override default CSS styles */
		appearance: none;
		height: 4px;
		background-color: whitesmoke;
		outline: none;
		cursor: pointer;
		border-radius: 10px;
	}
	/* The slider handle (use -webkit- (Chrome, Opera, Safari, Edge) and -moz- (Firefox) to override default look) */
	.global_audio_slider::-webkit-slider-thumb {
		-webkit-appearance: none; /* Override default look */
		appearance: none;
		width: 0px; /* Set a specific slider handle width */
		height: 0px; /* Slider handle height */
		background: #fff; /* Green background */
		cursor: pointer; /* Cursor on hover */
	}
	.global_audio_slider::-moz-range-thumb {
		width: 0px; /* Set a specific slider handle width */
		height: 0px; /* Slider handle height */
		background: #fff; /* Green background */
		cursor: pointer; /* Cursor on hover */
	}
	.global_audio_slider_wrapper {
		display: flex;
		align-items: center;
		width: 140px;
	}
	.global_audio_slider_wrapper:hover .global_audio_slider {
		height: 5px;
	}
	.global_audio_slider_wrapper:hover .global_audio_slider::-webkit-slider-thumb {
		width: 10px; /* Set a specific slider handle width */
		height: 10px; /* Slider handle height */
		border-radius: 9999px;
	}
	.global_audio_slider_wrapper:hover .global_audio_slider::-moz-range-thumb {
		width: 10px; /* Set a specific slider handle width */
		height: 10px; /* Slider handle height */
		border-radius: 9999px;
	}
	.call_search__body {
		margin-top: 10px;
		position: relative;
		display: flex;
		flex-direction: column;
		flex: 1;
		overflow: auto;
		padding: 0 20px;
	}
	.call_search__body.call_search__body__disabled {
		opacity: 0.8;
		user-select: none;
	}
	.call_modal_body {
		display: flex;
		flex-direction: column;
		padding: 0;
		overflow: auto;
		flex: 1;
	}
	.call_modal_input {
		width: 100%;
		margin-top: 0;
		border: none;
		font-size: 26px;
		font-weight: medium;
		height: 50px;
		background: whitesmoke;
		outline: 0;
		padding: 0 10px;
		border-radius: 8px;
		color: #555;
	}
	.call_modal_input:hover,
	.call_modal_input:active {
		background: #e7e7e7;
	}
	.call_search__item {
		user-select: none;
		flex-shrink: 0;
		width: 100%;
		cursor: pointer;
		display: flex;
		align-items: center;
		border-radius: 4px;
		padding: 6px 0px;
		overflow: hidden;
		word-break: break-all;
		white-space: nowrap;
		text-overflow: ellipsis;
		border-bottom: 1px solid whitesmoke;
	}
	.cal_modal_sub_label {
		font-weight: 500;
		font-size: 13px;
		padding: 0;
		line-height: 14px;
		/* identical to box height */
		text-transform: uppercase;
		color: #888888;
	}
	.tab__name {
		font-weight: 500;
		font-size: 18px;
		line-height: 21px;
	}
	.count__devices {
		height: 19px;
		font-size: 13px;
		line-height: 1;
		font-weight: 400;
		color: #7a7a7a;
		background-color: #ebebeb;
		border-radius: 4px;
		padding: 3px 5px;
		margin-top: 12px;
	}
	.device__item {
		flex-direction: column;
		padding-top: 8px;
		padding-bottom: 8px;
		border-top: 1px solid rgb(235, 235, 235);
	}
	.device_item__row {
		flex-direction: row;
		justify-content: space-between;
	}
	.error__connected {
		display: inline-block;
		padding-top: 4px;
		line-height: 1;
		padding-left: 5px;
		font-size: 11px;
		font-weight: 600;
		padding-right: 5px;
		border-radius: 6px;
		background: #ffc107;
		text-transform: uppercase;
		height: 18px;
		color: white;
	}
	.device__id {
		color: #717171;
		font-size: 13px;
		font-weight: 400;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		cursor: pointer;
	}
	.device__name {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		cursor: pointer;
		font-size: 15px;
		font-weight: 400;
	}
	.device__name:hover {
		color: #0d6efd;
	}
	.device__lastupdate {
		color: #717171;
		font-size: 15px;
		font-weight: 400;
	}
	.call_modal_content {
		background: white;
		display: flex;
		flex-direction: column;
		height: 400px;
		transition: background 0.5s ease;
	}
	.task_row {
		height: 28px;
	}
	.task_general_info_label {
		width: 90px;
		white-space: nowrap;
		overflow: hidden;
		margin-right: 10px;
		text-overflow: ellipsis;
		color: #6c757d;
		flex-shrink: 0;
	}
	.task_form_field {
		margin-bottom: 5px;
		display: flex;
		align-items: center;
		height: 28px;
	}
	.task_form_field:last-child {
		margin-bottom: 0;
	}
	.task_form_label {
		width: 150px;
		padding-right: 10px;
		flex-shrink: 0;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		color: #6c757d;
	}
	.task_form_field_edit {
		width: 180px;
		height: 30px;
		border: none;
		outline: none;
		background: #f3f3f3;
		padding: 5px 2px 2px 8px;
		border-radius: 4px;
	}
	.task_form_field_edit:hover,
	.task_form_field_edit:focus,
	.task_form_field_edit:active {
		background: #e8e8e8;
	}
	.task_form_field_edit:hover {
		color: #0d6efd;
	}
	.task_footer {
		display: flex;
		flex-shrink: 0;
		justify-content: flex-end;
		font-weight: 500;
		align-items: center;
	}
	.tasks__row.task__row__done {
		background: whitesmoke;
	}
	.tasks__row.task__row__done:hover {
		background: #ebebeb;
	}
	.tasks__row {
		cursor: pointer;
		display: flex;
		width: 100%;
		flex-shrink: 0;
		flex-direction: row;
		padding: 7px 12px 7px 20px;
		background: white;
	}
	.tasks__row:hover {
		background: rgba(13, 110, 253, 0.0705882353);
	}
	.tasks__row.tasks__row__active {
		background: #ddeafd;
	}
	.tasks__row.tasks__row__active:hover {
		background: #cfe0fa;
	}
	.task_pinned_icon {
		opacity: 0.7;
		margin-right: 10px;
		cursor: pointer;
	}
	.task_pinned_icon:hover {
		opacity: 1;
	}
	.task_pinned_icon.task_pinned_icon__hidden {
		opacity: 0.5;
	}
	.task_pinned_icon.task_pinned_icon__hidden:hover {
		opacity: 1;
		color: #495057;
	}
	.task_footer:hover .pinned_icon {
		visibility: visible;
	}
	.task_not_seen {
		font-weight: 600;
	}
	.task_input_title {
		border-radius: 4px;
		border: none;
		background: #f8f8f8;
		font-size: 18px;
		font-weight: 500;
		padding: 5px 10px;
		outline: none;
	}
	.task_input_title:hover {
		background: #f1f1f1;
	}
	.task_modal_header {
		display: flex;
		flex-direction: row;
		justify-content: center;
		align-items: center;
		height: 55px;
	}
	.task_modal_footer {
		height: 48px;
		display: flex;
		border-top: 1px solid #f1f1f1;
		align-items: center;
	}
	.task_checkbox {
		display: flex;
		flex-shrink: 0;
		align-items: center;
		justify-content: center;
		width: 24px;
		height: 24px;
		border-radius: 6px;
		border: 2px solid rgba(0, 0, 0, 0.3333333333);
		background: white;
		cursor: pointer;
	}
	.task_checkbox:hover {
		border: 2px solid rgba(0, 0, 0, 0.6);
	}
	.task_checkbox[disabled] {
		opacity: 0.5;
		cursor: default;
	}
	.task_checkbox[disabled]:hover {
		border: 2px solid rgba(0, 0, 0, 0.3333333333);
	}
	.task_checkbox.task_checkbox__done {
		color: #19b600;
		border: 2px solid #19b600;
	}
	.task_checkbox.task_checkbox__done:hover {
		border: 2px solid rgba(0, 0, 0, 0.6);
	}
	.task_form_title {
		font-size: 18px;
		font-weight: 500;
		overflow: hidden;
		white-space: nowrap;
		text-overflow: ellipsis;
		padding: 6px 10px;
		margin-left: -10px;
	}
	.task_form_title_input.form-control {
		font-size: 18px;
		margin-left: -10px;
	}
	.task_modal_content {
		flex: 1;
		overflow: hidden;
		background: #f5f5f5;
		flex-shrink: 0;
		padding: 0px 0 0px 0px;
	}
	.task_activities {
		padding: 10px 20px 0px 20px;
		border-top: 1px solid #dee2e6;
	}
	.task_activities_inner {
		overflow-y: auto;
		margin-right: -20px;
		padding-right: 10px;
		padding-top: 10px;
		flex: 1;
	}
	.message_editor.message_editor__plain.task_message_editor {
		border-radius: 10px;
	}
	.message_editor.message_editor__plain.task_message_editor .message_editor__input {
		font-family: unset;
		font-size: unset;
		width: 100%;
		overflow: auto;
		padding-left: 10px;
		padding-right: 60px;
		padding-top: 6px;
		padding-bottom: 6px;
		border-radius: 20px;
		background-color: #f4f4f4;
	}
	.message_editor.message_editor__plain.task_message_editor .message_editor__input:hover {
		background-color: #eee;
	}
	.message_editor.message_editor__plain.task_message_editor .message_editor__input .ProseMirror {
		outline: none;
		min-height: 30px;
	}
	.message_editor.message_editor__plain.task_message_editor .message_editor__input .ProseMirror .ProseMirror-widget {
		opacity: 0.5;
	}
	.task_history__entry {
		display: flex;
	}
	.task_history__entry__logo {
		width: 30px;
		display: flex;
		flex-direction: column;
		flex-shrink: 0;
		align-items: center;
		position: relative;
		margin-right: 10px;
	}
	.task_history__vline {
		position: absolute;
		left: 14px;
		top: 38px;
		bottom: 10px;
		width: 1px;
		border-left: 1px solid #c6c6c6;
		z-index: 1;
	}
	.task_history__entry__logo_img {
		z-index: 2;
		position: relative;
		margin-top: 0;
	}
	.task_history_entry__body {
		flex: 1;
		overflow: hidden;
		margin-bottom: 10px;
	}
	.task_list_header {
		display: flex;
		border-bottom: 1px solid #e6e6e6;
		position: relative;
		align-items: center;
		margin-bottom: 0;
		padding-right: 20px;
	}
	.task_list_header .tab {
		margin-bottom: 0;
		border-bottom: none;
		flex: 1;
	}
	.task_list_header .tab__item {
		padding-top: 14px;
	}
	.instant_noti__noti.in_list_task_noti {
		padding-left: 20px;
		padding-right: 12px;
		padding-top: 8px;
		padding-bottom: 6px;
		overflow: hidden;
		border-bottom: 1px solid #f0f0f0;
		align-items: flex-start;
	}
	.instant_noti__noti.in_list_task_noti:hover {
		background: #f8f8f8;
	}
	.in_list_task_noti .instant_noti__noti_content {
		-webkit-line-clamp: 2;
	}
	.in_list_task_noti .instant_noti__noti_body {
		font-size: 16px;
		line-height: 1.3;
	}
	.in_list_task_noti .instant_noti__time {
		font-size: 14px;
		color: rgba(0, 0, 0, 0.4666666667);
	}
	.instant_noti__noti.in_list_task_noti.in_list_task_noti__active {
		background: #ddeafd;
	}
	.instant_noti__noti.in_list_task_noti.in_list_task_noti__active:hover {
		background: #cfe0fa;
	}
	.task_noti___body {
		overflow: auto;
		padding: 0 0;
		flex: 1;
	}
	.task_detail_header {
		padding: 8px 20px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		flex-shrink: 0;
	}
	.task_detail_content_inner {
		max-width: 420px;
		margin: 0 auto;
	}
	.task_detail_footer {
		flex-shrink: 0;
	}
	.task_detail_footer_inner {
		max-width: 420px;
		margin: 0 auto;
		padding: 10px 20px;
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.task_detail_main_fields {
		padding: 10px 20px;
	}
	.task_detail_sub_fields {
		padding: 10px 20px;
		border-top: 1px solid #dee2e6;
		display: flex;
		justify-content: space-between;
	}
	.task_detail_content_wrapper {
		overflow-y: auto;
		overflow-x: hidden;
		flex: 1;
	}
	.task_create_form .task_detail_content_inner {
		max-width: 420px;
	}
	.task_create_form .task_detail_footer_inner {
		max-width: 420px;
		display: flex;
		align-items: center;
		justify-content: space-between;
	}
	.task_title_input {
		margin-left: -5px;
		margin-right: -5px;
		margin-top: -2px;
		padding: 2px 5px;
		font-size: 18px;
		font-weight: 600;
		outline: none;
		border-radius: 4px;
		resize: none;
		border: none;
		background: transparent;
		display: block;
		width: calc(100% + 10px);
		overflow: hidden;
		overflow-wrap: break-word;
		margin-bottom: 8px;
	}
	.task_title_input:focus {
		box-shadow: 0 0 0 1px #cacaca;
	}
	.task_title_input:focus[readonly] {
		box-shadow: none;
	}
	.task_title_input.no_border:focus {
		box-shadow: none;
	}
	.task__modal.task__modal__hide {
		display: none;
	}
	.task__modal_close {
		position: absolute;
		top: 0;
		left: -50px;
		width: 40px;
		height: 40px;
		display: flex;
		align-items: center;
		justify-content: center;
		z-index: 110;
		border-radius: 8px;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		background: #fff;
		border: 1px solid #c6c6c6;
		color: #adb5bd;
		display: flex;
		align-items: center;
		justify-content: center;
		cursor: pointer;
	}
	.task__modal_close:hover {
		color: #6c757d;
	}
	.task__modal_close:after {
		content: '';
		position: absolute;
		inset: -10px;
		background-color: transparent;
	}
	.task__modal_inner {
		display: flex;
		flex-direction: column;
		height: 100%;
		width: 100%;
		border-radius: 8px;
		overflow: hidden;
	}
	.task__modal {
		display: flex;
		height: 650px;
		width: 750px;
		cursor: default;
		flex-direction: column;
		position: absolute;
		background: white;
		border-radius: 8px;
		z-index: 210;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		border: 1px solid #c6c6c6;
		height: 500px;
		right: 20px;
		top: 60px;
	}
	.message_text.message_text__agent.task_note_text_meessage {
		margin: 0;
		padding: 0;
		font-size: 14px;
	}
	.message_text.message_text__agent.task_note_text_meessage .avatar {
		width: 14px !important;
		height: 14px !important;
	}
	.message_text.message_text__agent.task_note_text_meessage.has_overflow {
		width: 100%;
		overflow: hidden;
		max-height: 105px;
	}
	.message_text.message_text__agent.task_note_text_meessage.has_overflow .view_more {
		content: '';
		position: absolute;
		left: 0;
		right: 0;
		padding: 0;
		cursor: pointer;
		font-size: 14px;
		color: #6c757d;
		bottom: 0;
		background-color: #fff;
	}
	.message_text.message_text__agent.task_note_text_meessage.has_overflow .view_more:hover {
		color: #495057;
	}
	.message_text.message_text__agent.task_note_text_meessage.has_overflow .view_more:before {
		content: '';
		position: absolute;
		left: 0;
		right: 0;
		height: 24px;
		bottom: 20px;
		background: linear-gradient(rgba(255, 255, 255, 0.5), #fff);
		width: 100%;
	}
	.message_editor.message_editor__plain.task_note_editor {
		margin-left: -5px;
		margin-right: -5px;
		margin-top: -2px;
		margin-bottom: -2px;
		padding: 2px 5px;
		border-radius: 4px;
		background-color: #fff;
		box-shadow: 0 0 0 1px #cacaca;
	}
	.message_editor.message_editor__plain.task_note_editor.edit_mode {
		margin: 0;
	}
	.message_editor.message_editor__plain.task_note_editor.no_border {
		box-shadow: none;
		border: none;
	}
	.task_detail_attachment {
		width: 80px;
		height: 80px;
		border-radius: 8px;
		margin-right: 15px;
		margin-bottom: 15px;
		position: relative;
		object-fit: cover;
		border: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.task_detail_attachment.add_attachment {
		border: 2px solid #dee2e6;
		color: #dee2e6;
		cursor: pointer;
	}
	.task_detail_attachment.add_attachment:hover {
		border-color: #adb5bd;
		color: #adb5bd;
	}
	.task_detail_attachment.error {
		border-color: #ea3d2f;
		color: #ea3d2f;
	}
	.task_detail_attachment.error .task_detail_attachment_x {
		border-color: #ea3d2f;
		color: #ea3d2f;
	}
	.task_detail_attachment.error .task_detail_attachment_x:hover {
		color: shade-color(#ea3d2f, 4);
	}
	.task_detail_attachment_x {
		width: 20px;
		height: 20px;
		border-radius: 9999px;
		background-color: #fff;
		color: #adb5bd;
		cursor: pointer;
		position: absolute;
		top: -8px;
		right: -8px;
		display: flex;
		align-items: center;
		justify-content: center;
		border: 1px solid #dee2e6;
	}
	.task_detail_attachment_x:hover {
		color: #6c757d;
	}
	.tasks__row.recent_seen_task {
		background: #e6f0ff;
	}
	.user_task_row {
		margin-bottom: 8px;
		display: flex;
		align-items: center;
	}
	.user_task_row:last-child {
		margin-bottom: 0;
	}
	.noti_task_expired_item {
		flex-direction: column;
		justify-content: space-between;
		position: absolute;
		width: 100%;
		height: 95px;
		background: #ffffff;
		box-shadow: 0px 5px 20px rgba(0, 0, 0, 0.15);
		border-radius: 12px;
		padding: 15px;
	}
	.option_delay_task {
		width: 105px;
		height: 24px;
		background: #d9d9d9;
		border-radius: 3px;
		justify-content: space-between;
		align-items: center;
	}
	.option_delay_task:hover {
		background: #cfcfcf;
	}
	.task_list_filters_container {
		display: flex;
		flex-wrap: wrap;
		flex: 1;
	}
	.task_list_actions_container {
		padding: 10px 20px;
		padding-bottom: 0;
		border-bottom: 1px solid #e6e6e6;
		display: flex;
		align-items: flex-start;
	}
	.task_due_status_badge {
		display: inline-flex;
		align-items: center;
		position: relative;
		border-radius: 4px;
		font-size: 14px;
		background-color: transparent;
	}
	.task_due_status_badge.overdue {
		padding: 2px 6px;
		background-color: #ea3d2f;
		color: #fff;
		font-size: 12px;
	}
	.task_due_status_badge.due_today {
		padding: 2px 6px;
		background-color: #fff3cd;
		color: #495057;
		font-size: 12px;
	}
	.contain_task_message {
		flex-direction: row;
		flex-wrap: wrap;
		justify-content: center;
		padding-right: 50px;
		padding-left: 50px;
	}
	.task_message {
		display: flex;
		opacity: 1;
		align-items: center;
		border-radius: 12px;
		background-color: rgba(0, 0, 0, 0.0352941176);
		padding: 5px 10px;
		color: #000000;
		flex-direction: row;
	}
	.text__muted.task_message:hover,
	.task_message.timeline_group_day:hover,
	.task_message.ai_agent_table_row_desc:hover,
	.task_message.automation_template_card_desc:hover,
	.task_message.ticket_detail_page_info_section_title:hover,
	.task_message.onboarding_modal_desc:hover,
	.task_message.kv_row_label:hover,
	.dropdown2_item_icon_wrapper .task_message.icon-tabler:hover,
	.task_message.my_activities_grid_calendar_label:hover,
	.task_message.campaign_telesale_next_call_card_section_title:hover,
	.task_message.subscription_info_card_subtitle:hover,
	.task_message.trial_subscription_page_header_desc:hover,
	.task_message.bot_step__index:hover,
	.task_message.order_pipeline_card_description:hover {
		background-color: rgba(0, 0, 0, 0.0941176471);
	}
	.icon_status_task_message {
		display: flex;
		border: 2px solid #19b600;
		border-radius: 6px;
		width: 20px;
		height: 20px;
		justify-content: center;
		align-items: center;
		margin-right: 10px;
	}
	.icon_status_task_message.reopen {
		border: 2px solid rgba(0, 0, 0, 0.3333333333);
	}
	.done_task_icon {
		display: block;
		color: #19b600;
	}
	.reopen_task_icon {
		color: rgba(0, 0, 0, 0.3333333333);
		display: block;
	}
	.task_history_entry__body .message_container.message_container__agent.message_container__image {
		display: grid;
		width: 100%;
		padding-left: 0;
		padding-right: 0;
		grid-gap: 2px;
	}
	.task_history_entry__body .message_container.message_container__agent.message_container__image.grid_columns_1 {
		grid-template-columns: repeat(1, 1fr);
	}
	.task_history_entry__body .message_container.message_container__agent.message_container__image.grid_columns_2 {
		grid-template-columns: repeat(2, 1fr);
	}
	.task_history_entry__body .message_container.message_container__agent.message_container__image.grid_columns_3 {
		grid-template-columns: repeat(3, 1fr);
	}
	.task_history_entry__body .grid_columns_3 .message_image,
	.task_history_entry__body .grid_columns_2 .message_image {
		position: relative;
		padding-top: 100%;
		margin-top: 0;
	}
	.task_history_entry__body .grid_columns_3 .message_image .message_image__img,
	.task_history_entry__body .grid_columns_2 .message_image .message_image__img {
		position: absolute !important;
		inset: 0;
		max-height: unset;
		border-radius: 4px;
		min-width: unset;
		width: 100%;
	}

	.task_note_editor .message_editor__input {
		width: 100%;
		overflow: auto;
		padding-left: 10px;
		padding-right: 60px;
		padding-top: 6px;
		padding-bottom: 6px;
	}
	.task_note_editor .message_editor__input .ProseMirror {
		outline: none;
		min-height: 30px;
	}
	.task_note_editor .message_editor__input .ProseMirror p {
		margin-bottom: 6px;
	}
	.task_note_editor .message_editor__input .ProseMirror .ProseMirror-widget {
		opacity: 0.5;
	}
	.segment_container {
		padding-top: 20px;
		flex-direction: column;
		width: 100%;
		height: 100%;
		overflow: hidden;
	}
	.segment_header {
		justify-content: space-between;
		width: 100%;
	}
	.segment_content {
		width: 100%;
		flex-direction: row;
		flex: 1 1 0%;
		overflow: hidden;
	}
	.folder_plus_icon {
		color: white;
	}
	.create_segment_header {
		padding: 10px 25px;
		font-size: 20px;
		font-weight: 500;
	}
	.create_segment_body {
		padding: 25px 0;
		flex-direction: column;
	}
	.create_segment_footer {
		justify-content: flex-end;
		padding: 0 25px;
	}
	.segment_type_option {
		display: flex;
		flex-direction: row;
		width: 270px;
		background: #ffffff;
		border: 1px solid #dee2e6;
		border-radius: 9px;
		padding: 10px 10px 10px 20px;
		cursor: pointer;
	}
	.segment_type_option.active {
		border-color: #0d6efd;
		box-shadow: 0 0 0 1px #0d6efd;
	}
	.segment_name:hover {
		cursor: pointer;
	}

	.toolbar {
		display: flex;
		margin-bottom: 1px;
		background: #fff;
		padding: 4px;
		border-top-left-radius: 10px;
		border-top-right-radius: 10px;
		vertical-align: middle;
		border-bottom: 1px solid gray;
	}
	i.bold {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/b3bec3f33045771f9484.svg);
	}
	i.italic {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/d3971b39b0fe39a09b1b.svg);
	}
	i.underline {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/b41f84ace38d530f30b9.svg);
	}
	i.strikethrough {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/5d23c9047ed5de3d800c.svg);
	}
	i.code {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/617835135fe5b8cd2640.svg);
	}
	i.link,
	i.message_event_action_link,
	i.onboarding_row_ignore_link,
	.onboarding_row.done i.onboarding_row_cta {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/7d2df934bfb1a5cbb4fb.svg);
	}
	.editor-text-bold {
		font-weight: bold;
	}
	.editor-text-italic {
		font-style: italic;
	}
	.editor-text-underline {
		text-decoration: underline;
	}
	.editor-text-strikethrough {
		text-decoration: line-through;
	}
	.editor-text-underlineStrikethrough {
		text-decoration: underline line-through;
	}
	.editor-text-code {
		background-color: rgb(221, 221, 221);
		padding: 1px 0.25rem;
		font-family: Menlo, Consolas, Monaco, monospace;
		font-size: 94%;
	}
	.link-editor {
		position: absolute;
		z-index: 100;
		top: -10000px;
		left: -10000px;
		margin-top: -6px;
		max-width: 300px;
		width: 100%;
		opacity: 0;
		background-color: #fff;
		box-shadow: 0px 5px 10px rgba(0, 0, 0, 0.3);
		border-radius: 8px;
		transition: opacity 0.5s;
	}
	.link-editor .link-input {
		display: block;
		width: calc(100% - 24px);
		box-sizing: border-box;
		margin: 8px 12px;
		padding: 8px 12px;
		border-radius: 15px;
		background-color: #eee;
		font-size: 15px;
		color: rgb(5, 5, 5);
		border: 0;
		outline: 0;
		position: relative;
		font-family: inherit;
	}
	.link-editor div.link-edit {
		background-image: url(https://app.subiz.com.vn/dashboard-v4/public/4c640d95a61cb0764a83.svg);
		background-size: 16px;
		background-position: center;
		background-repeat: no-repeat;
		width: 35px;
		vertical-align: -0.25em;
		position: absolute;
		right: 0;
		top: 0;
		bottom: 0;
		cursor: pointer;
	}
	.link-editor .link-input a {
		color: rgb(33, 111, 219);
		text-decoration: none;
		display: block;
		white-space: nowrap;
		overflow: hidden;
		margin-right: 30px;
		text-overflow: ellipsis;
	}
	.link-editor .link-input a:hover {
		text-decoration: underline;
	}
	.link-editor .button {
		width: 20px;
		height: 20px;
		display: inline-block;
		padding: 6px;
		border-radius: 8px;
		cursor: pointer;
		margin: 0 2px;
	}
	.link-editor .button.hovered {
		width: 20px;
		height: 20px;
		display: inline-block;
		background-color: #eee;
	}
	.link-editor .button i,
	.actions i {
		background-size: contain;
		display: inline-block;
		height: 20px;
		width: 20px;
		vertical-align: -0.25em;
	}

	.sbz_lexical_img_wrapper_loading {
		position: relative;
	}
	.sbz_lexical_img_wrapper_loading:before {
		content: '';
		position: absolute;
		top: calc(50% - 10px);
		left: calc(50% - 10px);
		z-index: 2;
		border: 2px solid #f3f3f3;
		animation: spin 1s linear infinite;
		border-top: 2px solid #555;
		border-radius: 50%;
		width: 20px;
		height: 20px;
	}
	.sbz_lexical_img_wrapper_loading img {
		opacity: 0.5;
	}
	@keyframes spin {
		0% {
			transform: rotate(0deg);
		}
		100% {
			transform: rotate(360deg);
		}
	}
	.prose_editor span[is-image] {
		display: inline-flex;
		align-items: center;
		justify-content: center;
		min-width: 160px;
		min-height: 100px;
		max-width: 100%;
		vertical-align: bottom;
		background-color: #eef0f2;
		border-radius: 6px;
		overflow: hidden;
	}
	.prose_editor span[is-image] img {
		display: block;
		max-width: 100%;
	}
	.prose_editor span[is-image] .sbz_prose_img_error_message {
		display: none;
		flex-direction: column;
		align-items: center;
		justify-content: center;
		gap: 4px;
		padding: 12px;
		color: #6c757d;
		font-size: 13px;
		line-height: 18px;
		text-align: center;
	}
	.prose_editor span[is-image] .sbz_prose_img_error_message:before {
		content: '!';
		display: flex;
		align-items: center;
		justify-content: center;
		width: 22px;
		height: 22px;
		border: 1px solid currentColor;
		border-radius: 50%;
		font-weight: 600;
	}
	.prose_editor span[is-image].sbz_prose_img_loading img {
		opacity: 0;
	}
	.prose_editor span[is-image].sbz_prose_img_loaded {
		min-width: 0;
		min-height: 0;
		background-color: transparent;
	}
	.prose_editor span[is-image].sbz_prose_img_error {
		border: 1px solid #dfe3e8;
		background-color: #f5f6f7;
	}
	.prose_editor span[is-image].sbz_prose_img_error img {
		display: none;
	}
	.prose_editor span[is-image].sbz_prose_img_error .sbz_prose_img_error_message {
		display: flex;
	}
	[data-input='lexical_web'] p {
		margin-bottom: 0;
	}
	[data-input='prosemirror_web'] p {
		margin-bottom: 0;
	}
	[data-input='prosemirror_web'] strong {
		font-weight: 700;
	}
	.ticket_list_page {
		width: 100%;
		height: 100%;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.ticket_layout_sidebar {
		width: 260px;
		flex-shrink: 0;
		background-color: #f7f5f2;
		height: 100%;
		border-right: 1px solid #dee2e6;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.ticket_layout_sidebar_header {
		padding: 12px 20px;
		flex-shrink: 0;
	}
	.ticket_layout_sidebar_content {
		padding: 6px 20px;
		flex: 1;
		overflow: auto;
	}
	.ticket_layout_sidebar_item_section {
		margin-bottom: 10px;
	}
	.ticket_layout_sidebar_item_section:last-child {
		margin-bottom: 0;
	}
	.ticket_layout_sidebar_item_icon_actions_wrapper {
		width: 20px;
		height: 20px;
		flex-shrink: 0;
		display: flex;
		align-items: center;
		justify-content: flex-end;
	}
	.ticket_layout_sidebar_item_icon_actions_wrapper.triggered .ticket_layout_sidebar_item_shrink_icon {
		display: none;
	}
	.ticket_layout_sidebar_item_icon_actions_wrapper.triggered .ticket_layout_sidebar_item_settings_icon {
		display: flex;
	}
	.ticket_layout_sidebar_item_shrink_icon {
		display: block;
		color: #6c757d;
	}
	.ticket_layout_sidebar_item_settings_icon {
		display: none;
		color: #6c757d;
		width: 20px;
		height: 20px;
		align-items: center;
		justify-content: flex-end;
	}
	.ticket_layout_sidebar_item {
		display: flex;
		margin-left: -8px;
		margin-right: -8px;
		cursor: pointer;
		align-items: center;
		padding: 5px 8px;
		padding-right: 3px;
		border-radius: 5px;
		margin-bottom: 2px;
	}
	.ticket_layout_sidebar_item.danger {
		color: #ea3d2f;
	}
	.ticket_layout_sidebar_item.secondary .icon-tabler:first-child {
		color: #6c757d;
		stroke-width: 1;
	}
	.ticket_layout_sidebar_item.child {
		padding-left: 25px;
		padding-top: 3px;
		padding-bottom: 3px;
		margin-bottom: 0;
	}
	.ticket_layout_sidebar_item.hidden {
		display: none;
	}
	.ticket_layout_sidebar_item .tabler-icon {
		flex-shrink: 0;
	}
	.ticket_layout_sidebar_item:last-child {
		margin-bottom: 0;
	}
	.ticket_layout_sidebar_item:hover {
		background-color: #ececec;
	}
	.ticket_layout_sidebar_item.active {
		background-color: #495057;
		color: #fff;
	}
	.ticket_layout_sidebar_item.active .ticket_layout_sidebar_item_number_badge {
		background-color: #495057;
		color: #fff;
	}
	.ticket_layout_sidebar_item.unread {
		font-weight: 700;
		color: #000;
	}
	.ticket_layout_sidebar_item.unread .ticket_layout_sidebar_item_number_badge {
		background-color: #ea3d2f;
		font-weight: 700;
		color: #fff;
	}
	.ticket_layout_sidebar_item_number_badge {
		flex-shrink: 0;
		font-size: 12px;
		color: #6c757d;
		background-color: #e9ecef;
		border-radius: 4px;
		font-weight: 500;
		padding: 0px 5px;
	}
	.ticket_layout_sidebar_item_text {
		flex: 1;
		margin-left: 8px;
		margin-right: 10px;
	}
	.ticket_list_header {
		display: flex;
		align-items: center;
		padding: 10px 15px 0;
	}
	.ticket_list_header_title_container {
		flex: 1;
		display: flex;
	}
	.ticket_list_header_title {
		max-width: 350px;
		font-size: 18px;
	}
	.ticket_list_header_subtext {
		font-size: 14px;
		color: #6c757d;
		margin-left: 5px;
		position: relative;
		top: 4px;
	}
	.ticket_list_header_actions {
		margin-left: 20px;
		flex-shrink: 0;
		display: flex;
	}
	.ticket_list_filters {
		padding: 10px 15px 0;
		display: flex;
		margin-bottom: 5px;
		flex-wrap: wrap;
	}
	.ticket_page_layout {
		display: flex;
		width: 100%;
		height: 100%;
		overflow: hidden;
	}
	.ticket_page_layout_content {
		flex: 1;
		min-width: 0;
		overflow: hidden;
	}
	.ticket_detail_page {
		width: 100%;
		background: whitesmoke;
		height: 100%;
		overflow: hidden;
		position: relative;
		display: flex;
	}
	.ticket_detail_page.inconvo {
		border-left: 1px solid #dee2e6;
	}
	.ticket_detail_page_left_header {
		flex-shrink: 0;
		height: 55px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		padding: 0 20px;
	}
	.ticket_detail_page_left_inconvoheader {
		flex-shrink: 0;
		height: 64px;
		border-bottom: 1px solid #dee2e6;
		display: flex;
		align-items: center;
		padding: 0 20px;
	}
	.ticket_detail_page_left_col {
		flex: 1;
		padding: 12px 20px;
		overflow-y: scroll;
	}
	.ticket_detail_page_header_title_text {
		font-size: 20px;
		font-weight: 500;
	}
	.ticket_detail_page_subtitle_seperator {
		margin-left: 10px;
		margin-right: 10px;
		width: 1px;
		height: 14px;
		background-color: #dee2e6;
	}
	.ticket_detail_page__container.ticket_detail_page__container__inconvo {
		border-radius: 10px;
		margin: 10px;
		border: 1px solid #dee2e6;
	}
	.ticket_detail_page__container {
		background: white;
		border-right: 1px solid #dee2e6;
		flex: 2;
		display: flex;
		flex-direction: column;
		overflow-y: hidden;
	}
	.ticket_detail_page_right_col.ticket_detail_page_right_col__incovo {
		border-left: 1px solid #dee2e6;
		padding-top: 0px;
	}
	.ticket_detail_page_right_col {
		background: white;
		flex-shrink: 0;
		padding-top: 11px;
		height: 100%;
		overflow: hidden;
		display: flex;
		flex-direction: column;
		overflow-x: hidden;
		min-width: 200px;
		max-width: 400px;
		flex: 3;
		position: relative;
		min-height: 100%;
		transition: 0.3s ease;
	}
	.ticket_detail_page_right_col.expand {
		width: unset;
		flex: 3;
		max-width: unset;
	}
	.ticket_detail_page_right_col .tab {
		margin-bottom: 0;
		padding-left: 20px;
		flex-shrink: 0;
	}
	.ticket_detail_page_right_col_wrapper {
		flex: 1;
		overflow: hidden;
		position: relative;
	}
	.ticket_detail_page_right_col_inner {
		width: 100%;
		height: 100%;
		left: 0;
		top: 0;
		position: absolute;
		overflow-y: auto;
		transition: 0.3s;
	}
	.ticket_detail_page_right_col_inner .profile {
		overflow: hidden;
		border-left: none;
	}
	.ticket_detail_page_info_section {
		padding: 12px 20px;
		border-bottom: 1px solid #dee2e6;
	}
	.ticket_detail_page_info_section_title {
		font-size: 14px;
		text-transform: uppercase;
		font-weight: 500;
	}
	.ticket_cell.ticket_cell__status {
		width: 110px;
		flex-shrink: 0;
	}
	.ticket_cell {
		border-bottom: 1px solid #dee2e6;
		padding: 10px 8px;
		overflow: hidden;
		display: flex;
		align-items: center;
	}
	.ticket_cell.ticket_cell__sm {
		width: 125px;
		flex-shrink: 0;
	}
	.item-row:hover .ticket_cell {
		background-color: #f8f9fa;
	}
	.order_list_row.order_list_row__checked:hover .ticket_cell {
		background-color: #dfebf4;
	}
	.edit_ticket_modal {
		display: flex;
		flex-direction: column;
		width: 750px;
		max-width: calc(100vw - 32px);
		height: 630px;
		max-height: 90vh;
		overflow: hidden;
	}
	.edit_ticket_modal_header {
		padding: 12px 20px;
		border-bottom: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.edit_ticket_modal_content {
		position: relative;
		width: 100%;
		height: auto;
		min-height: 0;
		flex: 1;
		margin: 0;
	}
	.edit_ticket_modal_form_main {
		padding: 12px 20px;
		flex: 1;
		min-height: 0;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.edit_ticket_modal_form_sidebar {
		width: 280px;
		padding: 12px 20px;
		border-left: 1px solid #dee2e6;
		height: 100%;
		min-height: 0;
		flex-shrink: 0;
		overflow-y: auto;
	}
	.edit_ticket_modal_form_sidebar_field {
		margin-bottom: 15px;
	}
	.edit_ticket_modal_form_sidebar_field:last-child {
		margin-bottom: 0;
	}
	.edit_ticket_modal_form_sidebar_field_label {
		font-size: 14px;
		color: #6c757d;
	}
	.edit_ticket_modal_form {
		display: flex;
		height: 100%;
		width: 100%;
		overflow: hidden;
		flex: 1;
		position: relative;
	}
	.edit_ticket_modal_form_title_input {
		padding: 2px 0;
		font-size: 18px;
		font-weight: 600;
		outline: none;
		border-radius: 4px;
		resize: none;
		border: none;
		background: transparent;
		display: block;
		width: 100;
		overflow: hidden;
		overflow-wrap: break-word;
		padding-bottom: 5px;
	}
	.edit_ticket_modal_footer {
		padding: 12px 20px;
		border-top: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.ticket_status {
		font-size: 14px;
		text-transform: uppercase;
		display: flex;
		align-items: center;
		gap: 5px;
		color: #6c757d;
	}
	.ticket_id_col {
		color: #6c757d;
	}
	.order_list_row__unread .ticket_id_col,
	.order_list_row__unread .ticket_status {
		color: #495057;
	}
	.square {
		width: 14px;
		height: 14px;
		border-radius: 3px;
	}
	.square.square__success {
		background: #19b600;
	}
	.square.square__warning {
		background: #ffc107;
	}
	.square.square__primary {
		background: #0d6efd;
	}
	.square.square__secondary {
		background: #6c757d;
	}
	.ticket_detail_event_wrapper {
		margin-bottom: 15px;
	}
	.ticket_detail_event_wrapper:last-child {
		margin-bottom: 0;
	}
	.ticket_detail_event_inner {
		padding-left: 16px;
		padding-right: 16px;
	}
	.ticket_detail_event_inner_avatar_wrapper {
		position: relative;
		top: 2px;
		flex-shrink: 0;
		line-height: 1;
	}
	.ticket_detail_event_message_sent {
		border: 1px solid #dee2e6;
		padding: 10px 15px;
		border-radius: 8px;
		background-color: #fff;
		box-shadow: rgba(0, 0, 0, 0.09) 0px 1px 4px;
		position: relative;
	}
	.ticket_detail_event_message_sent.danger {
		border-color: #ea3d2f;
	}
	.ticket_detail_event_message_sent_status {
		position: absolute;
		z-index: 1;
		font-size: 12px;
		bottom: 10px;
		right: 10px;
	}
	.ticket_rating_star_icon_wrapper {
		cursor: pointer;
		margin-right: 5px;
		transition: transform 0.35s ease;
		line-height: 1;
	}
	.ticket_rating_star_icon_wrapper.readonly {
		cursor: auto;
	}
	.ticket_rating_star_icon_wrapper.active .ticket_rating_star_icon path:last-child {
		fill: currentColor;
	}
	.ticket_rating_star_icon_wrapper:hover {
		transform: scale(1.3);
		transform-origin: 50% 50%;
	}
	.ticket_rating_star_icon_wrapper:not(.readonly):hover .ticket_rating_star_icon path:last-child {
		fill: currentColor;
	}
	.ticket_rating_star_icon_wrapper.readonly:hover {
		transform: none;
	}
	.ticket_rating_star_icon_wrapper:last-child {
		margin-right: 0;
	}
	.ticket_rating_star_icon {
		stroke-width: 1;
	}
	.ticket_detail_priority_wrapper:hover .ticket_detail_priority_action {
		display: inline;
	}
	.ticket_detail_priority_action {
		display: none;
	}
	.user_ticket_row {
		display: block;
		margin-bottom: 8px;
		border: 1px solid #dee2e6;
		color: #222;
		border-radius: 8px;
		padding: 10px 15px;
	}
	.user_ticket_row:hover {
		background-color: #f8f9fa;
	}
	a[href].user_ticket_row:hover {
		color: #222;
	}
	.ticket_detail_delete_notif {
		color: #ea3d2f;
	}
	.ticket_detail_delete_notif a {
		display: none;
	}
	.ticket_detail_delete_notif:hover a {
		display: inline;
	}
	.edit_ticket_template_lexical {
		display: flex;
		overflow-y: auto;
		flex-direction: column;
		flex: 1;
		position: relative;
		height: 220px;
	}

	.resource_members_box {
		border: 1px solid #dee2e6;
		border-radius: 8px;
		overflow: hidden;
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.resource_members_box_header {
		flex-shrink: 0;
		padding: 10px;
		background-color: whitesmoke;
		border-bottom: 1px solid #dee2e6;
	}
	.resource_members_box_footer {
		flex-shrink: 0;
		padding: 6px 10px;
		border-top: 1px solid #dee2e6;
	}
	.resource_members_box_content {
		flex: 1;
		overflow-y: auto;
		overflow-x: hidden;
	}
	.resource_members_table_row {
		display: flex;
		align-items: center;
		overflow: hidden;
		padding: 8px 10px;
		border-bottom: 1px solid #dee2e6;
	}
	.resource_members_table_row_emoji_wrapper {
		width: 32px;
		height: 32px;
	}
	.resource_members_table_row_emoji_wrapper .emoji {
		width: 100%;
		height: 100%;
	}
	.ticket_list_page .order_list_row.order_list_row__closed {
		filter: none;
	}
	.ticket_detail_custom_attr_row {
		display: flex;
		font-size: 14px;
		padding-top: 5px;
		padding-bottom: 5px;
		border-bottom: 1px solid #dee2e6;
		overflow: hidden;
	}
	.ticket_detail_custom_attr_row:last-child {
		border-bottom: none;
	}
	.edit_sla_target_box {
		border: 1px solid #dee2e6;
		border-radius: 8px;
		overflow: hidden;
	}
	.edit_sla_target_box_row {
		padding: 8px 0;
		display: flex;
		font-size: 14px;
		border-bottom: 1px solid #dee2e6;
	}
	.edit_sla_target_box_row.header {
		background-color: #f8f9fa;
		font-weight: 500;
		color: #6c757d;
	}
	.edit_sla_target_box_row:last-child {
		border-bottom: none;
	}
	.edit_sla_target_box_cell {
		flex: 1;
		padding: 0 10px;
		display: flex;
		align-items: center;
	}
	.edit_sla_target_box_cell.priority {
		flex: unset;
		width: 100px;
		flex-shrink: 0;
	}
	.comment_editor_wrapper {
		border: 1px solid #cacaca;
		border-radius: 0.25rem;
		position: relative;
	}
	.comment_prose_editor .ProseMirror {
		outline: none;
		padding: 5px 10px;
		min-height: var(--editor-height);
	}
	.comment_prose_editor .ProseMirror .ProseMirror-widget {
		opacity: 0.5;
	}
	.comment_prose_editor p {
		margin: 0;
	}
	.prosee_email_editor_toolbar {
		border: 1px solid #cacaca;
		border-bottom: none;
		border-top-left-radius: 0.5rem;
		border-top-right-radius: 0.5rem;
	}
	.prose_email_editor {
		position: relative;
		background: #fff;
	}
	.prose_email_editor.is-invalid {
		border-color: #ea3d2f;
	}
	.prose_email_editor .ProseMirror {
		padding: 8px 10px;
		cursor: text;
		word-wrap: break-word;
		white-space: break-spaces;
		-webkit-font-variant-ligatures: none;
		font-variant-ligatures: none;
		color: #495057;
		line-height: 1.4;
		outline: none;
		min-height: 120px;
		max-height: 360px;
		overflow: auto;
		border: 1px solid #cacaca;
		border-bottom-left-radius: 0.5rem;
		border-bottom-right-radius: 0.5rem;
	}
	.prose_email_editor .ProseMirror.focus,
	.prose_email_editor .ProseMirror:focus,
	.prose_email_editor .ProseMirror:hover {
		color: #495057;
		background-color: #fff;
		border-color: #646464;
		outline: 0;
	}
	.prose_email_editor .ProseMirror:disabled:hover,
	.prose_email_editor .ProseMirror[readonly]:hover {
		border: 1px solid #cacaca;
	}
	.prose_email_editor .ProseMirror p {
		margin-bottom: 0;
	}
	.prose_email_editor .ProseMirror img {
		max-width: 100%;
	}
	.prose_email_editor .ProseMirror strong,
	.prose_email_editor .ProseMirror b {
		font-weight: 700;
	}
	.kb_editor {
		/* See https://github.com/ProseMirror/prosemirror/issues/1421#issuecomment-1759320191 */
		/* Make sure li selections wrap around markers */
		/* Protect against generic img rules */
		/* Add space around the hr to make clicking it easier */
	}
	.kb_editor .ProseMirror {
		position: relative;
		word-wrap: break-word;
		white-space: break-spaces;
		font-size: 17px;
		-webkit-font-variant-ligatures: none;
		font-variant-ligatures: none;
		font-feature-settings: 'liga' 0;
		flex: 1;
		padding: 4px 8px;
		line-height: 1.2;
		outline: none;
		height: 100%;
		/* the above doesn't seem to work in Edge */
	}
	.kb_editor .ProseMirror li {
		position: relative;
	}
	.kb_editor .ProseMirror-hideselection *::selection {
		background: transparent;
	}
	.kb_editor .ProseMirror-hideselection *::-moz-selection {
		background: transparent;
	}
	.kb_editor .ProseMirror-hideselection {
		caret-color: transparent;
	}
	.kb_editor .ProseMirror [draggable][contenteditable='false'] {
		user-select: text;
	}
	.kb_editor .ProseMirror-selectednode {
		outline: none;
	}
	.kb_editor li.ProseMirror-selectednode {
		outline: none;
	}
	.kb_editor li.ProseMirror-selectednode:after {
		content: '';
		position: absolute;
		left: -32px;
		right: -2px;
		top: -2px;
		bottom: -2px;
		border: 2px solid #8cf;
		pointer-events: none;
	}
	.kb_editor .ProseMirror-gapcursor {
		display: none;
		pointer-events: none;
		position: absolute;
	}
	.kb_editor .ProseMirror-gapcursor:after {
		content: '';
		display: block;
		position: absolute;
		top: -2px;
		width: 20px;
		border-top: 1px solid black;
		animation: ProseMirror-cursor-blink 1.1s steps(2, start) infinite;
	}
	@keyframes ProseMirror-cursor-blink {
		to {
			visibility: hidden;
		}
	}
	.kb_editor .ProseMirror-focused .ProseMirror-gapcursor {
		display: block;
	}
	.kb_editor .ProseMirror ul,
	.kb_editor .ProseMirror ol {
		padding-left: 20px;
	}
	.kb_editor .ProseMirror blockquote {
		padding-left: 1em;
		border-left: 3px solid #eee;
		margin-left: 0;
		margin-right: 0;
	}
	.kb_editor .ProseMirror p {
		margin-bottom: 8px;
		word-break: break-word;
	}
	.kb_editor .ProseMirror p code {
		background-color: #f8f8f8;
		border: 1px solid #cacaca;
		padding: 2px 4px;
		border-radius: 4px;
	}
	.kb_editor .ProseMirror ul li p {
		margin-bottom: 3px;
	}
	.kb_editor strong {
		font-weight: 600;
	}
	.kb_editor .ProseMirror table {
		margin: 10px 0;
		border: 1px solid;
	}
	.kb_editor .ProseMirror th {
		min-width: 80px;
		padding: 8px 10px;
		background-color: #f2f2f2;
		border: 1px solid;
	}
	.kb_editor .ProseMirror tr {
		border: 1px solid;
	}
	.kb_editor .ProseMirror td {
		min-width: 80px;
		padding: 8px 10px;
	}
	.kb_editor .ProseMirror img {
		max-width: 100%;
		max-height: 100%;
	}
	.kb_editor .ProseMirror pre {
		padding: 10px 20px;
		white-space: pre-wrap;
		overflow-x: auto;
		border: 1px solid #cacaca;
		background-color: #e9ecef;
	}
	.kb_page {
		padding: 20px 60px;
		height: 100%;
		display: flex;
		flex-direction: column;
	}
	.kb_header {
		margin-bottom: 36px;
	}
	.kb_header .kb_title {
		font-size: 20px;
		font-weight: 600;
	}
	.kb_list {
		display: flex;
		flex-wrap: wrap;
	}
	.kb_card_content {
		border-bottom: 1px solid #dee2e6;
		display: flex;
		padding: 10px 0;
		align-items: center;
		transition: all 150ms ease-out;
	}
	.kb_card_content:hover {
		background: whitesmoke;
	}
	.kb_edit_content {
		padding: 12px 0px;
		width: 500px;
		max-height: 700px;
		position: relative;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.kb_edit_body {
		padding: 0 24px;
		flex: 1;
		overflow-y: auto;
	}
	.kb_edit_footer {
		padding: 0 24px;
		display: flex;
		justify-content: end;
	}
	.kb_detail_container {
		height: 100%;
		display: flex;
	}
	.kb_detail_container .kb_detail_sidebar {
		min-width: 300px;
		width: 25%;
		background-color: #f9fafc;
		height: 100%;
		display: flex;
		padding: 8px 0;
		flex-direction: column;
		border-right: 1px solid #e5e5e5;
	}
	.kb_detail_container .kb_detail_sidebar .art_sidebar_header {
		padding: 4px 20px;
		border-bottom: 1px solid #e5e5e5;
		background-color: #f8f9fa;
	}
	.kb_detail_container .kb_detail_sidebar .sidebar_article {
		display: flex;
		align-items: center;
		position: relative;
		padding: 0 20px;
		min-height: 30px;
		margin-top: 6px;
	}
	.kb_detail_container .kb_article {
		flex: 1;
		height: 100%;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.cate_sidebar_item {
		margin-top: 10px;
		display: flex;
		align-items: center;
		justify-content: space-between;
		padding: 5px 10px;
		border-radius: 4px;
	}
	.cate_sidebar_item .cate_sidebar_item_title {
		display: flex;
		align-items: center;
		cursor: pointer;
	}
	.cate_sidebar_item .cate_sidebar_item_action {
		visibility: hidden;
		display: flex;
		align-items: center;
	}
	.cate_sidebar_item:hover,
	.cate_sidebar_item:focus {
		background-color: #ececec;
	}
	.cate_sidebar_item:hover .cate_sidebar_item_action,
	.cate_sidebar_item:focus .cate_sidebar_item_action {
		visibility: visible;
	}
	.kb_article_header {
		display: flex;
		padding: 10px 16px;
		border-bottom: 1px solid #e5e5e5;
	}
	.article_title {
		padding: 5px 10px;
		cursor: pointer;
		display: flex;
		align-items: center;
		border-radius: 4px;
	}
	.article_title .article_sidebar_action {
		display: none;
	}
	.article_title:hover {
		background-color: #ececec;
	}
	.article_title:hover .article_sidebar_action {
		display: flex;
		align-items: center;
	}
	.article_title.active {
		background-color: #0d6efd;
		color: white;
	}
	.article_action {
		display: flex;
		align-items: center;
	}
	.input_article_title {
		border: none;
		outline: none;
		padding: 0px 6px;
		transition: border 0.3s ease;
		min-width: 300px;
	}
	.input_article_title:hover {
		border: 1px solid;
		border-radius: 4px;
	}
	.input_article_title:focus {
		border: 2px solid;
		border-radius: 4px;
	}
	.typo_color_dropdown {
		position: absolute;
		top: 30px;
		left: 10px;
		width: 200px;
		padding: 10px 4px;
		border-radius: 8px;
		background-color: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		max-height: 300px;
		overflow-y: auto;
	}
	.text_color_item {
		padding: 4px 8px;
		border-radius: 6px;
		cursor: pointer;
	}
	.text_color_item:hover {
		background-color: #f3f1ec;
	}
	.text_color_item .typo {
		width: 20px;
		height: 20px;
		display: flex;
		align-items: center;
		justify-content: center;
		border-radius: 4px;
		border: solid 1px #cacaca;
	}
	.editor_command_menu {
		position: absolute;
		width: 400px;
		padding: 10px 4px;
		border-radius: 8px;
		background-color: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1),
			0px 8px 64px rgba(0, 0, 0, 0.12);
		max-height: 300px;
		overflow-y: auto;
	}
	.editor_command_menu .item_block_active {
		background-color: #f3f1ec;
	}
	.upload_image_kb {
		position: absolute;
		top: 50%;
		left: 50%;
		background-color: white;
		border: 1px solid #e5e5e5;
		box-shadow: 0px 4px 6px rgba(0, 0, 0, 0.1);
		width: 400px;
		height: 100px;
		border-radius: 8px;
	}
	.upload_kb_file {
		margin: 12px 10px;
		padding: 4px 0;
		border-radius: 8px;
		display: flex;
		justify-content: center;
		border: 1px solid #e5e5e5;
		cursor: pointer;
	}
	.upload_kb_file:hover {
		background-color: #f3f1ec;
	}
	.table_kb_option {
		position: absolute;
		background-color: white;
		border: 1px solid #e5e5e5;
		border-radius: 4px;
		box-shadow: 0px 4px 6px rgba(0, 0, 0, 0.1);
	}
	.table_kb_option:hover {
		background-color: #f3f1ec;
	}
	.resize-handle {
		display: none;
		width: 8px;
		height: 40px;
		background-color: #000;
		position: absolute;
		z-index: 10;
		top: 50%;
		transform: translateY(-50%);
		cursor: ew-resize;
		border-radius: 8px;
		border: 0.5px solid white;
	}
	.resize-handle.left {
		left: 5px;
	}
	.resize-handle.right {
		right: 5px;
	}
	.image_kb_menu {
		position: absolute;
		top: 5px;
		right: 5px;
		display: none;
	}
	.prose_img_wrapper {
		position: relative;
		display: inline-block;
		margin-top: 6px;
		margin-bottom: 6px;
		text-align: center;
	}
	.prose_img_wrapper:hover {
		border-radius: 4px;
	}
	.prose_img_wrapper:hover .resize-handle {
		display: block;
	}
	.prose_img_wrapper:hover .image_kb_menu {
		display: flex;
	}
	.prose_img_wrapper img:hover {
		outline: 1px solid #8cf;
	}
	.prose_img_wrapper .prose_img {
		max-width: 100%;
		max-height: 100%;
	}
	.bg_loading_img {
		position: absolute;
		inset: 0;
		z-index: 10;
		background-color: rgba(255, 255, 255, 0.6);
		display: flex;
		align-items: center;
		justify-content: center;
	}
	.prose_loading {
		border: 4px solid #f3f3f3;
		border-radius: 50%;
		border-top: 4px solid #3498db;
		width: 20px;
		height: 20px;
		-webkit-animation: spin 2s linear infinite;
		/* Safari */
		animation: spin 2s linear infinite;
	}
	@-webkit-keyframes spin {
		0% {
			-webkit-transform: rotate(0deg);
		}
		100% {
			-webkit-transform: rotate(360deg);
		}
	}
	@keyframes spin {
		0% {
			transform: rotate(0deg);
		}
		100% {
			transform: rotate(360deg);
		}
	}
	.kb_editor {
		flex: 1;
		width: 760px;
		max-width: 100%;
		position: relative;
	}
	.article_footer {
		margin-top: 10px;
		margin-bottom: 20px;
		width: 760px;
		padding: 4px 8px;
	}
	.article_sidebar_footer {
		height: 50px;
		padding: 0 20px;
		display: flex;
		align-items: center;
		border-top: 1px solid #e5e5e5;
	}
	.art_sidebar_header_item {
		display: flex;
		align-items: center;
		padding: 8px 10px;
		border-radius: 4px;
		cursor: pointer;
	}
	.art_sidebar_header_item:hover {
		background-color: #ececec;
	}
	.art_sidebar_header_item.active {
		background-color: #0d6efd;
		color: white;
	}
	.kb_card_name {
		padding-left: 6px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		max-width: 220px;
	}
	.save_kb {
		display: flex;
		align-items: center;
		margin-left: 8px;
		font-size: 16px !important;
		opacity: 0.7;
	}
	.topic_page {
		flex: 1;
		padding: 30px 50px;
		height: 100%;
		display: flex;
		flex-direction: column;
		overflow: hidden;
	}
	.topic_page .topic_table {
		margin-top: 30px;
		flex: 1;
		overflow: auto;
	}
	.topic_page .topic_table .topic_row {
		border-bottom: 1px solid #dee2e6;
		display: flex;
		padding: 10px 0;
		align-items: center;
		transition: all 150ms ease-out;
	}
	.topic_page .topic_table .topic_row:hover {
		background: whitesmoke;
	}
	.topic_modal {
		padding: 12px 24px;
		width: 350px;
		max-height: 400px;
		position: relative;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.kb_workspace {
		width: 100%;
		display: flex;
		align-items: center;
		padding: 6px 12px;
		border-radius: 6px;
		border: 1px solid #cacaca;
		cursor: pointer;
		position: relative;
		background-color: white;
		box-shadow: 0 0 5px rgba(0, 0, 0, 0.25);
	}
	.kb_manage {
		border-top: 1px solid #cacaca;
		display: flex;
		align-items: center;
	}
	.kb_manage:hover {
		background-color: #e9ecef;
	}
	.doc_event_page {
		flex: 1;
		height: 100%;
		padding: 20px 0 0 40px;
		overflow: hidden;
		display: flex;
		flex-direction: column;
	}
	.doc_event {
		display: flex;
		flex-direction: column;
		justify-content: center;
		padding: 10px 20px;
		height: 100%;
		width: 600px;
	}
	.doc_event:hover {
		background-color: #f8f9fa;
	}
	.doc_event .content {
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
	}
	.doc_line_update {
		margin-left: 10px;
		height: 100%;
		width: 2px;
		background-color: #cacaca;
		margin-right: 20px;
		position: relative;
	}
	.doc_line_update .dot {
		position: absolute;
		height: 8px;
		width: 8px;
		border-radius: 50%;
		background-color: #6c757d;
		top: 50%;
		left: -3px;
	}
	.doc_line_update .dot_end {
		position: absolute;
		height: 8px;
		width: 8px;
		border-radius: 50%;
		background-color: #6c757d;
		bottom: -3px;
		left: -3px;
	}
	.doc_line_update .dot_start {
		position: absolute;
		height: 8px;
		width: 8px;
		border-radius: 50%;
		background-color: #6c757d;
		top: -3px;
		left: -3px;
	}
	.article_state {
		border: 1px solid #cacaca;
		border-radius: 4px;
		cursor: pointer;
		padding: 6px 8px;
		display: flex;
		align-items: center;
	}
	.article_state .state {
		display: flex;
		align-items: center;
		min-width: 110px;
	}
	.article_state.disabled {
		color: #adb5bd;
		pointer-events: none;
		opacity: 0.65;
	}
	.state_article_option {
		position: absolute;
		z-index: 200;
		right: 0;
		top: 100%;
		width: 400px;
		border-radius: 6px;
		background-color: white;
		box-shadow: 0 0 2px rgba(0, 0, 0, 0.25);
	}
	.state_item {
		display: flex;
		padding: 10px 15px;
		cursor: pointer;
		background-color: #fff;
	}
	.state_item:hover {
		background-color: #e9ecef;
	}
	.state_item.disabled {
		color: #adb5bd;
		pointer-events: none;
		opacity: 0.7;
	}
	.header_article_item {
		padding: 0 15px;
	}
	.header_article_line {
		height: 30px;
		width: 1px;
		background-color: #dee2e6;
	}
	.history_article_icon {
		display: flex;
		align-items: center;
		padding: 5px;
		border-radius: 4px;
		cursor: pointer;
	}
	.history_article_icon:hover {
		background-color: #e9ecef;
	}
	.article_url {
		width: 760px;
		padding: 4px 8px;
		display: flex;
		align-items: center;
		min-height: 30px;
	}
	.article_history_content {
		flex: 3;
		overflow: auto;
		padding: 10px 20px;
		height: 100%;
	}
	.article_history_content img {
		max-width: 90%;
		max-height: 400px;
	}
	.article_history_sidebar {
		flex: 1;
		overflow-y: auto;
		border-left: 1px solid #cacaca;
		padding: 10px 20px;
	}
	.art_version_item {
		padding: 6px 10px;
		border-radius: 4px;
		position: relative;
		cursor: pointer;
	}
	.art_version_item .menu_item {
		position: absolute;
		right: 0;
		z-index: 100;
		bottom: 5px;
		display: flex;
		align-items: center;
		visibility: hidden;
		background-color: white;
		border-radius: 4px;
		padding: 6px 8px;
	}
	.art_version_item:hover {
		background-color: #e9ecef;
	}
	.art_version_item:hover .menu_item {
		visibility: visible;
	}
	.menu_item_icon {
		padding: 4px;
		cursor: pointer;
		border-radius: 2px;
		display: flex;
		align-items: center;
	}
	.menu_item_icon:hover {
		background-color: #e9ecef;
	}
	.art_version_item.active {
		background-color: #deddee;
	}
	.dropdown_text_type {
		border: none;
		padding-right: 35px;
	}
	.kb_nodes_wrapper {
		padding: 0 12px;
		overflow: auto;
	}
	.kb_single_node {
		width: 100%;
		padding: 0 0;
	}
	.kb_single_node.dragenter {
		background: #adb5bd;
	}
	.kb_node_dragable_zone {
		height: 0;
	}
	.kb_node_dragable_zone.dragenter {
		background: #adb5bd;
	}
	.kb_single_node .article_title {
		padding-top: 5px;
		padding-bottom: 5px;
	}
	.kb_nodes_wrapper.dragging .kb_single_node {
		padding-top: 0;
		padding-bottom: 0;
	}
	.kb_nodes_wrapper.dragging .kb_single_node:first-child {
		padding-top: 4px;
	}
	.kb_nodes_wrapper.dragging .kb_node_dragable_zone {
		height: 4px;
	}
	.referral_container {
		padding: 20px 30px;
		width: 800px;
	}
	.referral_box {
		background: white;
		padding: 16px 20px;
		border: 2px solid #e4e4e4;
		border-radius: 5px;
		width: 280px;
	}
	.referral_box__title {
		font-size: 20px;
		font-weight: 500;
	}
	.referral_box__label {
		font-weight: 500;
		color: #666;
		text-transform: uppercase;
		font-size: 12px;
	}
	.fpv_balance {
		background-color: #1890ff;
		color: white;
		font-weight: 600;
		border-radius: 6px;
		padding: 12px 16px;
	}
	.fpv_total_earned {
		background-color: #114490;
		color: white;
		font-weight: 600;
		border-radius: 6px;
		padding: 12px 16px;
	}
	.referral_table__row {
		display: flex;
		border-top: 1px solid #e9ecef;
		align-items: center;
		padding: 10px 20px;
	}
	.referral_table__row:first-child {
		background: #fcfcfc;
		font-weight: 400;
		text-transform: uppercase;
		font-size: 14px;
	}
	.rule_number {
		display: flex;
		align-items: center;
		justify-content: center;
		width: 24px;
		font-size: 13px;
		font-weight: 500;
		height: 24px;
		background-color: #ededed;
		padding: 4px;
		margin-right: 8px;
		border-radius: 6px;
	}
	.invite-agent {
		height: 100vh;
		overflow: auto;
		display: flex;
		justify-content: center;
	}
	.invite-agent .login-container {
		background-color: white;
		padding: 40px 30px;
		border-radius: 8px;
		padding-top: 15vh;
		width: 450px;
	}
	.invite-agent .logo {
		width: 50px;
		height: 50px;
		border-radius: 8px;
		display: flex;
		justify-content: center;
		align-items: center;
		margin: 0 auto 20px;
	}
	.invite-agent .form-control.wrong {
		border-color: #ea3d2f;
	}
	.invite-agent .auth-form__break {
		margin: 0;
		width: 390px;
	}
	.invite-agent .password-condition.required {
		color: #e81a1a;
	}
	.invite-agent .password-condition.required span {
		color: #e81a1a;
	}
	.invite-agent .password-condition {
		color: #dad9d9;
	}
	.invite-agent .password-condition span {
		color: #999999;
	}
	.invite-agent .password-condition.required.satified,
	.invite-agent .password-condition.satified {
		color: #11b936;
	}
	.invite-agent .password-condition.required.satified span,
	.invite-agent .password-condition.satified span {
		color: #11b936;
	}
	.invite-agent .verification-code {
		display: flex;
		justify-content: space-between;
	}
	.invite-agent .verification-code input {
		width: 50px;
		height: 60px;
		text-align: center;
		font-size: 25px;
		font-weight: 600;
		margin-bottom: 10px;
		border: 1px solid #dfdfdf;
		border-radius: 4px;
		box-sizing: border-box;
	}
	.invite-agent .verification-code.wrong input {
		border: 1px solid #e81a1a;
		color: #e81a1a;
	}
	.accmgr {
		display: flex;
		width: 100%;
		height: 100%;
		flex-direction: column;
	}
	.accmgr_header {
		display: flex;
		flex-shrink: 0;
		height: 44px;
		background: #f0f5fb;
		padding-left: 20px;
	}
	.account_item__avatar {
		display: flex;
		align-items: center;
		justify-content: center;
		background: whitesmoke;
		flex-shrink: 0;
		width: 55px;
		height: 55px;
		border-radius: 10px;
		border: 1px solid whitesmoke;
	}
	.account_item__name {
		font-weight: 500;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: nowrap;
		display: block;
		margin-bottom: 3px;
	}
	.promotion-program table {
		width: 100%;
		border-collapse: separate;
		border: 1px solid #ddd;
		border-spacing: 0px;
	}
	.promotion-program th,
	.promotion-program td {
		padding: 8px 8px;
		text-align: left;
	}
	.promotion-program th {
		background-color: white;
		border-bottom: 1px solid #ddd;
	}
	.promotion-program tr:not(:last-child) td {
		border-bottom: 1px solid #ddd;
	}
	.promotion-program .chart {
		width: 50px;
		height: 20px;
		display: inline-block;
		vertical-align: middle;
	}
	.promotion-program .chart-bar {
		display: inline-block;
		width: 2px;
		margin-right: 1px;
		background-color: #4caf50;
		vertical-align: bottom;
	}
	.promotion-program .view-link {
		color: #1a73e8;
		text-decoration: none;
	}
	.promocode_td {
		width: 600px;
	}
	.automation_action_box_wrapper {
		width: 500px;
		margin-bottom: 20px;
		position: relative;
	}
	.automation_action_box_wrapper:last-child {
		margin-bottom: 0;
	}
	.automation_action_box_wrapper:hover .automation_action_box_drag_inner {
		display: flex;
	}
	.automation_action_box_drag_section {
		position: absolute;
		width: 30px;
		height: 100%;
		justify-content: center;
		color: #adb5bd;
		top: 0;
		right: 100%;
	}
	.automation_action_box_drag_inner {
		display: none;
		width: 30px;
		height: 40px;
		justify-content: center;
		padding-top: 4px;
		cursor: grab;
	}
	.automation_action_box {
		width: fit-content;
		background-color: rgba(0, 0, 0, 0.062745098);
		border-radius: 4px;
		padding: 5px 10px;
		cursor: pointer;
	}
	.automation_action_box.no_hover {
		cursor: auto;
	}
	.automation_action_box.no_hover:hover {
		background-color: rgba(0, 0, 0, 0.062745098);
	}
	.automation_action_box:hover {
		background-color: rgba(0, 0, 0, 0.0941176471);
	}
	.automation_action_box.edit {
		background-color: #f1f8ff;
		box-shadow: inset 0 0 0 2px #0d6efd;
	}
	.automation_action_box.edit.static_width {
		width: 100%;
	}
	.automation_action_box.invalid,
	.automation_action_box.edit.invalid {
		background-color: tint-color(#ea3d2f, 8);
		box-shadow: inset 0 0 0 1px #ea3d2f;
	}
	.automation_action_message_box {
		max-width: 400px;
		min-width: 200px;
		min-height: 54px;
		max-height: 102px;
		overflow: hidden;
		border-radius: 4px;
		border: 1px solid #cecece;
		margin-bottom: 4px;
		padding: 3px 8px;
	}
	.tab.automation_detail_tab {
		margin-bottom: 0;
		display: inline-flex;
		height: 51px;
		border-bottom-color: transparent;
	}
	.tab.automation_detail_tab .tab__item:not(.tab__item__active):after {
		border-bottom-color: transparent;
	}
	.tab.automation_detail_tab .tab__item {
		display: flex;
		align-items: center;
		height: 100%;
	}
	.automation_report_box_sub_head {
		width: 180px;
		padding: 0 15px;
		border-right: 1px solid #dee2e6;
	}
	.automation_report_box_sub_head:first-child {
		padding-left: 0;
	}
	.automation_report_box_sub_head:last-child {
		border-right: none;
	}
	.item-row.workflow_row:hover {
		background: whitesmoke;
	}
	.item-row.workflow_row.workflow_row__disabled {
		filter: grayscale(1);
		opacity: 0.8;
	}
	.automation_action_sidebar_head {
		padding: 12px 20px;
		border-bottom: 1px solid #dee2e6;
		flex-shrink: 0;
	}
	.automation_action_sidebar_body {
		flex: 1;
		padding: 12px 20px;
		overflow-x: hidden;
		overflow-y: auto;
	}
	.automation_template_card {
		width: 320px;
		height: 280px;
		display: flex;
		flex-direction: column;
		margin-right: 30px;
		margin-bottom: 30px;
		overflow: hidden;
		cursor: pointer;
	}
	.automation_template_card:hover {
		box-shadow: 0 0 0 1px #dee2e6;
		background-color: #f8f9fa;
	}
	.automation_template_card.using {
		background-color: #f8f9fa;
	}
	.automation_template_card.small {
		width: 240px;
		height: 240px;
		margin-right: 20px;
		margin-bottom: 20px;
	}
	.automation_template_card.small .automation_template_card_name {
		font-size: 16px;
	}
	.automation_template_card.small .automation_template_card_content {
		padding: 15px 20px;
	}
	.automation_template_card.small:nth-child(3n) {
		margin-right: 0;
	}
	.automation_template_card_img {
		width: 100%;
		height: 180px;
		overflow: hidden;
	}
	.automation_template_card_img img {
		width: 100%;
		height: 100%;
		object-fit: cover;
	}
	.automation_template_card.small .automation_template_card_img {
		height: 150px;
	}
	.automation_template_card_content {
		padding: 20px 25px;
		flex: 1;
		display: flex;
		flex-direction: column;
	}
	.automation_template_card_name {
		font-weight: 500;
		font-size: 20px;
		margin-bottom: 5px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: pre-wrap;
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
	}
	.automation_template_card_desc {
		font-size: 14px;
		overflow: hidden;
		text-overflow: ellipsis;
		white-space: pre-wrap;
		display: -webkit-box;
		-webkit-line-clamp: 5;
		-webkit-box-orient: vertical;
	}
	.automation_condition_input {
		display: flex;
		align-items: center;
		position: relative;
	}
	.automation_condition_input.order_filter_input {
		padding-right: 30px;
	}
	.automation_condition_x {
		display: none;
		position: absolute;
		width: 18px;
		height: 18px;
		top: calc(50% - 9px);
		right: 5px;
	}
	.automation_condition_input:hover .automation_condition_x {
		display: block;
	}
	.automation_action_box .x-icon,
	.automation_action_box .message_event_single_reaction {
		width: 18px;
		height: 18px;
	}
	.automation_action_box:not(:hover) .x-icon,
	.automation_action_box:not(:hover) .message_event_single_reaction {
		visibility: hidden;
	}
	.automation_edit_section {
		display: flex;
		width: 100%;
	}
	.automation_edit_section:last-child .automation_edit_section_left {
		padding-bottom: 0;
	}
	.automation_edit_section:last-child .automation_edit_section_right {
		padding-bottom: 0;
	}
	.automation_edit_section_left {
		width: 200px;
		flex-shrink: 0;
		padding-top: 5px;
		padding-bottom: 30px;
		position: relative;
	}
	.automation_edit_section_left:before {
		content: '';
		position: absolute;
		top: 35px;
		left: 8px;
		bottom: 0;
		width: 1px;
		background-color: #e9ecef;
	}
	.automation_edit_section_right {
		flex: 1;
		overflow: hidden;
		padding-bottom: 30px;
		padding-top: 5px;
		padding-left: 30px;
	}
	.automation_send_message_editor .bot-textarea .ProseMirror[contenteditable] {
		max-height: 100px;
	}
	.automation_session_table .scroll-table tr th:first-child,
	.automation_session_table .scroll-table tr td:first-child {
		padding-left: 20px;
	}
	.automation_session_table .scroll-table tr th:last-child,
	.automation_session_table .scroll-table tr td:last-child {
		padding-right: 20px;
	}
	.dropdown_item.workflow_add_action_dropdown_item.active {
		background-color: whitesmoke;
	}
	.dropdown_item.workflow_add_action_dropdown_item .dropdown_item_text {
		font-weight: 500;
	}
	.automation_action_box_wrapper.just_focus .automation_action_box {
		background-color: #f1f8ff;
	}
	.ai_agent_table_row_desc {
		font-size: 14px;
		overflow: hidden;
		text-overflow: ellipsis;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
	}
	.ai_agent_intent_box_line {
		border-bottom: 1px solid #dee2e6;
	}
	.ai_agent_intent_box_line:last-child {
		border-bottom: none;
	}
	.ai_agent_intent_box_head {
		padding: 8px 15px;
		display: flex;
		align-items: center;
	}
	.ai_agent_intent_box_head:hover .ai_agent_intent_box_head_text {
		text-decoration: underline;
	}
	.ai_agent_intent_box_head_text {
		flex: 1;
		font-size: 14px;
	}
	.ai_agent_intent_box_content {
		padding: 8px 15px;
		padding-top: 0;
	}
	.ai_agent_intent_box_example {
		border: 1px solid #dee2e6;
		padding: 2px 10px;
		border-radius: 9999px;
		width: fit-content;
		margin-bottom: 5px;
	}
	.ai_agent_intent_box_example:last-child {
		margin-bottom: 0;
	}
	.ai_agent_modal_tab.tab {
		margin-bottom: -15px;
		border-bottom-color: transparent;
	}
	.ai_agent_modal_tab.tab .tab__item {
		font-size: 16px;
	}
	.ai_agent_modal_tab.tab .tab__item:not(.tab__item__active):after {
		border-bottom-color: transparent;
	}
	.ai_preview_section {
		flex: 1;
		overflow: hidden;
	}
	.ai_preview_section div#fakechatbox1 {
		height: 100% !important;
		display: block !important;
	}
	.ai_preview_section #fakechatbox1 .desktop {
		height: 100% !important;
	}
	.ai_preview_section #fakechatbox1 .widget-container.widget-container--full {
		border-radius: 0 !important;
		box-shadow: none !important;
		background: whitesmoke !important;
	}
	.ai_preview_section #fakechatbox1 .widget-header {
		display: none !important;
	}
	.ai_preview_section #fakechatbox1 .widget-body--content {
		background: whitesmoke !important;
		padding-bottom: 20px !important;
	}
	.ai_preview_section #fakechatbox1 .widget-body--content .poweredby {
		display: none !important;
	}
	.ai_preview_section #fakechatbox1 .message-input {
		border: 1px solid #e3e3e3 !important;
		border-radius: 8px !important;
		background: white !important;
	}
	.edit_entry_modal_table .sbz_table_cell {
		padding: 8px;
	}
	.edit_entry_modal_table .sbz_table_cell:first-child {
		padding-left: 10px;
	}
	.edit_entry_modal_table .sbz_table_cell:last-child {
		padding-right: 10px;
	}
	.edit_entry_modal_table .sbz_common_table_footer {
		padding: 8px;
		font-size: 14px;
	}
	.drawer.drawer--right.drawer--active.edit_ai_agent_drawer {
		z-index: 10;
	}
	.ai_function_actions_modal .drawer {
		position: unset;
	}
	.ai_function_actions_modal .drawer__background {
		width: 400px !important;
		box-shadow: none;
		border-left: 1px solid #dee2e6;
		display: flex;
		flex-direction: column;
	}
	.ai_function_actions_modal .automation_action_box_drag_inner {
		justify-content: flex-end;
	}
	.ai_function_actions_modal .automation_action_sidebar_head {
		padding-bottom: 0;
		border: none;
	}
	.ai_function_actions_modal .automation_action_box_wrapper {
		margin-bottom: 10px;
	}
	.add_ai_file_box {
		cursor: pointer;
		padding: 12px 20px;
		position: relative;
		background: white;
		text-align: center;
		margin-top: 6px;
		border-radius: 8px;
		border: 1px dashed lightgray;
	}
	.add_ai_file_box:hover {
		background: whitesmoke;
		border-color: #bdbdbd;
	}
	.ai_report_convo_table .sbz_table_row.header {
		background-color: #fafafa;
	}
	.ai_report_table_detail_link {
		display: none;
	}
	.sbz_box:hover .ai_report_table_detail_link,
	.public_payment_page_content_box:hover .ai_report_table_detail_link,
	.sbz_radio_box:hover .ai_report_table_detail_link,
	.zns_logo_select_box:hover .ai_report_table_detail_link {
		display: block;
	}
	.ai_agent_report_table .sbz_common_table_header {
		background: #fafafa;
	}
	.tab.schedule_appointment_modal_tab {
		margin-bottom: -16px;
		font-size: 14px;
		border: none;
	}
	.tab.schedule_appointment_modal_tab .tab__item:not(.tab__item__active):after {
		border-color: transparent;
	}
	.img_select_box {
		cursor: pointer;
		border-radius: 8px;
		position: relative;
		margin-bottom: 20px;
		overflow: hidden;
	}
	.img_select_box:after {
		position: absolute;
		z-index: 1;
		inset: 0;
		content: '';
		background-color: transparent;
	}
	.img_select_box:before {
		position: absolute;
		z-index: 1;
		content: '✓';
		background-color: transparent;
		right: 0;
		bottom: 0;
		padding: 0px 15px;
		border-top-left-radius: 8px;
		color: transparent;
	}
	.img_select_box:hover:after {
		background-color: rgba(255, 255, 255, 0.2);
	}
	.img_select_box.selected {
		cursor: auto;
		box-shadow: 0 0 0 2px #0d6efd;
	}
	.img_select_box.selected:hover:after {
		background-color: transparent;
	}
	.img_select_box.selected:before {
		background-color: #0d6efd;
		color: #fff;
	}
	.img_select_box:last-child {
		margin-bottom: 0;
	}
	.img_select_box img {
		width: 100%;
		height: 100%;
		object-fit: cover;
	}
	.ai_entry_editor_wrapper .prose_email_editor .ProseMirror {
		min-height: 400px;
		max-height: unset;
	}
	.ai_entry_document_editor_wrapper {
		position: absolute;
		inset: 0;
	}
	.timeline_group {
		position: relative;
		padding-bottom: 30px;
	}
	.timeline_group:last-child {
		padding-bottom: 0;
	}
	.timeline_group:before {
		content: '';
		position: absolute;
		left: 11px;
		top: 0;
		bottom: 0;
		width: 2px;
		background-color: #eee;
		z-index: 0;
	}
	.timeline_group_day {
		background: #fff;
		padding: 4px 12px;
		color: #6c757d;
		padding-left: 0;
		display: inline-flex;
		position: relative;
		font-size: 16px;
		z-index: 1;
		margin-bottom: 10px;
	}
	.timeline_events {
		position: relative;
	}
	.timeline_event {
		display: flex;
		width: 100%;
		overflow: hidden;
		position: relative;
		z-index: 1;
		margin-bottom: 15px;
	}
	.timeline_event:last-child {
		margin-bottom: 0;
	}
	.timeline_event_icon_wrapper {
		flex-shrink: 0;
		width: 24px;
		height: 24px;
		display: flex;
		align-items: center;
		justify-content: center;
		margin-right: 10px;
		border-radius: 50%;
		background-color: #e9ecef;
	}
	.timeline_event_icon_wrapper.highlighted {
		background-color: #0d6efd;
	}
	.timeline_event_body {
		flex: 1;
		overflow: hidden;
	}
	.message_text.message_text_in_useractivity.message_text__user {
		margin-left: 0;
	}
	.message_text.message_text_in_useractivity.message_text__agent {
		margin-right: 0;
	}
	.hoverable {
		font-weight: 500;
	}
	.hoverable:hover {
		color: #000;
	}
	.d-none {
		display: none;
	}
	.d-inline {
		display: inline;
	}
	.d-inline-block {
		display: inline-block;
	}
	.d-block {
		display: block;
	}
	.d-table {
		display: table;
	}
	.d-flex {
		display: flex;
	}
	.flex-fill {
		flex: 1 1 auto;
	}
	.flex-row {
		flex-direction: row;
	}
	.flex-column {
		flex-direction: column;
	}
	.flex-row-reverse {
		flex-direction: row-reverse;
	}
	.flex-column-reverse {
		flex-direction: column-reverse;
	}
	.flex-shrink-0 {
		flex-shrink: 0;
	}
	.flex-shrink-1 {
		flex-shrink: 1;
	}
	.flex-wrap {
		flex-wrap: wrap;
	}
	.flex-nowrap {
		flex-wrap: nowrap;
	}
	.flex-wrap-reverse {
		flex-wrap: wrap-reverse;
	}
	.justify-content-start {
		justify-content: flex-start;
	}
	.justify-content-end {
		justify-content: flex-end;
	}
	.justify-content-center {
		justify-content: center;
	}
	.justify-content-between {
		justify-content: space-between;
	}
	.justify-content-around {
		justify-content: space-around;
	}
	.align-items-start {
		align-items: flex-start;
	}
	.align-items-end {
		align-items: flex-end;
	}
	.align-items-center {
		align-items: center;
	}
	.align-items-baseline {
		align-items: baseline;
	}
	.align-items-stretch {
		align-items: stretch;
	}
	.mt-1 {
		margin-top: 2.5px;
	}
	.mt-2 {
		margin-top: 5px;
	}
	.mt-3 {
		margin-top: 10px;
	}
	.mt-4 {
		margin-top: 20px;
	}
	.mt-5 {
		margin-top: 30px;
	}
	.mt-auto {
		margin-top: auto;
	}
	.mr-1 {
		margin-right: 2.5px;
	}
	.mr-2 {
		margin-right: 5px;
	}
	.mr-3 {
		margin-right: 10px;
	}
	.mr-4 {
		margin-right: 20px;
	}
	.mr-5 {
		margin-right: 30px;
	}
	.mr-auto {
		margin-right: auto;
	}
	.mb-1 {
		margin-bottom: 2.5px;
	}
	.mb-2 {
		margin-bottom: 5px;
	}
	.mb-3 {
		margin-bottom: 10px;
	}
	.mb-4 {
		margin-bottom: 20px;
	}
	.mb-5 {
		margin-bottom: 30px;
	}
	.mb-auto {
		margin-bottom: auto;
	}
	.ml-1 {
		margin-left: 2.5px;
	}
	.ml-2 {
		margin-left: 5px;
	}
	.ml-3 {
		margin-left: 10px;
	}
	.ml-4 {
		margin-left: 20px;
	}
	.ml-5 {
		margin-left: 30px;
	}
	.ml-auto {
		margin-left: auto;
	}
	.pt-1 {
		padding-top: 2.5px;
	}
	.pt-2 {
		padding-top: 5px;
	}
	.pt-3 {
		padding-top: 10px;
	}
	.pt-4 {
		padding-top: 20px;
	}
	.pt-5 {
		padding-top: 30px;
	}
	.pr-1 {
		padding-right: 2.5px;
	}
	.pr-2 {
		padding-right: 5px;
	}
	.pr-3 {
		padding-right: 10px;
	}
	.pr-4 {
		padding-right: 20px;
	}
	.pr-5 {
		padding-right: 30px;
	}
	.pb-1 {
		padding-bottom: 2.5px;
	}
	.pb-2 {
		padding-bottom: 5px;
	}
	.pb-3 {
		padding-bottom: 10px;
	}
	.pb-4 {
		padding-bottom: 20px;
	}
	.pb-5 {
		padding-bottom: 30px;
	}
	.pl-1 {
		padding-left: 2.5px;
	}
	.pl-2 {
		padding-left: 5px;
	}
	.pl-3 {
		padding-left: 10px;
	}
	.pl-4 {
		padding-left: 20px;
	}
	.pl-5 {
		padding-left: 30px;
	}
	.text-left {
		text-align: left;
	}
	.text-right {
		text-align: right;
	}
	.text-center {
		text-align: center;
	}
	.d-inline-flex {
		display: inline-flex;
	}
	.no_border {
		border: none !important;
	}
	.v-popper__popper {
		z-index: 100000 !important;
	}
	.v-popper__popper.v-popper__popper--shown,
	.v-popper__popper.v-popper__popper--hidden {
		transition-duration: 60ms !important;
		transition-delay: 0ms !important;
	}
	.box {
		position: relative;
		border: 2px solid #adb5bd;
		border-radius: 5px;
		padding: 20px;
		margin-bottom: 10px;
	}
	.w-100 {
		width: 100%;
	}
	.flex__1 {
		flex: 1;
	}
	.flex__2 {
		flex: 2;
	}
	.feather {
		flex-shrink: 0;
	}
	.flag-icon {
		border-radius: 3px;
		margin-top: -2px;
		flex-shrink: 0;
	}
	.overflow__auto {
		overflow: auto;
	}
	.d__none {
		display: none !important;
	}
	.cursor__pointer {
		cursor: pointer;
	}
	.form-group {
		margin-bottom: 1.5rem;
	}
	.form-group:last-child {
		margin-bottom: 0;
	}
	.tag {
		display: inline-block;
		padding: 0 0.5rem;
		border-radius: 4px;
		line-height: 1.5;
		font-size: 13px;
		background: #ffffff;
		border: 1px solid transparent;
		white-space: nowrap;
		color: #555;
		cursor: pointer;
		-webkit-user-select: none;
		-moz-user-select: none;
		-ms-user-select: none;
		user-select: none;
	}
	.tag.tag--primary {
		color: #fff;
		background-color: #0d6efd;
		border-color: #0d6efd;
	}
	.tag.tag--warning {
		background: #ffc107;
		border-color: #ffc107;
	}
	.tag.tag--success {
		background: #19b600;
		border-color: #19b600;
		color: #333;
	}
	.tag.tag--danger {
		background: #ea3d2f;
		border-color: #ea3d2f;
		color: #fff;
	}
	.tag.tag--primary.tag--light {
		color: rgb(41, 116, 249);
		background: rgb(238, 244, 255);
		border-color: rgb(191, 213, 253);
	}
	.tag.tag--warning.tag--light {
		color: rgb(253, 174, 4);
		background: rgb(255, 249, 235);
		border-color: rgb(254, 231, 180);
	}
	.tag.tag--success.tag--light {
		color: rgb(3, 137, 47);
		background: rgb(235, 246, 238);
		border-color: rgb(179, 220, 193);
	}
	.tag.tag--danger.tag--light {
		color: rgb(252, 13, 6);
		background: rgb(255, 236, 235);
		border-color: rgb(254, 182, 180);
	}
	.cursor-initial {
		cursor: initial;
	}
	.card {
		position: relative;
		display: -webkit-box;
		display: -ms-flexbox;
		display: flex;
		-webkit-box-orient: vertical;
		-webkit-box-direction: normal;
		-ms-flex-direction: column;
		flex-direction: column;
		min-width: 0;
		word-wrap: break-word;
		background-color: #fff;
		background-clip: border-box;
		border: 1px solid #dee2e6;
		border-radius: 0.25rem;
	}
	.card-body {
		-webkit-box-flex: 1;
		-ms-flex: 1 1 auto;
		flex: 1 1 auto;
		padding: 1.25rem;
	}
	.page-header {
		display: flex;
		margin-bottom: 20px;
		align-items: center;
		flex-wrap: nowrap;
	}
	.page-header.page-header--mb-1 {
		margin-bottom: 2.5px;
	}
	.page-header.page-header--mb-2 {
		margin-bottom: 5px;
	}
	.page-header.page-header--mb-3 {
		margin-bottom: 10px;
	}
	.page-header__left {
		flex: 1;
		max-width: 70%;
	}
	.page-header__right {
		display: flex;
		margin-left: auto;
		align-items: center;
	}
	.page-header-title {
		font-weight: 500;
		line-height: 1.25;
		font-size: 1.5rem;
		color: #000;
	}
	.page-header-title.title--sm {
		font-size: 1.125rem;
		line-height: 1;
		margin-bottom: 0;
	}
	.page-header-subtitle {
		color: #495057;
		margin-bottom: 20px;
	}
	.x-icon,
	.message_event_single_reaction {
		cursor: pointer;
		stroke: #adb5bd;
		color: #adb5bd;
	}
	.x-icon:hover,
	.message_event_single_reaction:hover {
		stroke: #495057;
		color: #495057;
	}
	.modal__header {
		display: flex;
		justify-content: space-between;
		align-items: center;
		padding-bottom: 10px;
		border-bottom: solid 1px #dee2e6;
	}
	.modal__body {
		padding-top: 20px;
	}
	.modal__footer {
		margin-top: 20px;
		text-align: right;
	}
	.popover {
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1);
		border-radius: 10px;
		z-index: 10003;
	}
	.popover_inner {
		background: #fff;
		position: relative;
		z-index: 1;
		border-radius: 10px;
	}
	.popover::after {
		content: '';
		display: block;
		width: 18px;
		height: 18px;
		position: absolute;
		transform: translate(0, -50%) rotate(45deg);
		background-color: #fff;
		box-shadow:
			0px 1px 8px rgba(0, 0, 0, 0.1),
			0px 4px 32px rgba(0, 0, 0, 0.1);
	}
	.popover__header-title {
		font-size: 18px;
		font-weight: 700;
		padding: 10px 20px;
		border-bottom: solid 1px #dee2e6;
	}
	.popover__body {
		padding: 20px;
	}
	.dot {
		width: 6px;
		flex-shrink: 0;
		height: 6px;
		border-radius: 50%;
		background-color: #212529;
		margin-top: -3px;
	}
	.dot.dot--sm {
		width: 2px;
		height: 2px;
	}
	.dot.dot__md {
		width: 8px;
		height: 8px;
	}
	.dot.dot__lg {
		width: 12px;
		height: 12px;
	}
	.dot.dot__primary {
		background-color: #0d6efd;
	}
	.dot.dot__secondary {
		background-color: #6c757d;
	}
	.dot.dot__success {
		background-color: #19b600;
	}
	.dot.dot__warning {
		background-color: #ffc107;
	}
	.dot.dot__danger {
		background-color: #ea3d2f;
	}
	.dot.dot__light {
		background-color: #e9ecef;
	}
	.dot.dot__dark {
		background-color: #343a40;
	}
	.dot.dot__white {
		background-color: #fff;
	}
	.dot.dot__orange {
		background-color: #f3aa18;
	}
	.row {
		display: flex;
		flex-wrap: wrap;
		margin-left: -10px;
		margin-right: -10px;
	}
	.h3 {
		font-weight: 500;
		font-size: 16px;
	}
	.h4 {
		font-size: 15px;
	}
	.uploadable-image__wrapper {
		position: relative;
		border-radius: 2px;
		overflow: hidden;
		display: inline-block;
	}
	.uploadable-image__wrapper:hover .uploadable-image__content {
		opacity: 1;
	}
	.uploadable-image__content {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		display: flex;
		align-items: center;
		justify-content: center;
		color: #fff;
		background-color: rgba(0, 0, 0, 0.55);
		font-size: 12px;
		opacity: 0;
		transition: 0.3s;
		cursor: pointer;
	}
	.uploadable-image__bg {
		position: absolute;
		top: 0;
		left: 0;
		width: 100%;
		height: 100%;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: rgba(255, 255, 255, 0.65);
	}
	.upload-zone {
		border: 2px dashed #dee2e6;
		border-radius: 8px;
		min-height: 300px;
		max-height: 100%;
		display: flex;
		align-items: center;
		justify-content: center;
		background-color: #fff;
		cursor: pointer;
	}
	.upload-zone:hover {
		background-color: #f8f9fa;
	}
	.flag-icon.flag-icon--full {
		border-radius: 0;
	}
	.bounce-enter-active {
		animation: bounce-in 0.5s;
	}
	.bounce-leave-active {
		animation: bounce-in 0.5s reverse;
	}
	@keyframes bounce-in {
		0% {
			transform: scale(0);
		}
		50% {
			transform: scale(1.2);
		}
		100% {
			transform: scale(1);
		}
	}
	.blinking__slowly {
		animation: blinker 1500ms ease-out infinite;
	}
	.blinking {
		animation: blinker 1s linear infinite;
	}
	@keyframes blinker {
		0% {
			opacity: 1;
		}
		60% {
			opacity: 0.9;
		}
		80% {
			opacity: 0;
		}
		100% {
			opacity: 0.8;
		}
	}
	/* The device with borders */
	.smartphone {
		position: relative;
		width: 400px;
		height: 720px;
		margin: auto;
		border: 16px black solid;
		border-top-width: 60px;
		border-bottom-width: 60px;
		border-radius: 36px;
	}
	/* The horizontal line on the top of the device */
	.smartphone:before {
		content: '';
		display: block;
		width: 60px;
		height: 5px;
		position: absolute;
		top: -30px;
		left: 50%;
		transform: translate(-50%, -50%);
		background: #333;
		border-radius: 10px;
	}
	/* The circle on the bottom of the device */
	.smartphone:after {
		content: '';
		display: block;
		width: 35px;
		height: 35px;
		position: absolute;
		left: 50%;
		bottom: -65px;
		transform: translate(-50%, -50%);
		background: #333;
		border-radius: 50%;
	}
	/* The screen (or content) of the device */
	.smartphone__content {
		position: absolute;
		left: 0;
		top: 0;
		width: 370px;
		height: 600px;
	}
	.select_lang {
		height: 27px;
		color: #777;
		border: 1px solid #6c757d;
		border-radius: 4px;
		padding: 2px 7px;
		font-size: 12px;
	}
	.select_lang:hover {
		color: #444;
		border: 1px solid #555;
	}
	.clickable {
		cursor: pointer;
	}
	.clickable.bg_transparent {
		padding: 3px 8px;
		border-radius: 4px;
		background: transparent;
		color: #495057;
	}
	.clickable.bg_transparent:hover {
		background: #e9ecef;
		color: #495057;
	}
	.clickable.unclickable {
		cursor: auto;
	}
	.access_token {
		margin-top: 5px;
		padding: 5px 10px;
		background: #dfecff;
		border-radius: 5px;
		word-break: break-word;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
	}
	.mono {
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
	}
	.star-icon {
		stroke: #999;
		cursor: pointer;
	}
	.star-icon.active {
		stroke: #ffc107;
		cursor: initial;
	}
	.star-icon.active path:last-child {
		fill: #ffeb3b;
	}
	.fade-enter-active,
	.fade-leave-active {
		transition: opacity 0.4s;
	}
	.fade-enter,
	.fade-leave-to {
		opacity: 0;
	}
	.image2 {
		position: relative;
	}
	.image2:hover .image2__overlay {
		opacity: 1;
	}
	.image2__overlay {
		opacity: 0;
		position: absolute;
		top: 0;
		left: 0;
		right: 0;
		bottom: 0;
		background: rgba(0, 0, 0, 0.1411764706);
	}
	.no-shrink {
		flex-shrink: 0;
	}
	.undefined {
		color: rgb(192, 192, 192);
		font-style: italic;
	}
	.dot-typing {
		position: relative;
		left: -9983px;
		width: 4px;
		height: 4px;
		border-radius: 2px;
		background-color: #6c757d;
		color: #6c757d;
		box-shadow:
			9984px 0 0 0 #6c757d,
			9991px 0 0 0 #aca5ad,
			9998px 0 0 0 #ccc5cd;
	}
	.convo_modal_key {
		link-height: 1;
		font-size: 14px;
		padding: 3px 8px;
		background-color: #e9ecef;
		border-radius: 5px;
		font-family: Inconsolata, Monaco, Consolas, 'Liberation Mono', 'Courier New', monospace;
		display: inline-block;
	}
	.session__header {
		margin-top: 10px;
		font-size: 16px;
		font-weight: 500;
		color: black;
	}
	.section_label {
		font-size: 16px;
		font-weight: 500;
		margin-bottom: 5px;
		margin-top: 10px;
	}
	.icon-filled path:last-child {
		fill: currentColor;
	}
	#webpack-dev-server-client-overlay {
		display: none;
	}
	.sbz-time-picker-dropdown.dropdown {
		max-width: unset;
		max-height: unset;
		min-width: unset;
		min-height: unset;
		top: 0;
		border-radius: 4px;
	}
	.sbz-time-picker-dropdown-content {
		display: flex;
	}
	.sbz-time-picker-selection {
		flex: 1;
		width: 72px;
		height: 240px;
		overflow-y: scroll;
		overflow-x: hidden;
		border-right: 1px solid #dee2e6;
	}
	.sbz-time-picker-selection:last-child {
		border-right: none;
	}
	.sbz-time-picker-selection-item {
		margin: 3px;
		padding-top: 4px;
		padding-bottom: 4px;
		font-size: 14px;
		cursor: pointer;
		border-radius: 4px;
		text-align: center;
	}
	.sbz-time-picker-selection-item:hover {
		background-color: #e9ecef;
	}
	.sbz-time-picker-selection-item.active {
		background-color: #e6f4ff;
	}
	.sbz-time-picker-selection-item.empty {
		color: transparent;
		cursor: auto;
	}
	.sbz-time-picker-dropdown-footer {
		border-top: 1px solid #dee2e6;
		padding: 6px 14px;
		display: flex;
		align-items: center;
		justify-content: space-between;
	}
	.sbz-time-input-wrapper {
		position: relative;
		width: 140px;
	}
	.sbz-time-input-wrapper .sbz-time-input {
		padding-right: 40px;
	}
	.sbz-time-input-wrapper select.sbz-time-input {
		apperance: none;
	}
	.sbz-time-input.form-control.is-invalid {
		background-image: none;
	}
	.sbz-time-input.form-control.is-invalid + .sbz-time-input-icon {
		color: #ea3d2f;
	}
	.sbz-time-input-icon {
		position: absolute;
		width: 18px;
		height: 18px;
		right: 5px;
		top: calc(50% - 9px);
	}
	.sbz_box,
	.public_payment_page_content_box,
	.sbz_radio_box,
	.zns_logo_select_box {
		border-radius: 8px;
		border: 1px solid #dee2e6;
		background-color: #fff;
		position: relative;
	}
	.sbz_box_inner {
		padding: 12px 20px;
	}
	.sbz_radio_box,
	.zns_logo_select_box {
		cursor: pointer;
		padding: 8px 15px;
		display: flex;
		position: relative;
	}
	.sbz_radio_box.disabled,
	.disabled.zns_logo_select_box {
		background-color: #f8f9fa;
		cursor: auto;
		opacity: 0.6;
	}
	.sbz_radio_box:hover,
	.zns_logo_select_box:hover {
		background-color: #f8f9fa;
	}
	.sbz_radio_box.active,
	.active.zns_logo_select_box {
		border-color: #0d6efd;
		box-shadow: inset 0 0 0 1px #0d6efd;
		background-color: #eff8ff;
	}
	.sbz_radio_box input[type='radio'],
	.zns_logo_select_box input[type='radio'] {
		flex-shrink: 0;
	}
	.sbz_box_item {
		padding: 5px 10px;
		border-bottom: 1px solid #dee2e6;
	}
	.sbz_box_item:last-child {
		border-bottom: none;
	}
	.recent_users {
		right: 10px;
		height: 100%;
		bottom: 20px;
		display: flex;
		flex-direction: column;
		justify-content: space-between;
		background: #fff;
		border-left: 1px solid #e5e5e5;
		width: 50px;
		align-items: center;
		padding-bottom: 20px;
		z-index: 120;
	}
	.line-height-0 {
		line-height: 0;
	}
	.single_node {
		width: 100%;
		padding: 5px 0;
	}
	.single_node.dragenter {
		background: #e9ecef;
	}
	.node_zone_before {
		height: 0px;
	}
	.node_zone_before.dragenter {
		background: red;
	}
	.node_zone_after {
		height: 0px;
	}
	.node_zone_after.dragenter {
		background: red;
	}
	.test_list.dragging .single_node {
		padding-top: 0;
		padding-bottom: 0;
	}
	.test_list.dragging .single_node:first-child {
		padding-top: 5px;
	}
	.test_list.dragging .node_zone_before {
		height: 5px;
	}
	.test_list.dragging .node_zone_after {
		height: 5px;
	}
	.line_2 {
		overflow: hidden;
		text-overflow: ellipsis;
		display: -webkit-box;
		-webkit-line-clamp: 2;
		-webkit-box-orient: vertical;
	}
	.line_3 {
		overflow: hidden;
		text-overflow: ellipsis;
		display: -webkit-box;
		-webkit-line-clamp: 3;
		-webkit-box-orient: vertical;
	}
	.hover_visible_wrapper:hover .hover_visible_item {
		visibility: visible;
	}
	.hover_visible_item {
		visibility: hidden;
	}
	.hover_display_wrapper:hover .hover_display_item {
		display: block;
	}
	.hover_display_item {
		display: none;
	}
	.border_left {
		border-left: 1px solid #dee2e6;
	}
	.border_right {
		border-right: 1px solid #dee2e6;
	}
	.border_top {
		border-top: 1px solid #dee2e6;
	}
	.border_bottom {
		border-bottom: 1px solid #dee2e6;
	}
	.border_all {
		border: 1px solid #dee2e6;
	}
	.test_drag_item {
		width: 250px;
		background: white;
		border-radius: 8px;
		border: 1px solid #dee2e6;
		padding: 4px 10px;
		margin-bottom: 10px;
	}
	.test_drag_item.dragging {
		background: whitesmoke;
		color: whitesmoke;
	}
	.public_payment_page {
		display: flex;
		width: 100%;
		height: 100vh;
		overflow: hidden;
		flex-direction: column;
	}
	.public_payment_page_header {
		flex-shrink: 0;
		padding: 20px;
		border-bottom: 1px solid #dee2e6;
	}
	.public_payment_page_header_inner {
		width: 1000px;
		margin: 0 auto;
	}
	.public_payment_page_content {
		flex: 1;
		overflow: auto;
		padding: 40px 0;
		background-color: whitesmoke;
	}
	.public_payment_page_content_box {
		width: 1000px;
		display: flex;
		overflow: hidden;
		margin: 0 auto;
	}

	.public_payment_page_left {
		padding: 30px;
		flex: 5;
	}

	.public_payment_page_right {
		padding: 30px;
		flex: 3;
		background-color: #fff;
		border-left: 1px solid #dee2e6;
	}

	@media (max-width: 1000px) {
		.public_payment_page_header_inner {
			width: 100%;
		}
		.public_payment_page_content {
			padding: 20px;
		}
		.public_payment_page_content_box {
			flex-direction: column;
			width: 100%;
		}
		.public_payment_page_left {
			height: auto;
		}
		.public_payment_page_right {
			border-left: 0;
			border-top: 1px solid #dee2e6;
			height: auto;
			overflow: unset;
		}
	}
}

.ProseMirror {
  position: relative;
}

.ProseMirror {
  word-wrap: break-word;
  white-space: pre-wrap;
  white-space: break-spaces;
  font-variant-ligatures: none;
  font-feature-settings: "liga" 0; /* the above doesn't seem to work in Edge */
}

.ProseMirror pre {
  white-space: pre-wrap;
}

.ProseMirror li {
  position: relative;
}

.ProseMirror-hideselection *::selection { background: transparent; }
.ProseMirror-hideselection *::-moz-selection { background: transparent; }
.ProseMirror-hideselection { caret-color: transparent; }

/* See https://code.haverbeke.berlin/prosemirror/prosemirror/issues/1421#issuecomment-1759320191 */
.ProseMirror [draggable][contenteditable=false] { -webkit-user-select: text; user-select: text }

.ProseMirror-selectednode {
  outline: 2px solid #8cf;
}

/* Make sure li selections wrap around markers */

li.ProseMirror-selectednode {
  outline: none;
}

li.ProseMirror-selectednode:after {
  content: "";
  position: absolute;
  left: -32px;
  right: -2px; top: -2px; bottom: -2px;
  border: 2px solid #8cf;
  pointer-events: none;
}

/* Protect against generic img rules */

img.ProseMirror-separator {
  display: inline !important;
  border: none !important;
  margin: 0 !important;
}

/* Copyright (c) Meta Platforms, Inc. and affiliates. */

/**
 * Astryx Reset Stylesheet
 *
 * An opinionated CSS reset that provides a clean, predictable base for
 * Astryx applications. Built on the same principles as Tailwind Preflight
 * and modern-normalize, adapted for the Astryx design system.
 *
 * This reset:
 * - Normalizes cross-browser inconsistencies
 * - Sets box-sizing: border-box universally
 * - Removes default margins, padding, and list styles
 * - Makes images block-level and responsive
 * - Resets form elements to inherit font styles
 * - Uses :where() for zero specificity (pseudo-elements go outside it)
 *
 * Usage:
 *
 * 1. Import directly (global reset):
 *    import '@astryxdesign/core/reset.css';
 *
 * 2. Combine with base styles and theme:
 *    import '@astryxdesign/core/reset.css';        // @layer reset  — clean slate
 *    import '@astryxdesign/core/astryx.css';        // @layer astryx-base — component styles
 *    import '@astryxdesign/theme-neutral/theme.css'; // @layer astryx-theme — theme overrides
 *
 * Layer order: reset → astryx-base → astryx-theme. This file registers that
 * order itself, like every Astryx stylesheet, so it holds in any load order.
 * Consumer styles (unlayered) always override all Astryx layers.
 * The reset has the lowest priority and can be overridden by any other layer.
 *
 * Similar to:
 * - Tailwind CSS Preflight
 * - Chakra UI's preflight (v3)
 * - Bootstrap Reboot
 * - modern-normalize
 */

@layer reset, astryx-base, astryx-theme;

@layer reset {

  /* ===========================================================================
     Box Model
     =========================================================================== */

  /*
   * Use border-box globally. Prevents padding/border from affecting
   * element dimensions — the single most impactful reset.
   */
  :where(*), :where(*)::before, :where(*)::after {
    box-sizing: border-box;
  }

  /*
   * Reset borders to 0-width solid. This lets you add a border by just
   * setting border-width — no need to also specify border-style.
   */
  :where(*), :where(*)::before, :where(*)::after {
    border-width: 0;
    border-style: solid;
    border-color: currentColor;
  }

  /* ===========================================================================
     Document
     =========================================================================== */

  /*
   * Consistent line-height, prevent text size adjustment on orientation
   * change in iOS, and set a readable tab size.
   *
   * color-scheme: light dark — declares that this page supports both modes,
   * enabling CSS light-dark() to resolve correctly. Also ensures that CSS
   * tools (e.g. LightningCSS) which polyfill light-dark() for older browsers
   * inject their toggle-variable initialization in the same CSS bundle.
   * XDSTheme overrides color-scheme per-wrapper as needed.
   */
  :where(html) {
    line-height: 1.5;
    -webkit-text-size-adjust: 100%;
    tab-size: 4;
    color-scheme: light dark;
  }

  /*
   * Remove default body margin and set font smoothing for sharper text
   * rendering on macOS/iOS.
   */
  :where(body) {
    margin: 0;
    line-height: inherit;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
  }

  /* ===========================================================================
     Typography
     =========================================================================== */

  /*
   * Reset headings to inherit size and weight. Headings should be styled
   * intentionally — not rely on browser defaults that vary across browsers.
   */
  :where(h1, h2, h3, h4, h5, h6) {
    font-size: inherit;
    font-weight: inherit;
  }

  /*
   * Remove default margins on all block-level text elements.
   */
  :where(h1, h2, h3, h4, h5, h6, p, blockquote, figure, pre, dl, dd) {
    margin: 0;
  }

  /*
   * Links inherit color and text-decoration. Style them intentionally
   * rather than relying on browser-default blue/purple.
   */
  :where(a) {
    color: inherit;
    text-decoration: inherit;
  }

  /*
   * Correct font-weight rendering in Chrome and Safari.
   */
  :where(b, strong) {
    font-weight: bolder;
  }

  /*
   * Use the configured monospace font stack and fix the odd em sizing
   * that browsers apply to code elements.
   */
  :where(code, kbd, samp, pre) {
    font-family: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas,
      'Liberation Mono', 'Courier New', monospace;
    font-size: 1em;
  }

  /*
   * Correct font-size for small elements.
   */
  :where(small) {
    font-size: 80%;
  }

  /*
   * Prevent sub and sup from affecting line-height.
   */
  :where(sub, sup) {
    font-size: 75%;
    line-height: 0;
    position: relative;
    vertical-align: baseline;
  }

  :where(sub) {
    bottom: -0.25em;
  }

  :where(sup) {
    top: -0.5em;
  }

  /* ===========================================================================
     Lists
     =========================================================================== */

  /*
   * Remove default list styles, margin, and padding. Lists used for
   * navigation or layout shouldn't carry prose styling by default.
   * Use explicit styles for prose lists.
   */
  :where(ol, ul, menu) {
    list-style: none;
    margin: 0;
    padding: 0;
  }

  /* ===========================================================================
     Media
     =========================================================================== */

  /*
   * Make replaced elements block-level. Eliminates the "mystery gap"
   * below inline images and aligns with how these elements are
   * actually used in modern layouts.
   */
  :where(img, svg, video, canvas, audio, iframe, embed, object) {
    display: block;
    vertical-align: middle;
  }

  /*
   * Constrain images and video to their container. Responsive by default.
   */
  :where(img, video) {
    max-width: 100%;
    height: auto;
  }

  /* ===========================================================================
     AspectRatio Fit Baseline
     =========================================================================== */

  /*
   * Child sizing for AspectRatio's `fit` prop — the component marks the
   * child's direct parent with `data-astryx-aspect-ratio-override` (carrying
   * the fit value), and these direct-child rules size the child, so
   * consumers don't hand-write width/height/object-fit on every media child.
   * The marker sits on the parent itself, so the rules don't depend on
   * AspectRatio's internal element structure or its theming surface. As with
   * the [data-astryx-media] baseline below, the rules are zero-specificity
   * and any styling the child sets itself still wins. `fit="center"` needs
   * no rules here — the component centers the child from its own wrapper.
   */
  :where([data-astryx-aspect-ratio-override="cover"], [data-astryx-aspect-ratio-override="contain"])
    > :where(*) {
    width: 100%;
    height: 100%;
  }

  :where([data-astryx-aspect-ratio-override="cover"]) > :where(img, video) {
    object-fit: cover;
  }

  :where([data-astryx-aspect-ratio-override="contain"]) > :where(img, video) {
    object-fit: contain;
  }

  /* ===========================================================================
     Forms
     =========================================================================== */

  /*
   * Form elements should inherit font styles from their parent rather
   * than using the browser's default font stack.
   */
  :where(button, input, optgroup, select, textarea) {
    font: inherit;
    color: inherit;
    margin: 0;
    padding: 0;
  }

  /*
   * Remove default button styling. Buttons should be styled intentionally.
   */
  :where(button, [type='button'], [type='reset'], [type='submit']) {
    appearance: button;
    background-color: transparent;
    background-image: none;
  }

  /*
   * Pointer cursor for interactive elements.
   */
  :where(button, [role='button']) {
    cursor: pointer;
  }

  /*
   * Disabled elements take back any interactive cursor: a control that will
   * not respond must not answer the pointer as though it will. `default`
   * rather than `not-allowed` — a disabled control sealed behind
   * `pointer-events: none` shows whatever its ancestor shows, and one cursor
   * everywhere beats a stronger one we can only paint on half of them.
   * Covers [aria-disabled] too: astryx keeps a disabled control focusable
   * that way wherever its reason must stay discoverable (Button with a
   * tooltip, Selector's trigger, SideNavItem).
   */
  :where(:disabled, [aria-disabled='true']) {
    cursor: default;
  }

  /*
   * Only allow vertical resizing of textareas to prevent layout breakage.
   */
  :where(textarea) {
    resize: vertical;
  }

  /*
   * Normalize placeholder opacity (Firefox renders at reduced opacity)
   * and color it with the --color-text-secondary token, or its default.
   */
  :where(input, textarea)::placeholder {
    opacity: 1;
    color: var(--color-text-secondary, light-dark(#4E606F, #AAAFB5));
  }

  /*
   * Remove the inner padding and cancel buttons in search inputs
   * for Chrome and Safari.
   */
  :where([type='search'])::-webkit-search-decoration,
  :where([type='search'])::-webkit-search-cancel-button {
    -webkit-appearance: none;
  }

  /*
   * Remove default fieldset styles.
   */
  :where(fieldset) {
    margin: 0;
    padding: 0;
  }

  :where(legend) {
    padding: 0;
  }

  /* ===========================================================================
     Tables
     =========================================================================== */

  /*
   * Collapse table borders and fix text-indent/border-color inheritance.
   */
  :where(table) {
    text-indent: 0;
    border-color: inherit;
    border-collapse: collapse;
  }

  /* ===========================================================================
     Misc
     =========================================================================== */

  /*
   * Simplify hr to a single border-top line.
   */
  :where(hr) {
    height: 0;
    color: inherit;
    border-top-width: 1px;
  }

  /*
   * Correct display for summary elements.
   */
  :where(summary) {
    display: list-item;
  }

  /*
   * Reset dialog padding and outline.
   */
  :where(dialog) {
    padding: 0;
    outline: none;
  }

  /*
   * Ensure hidden elements are actually hidden. `hidden="until-found"` keeps
   * the browser's own rendering, `content-visibility: hidden`, so find in page
   * and text fragment links can still find its content and reveal it.
   */
  :where([hidden]:not([hidden='until-found' i])) {
    display: none;
  }

  /*
   * Remove tap highlight on iOS.
   */
  :where(html) {
    -webkit-tap-highlight-color: transparent;
  }

  /* ===========================================================================
     Color Scheme
     =========================================================================== */

  /*
   * Map data-theme attribute to CSS color-scheme.
   *
   * Setting data-theme on <html> tells the browser which color scheme
   * to use for native UI elements (scrollbars, form controls, date
   * pickers) and enables CSS light-dark() to resolve correctly.
   *
   * XDSTheme auto-detects when it's the root provider and syncs this
   * attribute on the client. For RSC / SSR, set it on <html> in your
   * root layout to avoid a flash of wrong theme:
   *
   *   <html lang="en" data-theme="dark">
   *
   * Values: "light" | "dark" | omitted (defaults to light dark = system)
   */
  :where(html[data-theme="light"]) {
    color-scheme: light;
  }

  :where(html[data-theme="dark"]) {
    color-scheme: dark;
  }

  :where(html:not([data-theme])) {
    color-scheme: light dark;
  }

  /* ===========================================================================
     Media Theme Baseline
     =========================================================================== */

  /*
   * color-scheme flip for [data-*-media] — makes light-dark() base
   * tokens resolve correctly on inverted surfaces without a theme.
   * Token overrides (text/icon/accent) are theme-level (generateOnMediaCSS).
   * Dual-prefix (astryx + legacy xds) during the compat window.
   */
  :where([data-astryx-media="dark"]) {
    color-scheme: dark;
  }

  :where([data-astryx-media="light"]) {
    color-scheme: light;
  }
}

/* Astryx Pre-compiled StyleX CSS — all components */
/* Auto-generated. Do not edit manually. */

@layer reset, astryx-base, astryx-theme;

@layer astryx-base {
  @property --x---_avatar-group-overlap { syntax: "*"; inherits: false;}
  @property --x---_codeblock-gutter-width { syntax: "*"; inherits: false;}
  @property --x---_hover-delay { syntax: "*"; inherits: false;}
  @property --x---_tab-indicator-bottom { syntax: "*"; inherits: false;}
  @property --x---container-max-height { syntax: "*"; inherits: false;}
  @property --x---layout-alignment-width { syntax: "*"; inherits: false;}
  @property --x---layout-content-width { syntax: "*"; inherits: false;}
  @property --x-126w13d { syntax: "*"; inherits: false;}
  @property --x-4drmnv { syntax: "*"; inherits: false;}
  @property --x-animationDelay { syntax: "*"; inherits: false;}
  @property --x-aspectRatio { syntax: "*"; inherits: false;}
  @property --x-backgroundColor { syntax: "*"; inherits: false;}
  @property --x-borderWidth { syntax: "*"; inherits: false;}
  @property --x-bottom { syntax: "*"; inherits: false;}
  @property --x-color { syntax: "*"; inherits: false;}
  @property --x-counterReset { syntax: "*"; inherits: false;}
  @property --x-fontSize { syntax: "*"; inherits: false;}
  @property --x-gap { syntax: "*"; inherits: false;}
  @property --x-gridAutoRows { syntax: "*"; inherits: false;}
  @property --x-gridTemplateColumns { syntax: "*"; inherits: false;}
  @property --x-height { syntax: "*"; inherits: false;}
  @property --x-inlineSize { syntax: "*"; inherits: false;}
  @property --x-insetInlineEnd { syntax: "*"; inherits: false;}
  @property --x-insetInlineStart { syntax: "*"; inherits: false;}
  @property --x-marginBlock { syntax: "*"; inherits: false;}
  @property --x-marginBlockEnd { syntax: "*"; inherits: false;}
  @property --x-marginBlockStart { syntax: "*"; inherits: false;}
  @property --x-marginInline { syntax: "*"; inherits: false;}
  @property --x-marginInlineEnd { syntax: "*"; inherits: false;}
  @property --x-marginInlineStart { syntax: "*"; inherits: false;}
  @property --x-maxBlockSize { syntax: "*"; inherits: false;}
  @property --x-maxHeight { syntax: "*"; inherits: false;}
  @property --x-maxWidth { syntax: "*"; inherits: false;}
  @property --x-minHeight { syntax: "*"; inherits: false;}
  @property --x-minWidth { syntax: "*"; inherits: false;}
  @property --x-overflowX { syntax: "*"; inherits: false;}
  @property --x-overflowY { syntax: "*"; inherits: false;}
  @property --x-paddingBlock { syntax: "*"; inherits: false;}
  @property --x-paddingInline { syntax: "*"; inherits: false;}
  @property --x-paddingInlineEnd { syntax: "*"; inherits: false;}
  @property --x-paddingInlineStart { syntax: "*"; inherits: false;}
  @property --x-qthpiu { syntax: "*"; inherits: false;}
  @property --x-sj6hyi { syntax: "*"; inherits: false;}
  @property --x-top { syntax: "*"; inherits: false;}
  @property --x-transform { syntax: "*"; inherits: false;}
  @property --x-WebkitLineClamp { syntax: "*"; inherits: false;}
  @property --x-width { syntax: "*"; inherits: false;}
  @property --x-1dd27dc { syntax: "*"; inherits: true;}
  @property --x-owu7oy { syntax: "*"; inherits: true;}
  @property --astryx-press-alpha { syntax: "<number>"; inherits: true; initial-value: 0 }
  @keyframes x10jkm1t-B{from{--astryx-press-alpha:1;}to{--astryx-press-alpha:0;}}
  @keyframes x188b6p3-B{from{color:inherit;}to{color:transparent;}}
  @keyframes xuvekqa-B{0%{opacity:.3;}50%{opacity:1;}100%{opacity:.3;}}
  @keyframes x1tut0r7-B{0%{opacity:.3;transform:rotateX(52deg) scale(.86);}50%{opacity:1;transform:rotateX(0deg) scale(1);}100%{opacity:.3;transform:rotateX(-52deg) scale(.86);}}
  @keyframes x13kz0yu-B{0%, 100%{opacity:1;}50%{opacity:.5;}}
  @keyframes x18re5ia-B{from{opacity:0;}to{opacity:1;}}
  @keyframes xgnty7z-B{0%{opacity:.25;}100%{opacity:1;}}
  @keyframes xtut5q7-B{0%{opacity:1;}50%{opacity:.5;}100%{opacity:1;}}
  @keyframes x1k48ry3-B{from{opacity:0;transform:scale(.95);}to{opacity:1;transform:scale(1);}}
  @keyframes x11lauxq-B{from{opacity:0;transform:translate(var(--dialog-dir-x,0px),var(--dialog-dir-y,16px)) scale(.95);}to{opacity:1;transform:translate(0,0) scale(1);}}
  @keyframes xu7jd1z-B{from{opacity:0;transform:translateX(var(--spacing-2)) scale(.95);}to{opacity:1;transform:translateX(0) scale(1);}}
  @keyframes xwmkjkf-B{from{opacity:0;transform:translateX(calc(-1 * var(--spacing-2))) scale(.95);}to{opacity:1;transform:translateX(0) scale(1);}}
  @keyframes x1ahk7ht-B{from{opacity:0;transform:translateY(var(--spacing-2)) scale(.95);}to{opacity:1;transform:translateY(0) scale(1);}}
  @keyframes xv1hr86-B{from{opacity:0;transform:translateY(calc(-1 * var(--spacing-2))) scale(.95);}to{opacity:1;transform:translateY(0) scale(1);}}
  @keyframes x1b6yrix-B{from{opacity:0;transform:translateY(var(--spacing-2));}to{opacity:1;transform:translateY(0);}}
  @keyframes xiylxmw-B{from{opacity:0;transform:translateY(calc(-1 * var(--spacing-2)));}to{opacity:1;transform:translateY(0);}}
  @keyframes x1wbvqyn-B{0%{stroke-dashoffset:0;}100%{stroke-dashoffset:calc(var(--_spinner-ring-diameter) * -3.141592653589793);}}
  @keyframes x1c2q33o-B{0%{transform:translateX(100%);}100%{transform:translateX(-250%);}}
  @keyframes xr3m334-B{0%{transform:translateX(-100%);}100%{transform:translateX(250%);}}
  @keyframes x1xhkexc-B{from{width:0;margin-inline-end:0;opacity:0;}to{width:14px;margin-inline-end:var(--spacing-1);opacity:1;}}
  :root, .x1qqxm5o{--astryx-press-alpha:0;}
  :root, .xafi2nm{--border-width:1px;}
  :root, .xj0fimd{--color-accent:light-dark(#0064E0, #2694FE);--color-accent-muted:light-dark(#0082FB33, #0082FB3F);--color-on-accent:light-dark(#FFFFFF, #FFFFFF);--color-neutral:light-dark(rgba(5, 54, 89, 0.1), rgba(223, 226, 229, 0.2));--color-background-surface:light-dark(#FFFFFF, #1F1F22);--color-background-body:light-dark(#F1F4F7, #111112);--color-overlay:light-dark(#01122866, #11111299);--color-overlay-hover:light-dark(#0536590C, #FFFFFF0C);--color-overlay-pressed:light-dark(#05365919, #FFFFFF19);--color-background-muted:light-dark(#0536590C, #1111127F);--color-text-primary:light-dark(#0A1317, #DFE2E5);--color-text-secondary:light-dark(#4E606F, #AAAFB5);--color-text-disabled:light-dark(#A4B0BC, #6F747C);--color-text-accent:light-dark(#0064E0, #3E9EFB);--color-on-dark:light-dark(#FFFFFF, #FFFFFF);--color-on-light:light-dark(#000000, #000000);--color-icon-accent:light-dark(#0064E0, #2694FE);--color-icon-primary:light-dark(#0A1317, #DFE2E5);--color-icon-secondary:light-dark(#4E606F, #AAAFB5);--color-icon-disabled:light-dark(#A4B0BC, #6F747C);--color-background-card:light-dark(#FFFFFF, #1F1F22);--color-background-popover:light-dark(#FFFFFF, #28292C);--color-background-inverted:light-dark(#0A1317, #FFFFFF);--color-background-error-inverted:light-dark(#AA071E, #E3193B);--color-success:light-dark(#0D8626, #0D8626);--color-success-muted:light-dark(#0B991F33, #0B991F3F);--color-on-success:light-dark(#FFFFFF, #FFFFFF);--color-error:light-dark(#E3193B, #F5394F);--color-error-muted:light-dark(#E3193B33, #F5394F3F);--color-on-error:light-dark(#FFFFFF, #FFFFFF);--color-warning:light-dark(#E9AF08, #F2C00B);--color-warning-muted:light-dark(#E2A40033, #E2A4003F);--color-on-warning:light-dark(#0A1317, #0A1317);--color-border:light-dark(#05365919, #F2F4F619);--color-border-emphasized:light-dark(#CCD3DB, #494D53);--color-skeleton:light-dark(#CCD3DB, #5A5E66);--color-track:light-dark(#CCD3DB, #5A5E66);--color-shadow:light-dark(rgba(5, 54, 89, 0.1), rgba(0, 0, 0, 0.3));--color-tint-hover:light-dark(black, white);--color-background-blue:light-dark(#0171E333, #0171E333);--color-border-blue:light-dark(#0064E0, #2694FE);--color-icon-blue:light-dark(#0064E0, #2694FE);--color-text-blue:light-dark(#042F97, #AFD7FF);--color-background-cyan:light-dark(#03A7D733, #03A7D733);--color-border-cyan:light-dark(#089DD0, #0171A4);--color-icon-cyan:light-dark(#00ACC1, #26C6DA);--color-text-cyan:light-dark(#014975, #A1EEF9);--color-background-gray:light-dark(#0A131733, #666A724C);--color-border-gray:light-dark(#647685, #748695);--color-icon-gray:light-dark(#4E606F, #AAAFB5);--color-text-gray:light-dark(#0A1317, #E7EAED);--color-background-green:light-dark(#24BB5E33, #24BB5E33);--color-border-green:light-dark(#0D8626, #0B991F);--color-icon-green:light-dark(#0D8626, #26A756);--color-text-green:light-dark(#09441F, #A5F690);--color-background-orange:light-dark(#F2790233, #F2790233);--color-border-orange:light-dark(#EB6E00, #B34A01);--color-icon-orange:light-dark(#E9690B, #FB8C00);--color-text-orange:light-dark(#6B2203, #FDB876);--color-background-pink:light-dark(#E638B333, #E638B333);--color-border-pink:light-dark(#F351C0, #C02294);--color-icon-pink:light-dark(#C2185B, #EC407A);--color-text-pink:light-dark(#650053, #FEADE3);--color-background-purple:light-dark(#7952FF33, #7952FF33);--color-border-purple:light-dark(#9081FF, #7340FE);--color-icon-purple:light-dark(#5B08D8, #7952FF);--color-text-purple:light-dark(#3E0697, #B3B0FE);--color-background-red:light-dark(#E3193B33, #E3193B33);--color-border-red:light-dark(#E3193B, #F5394F);--color-icon-red:light-dark(#D31130, #E3193B);--color-text-red:light-dark(#7B0210, #FFB2B8);--color-background-teal:light-dark(#0DB7AF33, #0DB7AF33);--color-border-teal:light-dark(#08A3A3, #08767D);--color-icon-teal:light-dark(#009688, #26A69A);--color-text-teal:light-dark(#083943, #40DCCD);--color-background-yellow:light-dark(#E2A40033, #E2A40033);--color-border-yellow:light-dark(#C58600, #B47700);--color-icon-yellow:light-dark(#FBC02D, #FFEE58);--color-text-yellow:light-dark(#753F07, #FBCE03);}
  :root, .x14lkjui{--duration-fast-min:130ms;--duration-fast:175ms;--duration-fast-max:230ms;--duration-medium-min:310ms;--duration-medium:410ms;--duration-medium-max:550ms;--duration-slow-min:730ms;--duration-slow:975ms;--duration-slow-max:1300ms;}
  :root, .xf09i69{--ease-standard:cubic-bezier(0.24, 1, 0.4, 1);}
  :root, .xzxs3qz{--focus-outline-width:2px;--focus-outline-style:solid;--focus-outline-color:var(--color-accent);--focus-outline-offset:3px;}
  :root, .x5tdzeq{--font-family-body:-apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Helvetica, Arial, sans-serif;--font-family-code:"SF Mono", Monaco, Consolas, monospace;--font-family-heading:-apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Helvetica, Arial, sans-serif;}
  :root, .x1q1ms06{--font-size-4xs:0.375rem;--font-size-3xs:0.4375rem;--font-size-2xs:0.5rem;--font-size-xs:0.625rem;--font-size-sm:0.75rem;--font-size-base:0.875rem;--font-size-lg:1.0625rem;--font-size-xl:1.25rem;--font-size-2xl:1.5rem;--font-size-3xl:1.8125rem;--font-size-4xl:2.1875rem;--font-size-5xl:2.625rem;}
  :root, .x1ccmotb{--font-weight-normal:400;--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;}
  :root, .xrw1vgx{--radius-none:0px;--radius-inner:4px;--radius-element:8px;--radius-container:12px;--radius-page:28px;--radius-chat:28px;--radius-full:9999px;}
  :root, .xua8qm3{--shadow-low:0px 1px 1px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.2)), 0px 2px 8px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.2));--shadow-med:0px 1px 2px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.2)), 0px 2px 12px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.2));--shadow-high:0px 2px 2px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.2)), 0px 8px 24px light-dark(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.3));--shadow-inset-hover:inset 0px 0px 0px 2px light-dark(rgba(5, 54, 89, 0.15), rgba(223, 226, 229, 0.2));--shadow-inset-selected:inset 0px 0px 0px 2px rgba(1, 113, 227, 0.5);--shadow-inset-success:inset 0px 0px 0px 2px rgba(38, 167, 86, 0.3);--shadow-inset-warning:inset 0px 0px 0px 2px rgba(226, 164, 0, 0.3);--shadow-inset-error:inset 0px 0px 0px 2px rgba(227, 25, 59, 0.3);}
  :root, .xkgjyic{--size-element-sm:28px;--size-element-md:32px;--size-element-lg:36px;}
  :root, .x1kvdh9l{--spacing-0:0rem;--spacing-0-5:0.125rem;--spacing-1:0.25rem;--spacing-1-5:0.375rem;--spacing-2:0.5rem;--spacing-3:0.75rem;--spacing-4:1rem;--spacing-5:1.25rem;--spacing-6:1.5rem;--spacing-7:1.75rem;--spacing-8:2rem;--spacing-9:2.25rem;--spacing-10:2.5rem;--spacing-11:2.75rem;--spacing-12:3rem;}
  :root, .x1etlgq0{--text-heading-1-size:var(--font-size-2xl);--text-heading-1-weight:var(--font-weight-semibold);--text-heading-1-leading:1.3333;--text-heading-2-size:var(--font-size-xl);--text-heading-2-weight:var(--font-weight-semibold);--text-heading-2-leading:1.4;--text-heading-3-size:var(--font-size-lg);--text-heading-3-weight:var(--font-weight-semibold);--text-heading-3-leading:1.4118;--text-heading-4-size:var(--font-size-base);--text-heading-4-weight:var(--font-weight-semibold);--text-heading-4-leading:1.4286;--text-heading-5-size:var(--font-size-sm);--text-heading-5-weight:var(--font-weight-semibold);--text-heading-5-leading:1.6667;--text-heading-6-size:var(--font-size-xs);--text-heading-6-weight:var(--font-weight-semibold);--text-heading-6-leading:1.6;--text-body-size:var(--font-size-base);--text-body-weight:var(--font-weight-normal);--text-body-leading:1.4286;--text-large-size:var(--font-size-lg);--text-large-weight:var(--font-weight-semibold);--text-large-leading:1.4118;--text-label-size:var(--font-size-base);--text-label-weight:var(--font-weight-medium);--text-label-leading:1.4286;--text-code-size:var(--font-size-base);--text-code-weight:var(--font-weight-normal);--text-code-leading:1.4286;--text-supporting-size:var(--font-size-sm);--text-supporting-weight:var(--font-weight-normal);--text-supporting-leading:1.6667;--text-display-1-size:var(--font-size-5xl);--text-display-1-weight:var(--font-weight-normal);--text-display-1-leading:1.2381;--text-display-2-size:var(--font-size-4xl);--text-display-2-weight:var(--font-weight-normal);--text-display-2-leading:1.2571;--text-display-3-size:var(--font-size-3xl);--text-display-3-weight:var(--font-weight-normal);--text-display-3-leading:1.2414;}
  .xlz5hwt{--_avatar-group-overlap:var(--x---_avatar-group-overlap)}
  .xdarwi0{--_avatar-radius:var(--radius-element)}
  .xeincmr{--_avatar-radius:var(--radius-full)}
  .x877142{--_avatar-radius:var(--radius-none)}
  .xh8ntw8{--_button-radius:calc(var(--radius-element) - var(--spacing-1))}
  .xcw7vlg{--_button-radius:max(var(--radius-element),calc(var(--_chat-composer-radius) - var(--_chat-composer-padding)))}
  .x1rjw8qi{--_button-radius:var(--radius-full)}
  .xw28qpl{--_card-elevation:0 0 transparent}
  .xnpe7fx{--_card-elevation:var(--shadow-high)}
  .x1nn8khe{--_card-elevation:var(--shadow-low)}
  .x1ovzxg0{--_card-elevation:var(--shadow-med)}
  .x2kkz0m{--_card-radius:var(--radius-container)}
  .xr9ms2c{--_card-ring:inset 0 0 0 2px var(--color-accent)}
  .xgwwt2v{--_card-ring:inset 0 0 0 2px var(--color-border-blue)}
  .xcdi0x3{--_card-ring:inset 0 0 0 2px var(--color-border-cyan)}
  .x1m1zkwp{--_card-ring:inset 0 0 0 2px var(--color-border-gray)}
  .x1485227{--_card-ring:inset 0 0 0 2px var(--color-border-green)}
  .x1cclxpp{--_card-ring:inset 0 0 0 2px var(--color-border-orange)}
  .xzs6dn4{--_card-ring:inset 0 0 0 2px var(--color-border-pink)}
  .x9zgi83{--_card-ring:inset 0 0 0 2px var(--color-border-purple)}
  .xo8718j{--_card-ring:inset 0 0 0 2px var(--color-border-red)}
  .xp4e5fy{--_card-ring:inset 0 0 0 2px var(--color-border-teal)}
  .x1glw7ee{--_card-ring:inset 0 0 0 2px var(--color-border-yellow)}
  .x3zsw4j{--_card-ring:inset 0 0 0 2px var(--selectable-card-ring-color)}
  .x18zce08{--_chat-composer-padding:var(--spacing-2)}
  .xk0ittl{--_chat-composer-padding:var(--spacing-3)}
  .xx161y6{--_chat-composer-radius:var(--radius-chat)}
  .xtk08jq{--_codeblock-gutter-width:var(--x---_codeblock-gutter-width)}
  .x9pmotm{--_conceal-opacity:0}
  .x1kgmhs9{--_conceal-opacity:1}
  .xvuvksw{--_dialog-radius:var(--radius-container)}
  .xgory14{--_dropdown-menu-padding:var(--spacing-1)}
  .x1fcsqxe{--_dropdown-menu-radius:var(--radius-container)}
  .x13l1x9d{--_fade-delay:0s}
  .x1832zxr{--_field-radius:var(--radius-element)}
  .x19nvjgn{--_field-status-overlap:calc(var(--size-element-md) / 2)}
  .xgzxwq1{--_focus-outline-offset:0}
  .x17wzz1v{--_focus-outline:none}
  .xhg274n{--_hover-delay:0s}
  .x8xu23y{--_hover-delay:var(--x---_hover-delay)}
  .xqwz7mz{--_hovercard-radius:var(--radius-container)}
  .xqxtgf4{--_input-clear-hit-content:none}
  .xtoycft{--_input-clear-hit-inset:0px}
  .xqlix59{--_item-description-color:var(--color-error)}
  .xw1s368{--_item-inset-inline:var(--spacing-2)}
  .x1ytau7y{--_item-inset-inline:var(--spacing-3)}
  .xufyqxy{--_item-label-color:var(--color-error)}
  .xiki222{--_popover-radius:var(--radius-container)}
  .x1wkyqe6{--_press-overlay-transition:var(--duration-fast)}
  .x1s9pv7w{--_press-overlay:transparent}
  .x1l7afqf{--_press-paint-image:linear-gradient(var(--_press-paint),var(--_press-paint))}
  .xz2mauf{--_press-paint:color-mix(in srgb,var(--color-overlay-pressed) calc(var(--astryx-press-alpha) * 100%),transparent)}
  .xdjmrzf{--_reveal-delay-reduced:0s,0s}
  .x1dejzja{--_reveal-delay:0s,0s}
  .x1xiarpw{--_reveal-delay:0s,var(--duration-fast)}
  .xct0gwe{--_reveal-opacity:0}
  .x5setjs{--_reveal-opacity:1}
  .xp0pj8v{--_reveal-position:absolute}
  .x1r6s5ct{--_reveal-position:static}
  .x1f17rg1{--_section-padding-propagated:initial}
  .x2ccaqq{--_section-padding-propagated:var(--spacing-0-5)}
  .x7mo41q{--_section-padding-propagated:var(--spacing-0)}
  .xxa843v{--_section-padding-propagated:var(--spacing-1-5)}
  .x1j3iakl{--_section-padding-propagated:var(--spacing-1)}
  .x4h2jfd{--_section-padding-propagated:var(--spacing-10)}
  .xezgk69{--_section-padding-propagated:var(--spacing-2)}
  .x1wtz8uf{--_section-padding-propagated:var(--spacing-3)}
  .x5wdj8h{--_section-padding-propagated:var(--spacing-4)}
  .xgjndll{--_section-padding-propagated:var(--spacing-5)}
  .x15i4jqh{--_section-padding-propagated:var(--spacing-6)}
  .xmb9lpv{--_section-padding-propagated:var(--spacing-8)}
  .x18jk3ff{--_segmented-control-padding:var(--spacing-0-5)}
  .x9icjy1{--_segmented-control-radius:var(--radius-element)}
  .x69vvuq{--_spinner-box-size:calc(var(--_spinner-ring-diameter) + var(--_spinner-ring-stroke) * 2)}
  .x2lq4xu{--_spinner-ring-diameter:var(--spinner-diameter)}
  .x10qssua{--_spinner-ring-stroke:var(--spinner-stroke-width)}
  .xficto1{--_tab-indicator-bottom:calc(-1 * (var(--spacing-1) + var(--border-width)))}
  .xbrl7fg{--_tab-indicator-bottom:var(--x---_tab-indicator-bottom)}
  .x78b515{--_tab-strip-bleed:0px}
  .x1kdpo6e{--_textarea-inline-padding:var(--spacing-2)}
  .x1ur4yav{--_thumbnail-hit-inset:0px}
  .x87gnkx{--_toast-slide-y:calc(-1 * var(--spacing-2))}
  .x1heqljd{--_toast-slide-y:var(--spacing-2)}
  .x16bblx1{--button-focus-offset:var(--focus-outline-offset)}
  .x1v15ycx{--button-icon-only-aspect:1 / 1}
  .x1mtvhk1{--color-syntax-background:transparent}
  .x18nyedi{--container-max-height:var(--x---container-max-height)}
  .xax9j7h{--container-padding-block-end:0px}
  .x1of45zw{--container-padding-block-end:var(--astryx-bottom-sheet-padding-block-end,var(--astryx-bottom-sheet-padding,var(--spacing-4)))}
  .x1omyuck{--container-padding-block-end:var(--astryx-card-padding-block-end,var(--astryx-card-padding,var(--spacing-4)))}
  .x1gvthzm{--container-padding-block-end:var(--astryx-dialog-padding-block-end,var(--astryx-dialog-padding,var(--spacing-4)))}
  .x1g5mqay{--container-padding-block-end:var(--astryx-drawer-padding-block-end,var(--astryx-drawer-padding,var(--spacing-4)))}
  .xek4msv{--container-padding-block-end:var(--astryx-section-padding-block-end,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4))))}
  .xi9ns85{--container-padding-block-end:var(--layout-padding-inner-y,var(--spacing-4))}
  .xfsxxt8{--container-padding-block-end:var(--layout-padding-own-outer-y,var(--layout-padding-outer-y,var(--spacing-4)))}
  .x1cao3zv{--container-padding-block-end:var(--spacing-0-5)}
  .xkunwnr{--container-padding-block-end:var(--spacing-0)}
  .xv53x8y{--container-padding-block-end:var(--spacing-1-5)}
  .x57a7ii{--container-padding-block-end:var(--spacing-1)}
  .x15vxphk{--container-padding-block-end:var(--spacing-10)}
  .x4bg2x9{--container-padding-block-end:var(--spacing-11)}
  .x186mjxr{--container-padding-block-end:var(--spacing-12)}
  .x1lsgcmx{--container-padding-block-end:var(--spacing-2)}
  .x1q3ppug{--container-padding-block-end:var(--spacing-3)}
  .x4hfsld{--container-padding-block-end:var(--spacing-4)}
  .xbib2ws{--container-padding-block-end:var(--spacing-5)}
  .x1q8d17g{--container-padding-block-end:var(--spacing-6)}
  .x1yqogew{--container-padding-block-end:var(--spacing-7)}
  .x8lgq76{--container-padding-block-end:var(--spacing-8)}
  .x1f7f9rt{--container-padding-block-end:var(--spacing-9)}
  .x1047aw6{--container-padding-block-start:0px}
  .x8qn3ha{--container-padding-block-start:var(--astryx-bottom-sheet-padding-block-start,var(--astryx-bottom-sheet-padding,var(--spacing-4)))}
  .x1rqz8me{--container-padding-block-start:var(--astryx-card-padding-block-start,var(--astryx-card-padding,var(--spacing-4)))}
  .x1g2kccc{--container-padding-block-start:var(--astryx-dialog-padding-block-start,var(--astryx-dialog-padding,var(--spacing-4)))}
  .x18184ib{--container-padding-block-start:var(--astryx-drawer-padding-block-start,var(--astryx-drawer-padding,var(--spacing-4)))}
  .xnw7zt4{--container-padding-block-start:var(--astryx-section-padding-block-start,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4))))}
  .xjmgx01{--container-padding-block-start:var(--layout-padding-inner-y,var(--spacing-4))}
  .x186o6qk{--container-padding-block-start:var(--layout-padding-own-outer-y,var(--layout-padding-outer-y,var(--spacing-4)))}
  .xvdf9ev{--container-padding-block-start:var(--spacing-0-5)}
  .x1i3qcxz{--container-padding-block-start:var(--spacing-0)}
  .x1kbx601{--container-padding-block-start:var(--spacing-1-5)}
  .xnsckjb{--container-padding-block-start:var(--spacing-1)}
  .x17h9kl7{--container-padding-block-start:var(--spacing-10)}
  .x1rdjxae{--container-padding-block-start:var(--spacing-11)}
  .xecwdl6{--container-padding-block-start:var(--spacing-12)}
  .xa8b4fq{--container-padding-block-start:var(--spacing-2)}
  .x11k4f5r{--container-padding-block-start:var(--spacing-3)}
  .xm01sq8{--container-padding-block-start:var(--spacing-4)}
  .xp8wdkl{--container-padding-block-start:var(--spacing-5)}
  .x1hmud4d{--container-padding-block-start:var(--spacing-6)}
  .x1c00sag{--container-padding-block-start:var(--spacing-7)}
  .xfv60at{--container-padding-block-start:var(--spacing-8)}
  .x14fzdu7{--container-padding-block-start:var(--spacing-9)}
  .xjsfl84{--container-padding-inline-end:0px}
  .x1ui7op6{--container-padding-inline-end:var(--astryx-bottom-sheet-padding-inline-end,var(--astryx-bottom-sheet-padding-inline,var(--astryx-bottom-sheet-padding,var(--spacing-4))))}
  .x1ihxwbr{--container-padding-inline-end:var(--astryx-card-padding-inline-end,var(--astryx-card-padding-inline,var(--astryx-card-padding,var(--spacing-4))))}
  .x11h1f2o{--container-padding-inline-end:var(--astryx-dialog-padding-inline-end,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,var(--spacing-4))))}
  .xlsqznw{--container-padding-inline-end:var(--astryx-drawer-padding-inline-end,var(--astryx-drawer-padding-inline,var(--astryx-drawer-padding,var(--spacing-4))))}
  .xu1wldr{--container-padding-inline-end:var(--astryx-section-padding-inline-end,var(--astryx-section-padding-inline,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4)))))}
  .xikqloz{--container-padding-inline-end:var(--layout-padding-inner-x,var(--spacing-4))}
  .xhq06x6{--container-padding-inline-end:var(--layout-padding-own-outer-x,var(--layout-padding-outer-x,var(--spacing-4)))}
  .x1wz3t3y{--container-padding-inline-end:var(--spacing-0-5)}
  .x91ghl5{--container-padding-inline-end:var(--spacing-0)}
  .xntetml{--container-padding-inline-end:var(--spacing-1-5)}
  .x2oyxnl{--container-padding-inline-end:var(--spacing-1)}
  .xx5lg5w{--container-padding-inline-end:var(--spacing-10)}
  .x1nmgbqg{--container-padding-inline-end:var(--spacing-11)}
  .x1wsfsk2{--container-padding-inline-end:var(--spacing-12)}
  .xcas3b9{--container-padding-inline-end:var(--spacing-2)}
  .xu0ipoa{--container-padding-inline-end:var(--spacing-3)}
  .xs0pscg{--container-padding-inline-end:var(--spacing-4)}
  .xgkj7vj{--container-padding-inline-end:var(--spacing-5)}
  .x94cj42{--container-padding-inline-end:var(--spacing-6)}
  .x11tj35w{--container-padding-inline-end:var(--spacing-7)}
  .x1b9k1pi{--container-padding-inline-end:var(--spacing-8)}
  .x19w02kr{--container-padding-inline-end:var(--spacing-9)}
  .xrhngw9{--container-padding-inline-start:0px}
  .xv7mus7{--container-padding-inline-start:var(--astryx-bottom-sheet-padding-inline-start,var(--astryx-bottom-sheet-padding-inline,var(--astryx-bottom-sheet-padding,var(--spacing-4))))}
  .xjmlhfd{--container-padding-inline-start:var(--astryx-card-padding-inline-start,var(--astryx-card-padding-inline,var(--astryx-card-padding,var(--spacing-4))))}
  .x1tewnwq{--container-padding-inline-start:var(--astryx-dialog-padding-inline-start,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,var(--spacing-4))))}
  .x1mndvw9{--container-padding-inline-start:var(--astryx-drawer-padding-inline-start,var(--astryx-drawer-padding-inline,var(--astryx-drawer-padding,var(--spacing-4))))}
  .x19lemt0{--container-padding-inline-start:var(--astryx-section-padding-inline-start,var(--astryx-section-padding-inline,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4)))))}
  .x408pgh{--container-padding-inline-start:var(--layout-padding-inner-x,var(--spacing-4))}
  .xt2a87w{--container-padding-inline-start:var(--layout-padding-own-outer-x,var(--layout-padding-outer-x,var(--spacing-4)))}
  .x14ws0sr{--container-padding-inline-start:var(--spacing-0-5)}
  .x1gu2k80{--container-padding-inline-start:var(--spacing-0)}
  .x176g23i{--container-padding-inline-start:var(--spacing-1-5)}
  .x1cvlban{--container-padding-inline-start:var(--spacing-1)}
  .xserb3f{--container-padding-inline-start:var(--spacing-10)}
  .xziclwo{--container-padding-inline-start:var(--spacing-11)}
  .x1iiwihq{--container-padding-inline-start:var(--spacing-12)}
  .x1xlrr2o{--container-padding-inline-start:var(--spacing-2)}
  .xfdwxua{--container-padding-inline-start:var(--spacing-3)}
  .x1dlhslv{--container-padding-inline-start:var(--spacing-4)}
  .x1s81nki{--container-padding-inline-start:var(--spacing-5)}
  .x1ep0dkj{--container-padding-inline-start:var(--spacing-6)}
  .x157xojc{--container-padding-inline-start:var(--spacing-7)}
  .xw1diwv{--container-padding-inline-start:var(--spacing-8)}
  .xraca2a{--container-padding-inline-start:var(--spacing-9)}
  .xd9j5qm{--indicator-color:var(--resize-hint,transparent)}
  .x19kr0ht{--layout-alignment-width:100cqi}
  .x1b1nz06{--layout-alignment-width:var(--x---layout-alignment-width)}
  .x15lplax{--layout-content-width:100cqi}
  .x4906uf{--layout-content-width:var(--x---layout-content-width)}
  .x1qfll2g{--layout-padding-inner-x:initial}
  .xp9icaw{--layout-padding-inner-x:var(--astryx-bottom-sheet-padding-inline-start,var(--astryx-bottom-sheet-padding-inline,var(--astryx-bottom-sheet-padding,var(--spacing-4))))}
  .x4poyjn{--layout-padding-inner-x:var(--astryx-card-padding-inline-start,var(--astryx-card-padding-inline,var(--astryx-card-padding,var(--spacing-4))))}
  .x2so38{--layout-padding-inner-x:var(--astryx-dialog-padding-inline-start,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,var(--spacing-4))))}
  .x1qbr0dm{--layout-padding-inner-x:var(--astryx-drawer-padding-inline-start,var(--astryx-drawer-padding-inline,var(--astryx-drawer-padding,var(--spacing-4))))}
  .x1v3gmnx{--layout-padding-inner-x:var(--astryx-section-padding-inline-start,var(--astryx-section-padding-inline,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4)))))}
  .xlriy2h{--layout-padding-inner-x:var(--spacing-0-5)}
  .xj1bl4l{--layout-padding-inner-x:var(--spacing-0)}
  .xd38f90{--layout-padding-inner-x:var(--spacing-1-5)}
  .x6uuyak{--layout-padding-inner-x:var(--spacing-1)}
  .x1vf4qco{--layout-padding-inner-x:var(--spacing-10)}
  .xsmamsf{--layout-padding-inner-x:var(--spacing-11)}
  .x2xk2xj{--layout-padding-inner-x:var(--spacing-12)}
  .xxqksqd{--layout-padding-inner-x:var(--spacing-2)}
  .x1fyui2f{--layout-padding-inner-x:var(--spacing-3)}
  .x1i2ajwi{--layout-padding-inner-x:var(--spacing-4)}
  .x1tac27u{--layout-padding-inner-x:var(--spacing-5)}
  .x1ntgf3t{--layout-padding-inner-x:var(--spacing-6)}
  .xhjd9tl{--layout-padding-inner-x:var(--spacing-7)}
  .xn7c84u{--layout-padding-inner-x:var(--spacing-8)}
  .xeqkbsz{--layout-padding-inner-x:var(--spacing-9)}
  .xyvxpqs{--layout-padding-inner-y:initial}
  .x10u54dy{--layout-padding-inner-y:var(--astryx-bottom-sheet-padding-block-start,var(--astryx-bottom-sheet-padding,var(--spacing-4)))}
  .x1u1kw4e{--layout-padding-inner-y:var(--astryx-card-padding-block-start,var(--astryx-card-padding,var(--spacing-4)))}
  .xinu7xd{--layout-padding-inner-y:var(--astryx-dialog-padding-block-start,var(--astryx-dialog-padding,var(--spacing-4)))}
  .x1ek71mq{--layout-padding-inner-y:var(--astryx-drawer-padding-block-start,var(--astryx-drawer-padding,var(--spacing-4)))}
  .x15yx5hm{--layout-padding-inner-y:var(--astryx-section-padding-block-start,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4))))}
  .x180h0y5{--layout-padding-inner-y:var(--spacing-0-5)}
  .xwuefyo{--layout-padding-inner-y:var(--spacing-0)}
  .x1g8jpzm{--layout-padding-inner-y:var(--spacing-1-5)}
  .xmpug6m{--layout-padding-inner-y:var(--spacing-1)}
  .x18gbwmk{--layout-padding-inner-y:var(--spacing-10)}
  .x14zymzj{--layout-padding-inner-y:var(--spacing-11)}
  .xzfpkx9{--layout-padding-inner-y:var(--spacing-12)}
  .x1lksgje{--layout-padding-inner-y:var(--spacing-2)}
  .x4j7gld{--layout-padding-inner-y:var(--spacing-3)}
  .x1s3ehtl{--layout-padding-inner-y:var(--spacing-4)}
  .x1rj5eim{--layout-padding-inner-y:var(--spacing-5)}
  .x1ftgg6u{--layout-padding-inner-y:var(--spacing-6)}
  .x1ho74vh{--layout-padding-inner-y:var(--spacing-7)}
  .xm2cs6f{--layout-padding-inner-y:var(--spacing-8)}
  .x1vsq92b{--layout-padding-inner-y:var(--spacing-9)}
  .xdt8ak2{--layout-padding-outer-x:initial}
  .x11ixy8q{--layout-padding-outer-x:var(--astryx-bottom-sheet-padding-inline-start,var(--astryx-bottom-sheet-padding-inline,var(--astryx-bottom-sheet-padding,var(--spacing-4))))}
  .x14rzhog{--layout-padding-outer-x:var(--astryx-card-padding-inline-start,var(--astryx-card-padding-inline,var(--astryx-card-padding,var(--spacing-4))))}
  .x1hsjncj{--layout-padding-outer-x:var(--astryx-dialog-padding-inline-start,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,var(--spacing-4))))}
  .x18e7m0u{--layout-padding-outer-x:var(--astryx-drawer-padding-inline-start,var(--astryx-drawer-padding-inline,var(--astryx-drawer-padding,var(--spacing-4))))}
  .x15i0zw9{--layout-padding-outer-x:var(--astryx-section-padding-inline-start,var(--astryx-section-padding-inline,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4)))))}
  .xihiwg7{--layout-padding-outer-x:var(--spacing-0-5)}
  .xswhm3q{--layout-padding-outer-x:var(--spacing-0)}
  .x1u93lgd{--layout-padding-outer-x:var(--spacing-1-5)}
  .xc96xmq{--layout-padding-outer-x:var(--spacing-1)}
  .x1jdf5a4{--layout-padding-outer-x:var(--spacing-10)}
  .x1hct0t0{--layout-padding-outer-x:var(--spacing-11)}
  .x11cyqoe{--layout-padding-outer-x:var(--spacing-12)}
  .x15dxnc0{--layout-padding-outer-x:var(--spacing-2)}
  .xadgj3j{--layout-padding-outer-x:var(--spacing-3)}
  .x1v56qcf{--layout-padding-outer-x:var(--spacing-4)}
  .x1nzs0gl{--layout-padding-outer-x:var(--spacing-5)}
  .x1c3n52a{--layout-padding-outer-x:var(--spacing-6)}
  .x1gfiokx{--layout-padding-outer-x:var(--spacing-7)}
  .x1t3kfz{--layout-padding-outer-x:var(--spacing-8)}
  .xzr4qsh{--layout-padding-outer-x:var(--spacing-9)}
  .x1rs4lu4{--layout-padding-outer-y:initial}
  .x1iwhsh0{--layout-padding-outer-y:var(--astryx-bottom-sheet-padding-block-start,var(--astryx-bottom-sheet-padding,var(--spacing-4)))}
  .xjej9fs{--layout-padding-outer-y:var(--astryx-card-padding-block-start,var(--astryx-card-padding,var(--spacing-4)))}
  .x1pui4bz{--layout-padding-outer-y:var(--astryx-dialog-padding-block-start,var(--astryx-dialog-padding,var(--spacing-4)))}
  .xc006j{--layout-padding-outer-y:var(--astryx-drawer-padding-block-start,var(--astryx-drawer-padding,var(--spacing-4)))}
  .x1vw4zgg{--layout-padding-outer-y:var(--astryx-section-padding-block-start,var(--_section-padding-propagated,var(--astryx-section-padding,var(--spacing-4))))}
  .x1vj96e0{--layout-padding-outer-y:var(--spacing-0-5)}
  .x1mzf5mb{--layout-padding-outer-y:var(--spacing-0)}
  .xd3dqby{--layout-padding-outer-y:var(--spacing-1-5)}
  .x1gpfxoh{--layout-padding-outer-y:var(--spacing-1)}
  .x26l4wa{--layout-padding-outer-y:var(--spacing-10)}
  .x10zktp0{--layout-padding-outer-y:var(--spacing-11)}
  .x1yz3n6a{--layout-padding-outer-y:var(--spacing-12)}
  .x10pz7y9{--layout-padding-outer-y:var(--spacing-2)}
  .x1p6yq3h{--layout-padding-outer-y:var(--spacing-3)}
  .xx738ci{--layout-padding-outer-y:var(--spacing-4)}
  .x6yxws5{--layout-padding-outer-y:var(--spacing-5)}
  .x180vrwl{--layout-padding-outer-y:var(--spacing-6)}
  .x1q6rme1{--layout-padding-outer-y:var(--spacing-7)}
  .xid7e43{--layout-padding-outer-y:var(--spacing-8)}
  .x1t5kicu{--layout-padding-outer-y:var(--spacing-9)}
  .xbjcssu{--layout-padding-own-outer-x:0px}
  .x1vii845{--layout-padding-own-outer-x:initial}
  .x1ftjo2o{--layout-padding-own-outer-x:var(--spacing-0-5)}
  .xhcsosl{--layout-padding-own-outer-x:var(--spacing-0)}
  .x1k4nu17{--layout-padding-own-outer-x:var(--spacing-1-5)}
  .x14y473{--layout-padding-own-outer-x:var(--spacing-1)}
  .xczqutc{--layout-padding-own-outer-x:var(--spacing-10)}
  .x18c6olm{--layout-padding-own-outer-x:var(--spacing-2)}
  .x1cfn5ow{--layout-padding-own-outer-x:var(--spacing-3)}
  .xh30wjg{--layout-padding-own-outer-x:var(--spacing-4)}
  .xse87af{--layout-padding-own-outer-x:var(--spacing-5)}
  .xznoj5s{--layout-padding-own-outer-x:var(--spacing-6)}
  .xtjvahm{--layout-padding-own-outer-x:var(--spacing-8)}
  .x1bz2q72{--layout-padding-own-outer-y:0px}
  .xojybgt{--layout-padding-own-outer-y:initial}
  .x1b6unwa{--layout-padding-own-outer-y:var(--spacing-0-5)}
  .xe1wva8{--layout-padding-own-outer-y:var(--spacing-0)}
  .x1g16mdy{--layout-padding-own-outer-y:var(--spacing-1-5)}
  .x1nxw61z{--layout-padding-own-outer-y:var(--spacing-1)}
  .xaqnhag{--layout-padding-own-outer-y:var(--spacing-10)}
  .xm4vj23{--layout-padding-own-outer-y:var(--spacing-2)}
  .x69uvy7{--layout-padding-own-outer-y:var(--spacing-3)}
  .x139ridu{--layout-padding-own-outer-y:var(--spacing-4)}
  .x1cq2jmq{--layout-padding-own-outer-y:var(--spacing-5)}
  .x1ir1f5p{--layout-padding-own-outer-y:var(--spacing-6)}
  .xhbsdkj{--layout-padding-own-outer-y:var(--spacing-8)}
  .xnpej1e{--radius-element:var(--radius-full)}
  .x1tnip43{--resize-hint:transparent}
  .x11rj6l1{--selectable-card-ring-color:var(--color-accent)}
  .xkce8z9{--separator-display:flex}
  .x7o5821{--spinner-arc-fraction:.375}
  .x1uzk0gl{--spinner-color:currentColor}
  .xt1b8mc{--spinner-color:var(--color-accent)}
  .x13u6jys{--spinner-color:var(--color-on-dark)}
  .x1jevo6s{--spinner-color:var(--color-text-secondary)}
  .x11wm0hx{--spinner-diameter:10px}
  .x15pu9g6{--spinner-diameter:14px}
  .x1w424tr{--spinner-diameter:18px}
  .x1orj1z9{--spinner-diameter:28px}
  .xls98ul{--spinner-stroke-width:2px}
  .xr0wkrm{--spinner-stroke-width:3px}
  .x7y2bof{--spinner-stroke-width:4px}
  .xbfzqbu{--spinner-track-color:currentColor}
  .x1ufpcf6{--spinner-track-color:var(--color-on-dark)}
  .xspt9s2{--spinner-track-color:var(--color-track)}
  .x152dxt4{--step-connector-gap:0px}
  .x5letbq{--step-connector-gap:inherit}
  .x1qkaldv{--step-connector-gap:initial}
  .xpa4xmd{--tree-list-indent:var(--spacing-4)}
  .x1xbi2jf{--tree-list-row-gap:var(--spacing-0-5)}
  .x1wfyzv7:focus-within{--_fade-delay:0s}
  .xqchwus:focus-visible{--_focus-outline-offset:var(--focus-outline-offset)}
  .xqih627:focus-visible{--_focus-outline:var(--focus-outline-width) var(--focus-outline-style) var(--focus-outline-color)}
  .x1z42dm:focus-within{--_reveal-delay-reduced:0s,0s}
  .x1mjsb9v:focus-within{--_reveal-delay:0s,0s}
  .xi33vf3:focus-within{--_reveal-opacity:1}
  .xoa21yc:focus-within{--_reveal-position:static}
  .x11woleg:focus-visible{--indicator-color:var(--color-accent)}
  .x1i79oho.x1i79oho:hover:where(:not(:disabled,[aria-disabled="true"])){--indicator-color:var(--resize-hint-gate,var(--color-accent))}
  .x1qs65gq:has(> [data-size="lg"]){--_field-status-overlap:calc(var(--size-element-lg) / 2)}
  .xlumz0n:has(> [data-size="sm"]){--_field-status-overlap:calc(var(--size-element-sm) / 2)}
  .x158n88w:has(:focus-visible){--_tab-strip-bleed:calc(var(--focus-outline-width) + var(--focus-outline-offset))}
  .x1ibt0lz:first-child{--separator-display:none}
  .xztvxw7:nth-child(even of :not([data-expansion-panel])){--table-row-overlay:var(--color-background-muted)}
  @media (any-pointer: coarse){.x1hl81f0.x1hl81f0{--_fade-delay:0s}}
  @media (pointer: coarse){.xp8r40j.xp8r40j{--_input-clear-hit-content:""}}
  @media (pointer: coarse){.x181bpwf.x181bpwf{--_input-clear-hit-inset:-2px}}
  @media (any-pointer: coarse){.xm1aeao.xm1aeao{--_reveal-delay-reduced:0s,0s}}
  @media (any-pointer: coarse){.x1pn63d7.x1pn63d7{--_reveal-delay:0s,0s}}
  @media (any-pointer: coarse){.xi7d7de.xi7d7de{--_reveal-opacity:1}}
  @media (any-pointer: coarse){.xarvkxi.xarvkxi{--_reveal-position:static}}
  @media (pointer: coarse){.x1h9khjt.x1h9khjt{--_thumbnail-hit-inset:-2px}}
  @media (hover: hover){.x1m110vg.x1m110vg{--resize-hint:transparent}}
  .xb8awce.xb8awce:active:where(:not(:disabled,[aria-disabled="true"])){--_press-overlay:var(--color-overlay-pressed)}
  @media (hover: hover){.x1316hva.x1316hva.x1316hva:hover:where(:not(:disabled,[aria-disabled="true"])){--_conceal-opacity:0}}
  @media (hover: hover){.xuzfaso.xuzfaso.xuzfaso:hover:where(:not(:disabled,[aria-disabled="true"])){--_conceal-opacity:1}}
  @media (hover: hover){.xq03417.xq03417.xq03417:hover:where(:not(:disabled,[aria-disabled="true"])){--_fade-delay:0s}}
  @media (hover: hover){.x14nxqze.x14nxqze.x14nxqze:hover:where(:not(:disabled,[aria-disabled="true"])){--_fade-delay:var(--_hover-delay,0s)}}
  @media (hover: hover){.xap96qf.xap96qf.xap96qf:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-delay-reduced:0s,0s}}
  @media (hover: hover){.xvd8mm8.xvd8mm8.xvd8mm8:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-delay-reduced:var(--_hover-delay,0s),var(--_hover-delay,0s)}}
  @media (hover: hover){.x1t6fdr0.x1t6fdr0.x1t6fdr0:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-delay:0s,0s}}
  @media (hover: hover){.x1tx49wl.x1tx49wl.x1tx49wl:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-delay:0s,var(--duration-fast)}}
  @media (hover: hover){.xi1ebb6.xi1ebb6.xi1ebb6:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-delay:var(--_hover-delay,0s),var(--_hover-delay,0s)}}
  @media (hover: hover){.xfqgg65.xfqgg65.xfqgg65:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-opacity:0}}
  @media (hover: hover){.x2xrgwu.x2xrgwu.x2xrgwu:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-opacity:1}}
  @media (hover: hover){.x17ock8y.x17ock8y.x17ock8y:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-position:absolute}}
  @media (hover: hover){.x1or4zte.x1or4zte.x1or4zte:hover:where(:not(:disabled,[aria-disabled="true"])){--_reveal-position:static}}
  @media (hover: hover){.x1o1xfy8.x1o1xfy8.x1o1xfy8:hover:where(:not(:disabled,[aria-disabled="true"])){--resize-hint:var(--resize-hint-gate,var(--color-border))}}
  @media (hover: hover){.xc01ov8.xc01ov8.xc01ov8:hover:where(:not(:disabled,[aria-disabled="true"])){--table-row-overlay:var(--color-overlay-hover)}}
  @media (hover: hover){.xmfmiv1.xmfmiv1.xmfmiv1:hover:where(:not(:disabled,[aria-disabled="true"])):where(:not(:disabled,[aria-disabled="true"])){--_press-overlay:var(--color-overlay-hover)}}
  @media (pointer: coarse){.x1a5qima.x1a5qima.x1a5qima:active:where(:not(:disabled,[aria-disabled="true"])){--_press-overlay:transparent}}
  @media (hover: hover){.x1hn5ov8.x1hn5ov8.x1hn5ov8:active:where(:not(:disabled,[aria-disabled="true"])){--_press-overlay:var(--color-overlay-pressed)}}
  .xln7xf2:not(#\#){font:inherit}
  .x15r89dc:not(#\#){grid-area:1 / 1}
  .x10a8y8t:not(#\#){inset:0}
  .x1anvkwx:not(#\#){inset:auto}
  .xh3736h:not(#\#){inset:unset}
  .xkdpibf:not(#\#){margin:-1px}
  .x1ghz6dp:not(#\#){margin:0}
  .xkib98w:not(#\#){margin:8px}
  .x1bpp3o7:not(#\#){margin:auto}
  .x1717udv:not(#\#){padding:0}
  .x1tamke2:not(#\#){padding:16px}
  .x1i3ajwb:not(#\#){padding:2px}
  .xfawy5m:not(#\#){padding:4px}
  .x1b50gpf:not(#\#){padding:calc(var(--_chat-composer-padding) - var(--border-width))}
  .x18oj4ui:not(#\#){padding:var(--_chat-composer-padding)}
  .xpoxszi:not(#\#){padding:var(--_segmented-control-padding)}
  .xtozwh:not(#\#){padding:var(--spacing-1) var(--spacing-2)}
  .x9epnlk:not(#\#){padding:var(--spacing-1)}
  .x15nmkw0:not(#\#){padding:var(--spacing-2) 0}
  .xlsj2fj:not(#\#){padding:var(--spacing-2)}
  .x1b2ylru:not(#\#){padding:var(--spacing-3)}
  .x1shk3sm:not(#\#){padding:var(--spacing-4)}
  .x1y5lnwp:focus:not(#\#){margin:0}
  .xg8s4dl:not(#\#):not(#\#){animation-range:cover 0% cover 100%}
  .x9r1u3d:not(#\#):not(#\#){border-color:transparent}
  .xad5do:not(#\#):not(#\#){border-color:var(--color-accent)}
  .x1touxvs:not(#\#):not(#\#){border-color:var(--color-background-surface)}
  .xlee4gx:not(#\#):not(#\#){border-color:var(--color-border-blue)}
  .xb1xfl:not(#\#):not(#\#){border-color:var(--color-border-cyan)}
  .xvy26l8:not(#\#):not(#\#){border-color:var(--color-border-emphasized)}
  .x1w9ec3u:not(#\#):not(#\#){border-color:var(--color-border-gray)}
  .xy90a9n:not(#\#):not(#\#){border-color:var(--color-border-green)}
  .xloqurj:not(#\#):not(#\#){border-color:var(--color-border-orange)}
  .x1czkbn8:not(#\#):not(#\#){border-color:var(--color-border-pink)}
  .xq98wne:not(#\#):not(#\#){border-color:var(--color-border-purple)}
  .xjqgoec:not(#\#):not(#\#){border-color:var(--color-border-red)}
  .x1r9gxr1:not(#\#):not(#\#){border-color:var(--color-border-teal)}
  .x1kpnwn1:not(#\#):not(#\#){border-color:var(--color-border-yellow)}
  .x14i3s5s:not(#\#):not(#\#){border-color:var(--color-border)}
  .x1ofxpqo:not(#\#):not(#\#){border-color:var(--color-error)}
  .x16m2moy:not(#\#):not(#\#){border-color:var(--color-success)}
  .xqcx1ss:not(#\#):not(#\#){border-color:var(--color-text-primary)}
  .x8wg1ba:not(#\#):not(#\#){border-color:var(--color-warning)}
  .x2u8bby:not(#\#):not(#\#){border-radius:0}
  .x1nj7uno:not(#\#):not(#\#){border-radius:1px}
  .x16rqkct:not(#\#):not(#\#){border-radius:50%}
  .xur7f20:not(#\#):not(#\#){border-radius:8px}
  .x1pjcqnp:not(#\#):not(#\#){border-radius:inherit}
  .x1ws5lxm:not(#\#):not(#\#){border-radius:max(0px,calc(var(--_dropdown-menu-radius,var(--spacing-2)) - var(--_dropdown-menu-padding,var(--spacing-1))))}
  .xc910v0:not(#\#):not(#\#){border-radius:max(0px,calc(var(--_segmented-control-radius) - var(--_segmented-control-padding)))}
  .xbc78cj:not(#\#):not(#\#){border-radius:var(--_avatar-radius)}
  .x1vf2byn:not(#\#):not(#\#){border-radius:var(--_banner-radius,var(--radius-container))}
  .x1jxw6zd:not(#\#):not(#\#){border-radius:var(--_button-radius,var(--radius-element))}
  .xy0xnkn:not(#\#):not(#\#){border-radius:var(--_button-radius,var(--radius-full))}
  .x153u1i6:not(#\#):not(#\#){border-radius:var(--_card-radius)}
  .x1xunbrq:not(#\#):not(#\#){border-radius:var(--_chat-composer-radius)}
  .xuacgfc:not(#\#):not(#\#){border-radius:var(--_dialog-radius)}
  .x1n97fys:not(#\#):not(#\#){border-radius:var(--_dropdown-menu-radius)}
  .xvdfih8:not(#\#):not(#\#){border-radius:var(--_field-radius)}
  .x7a53xk:not(#\#):not(#\#){border-radius:var(--_hovercard-radius)}
  .x11m9jtl:not(#\#):not(#\#){border-radius:var(--_popover-radius)}
  .x1hapoqb:not(#\#):not(#\#){border-radius:var(--_segmented-control-radius)}
  .xashgol:not(#\#):not(#\#){border-radius:var(--radius-chat)}
  .x1hviunn:not(#\#):not(#\#){border-radius:var(--radius-container)}
  .xh6dtrn:not(#\#):not(#\#){border-radius:var(--radius-element)}
  .xjspbzw:not(#\#):not(#\#){border-radius:var(--radius-full)}
  .xx3sua9:not(#\#):not(#\#){border-radius:var(--radius-inner)}
  .xwksslw:not(#\#):not(#\#){border-radius:var(--radius-none)}
  .xbsl7fq:not(#\#):not(#\#){border-style:dashed}
  .xng3xce:not(#\#):not(#\#){border-style:none}
  .x1y0btm7:not(#\#):not(#\#){border-style:solid}
  .xc342km:not(#\#):not(#\#){border-width:0}
  .xmkeg23:not(#\#):not(#\#){border-width:1px}
  .xdh2fpr:not(#\#):not(#\#){border-width:2px}
  .x1litavf:not(#\#):not(#\#){border-width:var(--border-width)}
  .x1mw0n95:not(#\#):not(#\#){border-width:var(--x-borderWidth)}
  .x1somy94:not(#\#):not(#\#){flex:0 0 0}
  .x3psx0u:not(#\#):not(#\#){flex:0 0 auto}
  .xkz0k9k:not(#\#):not(#\#){flex:0 1 auto}
  .x1cqoux5:not(#\#):not(#\#){flex:1 1 0}
  .x845mor:not(#\#):not(#\#){flex:1 1 0%}
  .xfoc8du:not(#\#):not(#\#){flex:1 1 40px}
  .x12lumcd:not(#\#):not(#\#){flex:1 1 auto}
  .x98rzlu:not(#\#):not(#\#){flex:1}
  .xxhr3t:not(#\#):not(#\#){gap:0}
  .x1jnr06f:not(#\#):not(#\#){gap:4px}
  .x14kbac9:not(#\#):not(#\#){gap:inherit}
  .x1lsbc85:not(#\#):not(#\#){gap:var(--spacing-0-5)}
  .xsn7fz1:not(#\#):not(#\#){gap:var(--spacing-0)}
  .x1s4dlld:not(#\#):not(#\#){gap:var(--spacing-1-5)}
  .xzye2dw:not(#\#):not(#\#){gap:var(--spacing-1)}
  .x3hoi3v:not(#\#):not(#\#){gap:var(--spacing-10)}
  .xpec5dj:not(#\#):not(#\#){gap:var(--spacing-2) var(--spacing-4)}
  .x1txdalj:not(#\#):not(#\#){gap:var(--spacing-2)}
  .xlaq8a2:not(#\#):not(#\#){gap:var(--spacing-3) var(--spacing-4)}
  .xjcht0a:not(#\#):not(#\#){gap:var(--spacing-3)}
  .x18g69wz:not(#\#):not(#\#){gap:var(--spacing-4)}
  .x9mgr7n:not(#\#):not(#\#){gap:var(--spacing-5)}
  .x1qh66ti:not(#\#):not(#\#){gap:var(--spacing-6)}
  .x4t41sb:not(#\#):not(#\#){gap:var(--spacing-8)}
  .x1pidvrl:not(#\#):not(#\#){gap:var(--x-gap)}
  .xgkxs2y:not(#\#):not(#\#){grid-column:1}
  .x1ms6mhf:not(#\#):not(#\#){grid-row:1}
  .x10no89f:not(#\#):not(#\#){inset-block:0}
  .x17y0mx6:not(#\#):not(#\#){inset-inline:0}
  .xe8uvvx:not(#\#):not(#\#){list-style:none}
  .x10im51j:not(#\#):not(#\#){margin-block:0}
  .x81ka23:not(#\#):not(#\#){margin-block:calc(-1 * (var(--spacing-3) - var(--spacing-2)))}
  .xhzvc8f:not(#\#):not(#\#){margin-block:calc(-1 * var(--spacing-2))}
  .xqixskq:not(#\#):not(#\#){margin-block:calc(var(--size-element-md) / 2 - var(--spacing-2) - var(--text-heading-2-size) * var(--text-heading-2-leading) / 2)}
  .xsq74q5:not(#\#):not(#\#){margin-block:var(--spacing-1)}
  .x1g06x3t:not(#\#):not(#\#){margin-block:var(--spacing-2)}
  .x1oqu0vw:not(#\#):not(#\#){margin-block:var(--x-marginBlock)}
  .xvueqy4:not(#\#):not(#\#){margin-inline:auto}
  .xi5l473:not(#\#):not(#\#){margin-inline:calc(-1 * (var(--_tab-strip-bleed)))}
  .xtedp8i:not(#\#):not(#\#){margin-inline:calc(-1 * var(--spacing-1))}
  .x1ho7dyk:not(#\#):not(#\#){margin-inline:calc(-1 * var(--spacing-2))}
  .x1ng9b9t:not(#\#):not(#\#){margin-inline:calc(-1 * var(--spacing-4))}
  .xhrcg97:not(#\#):not(#\#){margin-inline:var(--spacing-1)}
  .xam6yil:not(#\#):not(#\#){margin-inline:var(--spacing-3)}
  .xvlecxo:not(#\#):not(#\#){margin-inline:var(--x-marginInline)}
  .x1a2a7pz:not(#\#):not(#\#){outline:none}
  .xaw4jrz:not(#\#):not(#\#){outline:var(--_focus-outline,none)}
  .xysyzu8:not(#\#):not(#\#){overflow:auto}
  .x7giv3:not(#\#):not(#\#){overflow:clip}
  .xb3r6kr:not(#\#):not(#\#){overflow:hidden}
  .x1rea2x4:not(#\#):not(#\#){overflow:visible}
  .xish69e:not(#\#):not(#\#){overscroll-behavior:contain}
  .xt970qd:not(#\#):not(#\#){padding-block:0}
  .xsmncjp:not(#\#):not(#\#){padding-block:calc((var(--size-element-lg) - max(min(var(--spacing-5),max(var(--size-element-lg) - 2 * var(--border-width),1.5em)),20px,1rem) - 2 * var(--border-width)) / 2)}
  .xj646f7:not(#\#):not(#\#){padding-block:calc((var(--size-element-md) - max(min(var(--spacing-5),max(var(--size-element-md) - 2 * var(--border-width),1.5em)),20px,1rem) - 2 * var(--border-width)) / 2)}
  .x9ccq01:not(#\#):not(#\#){padding-block:calc((var(--size-element-sm) - max(min(var(--spacing-5),max(var(--size-element-sm) - 2 * var(--border-width),1.5em)),20px,1rem) - 2 * var(--border-width)) / 2)}
  .x1x7cmac:not(#\#):not(#\#){padding-block:calc(var(--spacing-1) - 1px)}
  .xwo4yc8:not(#\#):not(#\#){padding-block:calc(var(--tree-list-row-gap,0px) / 2)}
  .x13f7esw:not(#\#):not(#\#){padding-block:var(--spacing-0-5)}
  .x1hp7d8q:not(#\#):not(#\#){padding-block:var(--spacing-0)}
  .x1vofgu7:not(#\#):not(#\#){padding-block:var(--spacing-1-5)}
  .xu0wf1k:not(#\#):not(#\#){padding-block:var(--spacing-1)}
  .xce4md1:not(#\#):not(#\#){padding-block:var(--spacing-2)}
  .x8o8v82:not(#\#):not(#\#){padding-block:var(--spacing-3)}
  .x1na6nto:not(#\#):not(#\#){padding-block:var(--spacing-4)}
  .xq6koh6:not(#\#):not(#\#){padding-block:var(--spacing-6)}
  .xmfvnks:not(#\#):not(#\#){padding-block:var(--spacing-8)}
  .x1giekp1:not(#\#):not(#\#){padding-block:var(--x-paddingBlock)}
  .x1uameg1:not(#\#):not(#\#){padding-block:calc((6 * 44px - 28px) / 2)}
  .xnjsko4:not(#\#):not(#\#){padding-inline:0}
  .xx2oswg:not(#\#):not(#\#){padding-inline:calc(var(--spacing-1) - 1px)}
  .x2hg6jq:not(#\#):not(#\#){padding-inline:calc(var(--spacing-1) + var(--border-width))}
  .xaip428:not(#\#):not(#\#){padding-inline:var(--_item-inset-inline)}
  .x1kpkw9v:not(#\#):not(#\#){padding-inline:var(--_tab-strip-bleed)}
  .x1w6f3ag:not(#\#):not(#\#){padding-inline:var(--_textarea-inline-padding)}
  .xkjnx3w:not(#\#):not(#\#){padding-inline:var(--spacing-0-5)}
  .x17a0aqu:not(#\#):not(#\#){padding-inline:var(--spacing-0)}
  .x4ezzuc:not(#\#):not(#\#){padding-inline:var(--spacing-1-5)}
  .x7a5moj:not(#\#):not(#\#){padding-inline:var(--spacing-1)}
  .xixulwi:not(#\#):not(#\#){padding-inline:var(--spacing-10)}
  .xf314gf:not(#\#):not(#\#){padding-inline:var(--spacing-2)}
  .xrrkdod:not(#\#):not(#\#){padding-inline:var(--spacing-3)}
  .x1pzlopt:not(#\#):not(#\#){padding-inline:var(--spacing-4)}
  .xzz68wx:not(#\#):not(#\#){padding-inline:var(--spacing-5)}
  .xm7rs69:not(#\#):not(#\#){padding-inline:var(--spacing-6)}
  .x6xnjw4:not(#\#):not(#\#){padding-inline:var(--spacing-8)}
  .x30g6up:not(#\#):not(#\#){padding-inline:var(--x-paddingInline)}
  .x1ku5rj1:not(#\#):not(#\#){place-items:center}
  .x1xif8ns:not(#\#):not(#\#){scroll-padding-inline:calc(var(--_tab-strip-bleed) + var(--spacing-8))}
  .xdf8p4l:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-0-5)}
  .x9lgdif:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-0)}
  .x1w8vatw:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-1-5)}
  .x1u2972t:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-1)}
  .xw959t8:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-10)}
  .x1mfb6cv:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-2)}
  .xpnzzb2:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-3)}
  .x3m3szd:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-4)}
  .x1vx7sv0:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-5)}
  .x1mvw9yj:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-6)}
  .x1xn2tv3:not(#\#):not(#\#){scroll-padding-inline:var(--spacing-8)}
  .xhfbhpw:not(#\#):not(#\#){scroll-snap-type:x mandatory}
  .x168l2et:not(#\#):not(#\#){scroll-snap-type:y mandatory}
  .xmqliwb:not(#\#):not(#\#){text-decoration:line-through}
  .x1hl2dhg:not(#\#):not(#\#){text-decoration:none}
  .x1bvjpef:not(#\#):not(#\#){text-decoration:underline}
  .xrg7dcy:not(#\#):not(#\#){transition:box-shadow var(--duration-fast) var(--ease-standard),border-color var(--duration-fast) var(--ease-standard)}
  .xb0j27v:not(#\#):not(#\#){transition:grid-template-rows var(--duration-medium) var(--ease-standard)}
  .xq2gx43:not(#\#):not(#\#){transition:none}
  .x1ey1afo:not(#\#):not(#\#){transition:opacity var(--duration-fast)}
  .x1ob6yzd:not(#\#):not(#\#){transition:transform var(--duration-fast) var(--ease-standard)}
  .x6q1khz:focus-within:not(#\#):not(#\#){border-color:var(--color-accent)}
  .xk2sxw7:focus-within:not(#\#):not(#\#){border-color:var(--color-error)}
  .xyq33ac:focus-within:not(#\#):not(#\#){border-color:var(--color-success)}
  .xa1yw2k:focus-within:not(#\#):not(#\#){border-color:var(--color-warning)}
  .xafswnp.xafswnp:where(.x1iwu4tg:has(:focus-visible) *):not(#\#):not(#\#){outline:var(--focus-outline-width) var(--focus-outline-style) var(--focus-outline-color)}
  .x1dordxg:focus-within:not(#\#):not(#\#){overflow:visible}
  .xb0m1lw:has(> div > .astryx-layout-content):not(#\#):not(#\#){margin-inline:0}
  .x16s19ga:has(:focus-visible):not(#\#):not(#\#){outline:var(--focus-outline-width) var(--focus-outline-style) var(--focus-outline-color)}
  .xf0xpto:placeholder-shown:not(#\#):not(#\#){flex:0 0 auto}
  .x64lkcz:focus:not(#\#):not(#\#){border-color:var(--color-error)}
  .x1lglk5v:focus:not(#\#):not(#\#){border-color:var(--color-success)}
  .x12sck4v:focus:not(#\#):not(#\#){border-color:var(--color-warning)}
  .x1uvtmcs:focus:not(#\#):not(#\#){outline:none}
  .xomzh7y:focus:not(#\#):not(#\#){overflow:visible}
  .xh2mrf5:focus:not(#\#):not(#\#){padding-block:var(--spacing-2)}
  .x1cf3d6k:focus:not(#\#):not(#\#){padding-inline:var(--spacing-4)}
  @media (forced-colors: active){.x1w1tqly.x1w1tqly:not(#\#):not(#\#){border-color:CanvasText}}
  @media (forced-colors: active){.xmnqt3w.xmnqt3w:not(#\#):not(#\#){border-color:GrayText}}
  @media (forced-colors: active){.xx61lck.xx61lck:not(#\#):not(#\#){border-style:solid}}
  @media (forced-colors: active){.x13rsnn2.x13rsnn2:not(#\#):not(#\#){border-width:1px}}
  @media (max-width: 480px){.x1a1jff.x1a1jff:not(#\#):not(#\#){gap:var(--spacing-4)}}
  @media (prefers-reduced-motion: reduce){.x9kvfbb.x9kvfbb:not(#\#):not(#\#){transition:none}}
  @media (hover: hover){.x1ozl1p1.x1ozl1p1.x1ozl1p1:where(.x1odsvnm:hover *):not(#\#):not(#\#){border-color:color-mix(in srgb,var(--color-accent),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.xilc7fp.xilc7fp.xilc7fp:where(.x1odsvnm:hover *):not(#\#):not(#\#){border-color:color-mix(in srgb,var(--color-border-emphasized),var(--color-tint-hover) 20%)}}
  @media (hover: hover){.x61roa7.x61roa7.x61roa7:where(.x1odsvnm:hover *):not(#\#):not(#\#){border-color:var(--color-border)}}
  @media (hover: hover){.x1xwh4np.x1xwh4np.x1xwh4np:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#){border-color:var(--color-border-emphasized)}}
  @media (hover: hover){.x13nosk6.x13nosk6.x13nosk6:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#){text-decoration:underline}}
  .x1lugfcp:not(#\#):not(#\#):not(#\#){-webkit-appearance:none}
  .x67t5t6:not(#\#):not(#\#):not(#\#){-webkit-backdrop-filter:blur(12px)}
  .x1ua5tub:not(#\#):not(#\#):not(#\#){-webkit-box-orient:vertical}
  .x1yhjpo9:not(#\#):not(#\#):not(#\#){-webkit-line-clamp:var(--x-WebkitLineClamp)}
  .xiy8rlo:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 24px)}
  .x1bv1mxo:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 36px)}
  .xo9xo30:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 48px)}
  .xt2iwb0:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(transparent,transparent)}
  .x5lxg6s:not(#\#):not(#\#):not(#\#){-webkit-overflow-scrolling:touch}
  .x1i10hfl:not(#\#):not(#\#):not(#\#){-webkit-tap-highlight-color:transparent}
  .xg7jpbn:not(#\#):not(#\#):not(#\#){-webkit-text-fill-color:transparent}
  .xpdipgo:not(#\#):not(#\#):not(#\#){-webkit-touch-callout:none}
  .x1winvzj:not(#\#):not(#\#):not(#\#){-webkit-user-select:none}
  .x8gbvx8:not(#\#):not(#\#):not(#\#){align-content:flex-start}
  .x1pha0wt:not(#\#):not(#\#):not(#\#){align-items:baseline}
  .x6s0dn4:not(#\#):not(#\#):not(#\#){align-items:center}
  .xpqajaz:not(#\#):not(#\#):not(#\#){align-items:end}
  .xuk3077:not(#\#):not(#\#):not(#\#){align-items:flex-end}
  .x1cy8zhl:not(#\#):not(#\#):not(#\#){align-items:flex-start}
  .xaz6w31:not(#\#):not(#\#):not(#\#){align-items:last baseline}
  .x7a106z:not(#\#):not(#\#):not(#\#){align-items:start}
  .x1qjc9v5:not(#\#):not(#\#):not(#\#){align-items:stretch}
  .xoi2r2e:not(#\#):not(#\#):not(#\#){align-self:baseline}
  .xamitd3:not(#\#):not(#\#):not(#\#){align-self:center}
  .xpvyfi4:not(#\#):not(#\#):not(#\#){align-self:flex-end}
  .xqcrz7y:not(#\#):not(#\#):not(#\#){align-self:flex-start}
  .x1y8v6su:not(#\#):not(#\#):not(#\#){align-self:start}
  .xkh2ocl:not(#\#):not(#\#):not(#\#){align-self:stretch}
  .x7dpabl:not(#\#):not(#\#):not(#\#){anchor-name:--outline-active}
  .x17yabm6:not(#\#):not(#\#):not(#\#){animation-delay:var(--duration-medium-min)}
  .xvo38ju:not(#\#):not(#\#):not(#\#){animation-delay:var(--x-animationDelay)}
  .xpz12be:not(#\#):not(#\#):not(#\#){animation-direction:alternate}
  .xmg6eyc:not(#\#):not(#\#):not(#\#){animation-duration:1.5s}
  .xjlvqhv:not(#\#):not(#\#):not(#\#){animation-duration:1ms}
  .x1c74tu6:not(#\#):not(#\#):not(#\#){animation-duration:2s}
  .xwms9i0:not(#\#):not(#\#):not(#\#){animation-duration:auto}
  .x9uej1z:not(#\#):not(#\#):not(#\#){animation-duration:var(--duration-fast-max)}
  .xb2rp9n:not(#\#):not(#\#):not(#\#){animation-duration:var(--duration-fast)}
  .xqgcaz:not(#\#):not(#\#):not(#\#){animation-duration:var(--duration-medium-max)}
  .x12wqnr7:not(#\#):not(#\#):not(#\#){animation-duration:var(--duration-medium)}
  .x14qxm4i:not(#\#):not(#\#):not(#\#){animation-duration:var(--duration-slow-min)}
  .xskzprw:not(#\#):not(#\#):not(#\#){animation-fill-mode:backwards}
  .x1u6ievf:not(#\#):not(#\#):not(#\#){animation-fill-mode:both}
  .x10e4vud:not(#\#):not(#\#):not(#\#){animation-fill-mode:forwards}
  .xa4qsjk:not(#\#):not(#\#):not(#\#){animation-iteration-count:infinite}
  .x1ewfqum:not(#\#):not(#\#):not(#\#){animation-name:x11lauxq-B}
  .xcx56e2:not(#\#):not(#\#):not(#\#){animation-name:x13kz0yu-B}
  .x1ffowhz:not(#\#):not(#\#):not(#\#){animation-name:x188b6p3-B}
  .xqcmdr3:not(#\#):not(#\#):not(#\#){animation-name:x18re5ia-B}
  .x3psbcj:not(#\#):not(#\#):not(#\#){animation-name:x1ahk7ht-B}
  .x1dvww92:not(#\#):not(#\#):not(#\#){animation-name:x1b6yrix-B}
  .x97zbip:not(#\#):not(#\#):not(#\#){animation-name:x1k48ry3-B}
  .x1nlxm0d:not(#\#):not(#\#):not(#\#){animation-name:x1wbvqyn-B}
  .x1gbn2au:not(#\#):not(#\#):not(#\#){animation-name:x1xhkexc-B}
  .xeuoslp:not(#\#):not(#\#):not(#\#){animation-name:xgnty7z-B}
  .x1srr2gu:not(#\#):not(#\#):not(#\#){animation-name:xiylxmw-B}
  .xozk8ic:not(#\#):not(#\#):not(#\#){animation-name:xr3m334-B}
  .x1mta51n:not(#\#):not(#\#):not(#\#){animation-name:xtut5q7-B}
  .xck01x9:not(#\#):not(#\#):not(#\#){animation-name:xu7jd1z-B}
  .xl1vlw0:not(#\#):not(#\#):not(#\#){animation-name:xv1hr86-B}
  .x1i331go:not(#\#):not(#\#):not(#\#){animation-name:xwmkjkf-B}
  .x190lv1:not(#\#):not(#\#):not(#\#){animation-timeline:view(y)}
  .x4hg4is:not(#\#):not(#\#):not(#\#){animation-timing-function:ease-in-out}
  .x1esw782:not(#\#):not(#\#):not(#\#){animation-timing-function:linear}
  .x193epu2:not(#\#):not(#\#):not(#\#){animation-timing-function:steps(10,end)}
  .x128ha8g:not(#\#):not(#\#):not(#\#){animation-timing-function:var(--ease-standard)}
  .xjyslct:not(#\#):not(#\#):not(#\#){appearance:none}
  .x1plog1:not(#\#):not(#\#):not(#\#){aspect-ratio:1}
  .xioom0i:not(#\#):not(#\#):not(#\#){aspect-ratio:var(--button-icon-only-aspect)}
  .x10y9f9r:not(#\#):not(#\#):not(#\#){aspect-ratio:var(--x-aspectRatio)}
  .xvn2z4z:not(#\#):not(#\#):not(#\#){backdrop-filter:blur(12px)}
  .xlp1x4z:not(#\#):not(#\#):not(#\#){backface-visibility:hidden}
  .xx83zyx:not(#\#):not(#\#):not(#\#){background-clip:padding-box}
  .x1rkw3yq:not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,white 60%,transparent)}
  .xgcd1z6:not(#\#):not(#\#):not(#\#){background-color:inherit}
  .xcpsgoo:not(#\#):not(#\#):not(#\#){background-color:rgba(0,0,0,.5)}
  .xjbqb8w:not(#\#):not(#\#):not(#\#){background-color:transparent}
  .xgcxg3y:not(#\#):not(#\#):not(#\#){background-color:var(--color-accent-muted)}
  .x1ewilqj:not(#\#):not(#\#):not(#\#){background-color:var(--color-accent)}
  .x1o0wnni:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-blue)}
  .x1eiddq6:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-body)}
  .x1de1mus:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-card)}
  .x1rgj867:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-cyan)}
  .x1l5t2a3:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-error-inverted)}
  .xspzpui:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-gray)}
  .x1sqjeoo:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-green)}
  .xenstv7:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-inverted)}
  .xwmxj5m:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-muted)}
  .x1e9xt6e:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-orange)}
  .xnpoty2:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-pink)}
  .x1prclbq:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-popover)}
  .x16i6n6f:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-purple)}
  .x1cibrc5:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-red)}
  .x10xzikg:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-surface)}
  .x1jtji5o:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-teal)}
  .x1bo7t0x:not(#\#):not(#\#):not(#\#){background-color:var(--color-background-yellow)}
  .x7njt3n:not(#\#):not(#\#):not(#\#){background-color:var(--color-border-emphasized)}
  .x1m4xfpy:not(#\#):not(#\#):not(#\#){background-color:var(--color-border)}
  .x1pritpl:not(#\#):not(#\#):not(#\#){background-color:var(--color-error-muted)}
  .x1pjz0fi:not(#\#):not(#\#):not(#\#){background-color:var(--color-error)}
  .xowkcby:not(#\#):not(#\#):not(#\#){background-color:var(--color-icon-primary)}
  .x1q5y3ey:not(#\#):not(#\#):not(#\#){background-color:var(--color-icon-secondary)}
  .x17x4s8c:not(#\#):not(#\#):not(#\#){background-color:var(--color-neutral)}
  .x1azo05:not(#\#):not(#\#):not(#\#){background-color:var(--color-on-accent)}
  .xfba6wv:not(#\#):not(#\#):not(#\#){background-color:var(--color-on-error)}
  .x9mohwv:not(#\#):not(#\#):not(#\#){background-color:var(--color-on-success)}
  .xmgwp2l:not(#\#):not(#\#):not(#\#){background-color:var(--color-on-warning)}
  .x1lmrjuc:not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-hover)}
  .xi89dp7:not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-pressed)}
  .x1u4601x:not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay)}
  .xprdx6m:not(#\#):not(#\#):not(#\#){background-color:var(--color-skeleton)}
  .xu13z74:not(#\#):not(#\#):not(#\#){background-color:var(--color-success-muted)}
  .xdsz4j9:not(#\#):not(#\#):not(#\#){background-color:var(--color-success)}
  .xjqijk9:not(#\#):not(#\#):not(#\#){background-color:var(--color-syntax-added)}
  .xzyc27v:not(#\#):not(#\#):not(#\#){background-color:var(--color-syntax-background)}
  .x11ds9ch:not(#\#):not(#\#):not(#\#){background-color:var(--color-syntax-diff-header)}
  .xv48ua2:not(#\#):not(#\#):not(#\#){background-color:var(--color-syntax-removed)}
  .x16fr6go:not(#\#):not(#\#):not(#\#){background-color:var(--color-text-disabled)}
  .x19aspcf:not(#\#):not(#\#):not(#\#){background-color:var(--color-text-primary)}
  .xdomwnj:not(#\#):not(#\#):not(#\#){background-color:var(--color-text-secondary)}
  .xdsb6cv:not(#\#):not(#\#):not(#\#){background-color:var(--color-track)}
  .x24i8r5:not(#\#):not(#\#):not(#\#){background-color:var(--color-warning-muted)}
  .x1q8g9m5:not(#\#):not(#\#):not(#\#){background-color:var(--color-warning)}
  .x1fd97le:not(#\#):not(#\#):not(#\#){background-color:var(--table-sticky-background,var(--color-background-card))}
  .xl8spv7:not(#\#):not(#\#):not(#\#){background-color:var(--x-backgroundColor)}
  .xafqdz2:not(#\#):not(#\#):not(#\#){background-image:linear-gradient(to bottom,var(--color-background-surface) 60%,transparent)}
  .x1vrk509:not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-background-muted),var(--color-background-muted))}
  .x14bno8m:not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-neutral),var(--color-neutral))}
  .xpl5ynk:not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed))}
  .x18o3ruo:not(#\#):not(#\#):not(#\#){background-image:none}
  .x1mwwwfo:not(#\#):not(#\#):not(#\#){border-collapse:collapse}
  .x16uus16:not(#\#):not(#\#):not(#\#){border-end-end-radius:0}
  .x1eprgri:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--_banner-radius,var(--radius-container))}
  .x6k0y1c:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--_chat-composer-radius)}
  .xoao14b:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--_field-radius)}
  .x14i3lts:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--radius-element)}
  .x1dgc8on:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--radius-full)}
  .x1whkvtz:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--radius-inner)}
  .xbiv7yw:not(#\#):not(#\#):not(#\#){border-end-start-radius:0}
  .x1k5g1gk:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--_banner-radius,var(--radius-container))}
  .xkvxy4d:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--_chat-composer-radius)}
  .xquck67:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--radius-element)}
  .x1wc3881:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--radius-full)}
  .xrfs2vl:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--radius-inner)}
  .xl0t3rv:not(#\#):not(#\#):not(#\#){border-inline-end-color:var(--color-border-emphasized)}
  .x1gejf6u:not(#\#):not(#\#):not(#\#){border-inline-end-color:var(--color-border)}
  .x18b5jzi:not(#\#):not(#\#):not(#\#){border-inline-end-style:solid}
  .x1lun4ml:not(#\#):not(#\#):not(#\#){border-inline-end-width:1px}
  .xw8tdv1:not(#\#):not(#\#):not(#\#){border-inline-end-width:var(--border-width)}
  .x14ydlgx:not(#\#):not(#\#):not(#\#){border-inline-start-color:var(--color-border-emphasized)}
  .x1j92z86:not(#\#):not(#\#):not(#\#){border-inline-start-color:var(--color-border)}
  .xrvmtm5:not(#\#):not(#\#):not(#\#){border-inline-start-color:var(--color-on-accent)}
  .x1t7ytsu:not(#\#):not(#\#):not(#\#){border-inline-start-style:solid}
  .xpilrb4:not(#\#):not(#\#):not(#\#){border-inline-start-width:1px}
  .xgbv0en:not(#\#):not(#\#):not(#\#){border-inline-start-width:var(--border-width)}
  .xtpqe59:not(#\#):not(#\#):not(#\#){border-inline-start-width:var(--spacing-0-5)}
  .x1gukg7c:not(#\#):not(#\#):not(#\#){border-spacing:0}
  .x1ga7v0g:not(#\#):not(#\#):not(#\#){border-start-end-radius:0}
  .x13nour3:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--_banner-radius,var(--radius-container))}
  .xzc3kxz:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--_chat-composer-radius)}
  .x1g2gkjz:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--_field-radius)}
  .xg0tfu:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-chat)}
  .x7hs6f1:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-container)}
  .x8agd5o:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-full)}
  .x126per9:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-inner)}
  .x15mokao:not(#\#):not(#\#):not(#\#){border-start-start-radius:0}
  .xwxb7qi:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--_banner-radius,var(--radius-container))}
  .xy7p8pm:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--_chat-composer-radius)}
  .x1n70msy:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-chat)}
  .x81l70g:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-container)}
  .x19415el:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-full)}
  .x3qb8m:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-inner)}
  .x183tx6i:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-page)}
  .x1lp15jv:not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 1px var(--color-border-emphasized)}
  .x1er153n:not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 1px var(--color-border)}
  .x1iobdd1:not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 1px var(--color-text-primary)}
  .x1gnnqk1:not(#\#):not(#\#):not(#\#){box-shadow:none}
  .x1p8z4y0:not(#\#):not(#\#):not(#\#){box-shadow:var(--_card-ring,0 0 transparent),var(--_card-elevation,0 0 transparent)}
  .x1kcpxr7:not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-high)}
  .x1i5ehqx:not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-low)}
  .x14hfi27:not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-med)}
  .x9f619:not(#\#):not(#\#):not(#\#){box-sizing:border-box}
  .x1afcbsf:not(#\#):not(#\#):not(#\#){box-sizing:content-box}
  .xbuiw85:not(#\#):not(#\#):not(#\#){caret-color:transparent}
  .xxugrtn:not(#\#):not(#\#):not(#\#){caret-color:var(--color-accent)}
  .x13hy1yx:not(#\#):not(#\#):not(#\#){clip-path:inset(0 0 0 max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))))}
  .x1yxrbr4:not(#\#):not(#\#):not(#\#){clip-path:inset(0 0 max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))) 0)}
  .x17qoqre:not(#\#):not(#\#):not(#\#){clip-path:inset(0 max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))) 0 0)}
  .x1hyvwdk:not(#\#):not(#\#):not(#\#){clip-path:inset(50%)}
  .x1eyou77:not(#\#):not(#\#):not(#\#){clip-path:inset(max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))) 0 0 0)}
  .xzpqnlu:not(#\#):not(#\#):not(#\#){clip:rect(0,0,0,0)}
  .xntwwlm:not(#\#):not(#\#):not(#\#){color-scheme:dark}
  .x108lcm5:not(#\#):not(#\#):not(#\#){color-scheme:light dark}
  .x19aimcq:not(#\#):not(#\#):not(#\#){color-scheme:light}
  .xj8ax7g:not(#\#):not(#\#):not(#\#){color:#FF0000}
  .x1heor9g:not(#\#):not(#\#):not(#\#){color:inherit}
  .x19co3pv:not(#\#):not(#\#):not(#\#){color:transparent}
  .x1gb3s7i:not(#\#):not(#\#):not(#\#){color:var(--_item-description-color,var(--color-text-secondary))}
  .x5tbw38:not(#\#):not(#\#):not(#\#){color:var(--_item-label-color,var(--color-text-primary))}
  .xqwr325:not(#\#):not(#\#):not(#\#){color:var(--color-accent)}
  .xrkvqaz:not(#\#):not(#\#):not(#\#){color:var(--color-background-surface)}
  .xjt36v0:not(#\#):not(#\#):not(#\#){color:var(--color-error)}
  .x1fns2mt:not(#\#):not(#\#):not(#\#){color:var(--color-icon-blue)}
  .x157w0xa:not(#\#):not(#\#):not(#\#){color:var(--color-icon-cyan)}
  .xqa6c3m:not(#\#):not(#\#):not(#\#){color:var(--color-icon-disabled)}
  .x1eyinzz:not(#\#):not(#\#):not(#\#){color:var(--color-icon-gray)}
  .xmxeech:not(#\#):not(#\#):not(#\#){color:var(--color-icon-green)}
  .xxu74a4:not(#\#):not(#\#):not(#\#){color:var(--color-icon-orange)}
  .x1kxxfg5:not(#\#):not(#\#):not(#\#){color:var(--color-icon-pink)}
  .xtbr613:not(#\#):not(#\#):not(#\#){color:var(--color-icon-primary)}
  .xzdw94u:not(#\#):not(#\#):not(#\#){color:var(--color-icon-purple)}
  .xeffzf7:not(#\#):not(#\#):not(#\#){color:var(--color-icon-red)}
  .xv9yike:not(#\#):not(#\#):not(#\#){color:var(--color-icon-secondary)}
  .x1f3zxcb:not(#\#):not(#\#):not(#\#){color:var(--color-icon-teal)}
  .x1g6zdft:not(#\#):not(#\#):not(#\#){color:var(--color-icon-yellow)}
  .x17wrial:not(#\#):not(#\#):not(#\#){color:var(--color-on-accent)}
  .x9e3rv5:not(#\#):not(#\#):not(#\#){color:var(--color-on-dark)}
  .x1m024r3:not(#\#):not(#\#):not(#\#){color:var(--color-on-error)}
  .xri61p4:not(#\#):not(#\#):not(#\#){color:var(--color-on-success)}
  .xrebv38:not(#\#):not(#\#):not(#\#){color:var(--color-on-warning)}
  .xtjic6:not(#\#):not(#\#):not(#\#){color:var(--color-success)}
  .x1wxerb0:not(#\#):not(#\#):not(#\#){color:var(--color-syntax-added-marker)}
  .x1mjzq1q:not(#\#):not(#\#):not(#\#){color:var(--color-syntax-comment)}
  .xt5rlkq:not(#\#):not(#\#):not(#\#){color:var(--color-syntax-punctuation)}
  .x103bwea:not(#\#):not(#\#):not(#\#){color:var(--color-syntax-removed-marker)}
  .xdfisg:not(#\#):not(#\#):not(#\#){color:var(--color-syntax-variable)}
  .xjse4m1:not(#\#):not(#\#):not(#\#){color:var(--color-text-accent)}
  .x1vvqiwl:not(#\#):not(#\#):not(#\#){color:var(--color-text-blue)}
  .x1txnczv:not(#\#):not(#\#):not(#\#){color:var(--color-text-cyan)}
  .xnbbluu:not(#\#):not(#\#):not(#\#){color:var(--color-text-disabled)}
  .xru1t7f:not(#\#):not(#\#):not(#\#){color:var(--color-text-gray)}
  .xltfdvo:not(#\#):not(#\#):not(#\#){color:var(--color-text-green)}
  .xm47u9q:not(#\#):not(#\#):not(#\#){color:var(--color-text-orange)}
  .xiuofww:not(#\#):not(#\#):not(#\#){color:var(--color-text-pink)}
  .x1tgivj0:not(#\#):not(#\#):not(#\#){color:var(--color-text-primary)}
  .x1m9wyeb:not(#\#):not(#\#):not(#\#){color:var(--color-text-purple)}
  .x1joocv1:not(#\#):not(#\#):not(#\#){color:var(--color-text-red)}
  .xv1l7n4:not(#\#):not(#\#):not(#\#){color:var(--color-text-secondary)}
  .x9x0lbs:not(#\#):not(#\#):not(#\#){color:var(--color-text-teal)}
  .xdhq94a:not(#\#):not(#\#):not(#\#){color:var(--color-text-yellow)}
  .xs3pv69:not(#\#):not(#\#):not(#\#){color:var(--color-warning)}
  .x14rh7hd:not(#\#):not(#\#):not(#\#){color:var(--x-color)}
  .x1o1pmfc:not(#\#):not(#\#):not(#\#){column-gap:0}
  .xf5zn4v:not(#\#):not(#\#):not(#\#){column-gap:calc(var(--spacing-3) + var(--border-width) + var(--spacing-4))}
  .x1kihgfc:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-0-5)}
  .x1o57wo1:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-0)}
  .x1thn6ci:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-1-5)}
  .x1lfs0n9:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-1)}
  .x1p37tyl:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-10)}
  .xak3so:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-2)}
  .xewh9hi:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-3)}
  .xty4p9g:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-4)}
  .x1eqhezk:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-5)}
  .x3qlgwd:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-6)}
  .xicv188:not(#\#):not(#\#):not(#\#){column-gap:var(--spacing-8)}
  .xawy1a7:not(#\#):not(#\#):not(#\#){contain:layout style}
  .x12h1iku:not(#\#):not(#\#):not(#\#){container-type:inline-size}
  .xb5mbof:not(#\#):not(#\#):not(#\#){content-visibility:auto}
  .xfrknyr:not(#\#):not(#\#):not(#\#){counter-increment:astryx-list}
  .xif0320:not(#\#):not(#\#):not(#\#){counter-reset:astryx-list}
  .x1khind5:not(#\#):not(#\#):not(#\#){counter-reset:var(--x-counterReset)}
  .xicojor:not(#\#):not(#\#):not(#\#){cursor:col-resize}
  .xt0e3qv:not(#\#):not(#\#):not(#\#){cursor:default}
  .x7eptgl:not(#\#):not(#\#):not(#\#){cursor:ew-resize}
  .x1jm3nie:not(#\#):not(#\#):not(#\#){cursor:grab}
  .xi9pz9s:not(#\#):not(#\#):not(#\#){cursor:grabbing}
  .xmper1u:not(#\#):not(#\#):not(#\#){cursor:inherit}
  .x1ypdohk:not(#\#):not(#\#):not(#\#){cursor:pointer}
  .xyozgr7:not(#\#):not(#\#):not(#\#){cursor:row-resize}
  .x1ed109x:not(#\#):not(#\#):not(#\#){cursor:text}
  .x1huxd7x:not(#\#):not(#\#):not(#\#){cursor:zoom-in}
  .x104kibb:not(#\#):not(#\#):not(#\#){display:-webkit-box}
  .x1lliihq:not(#\#):not(#\#):not(#\#){display:block}
  .xjp7ctv:not(#\#):not(#\#):not(#\#){display:contents}
  .x78zum5:not(#\#):not(#\#):not(#\#){display:flex}
  .xufnvkl:not(#\#):not(#\#):not(#\#){display:flow-root}
  .xrvj5dj:not(#\#):not(#\#):not(#\#){display:grid}
  .x1rg5ohu:not(#\#):not(#\#):not(#\#){display:inline-block}
  .x3nfvp2:not(#\#):not(#\#):not(#\#){display:inline-flex}
  .xwz0xwf:not(#\#):not(#\#):not(#\#){display:inline-grid}
  .xt0psk2:not(#\#):not(#\#):not(#\#){display:inline}
  .x1s85apg:not(#\#):not(#\#):not(#\#){display:none}
  .x11ke7fs:not(#\#):not(#\#):not(#\#){display:var(--separator-display)}
  .xbh8q5q:not(#\#):not(#\#):not(#\#){fill:none}
  .x1r8uery:not(#\#):not(#\#):not(#\#){flex-basis:0}
  .xrjwirl:not(#\#):not(#\#):not(#\#){flex-basis:196px}
  .xjpgo6f:not(#\#):not(#\#):not(#\#){flex-basis:200px}
  .xchdapg:not(#\#):not(#\#):not(#\#){flex-basis:300px}
  .xgualba:not(#\#):not(#\#):not(#\#){flex-basis:8rem}
  .xdl72j9:not(#\#):not(#\#):not(#\#){flex-basis:auto}
  .x3ieub6:not(#\#):not(#\#):not(#\#){flex-direction:column-reverse}
  .xdt5ytf:not(#\#):not(#\#):not(#\#){flex-direction:column}
  .x15zctf7:not(#\#):not(#\#):not(#\#){flex-direction:row-reverse}
  .x1q0g3np:not(#\#):not(#\#):not(#\#){flex-direction:row}
  .x1c4vz4f:not(#\#):not(#\#):not(#\#){flex-grow:0}
  .x1iyjqo2:not(#\#):not(#\#):not(#\#){flex-grow:1}
  .xgyuaek:not(#\#):not(#\#):not(#\#){flex-grow:2}
  .x2lah0s:not(#\#):not(#\#):not(#\#){flex-shrink:0}
  .xs83m0k:not(#\#):not(#\#):not(#\#){flex-shrink:1}
  .x1g3ib7:not(#\#):not(#\#):not(#\#){flex-shrink:10}
  .xozqiw3:not(#\#):not(#\#):not(#\#){flex-wrap:nowrap}
  .x8hhl5t:not(#\#):not(#\#):not(#\#){flex-wrap:wrap-reverse}
  .x1a02dak:not(#\#):not(#\#):not(#\#){flex-wrap:wrap}
  .xjb2p0i:not(#\#):not(#\#):not(#\#){font-family:inherit}
  .x9ynric:not(#\#):not(#\#):not(#\#){font-family:var(--font-family-body)}
  .x9m5x89:not(#\#):not(#\#):not(#\#){font-family:var(--font-family-code)}
  .x1g81bgm:not(#\#):not(#\#):not(#\#){font-family:var(--font-family-heading)}
  .xboafo0:not(#\#):not(#\#):not(#\#){font-size:.75rem}
  .x1603h9y:not(#\#):not(#\#):not(#\#){font-size:1.25rem}
  .xngnso2:not(#\#):not(#\#):not(#\#){font-size:1.5rem}
  .x1k6wstc:not(#\#):not(#\#):not(#\#){font-size:10px}
  .xfifm61:not(#\#):not(#\#):not(#\#){font-size:12px}
  .xif65rj:not(#\#):not(#\#):not(#\#){font-size:14px}
  .x1jchvi3:not(#\#):not(#\#):not(#\#){font-size:1rem}
  .x1qlqyl8:not(#\#):not(#\#):not(#\#){font-size:inherit}
  .xhs0kqb:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-2xl)}
  .x16a80zy:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-2xs)}
  .x10srzze:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-3xl)}
  .x10p7juq:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-3xs)}
  .xqcvi3d:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-4xl)}
  .xxc45ev:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-4xs)}
  .x1j29vfg:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-base)}
  .xc7cgfe:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-lg)}
  .x1eqnyfr:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-sm)}
  .x1wqms48:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-xl)}
  .x51wmvv:not(#\#):not(#\#):not(#\#){font-size:var(--font-size-xs)}
  .xho7bvi:not(#\#):not(#\#):not(#\#){font-size:var(--spacing-4)}
  .xjm74w1:not(#\#):not(#\#):not(#\#){font-size:var(--text-body-size)}
  .xp03k98:not(#\#):not(#\#):not(#\#){font-size:var(--text-code-size)}
  .xsub3ws:not(#\#):not(#\#):not(#\#){font-size:var(--text-display-1-size)}
  .x1yego12:not(#\#):not(#\#):not(#\#){font-size:var(--text-display-2-size)}
  .xlgnzhf:not(#\#):not(#\#):not(#\#){font-size:var(--text-display-3-size)}
  .xcg7oai:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-1-size)}
  .x1xvnhcw:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-2-size)}
  .xii13ha:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-3-size)}
  .x8tkxat:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-4-size)}
  .xsgqta0:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-5-size)}
  .xw5ohdf:not(#\#):not(#\#):not(#\#){font-size:var(--text-heading-6-size)}
  .xcr08ib:not(#\#):not(#\#):not(#\#){font-size:var(--text-label-size)}
  .x18juvz8:not(#\#):not(#\#):not(#\#){font-size:var(--text-large-size)}
  .x141an7d:not(#\#):not(#\#):not(#\#){font-size:var(--text-supporting-size)}
  .xdmh292:not(#\#):not(#\#):not(#\#){font-size:var(--x-fontSize)}
  .x1j61x8r:not(#\#):not(#\#):not(#\#){font-style:normal}
  .xss6m8b:not(#\#):not(#\#):not(#\#){font-variant-numeric:tabular-nums}
  .xk50ysn:not(#\#):not(#\#):not(#\#){font-weight:500}
  .x1s688f:not(#\#):not(#\#):not(#\#){font-weight:600}
  .x1pd3egz:not(#\#):not(#\#):not(#\#){font-weight:inherit}
  .x1lvx875:not(#\#):not(#\#):not(#\#){font-weight:var(--font-weight-bold)}
  .x1e4wzip:not(#\#):not(#\#):not(#\#){font-weight:var(--font-weight-medium)}
  .x1sodnla:not(#\#):not(#\#):not(#\#){font-weight:var(--font-weight-normal)}
  .x2mo6ok:not(#\#):not(#\#):not(#\#){font-weight:var(--font-weight-semibold)}
  .xxovm9e:not(#\#):not(#\#):not(#\#){font-weight:var(--text-body-weight)}
  .xx3eeay:not(#\#):not(#\#):not(#\#){font-weight:var(--text-code-weight)}
  .x1txul5o:not(#\#):not(#\#):not(#\#){font-weight:var(--text-display-1-weight)}
  .x1y36c3f:not(#\#):not(#\#):not(#\#){font-weight:var(--text-display-2-weight)}
  .x1on40hk:not(#\#):not(#\#):not(#\#){font-weight:var(--text-display-3-weight)}
  .x1v68xuy:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-1-weight)}
  .x12yy4cs:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-2-weight)}
  .x1jcxfy8:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-3-weight)}
  .x2hcmsi:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-4-weight)}
  .xno150v:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-5-weight)}
  .x1pw4frv:not(#\#):not(#\#):not(#\#){font-weight:var(--text-heading-6-weight)}
  .xmhvcl5:not(#\#):not(#\#):not(#\#){font-weight:var(--text-label-weight)}
  .x149oux8:not(#\#):not(#\#):not(#\#){font-weight:var(--text-large-weight)}
  .xv8on6e:not(#\#):not(#\#):not(#\#){font-weight:var(--text-supporting-weight)}
  .x1kzknox:not(#\#):not(#\#):not(#\#){forced-color-adjust:none}
  .xu6a5m6:not(#\#):not(#\#):not(#\#){grid-auto-columns:1fr}
  .x1mt1orb:not(#\#):not(#\#):not(#\#){grid-auto-flow:column}
  .xhij9v2:not(#\#):not(#\#):not(#\#){grid-auto-rows:var(--x-gridAutoRows)}
  .xcrlgei:not(#\#):not(#\#):not(#\#){grid-column-start:1}
  .x1agbcgv:not(#\#):not(#\#):not(#\#){grid-row-start:1}
  .xrnahuw:not(#\#):not(#\#):not(#\#){grid-template-columns:1ch 1fr}
  .x134kloy:not(#\#):not(#\#):not(#\#){grid-template-columns:1fr auto 1fr}
  .x52fmzj:not(#\#):not(#\#):not(#\#){grid-template-columns:1fr auto}
  .x1y6fwsi:not(#\#):not(#\#):not(#\#){grid-template-columns:1fr}
  .x1g3yg12:not(#\#):not(#\#):not(#\#){grid-template-columns:auto 1fr auto}
  .x1pmbctz:not(#\#):not(#\#):not(#\#){grid-template-columns:auto 1fr}
  .x1rkzygb:not(#\#):not(#\#):not(#\#){grid-template-columns:auto minmax(0,1fr)}
  .x1wthsqz:not(#\#):not(#\#):not(#\#){grid-template-columns:auto repeat(7,1fr)}
  .x1mzazjb:not(#\#):not(#\#):not(#\#){grid-template-columns:repeat(7,1fr)}
  .x189bvgu:not(#\#):not(#\#):not(#\#){grid-template-columns:repeat(auto-fill,minmax(280px,1fr))}
  .x1xx4m37:not(#\#):not(#\#):not(#\#){grid-template-columns:var(--_codeblock-gutter-width) 1fr}
  .x1v9b7p9:not(#\#):not(#\#):not(#\#){grid-template-columns:var(--_codeblock-gutter-width) auto 1fr}
  .xqketvx:not(#\#):not(#\#):not(#\#){grid-template-columns:var(--x-gridTemplateColumns)}
  .xihq33y:not(#\#):not(#\#):not(#\#){grid-template-rows:0fr}
  .x1tu4anv:not(#\#):not(#\#):not(#\#){grid-template-rows:1fr}
  .xy8nx85:not(#\#):not(#\#):not(#\#){grid-template-rows:repeat(6, 1fr)}
  .xxydokm:not(#\#):not(#\#):not(#\#){hyphens:manual}
  .xtijo5x:not(#\#):not(#\#):not(#\#){inset-inline-end:0}
  .xz03a8w:not(#\#):not(#\#):not(#\#){inset-inline-end:2px}
  .x13oyzgk:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--_textarea-inline-padding)}
  .xu9ngte:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--astryx-layer-inset-inline-end,0px)}
  .xy3asu9:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--spacing-1)}
  .x72tfeb:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--spacing-2)}
  .x1mcfs9z:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--spacing-3)}
  .xqxgn94:not(#\#):not(#\#):not(#\#){inset-inline-end:var(--x-insetInlineEnd)}
  .x1o0tod:not(#\#):not(#\#):not(#\#){inset-inline-start:0}
  .x9p6ekw:not(#\#):not(#\#):not(#\#){inset-inline-start:14px}
  .xaoy8p5:not(#\#):not(#\#):not(#\#){inset-inline-start:2px}
  .xbudbmw:not(#\#):not(#\#):not(#\#){inset-inline-start:50%}
  .xhi6v0a:not(#\#):not(#\#):not(#\#){inset-inline-start:auto}
  .xmt1zuk:not(#\#):not(#\#):not(#\#){inset-inline-start:calc(-1 * (var(--spacing-1) - 1px))}
  .x1kiyvbf:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--_textarea-inline-padding)}
  .xsrzrpt:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--astryx-layer-inset-inline-start,0px)}
  .x1mzz43t:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--spacing-1)}
  .x1ybfrjj:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--spacing-3)}
  .x1lxsm33:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--x-insetInlineStart)}
  .xc8icb0:not(#\#):not(#\#):not(#\#){isolation:isolate}
  .xl56j7k:not(#\#):not(#\#):not(#\#){justify-content:center}
  .x13a6bvl:not(#\#):not(#\#):not(#\#){justify-content:flex-end}
  .x1nhvcw1:not(#\#):not(#\#):not(#\#){justify-content:flex-start}
  .x1l1ennw:not(#\#):not(#\#):not(#\#){justify-content:space-around}
  .x1qughib:not(#\#):not(#\#):not(#\#){justify-content:space-between}
  .xaw8158:not(#\#):not(#\#):not(#\#){justify-content:space-evenly}
  .x1o2pa38:not(#\#):not(#\#):not(#\#){justify-items:center}
  .x4xo5sw:not(#\#):not(#\#):not(#\#){justify-items:end}
  .x619ttb:not(#\#):not(#\#):not(#\#){justify-items:start}
  .xl4xnwh:not(#\#):not(#\#):not(#\#){justify-items:stretch}
  .x7v7x1q:not(#\#):not(#\#):not(#\#){justify-self:center}
  .x1lqcxt8:not(#\#):not(#\#):not(#\#){justify-self:start}
  .x1i21sxh:not(#\#):not(#\#):not(#\#){letter-spacing:normal}
  .x14ju556:not(#\#):not(#\#):not(#\#){line-height:0}
  .xo5v014:not(#\#):not(#\#):not(#\#){line-height:1}
  .x19v9tvf:not(#\#):not(#\#):not(#\#){line-height:22px}
  .x15bjb6t:not(#\#):not(#\#):not(#\#){line-height:inherit}
  .xkwxim8:not(#\#):not(#\#):not(#\#){line-height:max(min(var(--spacing-5),max(var(--size-element-lg) - 2 * var(--border-width),1.5em)),20px,1rem)}
  .xe5am2i:not(#\#):not(#\#):not(#\#){line-height:max(min(var(--spacing-5),max(var(--size-element-md) - 2 * var(--border-width),1.5em)),20px,1rem)}
  .x1j3cc6x:not(#\#):not(#\#):not(#\#){line-height:max(min(var(--spacing-5),max(var(--size-element-sm) - 2 * var(--border-width),1.5em)),20px,1rem)}
  .x8vohu:not(#\#):not(#\#):not(#\#){line-height:max(var(--spacing-5),20px,1rem)}
  .x1ojctns:not(#\#):not(#\#):not(#\#){line-height:var(--spacing-4)}
  .x7acx1w:not(#\#):not(#\#):not(#\#){line-height:var(--spacing-5)}
  .xw6l6zx:not(#\#):not(#\#):not(#\#){line-height:var(--text-body-leading)}
  .x17iicif:not(#\#):not(#\#):not(#\#){line-height:var(--text-code-leading)}
  .x112ttwr:not(#\#):not(#\#):not(#\#){line-height:var(--text-display-1-leading)}
  .xh0iwvy:not(#\#):not(#\#):not(#\#){line-height:var(--text-display-2-leading)}
  .x1ujwuaq:not(#\#):not(#\#):not(#\#){line-height:var(--text-display-3-leading)}
  .xfmsba7:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-1-leading)}
  .x1cpk1wn:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-2-leading)}
  .xwjzt0u:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-3-leading)}
  .xqerer:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-4-leading)}
  .xo3gurs:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-5-leading)}
  .xeixjfn:not(#\#):not(#\#):not(#\#){line-height:var(--text-heading-6-leading)}
  .x1kq96og:not(#\#):not(#\#):not(#\#){line-height:var(--text-label-leading)}
  .xf74fhv:not(#\#):not(#\#):not(#\#){line-height:var(--text-large-leading)}
  .x1ltkj2j:not(#\#):not(#\#):not(#\#){line-height:var(--text-supporting-leading)}
  .x3ct3a4:not(#\#):not(#\#):not(#\#){list-style-type:none}
  .x14z9mp:not(#\#):not(#\#):not(#\#){margin-inline-end:0}
  .x11t971q:not(#\#):not(#\#):not(#\#){margin-inline-end:auto}
  .x1cphv78:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(-1 * min(var(--_item-inset-inline),var(--container-padding-inline-end,0px)))}
  .x1fcf3bl:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(-1 * var(--container-padding-inline-end,0px))}
  .x1kpg4um:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(-1 * var(--layout-padding-inner-x,var(--spacing-4)))}
  .xkd40ry:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(-1 * var(--spacing-1))}
  .x3kzqx6:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(-1 * var(--spacing-2))}
  .xmequkd:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(var(--spacing-1) * -1)}
  .xnur1sd:not(#\#):not(#\#):not(#\#){margin-inline-end:var(--spacing-1)}
  .x1pezmd8:not(#\#):not(#\#):not(#\#){margin-inline-end:var(--spacing-2)}
  .x1c9tiao:not(#\#):not(#\#):not(#\#){margin-inline-end:var(--x-marginInlineEnd)}
  .x1m9hk3x:not(#\#):not(#\#):not(#\#){margin-inline-end:var(--x3pzc91,calc(var(--spacing-4) + max(var(--astryx-layer-inset-inline-start, 0px), var(--astryx-layer-inset-inline-end, 0px))))}
  .xa3ewmy:not(#\#):not(#\#):not(#\#){margin-inline-end:calc(max(var(--spacing-4), env(safe-area-inset-left, 0px), env(safe-area-inset-right, 0px)) + max(var(--astryx-layer-inset-inline-start, 0px), var(--astryx-layer-inset-inline-end, 0px)))}
  .x1qfufaz:not(#\#):not(#\#):not(#\#){margin-inline-start:-8px}
  .x1lziwak:not(#\#):not(#\#):not(#\#){margin-inline-start:0}
  .xvc5jky:not(#\#):not(#\#):not(#\#){margin-inline-start:auto}
  .x1t1czy8:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(-1 * min(var(--_item-inset-inline),var(--container-padding-inline-start,0px)))}
  .xd10s4z:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(-1 * var(--border-width))}
  .xojxgvx:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(-1 * var(--container-padding-inline-start,0px))}
  .x1wim8z0:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(-1 * var(--layout-padding-inner-x,var(--spacing-4)))}
  .x1s1akpx:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(-1 * var(--spacing-2))}
  .x6n8pbd:not(#\#):not(#\#):not(#\#){margin-inline-start:calc((40px - min(var(--spacing-6),40px)) / 2 - var(--spacing-2))}
  .xs69w1r:not(#\#):not(#\#):not(#\#){margin-inline-start:calc((40px - min(var(--spacing-6),40px)) / 2 - var(--spacing-3))}
  .x1idpjx9:not(#\#):not(#\#):not(#\#){margin-inline-start:calc((40px - min(var(--spacing-6),40px)) / 2 - var(--spacing-4))}
  .x1xrm450:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(var(--spacing-2) - var(--spacing-1) + 1px)}
  .x6w1cxl:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(var(--spacing-3) + var(--border-width) + var(--spacing-4))}
  .x13hpdyo:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--_avatar-group-overlap)}
  .x12vn87o:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--_tree-indent,0px)}
  .xladpz9:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--spacing-0-5)}
  .x17lnmll:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--spacing-1-5)}
  .x11g1kdw:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--spacing-1)}
  .x6i7dpz:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--spacing-3)}
  .x1l10yog:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--spacing-6)}
  .x4lel18:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--x-marginInlineStart)}
  .x1ey4id:not(#\#):not(#\#):not(#\#){margin-inline-start:var(--x3pzc91,calc(var(--spacing-4) + max(var(--astryx-layer-inset-inline-start, 0px), var(--astryx-layer-inset-inline-end, 0px))))}
  .x1cytvie:not(#\#):not(#\#):not(#\#){margin-inline-start:calc(max(var(--spacing-4), env(safe-area-inset-left, 0px), env(safe-area-inset-right, 0px)) + max(var(--astryx-layer-inset-inline-start, 0px), var(--astryx-layer-inset-inline-end, 0px)))}
  .xkm2don:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 24px);mask-image:linear-gradient(to bottom,transparent,black 24px)}
  .xw26lqc:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 36px);mask-image:linear-gradient(to bottom,transparent,black 36px)}
  .xr5yg4x:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to bottom,transparent,black 48px);mask-image:linear-gradient(to bottom,transparent,black 48px)}
  .xtdd0ob:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to left,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1));mask-image:linear-gradient(to left,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1))}
  .xoj6v2h:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to left,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)));mask-image:linear-gradient(to left,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)))}
  .x1b5cd1y:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1),black calc(100% - var(--spacing-1)),rgba(0,0,0,.3) calc(100% - 2px),transparent 100%);mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1),black calc(100% - var(--spacing-1)),rgba(0,0,0,.3) calc(100% - 2px),transparent 100%)}
  .x1ujl4f5:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1));mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1))}
  .xq05pg6:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)),black calc(100% - calc(var(--_tab-strip-bleed) + var(--spacing-8))),transparent calc(100% - var(--_tab-strip-bleed)));mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)),black calc(100% - calc(var(--_tab-strip-bleed) + var(--spacing-8))),transparent calc(100% - var(--_tab-strip-bleed)))}
  .x1hua2o0:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)));mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)))}
  .x1cb67k9:not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(transparent,transparent);mask-image:linear-gradient(transparent,transparent)}
  .xw4ya9i:not(#\#):not(#\#):not(#\#){-webkit-mask-image:none;mask-image:none}
  .x19kjcj4:not(#\#):not(#\#):not(#\#){object-fit:contain}
  .xl1xv1r:not(#\#):not(#\#):not(#\#){object-fit:cover}
  .x1xyvc85:not(#\#):not(#\#):not(#\#){opacity:.15}
  .xvpkmg4:not(#\#):not(#\#):not(#\#){opacity:.25}
  .xuzhngd:not(#\#):not(#\#):not(#\#){opacity:.3}
  .x3onkmb:not(#\#):not(#\#):not(#\#){opacity:.35}
  .xbyyjgo:not(#\#):not(#\#):not(#\#){opacity:.5}
  .x197sbye:not(#\#):not(#\#):not(#\#){opacity:.6}
  .xg01cxk:not(#\#):not(#\#):not(#\#){opacity:0}
  .x1hc1fzr:not(#\#):not(#\#):not(#\#){opacity:1}
  .x1wnsjo:not(#\#):not(#\#):not(#\#){opacity:var(--_conceal-opacity,1)}
  .xgsobzw:not(#\#):not(#\#):not(#\#){opacity:var(--_reveal-opacity,1)}
  .x1i7u4iq:not(#\#):not(#\#):not(#\#){opacity:var(--_toast-swipe-opacity,1)}
  .x1clqncf:not(#\#):not(#\#):not(#\#){order:-1}
  .x1g77sc7:not(#\#):not(#\#):not(#\#){order:0}
  .xb9bu2e:not(#\#):not(#\#):not(#\#){outline-color:var(--x18622n)}
  .x1wfwxd8:not(#\#):not(#\#):not(#\#){outline-offset:0}
  .x1kvmbwa:not(#\#):not(#\#):not(#\#){outline-offset:var(--_focus-outline-offset,0)}
  .xgg8d26:not(#\#):not(#\#):not(#\#){outline-offset:var(--x8bm18s)}
  .x1t137rt:not(#\#):not(#\#):not(#\#){outline-style:none}
  .xy741jp:not(#\#):not(#\#):not(#\#){outline-style:var(--xy2juf7)}
  .x1k57tk5:not(#\#):not(#\#):not(#\#){outline-width:0}
  .x19wbafz:not(#\#):not(#\#):not(#\#){outline-width:var(--x1hdvljp)}
  .x9y5y3v:not(#\#):not(#\#):not(#\#){overflow-clip-margin:1px}
  .xj0a0fe:not(#\#):not(#\#):not(#\#){overflow-wrap:anywhere}
  .x1mzt3pk:not(#\#):not(#\#):not(#\#){overflow-wrap:break-word}
  .x1h4wwuj:not(#\#):not(#\#):not(#\#){overflow-wrap:normal}
  .xyri2b:not(#\#):not(#\#):not(#\#){padding-inline-end:0}
  .xtvv6yu:not(#\#):not(#\#):not(#\#){padding-inline-end:calc(var(--_tab-strip-bleed,0px) + max(var(--container-padding-inline-end,0px) - var(--spacing-3),0px))}
  .x1g2apga:not(#\#):not(#\#):not(#\#){padding-inline-end:calc(var(--_textarea-inline-padding) + var(--spacing-12))}
  .xp2dy4z:not(#\#):not(#\#):not(#\#){padding-inline-end:calc(var(--_textarea-inline-padding) + var(--spacing-6))}
  .x12frdag:not(#\#):not(#\#):not(#\#){padding-inline-end:calc(var(--container-padding-inline-end) - var(--border-width))}
  .x1ahicqp:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--container-padding-inline-end,0px),calc((100cqi - var(--layout-alignment-width)) / 2 + var(--container-padding-inline-end,0px)))}
  .xy07wb4:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--container-padding-inline-end,0px),calc(100cqi - var(--layout-alignment-width) + var(--container-padding-inline-end,0px)))}
  .x1g0rcpp:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--spacing-4),env(safe-area-inset-right,0px))}
  .x1p6hqjl:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--_tokenizer-end-lane-reserve,0px)}
  .x1by8st6:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--astryx-dialog-padding-inline-end,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-right,0px)))))}
  .x17sfb9:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--astryx-number-input-padding-inline-end,var(--astryx-number-input-padding-inline,var(--astryx-number-input-padding,var(--spacing-2))))}
  .x64h4k7:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--container-padding-inline-end)}
  .x1peupej:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--layout-padding-inner-x,var(--spacing-4))}
  .x19eyx77:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--layout-padding-own-outer-x,var(--layout-padding-outer-x,var(--spacing-4)))}
  .x1le3yxw:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-0-5)}
  .x1s0aq8i:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-0)}
  .x17hk9do:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-1-5)}
  .x1nryj5t:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-1)}
  .x160ivqr:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-10)}
  .x1djylfy:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-2)}
  .x1t818jl:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-3)}
  .xnjyzlh:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-4)}
  .xdbrk9v:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-5)}
  .x1we12cn:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-6)}
  .x1q91b2g:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-8)}
  .x120eax6:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--x-paddingInlineEnd)}
  .x1c1uobl:not(#\#):not(#\#):not(#\#){padding-inline-start:0}
  .x12t6xex:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(-1 * var(--_avatar-group-overlap))}
  .x1f43n9v:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(16px + var(--spacing-1-5))}
  .x8oor0o:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(40px + var(--spacing-2))}
  .xir64ve:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(40px + var(--spacing-3))}
  .x19picz4:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(40px + var(--spacing-4))}
  .xwb75os:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(var(--_tab-strip-bleed,0px) + max(var(--container-padding-inline-start,0px) - var(--spacing-3),0px))}
  .x1b6te9z:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(var(--_textarea-inline-padding) + var(--spacing-6))}
  .xs19ii7:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(var(--container-padding-inline-start) - var(--border-width))}
  .x2a0j69:not(#\#):not(#\#):not(#\#){padding-inline-start:calc(var(--spacing-2) - var(--spacing-1) + 1px)}
  .xhlv5e7:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--container-padding-inline-start,0px),calc((100cqi - var(--layout-alignment-width)) / 2 + var(--container-padding-inline-start,0px)))}
  .xxjme2g:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--container-padding-inline-start,0px),calc(100cqi - var(--layout-alignment-width) + var(--container-padding-inline-start,0px)))}
  .xf4btlh:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--spacing-4),env(safe-area-inset-left,0px))}
  .xqmdmw:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--astryx-dialog-padding-inline-start,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-left,0px)))))}
  .x1jni19p:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--astryx-number-input-padding-inline-start,var(--astryx-number-input-padding-inline,var(--astryx-number-input-padding,var(--spacing-2))))}
  .x1c35znw:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--container-padding-inline-start)}
  .xwjyata:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--layout-padding-inner-x,var(--spacing-4))}
  .xaku5ci:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--layout-padding-own-outer-x,var(--layout-padding-outer-x,var(--spacing-4)))}
  .x138rykx:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-0-5)}
  .x18gyask:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-0)}
  .xfti1ec:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-1-5)}
  .x1vsv5vr:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-1)}
  .xqp078j:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-10)}
  .xc8afjc:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-11)}
  .x19b7t93:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-12)}
  .x12gdq22:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-2)}
  .x126nfab:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-3)}
  .x1rey3nv:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-4)}
  .x1blguxw:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-5)}
  .x31w388:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-6)}
  .xchaq28:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-7)}
  .x1j3hnjz:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--spacing-8)}
  .xnvo3vl:not(#\#):not(#\#):not(#\#){padding-inline-start:var(--x-paddingInlineStart)}
  .x201tam:not(#\#):not(#\#):not(#\#){perspective:520px}
  .x67bb7w:not(#\#):not(#\#):not(#\#){pointer-events:auto}
  .x47corl:not(#\#):not(#\#):not(#\#){pointer-events:none}
  .x1tsffl5:not(#\#):not(#\#):not(#\#){position-anchor:--outline-active}
  .x10l6tqk:not(#\#):not(#\#):not(#\#){position:absolute}
  .xixxii4:not(#\#):not(#\#):not(#\#){position:fixed}
  .x1n2onr6:not(#\#):not(#\#):not(#\#){position:relative}
  .x1uhb9sk:not(#\#):not(#\#):not(#\#){position:static}
  .x7wzq59:not(#\#):not(#\#):not(#\#){position:sticky}
  .x1mf7ja4:not(#\#):not(#\#):not(#\#){position:var(--_reveal-position,static)}
  .xio8zfp:not(#\#):not(#\#):not(#\#){r:calc(var(--_spinner-ring-diameter) / 2)}
  .xtt52l0:not(#\#):not(#\#):not(#\#){resize:none}
  .x288g5:not(#\#):not(#\#):not(#\#){resize:vertical}
  .xajebq8:not(#\#):not(#\#):not(#\#){row-gap:calc(var(--spacing-1) - 1px)}
  .x1tw44j4:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-0-5)}
  .x6yxi7o:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-0)}
  .xhq53yo:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-1-5)}
  .x1ngg2t4:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-1)}
  .x1xpicb7:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-10)}
  .x1x7z4sm:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-2)}
  .x4olc9o:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-3)}
  .xtx9w7w:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-4)}
  .x1iu6piu:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-5)}
  .xczp1bk:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-6)}
  .xgx0vcf:not(#\#):not(#\#):not(#\#){row-gap:var(--spacing-8)}
  .xkcv6ua:not(#\#):not(#\#):not(#\#){scroll-behavior:smooth}
  .xrw9175:not(#\#):not(#\#):not(#\#){scroll-padding-block-end:48px}
  .x1hdbdi8:not(#\#):not(#\#):not(#\#){scroll-snap-align:center}
  .x1bhewko:not(#\#):not(#\#):not(#\#){scroll-snap-align:start}
  .x19jbwzc:not(#\#):not(#\#):not(#\#){scrollbar-color:var(--color-neutral) transparent}
  .x24f09q:not(#\#):not(#\#):not(#\#){scrollbar-gutter:auto}
  .xosa0jh:not(#\#):not(#\#):not(#\#){scrollbar-width:auto}
  .x1rohswg:not(#\#):not(#\#):not(#\#){scrollbar-width:none}
  .xdv9ggb:not(#\#):not(#\#):not(#\#){stroke-dasharray:calc(var(--_spinner-ring-diameter) * 3.141592653589793 * var(--spinner-arc-fraction)) calc(var(--_spinner-ring-diameter) * 3.141592653589793 * (1 - var(--spinner-arc-fraction)))}
  .x1owpc8m:not(#\#):not(#\#):not(#\#){stroke-linecap:round}
  .x7bo2k:not(#\#):not(#\#):not(#\#){stroke-opacity:.3}
  .x1smxkh6:not(#\#):not(#\#):not(#\#){stroke-opacity:.302}
  .x1g350g8:not(#\#):not(#\#):not(#\#){stroke-opacity:1}
  .xgw3ha0:not(#\#):not(#\#):not(#\#){stroke-width:var(--_spinner-ring-stroke)}
  .xtve3lm:not(#\#):not(#\#):not(#\#){stroke:var(--spinner-color)}
  .xalkhop:not(#\#):not(#\#):not(#\#){stroke:var(--spinner-track-color)}
  .xeq4nuv:not(#\#):not(#\#):not(#\#){tab-size:2}
  .x1drmoe9:not(#\#):not(#\#):not(#\#){table-layout:auto}
  .x140o2bo:not(#\#):not(#\#):not(#\#){table-layout:fixed}
  .x7ssn7h:not(#\#):not(#\#):not(#\#){text-align-last:auto}
  .x2b8uid:not(#\#):not(#\#):not(#\#){text-align:center}
  .xp4054r:not(#\#):not(#\#):not(#\#){text-align:end}
  .x16tdsg8:not(#\#):not(#\#):not(#\#){text-align:inherit}
  .x1yc453h:not(#\#):not(#\#):not(#\#){text-align:start}
  .x1b2iylo:not(#\#):not(#\#):not(#\#){text-box-edge:cap alphabetic}
  .xwgcxoh:not(#\#):not(#\#):not(#\#){text-box-trim:trim-both}
  .xycaml9:not(#\#):not(#\#):not(#\#){text-decoration-color:var(--color-border-emphasized)}
  .xujl8zx:not(#\#):not(#\#):not(#\#){text-decoration-line:underline}
  .xev0dqp:not(#\#):not(#\#):not(#\#){text-decoration-style:dashed}
  .xzugeeo:not(#\#):not(#\#):not(#\#){text-indent:0}
  .xbrixnn:not(#\#):not(#\#):not(#\#){text-overflow:clip}
  .xlyipyv:not(#\#):not(#\#):not(#\#){text-overflow:ellipsis}
  .x19pm5ym:not(#\#):not(#\#):not(#\#){text-shadow:none}
  .x6mezaz:not(#\#):not(#\#):not(#\#){text-transform:none}
  .xtvhhri:not(#\#):not(#\#):not(#\#){text-transform:uppercase}
  .xrys4gj:not(#\#):not(#\#):not(#\#){text-underline-offset:2px}
  .x11b3rvo:not(#\#):not(#\#):not(#\#){text-underline-offset:var(--spacing-0-5)}
  .x1w2vvpw:not(#\#):not(#\#):not(#\#){text-wrap:balance}
  .xebhuq6:not(#\#):not(#\#):not(#\#){text-wrap:nowrap}
  .x1fzhlzt:not(#\#):not(#\#):not(#\#){text-wrap:pretty}
  .xk4td0m:not(#\#):not(#\#):not(#\#){text-wrap:wrap}
  .x5ve5x3:not(#\#):not(#\#):not(#\#){touch-action:none}
  .x1bblx7b:not(#\#):not(#\#):not(#\#){touch-action:pan-x}
  .xge0x1e:not(#\#):not(#\#):not(#\#){touch-action:pan-y pinch-zoom}
  .xx69xxh:not(#\#):not(#\#):not(#\#){touch-action:pan-y}
  .x1j4r261:not(#\#):not(#\#):not(#\#){touch-action:pinch-zoom}
  .x1764fhq:not(#\#):not(#\#):not(#\#){transform-box:fill-box}
  .x1g0ag68:not(#\#):not(#\#):not(#\#){transform-origin:center}
  .x1oyok0e:not(#\#):not(#\#):not(#\#){transform-style:preserve-3d}
  .x1c071of:not(#\#):not(#\#):not(#\#){transform:none}
  .x9tu13d:not(#\#):not(#\#):not(#\#){transform:rotate(-90deg)}
  .x7p49u4:not(#\#):not(#\#):not(#\#){transform:rotate(0deg)}
  .x19jd1h0:not(#\#):not(#\#):not(#\#){transform:rotate(180deg)}
  .x1iffjtl:not(#\#):not(#\#):not(#\#){transform:rotate(90deg)}
  .x3oybdh:not(#\#):not(#\#):not(#\#){transform:scale(1)}
  .x11lhmoz:not(#\#):not(#\#):not(#\#){transform:translate(-50%,-50%)}
  .x1m9mm8y:not(#\#):not(#\#):not(#\#){transform:translate(-50%,50%)}
  .xv8yid9:not(#\#):not(#\#):not(#\#){transform:translate(25%,25%)}
  .x4v1no5:not(#\#):not(#\#):not(#\#){transform:translate(50%,50%)}
  .x145au52:not(#\#):not(#\#):not(#\#){transform:translate3d(calc(-1 * var(--_item-swipe-travel,0px)),0,0)}
  .x1kncwj0:not(#\#):not(#\#):not(#\#){transform:translate3d(var(--_item-swipe-travel,0px),0,0)}
  .x5i6ehr:not(#\#):not(#\#):not(#\#){transform:translateX(-100%)}
  .xuuh30:not(#\#):not(#\#):not(#\#){transform:translateX(-50%)}
  .xbryuvx:not(#\#):not(#\#):not(#\#){transform:translateX(0)}
  .xumwmo6:not(#\#):not(#\#):not(#\#){transform:translateX(100%)}
  .xv5t66b:not(#\#):not(#\#):not(#\#){transform:translateX(12px)}
  .x15481yp:not(#\#):not(#\#):not(#\#){transform:translateX(14px)}
  .xitnhlw:not(#\#):not(#\#):not(#\#){transform:translateX(50%)}
  .x105ttfm:not(#\#):not(#\#):not(#\#){transform:translateY(-100%)}
  .x19xzu86:not(#\#):not(#\#):not(#\#){transform:translateY(-3px) scale(.985)}
  .x1bvilyr:not(#\#):not(#\#):not(#\#){transform:translateY(-4px)}
  .x1cb1t30:not(#\#):not(#\#):not(#\#){transform:translateY(-50%)}
  .xp0htlv:not(#\#):not(#\#):not(#\#){transform:translateY(-6px) scale(.97)}
  .xnn1q72:not(#\#):not(#\#):not(#\#){transform:translateY(0)}
  .x1weeur4:not(#\#):not(#\#):not(#\#){transform:translateY(100%)}
  .x131p8rn:not(#\#):not(#\#):not(#\#){transform:translateY(50%)}
  .x149p1fo:not(#\#):not(#\#):not(#\#){transform:translateY(var(--_toast-swipe-exit-y,var(--_toast-swipe-y,var(--_toast-slide-y,var(--spacing-2))))) scale(var(--_toast-swipe-scale,1))}
  .x1qk3xlt:not(#\#):not(#\#):not(#\#){transform:translateY(var(--_toast-swipe-y,0px)) scale(var(--_toast-swipe-scale,1))}
  .x11wx31z:not(#\#):not(#\#):not(#\#){transform:var(--x-qthpiu)}
  .xsqj5wx:not(#\#):not(#\#):not(#\#){transform:var(--x-transform)}
  .xd00j3c:not(#\#):not(#\#):not(#\#){transition-behavior:allow-discrete}
  .x5h36tt:not(#\#):not(#\#):not(#\#){transition-delay:.15s}
  .x1ahifba:not(#\#):not(#\#):not(#\#){transition-delay:0s}
  .x4avkj2:not(#\#):not(#\#):not(#\#){transition-delay:var(--_fade-delay,0s)}
  .x1rq8cwj:not(#\#):not(#\#):not(#\#){transition-delay:var(--_reveal-delay,0s,0s)}
  .x10b1n17:not(#\#):not(#\#):not(#\#){transition-delay:var(--duration-fast)}
  .x11bq7d0:not(#\#):not(#\#):not(#\#){transition-duration:.06s}
  .xx6bhzk:not(#\#):not(#\#):not(#\#){transition-duration:.15s}
  .x13dflua:not(#\#):not(#\#):not(#\#){transition-duration:.2s}
  .xjd9b36:not(#\#):not(#\#):not(#\#){transition-duration:1ms}
  .xxfakuu:not(#\#):not(#\#):not(#\#){transition-duration:var(--_item-swipe-duration,0s),var(--_item-swipe-duration,0s)}
  .x2rcmwa:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-fast-max)}
  .x15p14ac:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-fast-min),var(--_item-swipe-duration,0s)}
  .xkvfbh3:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-fast-min)}
  .x1tw3moq:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-fast),0s}
  .xuedmi6:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-fast)}
  .xgneliz:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-medium-min)}
  .x80gvsz:not(#\#):not(#\#):not(#\#){transition-duration:var(--duration-medium)}
  .x1eaenvl:not(#\#):not(#\#):not(#\#){transition-property:background-color,border-color,color}
  .xts7igz:not(#\#):not(#\#):not(#\#){transition-property:background-color,border-color}
  .x106061f:not(#\#):not(#\#):not(#\#){transition-property:background-color,box-shadow}
  .xzo0q3i:not(#\#):not(#\#):not(#\#){transition-property:background-color,color,border-color}
  .xs2xxs2:not(#\#):not(#\#):not(#\#){transition-property:background-color,color}
  .x1e8aii2:not(#\#):not(#\#):not(#\#){transition-property:background-color,opacity}
  .xuo13n2:not(#\#):not(#\#):not(#\#){transition-property:background-color,transform}
  .x15406qy:not(#\#):not(#\#):not(#\#){transition-property:background-color}
  .xrafxwg:not(#\#):not(#\#):not(#\#){transition-property:background-image,background-color,color,opacity,transform}
  .x12qzo2w:not(#\#):not(#\#):not(#\#){transition-property:background-image}
  .x1tv3a4w:not(#\#):not(#\#):not(#\#){transition-property:border-color,box-shadow,background-color}
  .x12zzom9:not(#\#):not(#\#):not(#\#){transition-property:border-color,box-shadow}
  .xshfolx:not(#\#):not(#\#):not(#\#){transition-property:border-color}
  .x16mfhj0:not(#\#):not(#\#):not(#\#){transition-property:box-shadow,border-color}
  .xkdsq27:not(#\#):not(#\#):not(#\#){transition-property:box-shadow}
  .x1vix5yk:not(#\#):not(#\#):not(#\#){transition-property:color,background-color,box-shadow}
  .x1gbuem2:not(#\#):not(#\#):not(#\#){transition-property:color,background-color}
  .x1jbe559:not(#\#):not(#\#):not(#\#){transition-property:color,font-weight}
  .x1mpt4pi:not(#\#):not(#\#):not(#\#){transition-property:color,-webkit-text-decoration;transition-property:color,text-decoration;transition-property:color,text-decoration,-webkit-text-decoration}
  .xt3l3uh:not(#\#):not(#\#):not(#\#){transition-property:color}
  .xrgi2yo:not(#\#):not(#\#):not(#\#){transition-property:display}
  .xjshnde:not(#\#):not(#\#):not(#\#){transition-property:grid-template-rows,padding}
  .x1qn9uv2:not(#\#):not(#\#):not(#\#){transition-property:grid-template-rows}
  .x157bb6t:not(#\#):not(#\#):not(#\#){transition-property:-webkit-mask-image;transition-property:mask-image;transition-property:mask-image, -webkit-mask-image}
  .x13b0p5u:not(#\#):not(#\#):not(#\#){transition-property:none}
  .x1wbls7o:not(#\#):not(#\#):not(#\#){transition-property:opacity,background-color,transform}
  .xnpjden:not(#\#):not(#\#):not(#\#){transition-property:opacity,background-color}
  .xsm4mo9:not(#\#):not(#\#):not(#\#){transition-property:opacity,display,overlay}
  .x1n1p2mu:not(#\#):not(#\#):not(#\#){transition-property:opacity,position}
  .xrgg2z9:not(#\#):not(#\#):not(#\#){transition-property:opacity,transform,max-width,visibility}
  .x4bbghf:not(#\#):not(#\#):not(#\#){transition-property:opacity,transform,overlay,display}
  .x6o7n8i:not(#\#):not(#\#):not(#\#){transition-property:opacity,transform}
  .xxup5nn:not(#\#):not(#\#):not(#\#){transition-property:opacity,visibility,transform}
  .x1jl3cmp:not(#\#):not(#\#):not(#\#){transition-property:opacity,visibility}
  .x19991ni:not(#\#):not(#\#):not(#\#){transition-property:opacity}
  .x1xuz8iz:not(#\#):not(#\#):not(#\#){transition-property:top,height}
  .x18dpk69:not(#\#):not(#\#):not(#\#){transition-property:transform,background-color}
  .xwcsmn1:not(#\#):not(#\#):not(#\#){transition-property:transform,opacity}
  .xh3q6i0:not(#\#):not(#\#):not(#\#){transition-property:transform,width,height}
  .x13zkoj4:not(#\#):not(#\#):not(#\#){transition-property:transform,width}
  .x11xpdln:not(#\#):not(#\#):not(#\#){transition-property:transform}
  .x74b7sa:not(#\#):not(#\#):not(#\#){transition-property:visibility}
  .xxrbq2n:not(#\#):not(#\#):not(#\#){transition-property:width}
  .xv2sgk5:not(#\#):not(#\#):not(#\#){transition-timing-function:cubic-bezier(.3,0,.6,.6)}
  .xn34ekc:not(#\#):not(#\#):not(#\#){transition-timing-function:ease-out,ease-out}
  .x9lcvmn:not(#\#):not(#\#):not(#\#){transition-timing-function:ease-out}
  .xcj1dhv:not(#\#):not(#\#):not(#\#){transition-timing-function:linear}
  .x158wxwp:not(#\#):not(#\#):not(#\#){transition-timing-function:var(--ease-standard),ease-out}
  .xlr8y92:not(#\#):not(#\#):not(#\#){transition-timing-function:var(--ease-standard)}
  .x3sa99s:not(#\#):not(#\#):not(#\#){translate:0 -50%}
  .x87ps6o:not(#\#):not(#\#):not(#\#){-webkit-user-select:none;user-select:none}
  .x11njtxf:not(#\#):not(#\#):not(#\#){vertical-align:baseline}
  .x3ajldb:not(#\#):not(#\#):not(#\#){vertical-align:bottom}
  .xxymvpz:not(#\#):not(#\#):not(#\#){vertical-align:middle}
  .x1v0h343:not(#\#):not(#\#):not(#\#){vertical-align:super}
  .x16dsc37:not(#\#):not(#\#):not(#\#){vertical-align:top}
  .xlshs6z:not(#\#):not(#\#):not(#\#){visibility:hidden}
  .xnpuxes:not(#\#):not(#\#):not(#\#){visibility:visible}
  .xeaf4i8:not(#\#):not(#\#):not(#\#){white-space:normal}
  .xuxw1ft:not(#\#):not(#\#):not(#\#){white-space:nowrap}
  .x126k92a:not(#\#):not(#\#):not(#\#){white-space:pre-wrap}
  .x1sdyfia:not(#\#):not(#\#):not(#\#){white-space:pre}
  .x1q1rmc8:not(#\#):not(#\#):not(#\#){will-change:transform,opacity}
  .x1yn0g08:not(#\#):not(#\#):not(#\#){word-break:break-all}
  .x13faqbe:not(#\#):not(#\#):not(#\#){word-break:break-word}
  .x1lldw8n:not(#\#):not(#\#):not(#\#){word-break:normal}
  .xp3md9m:not(#\#):not(#\#):not(#\#){word-spacing:normal}
  .x8knxv4:not(#\#):not(#\#):not(#\#){z-index:-1}
  .x1ja2u2z:not(#\#):not(#\#):not(#\#){z-index:0}
  .x1vjfegm:not(#\#):not(#\#):not(#\#){z-index:1}
  .xfo81ep:not(#\#):not(#\#):not(#\#){z-index:1000}
  .xhtitgo:not(#\#):not(#\#):not(#\#){z-index:2}
  .xzkaem6:not(#\#):not(#\#):not(#\#){z-index:3}
  .x6cuj84:not(#\#):not(#\#):not(#\#){z-index:500}
  .x1q2oy4v:not(#\#):not(#\#):not(#\#){z-index:9999}
  .x1wphrdb[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#){--_press-overlay-transition:0s}
  .xbb2ue6[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#){--_press-overlay-transition:0s}
  .x11z29ks[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#){--astryx-press-alpha:1}
  .xli5ek3[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#){--astryx-press-alpha:1}
  .x1v2claj.x1v2claj:where(.x84s7jz:focus-within *):not(#\#):not(#\#):not(#\#){opacity:1}
  .x3730vf.x3730vf:where(.x84s7jz:focus-within *):not(#\#):not(#\#):not(#\#){pointer-events:auto}
  .xuqivmr.xuqivmr:where(.x84s7jz:focus-within *):not(#\#):not(#\#):not(#\#){transform:translateY(0)}
  .x7v6acp.x7v6acp:where(.x84s7jz:focus-within *):not(#\#):not(#\#):not(#\#){visibility:visible}
  .x5um2zc.x5um2zc:where(.x1twag4g:first-child *):not(#\#):not(#\#):not(#\#){visibility:hidden}
  .x1se5z8o.x1se5z8o:where(.x1twag4g:last-child *):not(#\#):not(#\#):not(#\#){visibility:hidden}
  .x6ipy2d.x6ipy2d:where(.x1u3b27q:active *):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-pressed)}
  @supports (animation-timeline: view()){.x1iu2jvn.x1iu2jvn:not(#\#):not(#\#):not(#\#){animation-name:x1tut0r7-B}}
  @supports (container-type: scroll-state){.xafyuhj.xafyuhj:not(#\#):not(#\#):not(#\#){container-type:scroll-state}}
  .xfd3fxj:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){animation-name:x1c2q33o-B}
  .x1vxsm5i:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){animation-name:xu7jd1z-B}
  .x18lne9g:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){animation-name:xwmkjkf-B}
  .x1spg45b.x1spg45b:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:var(--color-accent)}
  .x1tgb0ru.x1tgb0ru:where(.astryx-input-group > *):has(~ *:not([popover]):not(template):not(dialog)):not(#\#):not(#\#):not(#\#){border-end-end-radius:0}
  .x1ursds5:not(:has(~ *:not([popover]):not(template):not(dialog))):not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--radius-element)}
  .xf2wquc.xf2wquc:where(.astryx-input-group > *):not(:first-child):not(#\#):not(#\#):not(#\#){border-end-start-radius:0}
  .xy2bsav:not(:has(~ *:not([popover]):not(template):not(dialog))):not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--radius-element)}
  .x2dar1b.x2dar1b:where(.astryx-input-group > *):has(~ *:not([popover]):not(template):not(dialog)):not(#\#):not(#\#):not(#\#){border-start-end-radius:0}
  .x149bkfe:not(:has(~ *:not([popover]):not(template):not(dialog))):not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-element)}
  .x1epqg88.x1epqg88:where(.astryx-input-group > *):not(:first-child):not(#\#):not(#\#):not(#\#){border-start-start-radius:0}
  .xuihb5h:focus-within:not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 2px var(--color-accent-muted)}
  .x15ysqaf:focus-within:not(#\#):not(#\#):not(#\#){box-shadow:none}
  .xyavpck:focus-within:not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-med)}
  .x153f7d5:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){clip-path:inset(0 0 0 max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))))}
  .x7cmjge:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){clip-path:inset(0 max(0px,min(var(--step-connector-gap,0px),var(--spacing-2))) 0 0)}
  .x10wafsz:focus-within:not(#\#):not(#\#):not(#\#){clip-path:none}
  .xy5bzlh.xy5bzlh:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:var(--color-icon-primary)}
  .x9o1np9.x9o1np9:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:var(--color-text-primary)}
  .x16khyan:is(:disabled,[aria-disabled="true"]):not(#\#):not(#\#):not(#\#){cursor:default}
  .x1y40yee:popover-open:not(#\#):not(#\#):not(#\#){display:flex}
  .x17xqekc:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to left,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1));mask-image:linear-gradient(to left,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1))}
  .x1nwey30:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to left,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)));mask-image:linear-gradient(to left,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)))}
  .x8ulde1:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1));mask-image:linear-gradient(to right,transparent 0%,rgba(0,0,0,.3) 2px,black var(--spacing-1))}
  .x1rxa4r8:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){-webkit-mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)));mask-image:linear-gradient(to right,transparent var(--_tab-strip-bleed),black calc(var(--_tab-strip-bleed) + var(--spacing-8)))}
  .x1euntei:focus-within:not(#\#):not(#\#):not(#\#){opacity:1}
  .x25t5g8:focus-visible:not(#\#):not(#\#):not(#\#){opacity:1}
  .xof6bs:is(th:hover *):not(#\#):not(#\#):not(#\#){opacity:1}
  .xofkqq2:popover-open:not(#\#):not(#\#):not(#\#){opacity:1}
  .x1e0x2sz:focus-visible:not(#\#):not(#\#):not(#\#){outline-color:var(--color-error)}
  .xx47ajj:focus-visible:not(#\#):not(#\#):not(#\#){outline-color:var(--focus-outline-color)}
  .x7s97pk:focus-visible:not(#\#):not(#\#):not(#\#){outline-offset:2px}
  .x1nw7mhf:focus-visible:not(#\#):not(#\#):not(#\#){outline-offset:calc(-1 * var(--focus-outline-width))}
  .x1l5jwag:focus-visible:not(#\#):not(#\#):not(#\#){outline-offset:calc(0px - var(--focus-outline-width))}
  .x13aywxo:focus-visible:not(#\#):not(#\#):not(#\#){outline-offset:var(--button-focus-offset)}
  .x1vwwbsn:focus-visible:not(#\#):not(#\#):not(#\#){outline-offset:var(--focus-outline-offset)}
  .xwz5zln.xwz5zln:where(.x1iwu4tg:has(:focus-visible) *):not(#\#):not(#\#):not(#\#){outline-offset:var(--focus-outline-offset)}
  .x1jhp3zv:focus-visible:not(#\#):not(#\#):not(#\#){outline-style:var(--focus-outline-style)}
  .x1vidyx5:focus-visible:not(#\#):not(#\#):not(#\#){outline-width:var(--focus-outline-width)}
  .x1n6uwha:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--spacing-4),env(safe-area-inset-left,0px))}
  .xtjjor6:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){padding-inline-end:var(--astryx-dialog-padding-inline-end,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-left,0px)))))}
  .x19efkpl:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--spacing-4),env(safe-area-inset-right,0px))}
  .x1i7f2ot:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){padding-inline-start:var(--astryx-dialog-padding-inline-start,var(--astryx-dialog-padding-inline,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-right,0px)))))}
  .xbt4iw:focus-within:not(#\#):not(#\#):not(#\#){pointer-events:auto}
  .xo74pv5:focus-within:not(#\#):not(#\#):not(#\#){position:static}
  .x1mqgsch:is([data-astryx-scrolling]):not(#\#):not(#\#):not(#\#){scrollbar-width:none}
  .x8ppqj.x8ppqj:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){transform:scale(.98)}
  .xaafvuh:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:scaleX(-1) rotate(0deg)}
  .x1nxqau:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:scaleX(-1) rotate(90deg)}
  .xgtlewx:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:scaleX(-1)}
  .x10fxb7p:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translate(-25%,25%)}
  .xqgnvz5:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translate(-50%,50%)}
  .xoffwj3:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translate(50%,-50%)}
  .x1df3fe5:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(-100%)}
  .xi9aj42:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(-12px)}
  .x12xz5k6:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(-14px)}
  .x36dvrd:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(-50%)}
  .xttggg:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(100%)}
  .x1nyx83j:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:translateX(50%)}
  .x9cjr8z:popover-open:not(#\#):not(#\#):not(#\#){transform:translateY(0)}
  .x75qhwu:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#){transform:var(--x-sj6hyi)}
  .x1rm9qnc:focus-within:not(#\#):not(#\#):not(#\#){z-index:1}
  .x1qf1n5z.x1qf1n5z:where(.astryx-input-group > *):focus-visible:not(#\#):not(#\#):not(#\#){z-index:2}
  .x1s2lk0z.x1s2lk0z:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#){--_press-overlay:var(--_press-paint)}
  .x1sad4of.x1sad4of:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#){--_press-overlay:var(--_press-paint)}
  .x1btxeh5:has(input:focus-visible):not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 2px var(--color-accent)}
  .xsw3flo:has(> div > .astryx-layout-content):not(#\#):not(#\#):not(#\#){container-type:inline-size}
  .x92e2el:has(> [data-astryx-edge-comp]:last-child):not(#\#):not(#\#):not(#\#){margin-inline-end:var(--x-4drmnv)}
  .x1kftj4p:has(> [data-astryx-edge-comp]:first-child):not(#\#):not(#\#):not(#\#){margin-inline-start:var(--x-126w13d)}
  .x1uy843r:has(:focus-visible):not(#\#):not(#\#):not(#\#){outline-color:var(--focus-outline-color)}
  .xobxmqy:has(> :first-child:focus-visible):not(#\#):not(#\#):not(#\#){outline-color:var(--focus-outline-color)}
  .x1jumodi:has(:focus-visible):not(#\#):not(#\#):not(#\#){outline-offset:var(--focus-outline-offset)}
  .x2vr5qc:has(> :first-child:focus-visible):not(#\#):not(#\#):not(#\#){outline-offset:var(--focus-outline-offset)}
  .xciu248:has(:focus-visible):not(#\#):not(#\#):not(#\#){outline-style:var(--focus-outline-style)}
  .xfd04fr:has(> :first-child:focus-visible):not(#\#):not(#\#):not(#\#){outline-style:var(--focus-outline-style)}
  .x11j6mr8:has(:focus-visible):not(#\#):not(#\#):not(#\#){outline-width:var(--focus-outline-width)}
  .xmmisi4:has(> :first-child:focus-visible):not(#\#):not(#\#):not(#\#){outline-width:var(--focus-outline-width)}
  .xxdn8bs:has(> div > .astryx-layout-content):not(#\#):not(#\#):not(#\#){padding-inline-end:max(0px,calc((100% - var(--layout-content-width)) / 2))}
  .xmnmr5y:has(.astryx-nav-icon):not(#\#):not(#\#):not(#\#){padding-inline-start:0}
  .x1vvd0s7:has(> div > .astryx-layout-content):not(#\#):not(#\#):not(#\#){padding-inline-start:max(0px,calc((100% - var(--layout-content-width)) / 2))}
  .x1xrp5p4:first-child:not(#\#):not(#\#):not(#\#){border-end-start-radius:var(--radius-element)}
  .xyf0ibl:first-child:not(#\#):not(#\#):not(#\#){border-inline-start-style:none}
  .x1pjv70x:first-child:not(#\#):not(#\#):not(#\#){border-inline-start-width:0}
  .x2qxyot:first-child:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-element)}
  .x8eehn2:first-child:not(#\#):not(#\#):not(#\#){border-start-start-radius:var(--radius-element)}
  .x1pwwqoy:first-child:not(#\#):not(#\#):not(#\#){margin-inline-start:0}
  .x5uh4xs:first-child:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--container-padding-inline-start,var(--spacing-2)),var(--spacing-2))}
  .x9bi00s:first-child:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--container-padding-inline-start,var(--spacing-3)),var(--spacing-2))}
  .x18c6q21:first-child:not(#\#):not(#\#):not(#\#){padding-inline-start:max(var(--container-padding-inline-start,var(--spacing-4)),var(--spacing-2))}
  .x747jw7:last-child:not(#\#):not(#\#):not(#\#){border-end-end-radius:var(--radius-element)}
  .x1qlsc9e:last-child:not(#\#):not(#\#):not(#\#){border-inline-end-width:0}
  .x11xp8u1:last-child:not(#\#):not(#\#):not(#\#){border-start-end-radius:var(--radius-element)}
  .xbg7gas:last-child:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--container-padding-inline-end,var(--spacing-2)),var(--spacing-2))}
  .xpilulx:last-child:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--container-padding-inline-end,var(--spacing-3)),var(--spacing-2))}
  .x1wzlfcn:last-child:not(#\#):not(#\#):not(#\#){padding-inline-end:max(var(--container-padding-inline-end,var(--spacing-4)),var(--spacing-2))}
  .x189zj9d:nth-child(even of :not([data-expansion-panel])):not(#\#):not(#\#):not(#\#){background-color:var(--color-background-muted)}
  .xjl7jj:empty:not(#\#):not(#\#):not(#\#){display:none}
  .x1e0d1ib:empty:not(#\#):not(#\#):not(#\#){padding-inline-start:0}
  .x1cs7wtd:placeholder-shown:not(#\#):not(#\#):not(#\#){inset-inline-start:calc(var(--spacing-1) - 1px)}
  .x1wg34a1:placeholder-shown:not(#\#):not(#\#):not(#\#){padding-inline-end:var(--spacing-1)}
  .xf0ofad:placeholder-shown:not(#\#):not(#\#):not(#\#){padding-inline-start:0}
  .x1utg46d:placeholder-shown:not(#\#):not(#\#):not(#\#){position:absolute}
  .x75j1tr:placeholder-shown:not(#\#):not(#\#):not(#\#){text-align:end}
  .xv6p7n0:placeholder-shown:not(#\#):not(#\#):not(#\#){transform:translateY(-50%)}
  .x1c52tdz:focus:not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-hover)}
  .x1rsz1da:focus:not(#\#):not(#\#):not(#\#){clip-path:none}
  .xodanix:focus:not(#\#):not(#\#):not(#\#){inset-inline-start:var(--spacing-2)}
  .x1xrnuwo:focus:not(#\#):not(#\#):not(#\#){position:fixed}
  .x1hbpcn8:focus:not(#\#):not(#\#):not(#\#){white-space:normal}
  .xjtnuge:active:not(#\#):not(#\#):not(#\#){background-color:var(--color-neutral)}
  .xuqm82a:active:not(#\#):not(#\#):not(#\#){background-image:none}
  .x1pdlv7q:active:not(#\#):not(#\#):not(#\#){transform:none}
  .xk4oym4:active:not(#\#):not(#\#):not(#\#){transform:scale(.98)}
  @media (max-width: 480px){.x1q32nj3.x1q32nj3:not(#\#):not(#\#):not(#\#){align-items:stretch}}
  @media (prefers-reduced-motion: reduce){.x14q22ui.x14q22ui:not(#\#):not(#\#):not(#\#){animation-delay:0s}}
  @media (prefers-reduced-motion: reduce){.xnh0sag.xnh0sag:not(#\#):not(#\#):not(#\#){animation-duration:3s}}
  @media (prefers-reduced-motion: reduce){.x1aquc0h.x1aquc0h:not(#\#):not(#\#):not(#\#){animation-name:none}}
  @media (forced-colors: active){.x9yvj25.x9yvj25:not(#\#):not(#\#):not(#\#){background-color:Canvas}}
  @media (forced-colors: active){.xwvh9j7.xwvh9j7:not(#\#):not(#\#):not(#\#){background-color:CanvasText}}
  @media (prefers-contrast: more) and (not (forced-colors: active)){.x1j0df82.x1j0df82:not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-skeleton),var(--color-text-primary) 30%)}}
  @media (forced-colors: active){.x1o55y2u.x1o55y2u:not(#\#):not(#\#):not(#\#){background-color:GrayText}}
  @media (forced-colors: active){.x1jzqe4.x1jzqe4:not(#\#):not(#\#):not(#\#){background-color:Highlight}}
  @media (forced-colors: active){.x1sir5s4.x1sir5s4:not(#\#):not(#\#):not(#\#){background-color:HighlightText}}
  @media (hover: hover){.x150ydqw.x150ydqw:not(#\#):not(#\#):not(#\#){background-color:transparent}}
  @media (forced-colors: active){.xs5hli.xs5hli:not(#\#):not(#\#):not(#\#){color:CanvasText}}
  @media (forced-colors: active){.x1k5gbb1.x1k5gbb1:not(#\#):not(#\#):not(#\#){color:HighlightText}}
  @media (hover: hover){.x2dt3px.x2dt3px:not(#\#):not(#\#):not(#\#){cursor:zoom-in}}
  @media (hover: hover){.xqwu39o.xqwu39o:not(#\#):not(#\#):not(#\#){display:flex}}
  @media (max-width: 480px){.xedohl4.xedohl4:not(#\#):not(#\#):not(#\#){display:flex}}
  @media (max-width: 480px){.x1rpgqan.x1rpgqan:not(#\#):not(#\#):not(#\#){flex-direction:column}}
  @media (pointer: coarse){.x1jymrmb.x1jymrmb:not(#\#):not(#\#):not(#\#){margin-inline-start:auto}}
  @media (forced-colors: active){.x1tbh5bv.x1tbh5bv:not(#\#):not(#\#):not(#\#){opacity:1}}
  @media (pointer: coarse){.xozvky.xozvky:not(#\#):not(#\#):not(#\#){order:1}}
  @media (forced-colors: active){.x1x84bn5.x1x84bn5:not(#\#):not(#\#):not(#\#){outline-color:Highlight}}
  @media (forced-colors: active){.x815t2r.x815t2r:not(#\#):not(#\#):not(#\#){outline-style:solid}}
  @media (forced-colors: active){.x1xvue0r.x1xvue0r:not(#\#):not(#\#):not(#\#){outline-width:var(--border-width)}}
  @media (pointer: coarse){.x1bjav06.x1bjav06:not(#\#):not(#\#):not(#\#){pointer-events:none}}
  @media (prefers-reduced-motion: reduce){.xg83hb1.xg83hb1:not(#\#):not(#\#):not(#\#){scroll-behavior:auto}}
  @media (forced-colors: active){.xrih18v.xrih18v:not(#\#):not(#\#):not(#\#){scrollbar-color:auto}}
  @media (prefers-reduced-motion: reduce){.xwgk2z2.xwgk2z2:not(#\#):not(#\#):not(#\#){transition-delay:var(--_reveal-delay-reduced,0s,0s)}}
  @media (prefers-reduced-motion: reduce){.xsagj69.xsagj69:not(#\#):not(#\#):not(#\#){transition-duration:.01ms}}
  @media (prefers-reduced-motion: reduce){.xzg1mie.xzg1mie:not(#\#):not(#\#):not(#\#){transition-duration:.01s}}
  @media (prefers-reduced-motion: reduce){.xsr0bmt.xsr0bmt:not(#\#):not(#\#):not(#\#){transition-duration:0s,0s}}
  @media (prefers-reduced-motion: reduce){.x12w9bfk.x12w9bfk:not(#\#):not(#\#):not(#\#){transition-duration:0s}}
  @media (prefers-reduced-motion: reduce){.x4wkmsb.x4wkmsb:not(#\#):not(#\#):not(#\#){transition-property:none}}
  .x1anq1lc.x1anq1lc:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-pressed)}
  .xzmimnh.xzmimnh:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed)),linear-gradient(var(--color-neutral),var(--color-neutral))}
  .x7uyq82.x7uyq82:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed))}
  @media (hover: hover) and (forced-colors: none){.xcgwt1n.xcgwt1n.xcgwt1n:where(.x1iwu4tg:hover *):not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-accent),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.x17srpfb.x17srpfb.x17srpfb:where(.x1odsvnm:hover *):not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-accent),var(--color-tint-hover) 15%)}}
  @media (hover: hover) and (forced-colors: none){.x1a8ae7b.x1a8ae7b.x1a8ae7b:where(.x1iwu4tg:hover *):not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-background-gray),var(--color-tint-hover) 5%)}}
  @media (hover: hover){.xeultfy.xeultfy.xeultfy:where(.x1odsvnm:hover *):not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-background-surface),var(--color-tint-hover) 5%)}}
  @media (hover: hover){.xqxnq6d.xqxnq6d.xqxnq6d:where(.x1odsvnm:hover *):not(#\#):not(#\#):not(#\#){background-color:var(--color-background-muted)}}
  @media (hover: hover){.x1pe4z86.x1pe4z86.x1pe4z86:where(.x-default-marker:hover *):not(#\#):not(#\#):not(#\#){background-color:var(--color-icon-primary)}}
  @media (hover: hover){.x1a1zr74.x1a1zr74.x1a1zr74:where(.x1u3b27q:hover *):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-hover)}}
  @media (hover: hover){.x1t9gxa6.x1t9gxa6.x1t9gxa6:where(.x-default-marker:hover *):not(#\#):not(#\#):not(#\#){color:var(--color-text-primary)}}
  @media (hover: hover){.xcwhr9z.xcwhr9z.xcwhr9z:where(.x84s7jz:hover *):not(#\#):not(#\#):not(#\#){opacity:1}}
  @media (hover: hover){.x8ydxbz.x8ydxbz.x8ydxbz:where(.x84s7jz:hover *):not(#\#):not(#\#):not(#\#){pointer-events:auto}}
  @media (hover: hover){.x17hxqr7.x17hxqr7.x17hxqr7:where(.x84s7jz:hover *):not(#\#):not(#\#):not(#\#){transform:translateY(0)}}
  @media (hover: hover){.xneequu.xneequu.xneequu:where(.x84s7jz:hover *):not(#\#):not(#\#):not(#\#){visibility:visible}}
  @media (pointer: coarse){.x1brxl7n.x1brxl7n.x1brxl7n:where(.x1u3b27q:active *):not(#\#):not(#\#):not(#\#){background-color:transparent}}
  @media (hover: hover) and (not (pointer: coarse)){.xvy5t78.xvy5t78.xvy5t78:where(.x1u3b27q:active *):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-pressed)}}
  @media (forced-colors: none){.x1xm682w.x1xm682w.x1xm682w:where(.x1iwu4tg:active *):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed))}}
  @supports (animation-timeline: view()){@media (prefers-reduced-motion: reduce){.xk3h8ob.xk3h8ob.xk3h8ob:not(#\#):not(#\#):not(#\#){animation-name:xuvekqa-B}}}
  @supports (-webkit-touch-callout: none){@media (pointer: coarse){.xf9zqsd.xf9zqsd.xf9zqsd:not(#\#):not(#\#):not(#\#){font-size:max(1rem,var(--text-body-size))}}}
  @supports (-webkit-touch-callout: none){@media (pointer: coarse){.x1w61h2b.x1w61h2b.x1w61h2b:not(#\#):not(#\#):not(#\#){font-size:max(1rem,var(--text-label-size))}}}
  @media (hover: hover){.xvxo0qp.xvxo0qp.xvxo0qp:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:color-mix(in srgb,var(--color-accent),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.x1pfkqlk.x1pfkqlk.x1pfkqlk:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:transparent}}
  @media (hover: hover){.xcu6dpe.xcu6dpe.xcu6dpe:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:var(--color-neutral)}}
  @media (hover: hover){.xoevpu5.xoevpu5.xoevpu5:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-hover)}}
  @media (hover: hover){.xprvw0a.xprvw0a.xprvw0a:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:var(--color-overlay-pressed)}}
  @media (hover: hover){.xmvprkv.xmvprkv.xmvprkv:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-hover),var(--color-overlay-hover))}}
  @media (hover: hover){.x1bm8j9m.x1bm8j9m.x1bm8j9m:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:none}}
  @media (pointer: coarse){.x1xp12g4.x1xp12g4.x1xp12g4:where(.x1u3b27q[data-astryx-press="fading"] *):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}}
  @media (pointer: coarse){.x80uhwv.x80uhwv.x80uhwv:where(.x1u3b27q[data-astryx-press="on"] *):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}}
  @media (hover: hover){.x1telqz2.x1telqz2.x1telqz2:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 2px color-mix(in srgb,var(--color-accent) 20%,transparent)}}
  @media (hover: hover){.x1v5wwkd.x1v5wwkd.x1v5wwkd:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 2px color-mix(in srgb,var(--color-accent) 20%,transparent)}}
  @media (hover: hover){.x1xqjsvb.x1xqjsvb.x1xqjsvb:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:inset 0 0 0 2px color-mix(in srgb,var(--color-border-emphasized) 30%,transparent)}}
  @media (hover: hover){.x1s17dad.x1s17dad.x1s17dad:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:none}}
  @media (hover: hover){.x1bgmis8.x1bgmis8.x1bgmis8:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-inset-error)}}
  @media (hover: hover){.x8wp45d.x8wp45d.x8wp45d:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-inset-success)}}
  @media (hover: hover){.x9156jc.x9156jc.x9156jc:hover:not(:focus-within):where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-inset-warning)}}
  @media (hover: hover){.x1ymidup.x1ymidup.x1ymidup:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){box-shadow:var(--shadow-med)}}
  @media (hover: hover){.x1rfoswn.x1rfoswn.x1rfoswn:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:color-mix(in srgb,var(--color-text-accent),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.xcunlro.xcunlro.xcunlro:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:color-mix(in srgb,var(--color-text-primary),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.x7jm8ul.x7jm8ul.x7jm8ul:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:color-mix(in srgb,var(--color-text-secondary),var(--color-tint-hover) 15%)}}
  @media (hover: hover){.xo5jvnm.xo5jvnm.xo5jvnm:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){color:var(--color-text-primary)}}
  @media (pointer: coarse){.xom6oz5.xom6oz5.xom6oz5:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){transform:scale(1)}}
  @container (max-width: 399px){.x1alyx8p.x1alyx8p:not(#\#):not(#\#):not(#\#){flex-wrap:wrap}}
  @media (forced-colors: active){.x1vo6n7o.x1vo6n7o:active:not(#\#):not(#\#):not(#\#){background-color:Highlight}}
  @media (hover: hover){.x1otsd3y.x1otsd3y.x1otsd3y:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-hover),var(--color-overlay-hover)),linear-gradient(var(--color-neutral),var(--color-neutral))}}
  @media (pointer: coarse){.x5lqen6.x5lqen6:active:not(#\#):not(#\#):not(#\#){transform:scale(1)}}
  @media (pointer: coarse){.x1s5nr2v.x1s5nr2v.x1s5nr2v:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:transparent}}
  @media (pointer: coarse){.xvbnuu.xvbnuu.xvbnuu:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-neutral),var(--color-neutral))}}
  @media (hover: hover){.xo3fi6e.xo3fi6e.xo3fi6e:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed)),linear-gradient(var(--color-neutral),var(--color-neutral))}}
  @media (hover: hover){.xetgvay.xetgvay.xetgvay:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:linear-gradient(var(--color-overlay-pressed),var(--color-overlay-pressed))}}
  @media (pointer: coarse){.x3f84ok.x3f84ok.x3f84ok:active:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-image:none}}
  @media (pointer: coarse){@media (forced-colors: none){.xowtp19.xowtp19.xowtp19.xowtp19:where(.x1iwu4tg:active *):not(#\#):not(#\#):not(#\#){background-image:none}}}
  @media (hover: hover){@media (forced-colors: active){.x1d42zcn.x1d42zcn.x1d42zcn.x1d42zcn:hover:where(:not(:disabled,[aria-disabled="true"])):not(#\#):not(#\#):not(#\#){background-color:Highlight}}}
  @media (pointer: coarse){@media (forced-colors: none){.x1p4304o.x1p4304o.x1p4304o.x1p4304o:where(.x1iwu4tg[data-astryx-press="fading"] *):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}}}
  @media (pointer: coarse){@media (forced-colors: none){.xphwcek.xphwcek.xphwcek.xphwcek:where(.x1iwu4tg[data-astryx-press="on"] *):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}}}
  .xib2hle:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-color:var(--color-border-emphasized)}
  .xw8gpjh:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-color:var(--color-border)}
  .x1q0q8m5:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-style:solid}
  .x1qhh985:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:0}
  .xso031l:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:1px}
  .xlxy82:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:2px}
  .x92x3c3:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:var(--border-width)}
  .x1mly77v:not(#\#):not(#\#):not(#\#):not(#\#){border-top-color:var(--color-border-emphasized)}
  .x1pc3f07:not(#\#):not(#\#):not(#\#):not(#\#){border-top-color:var(--color-border)}
  .x11npmm7:not(#\#):not(#\#):not(#\#):not(#\#){border-top-color:var(--color-on-accent)}
  .x13fuv20:not(#\#):not(#\#):not(#\#):not(#\#){border-top-style:solid}
  .x178xt8z:not(#\#):not(#\#):not(#\#):not(#\#){border-top-width:1px}
  .x11xkdxz:not(#\#):not(#\#):not(#\#):not(#\#){border-top-width:var(--border-width)}
  .x1ey2m1c:not(#\#):not(#\#):not(#\#):not(#\#){bottom:0}
  .x1c7jfne:not(#\#):not(#\#):not(#\#):not(#\#){bottom:2px}
  .xyi47jn:not(#\#):not(#\#):not(#\#):not(#\#){bottom:var(--_tab-indicator-bottom,-1px)}
  .xvxfwfv:not(#\#):not(#\#):not(#\#):not(#\#){bottom:var(--astryx-layer-inset-block-end,0px)}
  .x112dmjn:not(#\#):not(#\#):not(#\#):not(#\#){bottom:var(--spacing-1)}
  .x1nqzi6q:not(#\#):not(#\#):not(#\#):not(#\#){bottom:var(--x-bottom)}
  .xvle69y:not(#\#):not(#\#):not(#\#):not(#\#){height:.75rem}
  .xqtp20y:not(#\#):not(#\#):not(#\#):not(#\#){height:0}
  .xmll18r:not(#\#):not(#\#):not(#\#):not(#\#){height:1.25rem}
  .xam5rvr:not(#\#):not(#\#):not(#\#):not(#\#){height:1.5rem}
  .x5yr21d:not(#\#):not(#\#):not(#\#):not(#\#){height:100%}
  .xtdtrs8:not(#\#):not(#\#):not(#\#):not(#\#){height:100dvh}
  .xpyat2d:not(#\#):not(#\#):not(#\#):not(#\#){height:100px}
  .x1dr59a3:not(#\#):not(#\#):not(#\#):not(#\#){height:100vh}
  .x170jfvy:not(#\#):not(#\#):not(#\#):not(#\#){height:10px}
  .x1wkxgih:not(#\#):not(#\#):not(#\#):not(#\#){height:120px}
  .x1kpxq89:not(#\#):not(#\#):not(#\#):not(#\#){height:12px}
  .xhjk10j:not(#\#):not(#\#):not(#\#):not(#\#){height:140px}
  .x1v9usgg:not(#\#):not(#\#):not(#\#):not(#\#){height:14px}
  .x1ymw6g:not(#\#):not(#\#):not(#\#):not(#\#){height:160px}
  .xlup9mm:not(#\#):not(#\#):not(#\#):not(#\#){height:16px}
  .xmix8c7:not(#\#):not(#\#):not(#\#):not(#\#){height:18px}
  .xlzyvqe:not(#\#):not(#\#):not(#\#):not(#\#){height:1em}
  .xg2ss61:not(#\#):not(#\#):not(#\#):not(#\#){height:1lh}
  .xjm9jq1:not(#\#):not(#\#):not(#\#):not(#\#){height:1px}
  .x1l36t39:not(#\#):not(#\#):not(#\#):not(#\#){height:1rem}
  .x1qx5ct2:not(#\#):not(#\#):not(#\#):not(#\#){height:20px}
  .xxk0z11:not(#\#):not(#\#):not(#\#):not(#\#){height:24px}
  .x1fgtraw:not(#\#):not(#\#):not(#\#):not(#\#){height:28px}
  .x36qwtl:not(#\#):not(#\#):not(#\#):not(#\#){height:2px}
  .x10w6t97:not(#\#):not(#\#):not(#\#):not(#\#){height:32px}
  .xuoj239:not(#\#):not(#\#):not(#\#):not(#\#){height:3px}
  .x1vqgdyp:not(#\#):not(#\#):not(#\#):not(#\#){height:40px}
  .xsdox4t:not(#\#):not(#\#):not(#\#):not(#\#){height:48px}
  .xqu0tyb:not(#\#):not(#\#):not(#\#):not(#\#){height:4px}
  .xols6we:not(#\#):not(#\#):not(#\#):not(#\#){height:6px}
  .xwzfr38:not(#\#):not(#\#):not(#\#):not(#\#){height:80px}
  .xdk7pt:not(#\#):not(#\#):not(#\#):not(#\#){height:8px}
  .x1qjb5ga:not(#\#):not(#\#):not(#\#):not(#\#){height:anchor-size(--outline-active height,0px)}
  .xt7dq6l:not(#\#):not(#\#):not(#\#):not(#\#){height:auto}
  .xuk38ov:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(100% - var(--tree-list-row-gap,0px) / 2)}
  .xs02d24:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(100% + 1px)}
  .x12qplqi:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(100% + var(--container-padding-block-start,0px) + var(--container-padding-block-end,0px))}
  .xpa73km:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(100dvh - var(--_app-shell-header-height,0px))}
  .x1tpcejd:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--_sheet-budget) + 48px)}
  .x1uiybsj:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-lg) - 4px)}
  .x102lyln:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-lg) - 8px)}
  .x184gfjb:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-md) - 4px)}
  .xrmxcn7:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-md) - 8px)}
  .x1u5rhrp:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-md) + var(--spacing-1))}
  .xzj98nu:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-sm) - 4px)}
  .xzydfjl:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--size-element-sm) - 8px)}
  .xdya1qv:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--table-resize-height,100%) - var(--table-resize-offset,0px))}
  .x1mutkkf:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--text-body-size) * var(--text-body-leading));height:1lh}
  .x1q370uo:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--text-body-size) * var(--text-body-leading))}
  .x14o5nre:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(var(--text-supporting-size) * var(--text-supporting-leading))}
  .xw1wawg:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(44px - 8px)}
  .xg7h5cd:not(#\#):not(#\#):not(#\#):not(#\#){height:fit-content}
  .xsbjeu0:not(#\#):not(#\#):not(#\#):not(#\#){height:min(var(--spacing-6),40px)}
  .xhovv34:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--_progressbar-mark-height,8px)}
  .x7yyq19:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--_spinner-box-size)}
  .xsyqizj:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--border-width)}
  .x5kfih4:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--resize-handle-hit-area,16px)}
  .xssyfek:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--size-element-lg)}
  .x1ueg155:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--size-element-md)}
  .x6k0iem:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--size-element-sm)}
  .x1b2l0oc:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-0-5)}
  .xcenk2v:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-1-5)}
  .x11c6zpc:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-1)}
  .x1k15mir:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-12)}
  .xoqw5ej:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-2)}
  .x9gl9lo:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-3)}
  .x6b6gus:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-4)}
  .x1grt7ep:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-5)}
  .xvpftlf:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-6)}
  .x18to7ep:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--spacing-8)}
  .x1seg80s:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--text-large-size)}
  .x15rwvks:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--text-supporting-size)}
  .x16ye13r:not(#\#):not(#\#):not(#\#):not(#\#){height:var(--x-height)}
  .xm8gem:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(6 * 44px)}
  .x6hpsvf:not(#\#):not(#\#):not(#\#):not(#\#){height:28px}
  .x1nrll8i:not(#\#):not(#\#):not(#\#):not(#\#){left:50%}
  .x1jyxor1:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:-1px}
  .x1if0o47:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:-48px}
  .xat24cr:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:0}
  .xlgak1e:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * (max(var(--_tab-strip-bleed),calc(-1 * var(--_tab-indicator-bottom,-1px)))))}
  .x1z0f2p2:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--_chat-composer-radius))}
  .x13i4uq0:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--astryx-number-input-padding-block-end,var(--astryx-number-input-padding,var(--spacing-1))))}
  .x6h7pi7:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--container-padding-block-end,0px))}
  .x1cdrix3:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--radius-chat))}
  .xdrfirk:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--spacing-1-5))}
  .xlstkdb:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-0-5)}
  .x14cgwvg:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-1)}
  .x1p37lm5:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-2)}
  .xep27e5:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-3)}
  .xwh1t77:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-4)}
  .x4d5cxa:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--spacing-6)}
  .xlm3tn6:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--x-marginBlockEnd)}
  .x1chv945:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:var(--x1ot8se4,calc(var(--spacing-4) + max(var(--astryx-layer-inset-block-start, 0px), var(--astryx-layer-inset-block-end, 0px))))}
  .x119uzjn:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(max(var(--spacing-4), env(safe-area-inset-top, 0px), env(safe-area-inset-bottom, 0px)) + max(var(--astryx-layer-inset-block-start, 0px), var(--astryx-layer-inset-block-end, 0px)))}
  .xdj266r:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:0}
  .xr1yuqi:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:auto}
  .xmqyaqf:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * (var(--_tab-strip-bleed)))}
  .xvyqdj1:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * anchor-size(height) - 8px)}
  .xckg3cf:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--_chat-composer-radius))}
  .x3dbumh:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--_field-status-overlap,var(--spacing-1-5)))}
  .x5j3pgv:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--astryx-number-input-padding-block-start,var(--astryx-number-input-padding,var(--spacing-1))))}
  .x1sa9bsh:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--container-padding-block-start,0px))}
  .x1c40v9y:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--spacing-1-5))}
  .x1ajqlyv:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--spacing-2))}
  .x1oms9s6:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc((1em * var(--text-body-leading) - 20px) / 2)}
  .x1233pnv:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc((1em * var(--text-body-leading) - 6px) / 2)}
  .xjc2qm6:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-0-5)}
  .xcsaf9d:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-1)}
  .xtbrsbv:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-2)}
  .xj6sv8s:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-3)}
  .x1s1qpeq:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-4)}
  .x13rv44w:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-6)}
  .x1vhfslr:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--x-marginBlockStart)}
  .x3390rn:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--x1ot8se4,calc(var(--spacing-4) + max(var(--astryx-layer-inset-block-start, 0px), var(--astryx-layer-inset-block-end, 0px))))}
  .x1lhixnp:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(max(var(--spacing-4), env(safe-area-inset-top, 0px), env(safe-area-inset-bottom, 0px)) + max(var(--astryx-layer-inset-block-start, 0px), var(--astryx-layer-inset-block-end, 0px)))}
  .xmz0i5r:not(#\#):not(#\#):not(#\#):not(#\#){max-height:100%}
  .x1wj9ous:not(#\#):not(#\#):not(#\#):not(#\#){max-height:100dvh}
  .x18s7i0i:not(#\#):not(#\#):not(#\#):not(#\#){max-height:176px}
  .x1xiyphd:not(#\#):not(#\#):not(#\#):not(#\#){max-height:240px}
  .xuyqlj2:not(#\#):not(#\#):not(#\#):not(#\#){max-height:300px}
  .xbhvqqn:not(#\#):not(#\#):not(#\#):not(#\#){max-height:calc(100% - var(--spacing-3))}
  .x14bu9tk:not(#\#):not(#\#):not(#\#):not(#\#){max-height:calc(92dvh + 48px)}
  .x1uh1i8a:not(#\#):not(#\#):not(#\#):not(#\#){max-height:min(300px,calc(100vh - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-block-start, 0px) - var(--astryx-layer-inset-block-end, 0px)));max-height:min(300px,calc(100dvb - calc(max(var(--spacing-4), env(safe-area-inset-top, 0px)) + var(--astryx-layer-inset-block-start, 0px)) - calc(max(var(--spacing-4), env(safe-area-inset-bottom, 0px)) + var(--astryx-layer-inset-block-end, 0px))))}
  .xpnbb6b:not(#\#):not(#\#):not(#\#):not(#\#){max-height:min(480px,calc(100vh - 32px))}
  .x7ab17h:not(#\#):not(#\#):not(#\#):not(#\#){max-height:none}
  .xenllk4:not(#\#):not(#\#):not(#\#):not(#\#){max-height:var(--container-max-height,none)}
  .xbmfmqd:not(#\#):not(#\#):not(#\#):not(#\#){max-height:var(--x-maxBlockSize)}
  .x1jols5v:not(#\#):not(#\#):not(#\#):not(#\#){max-height:var(--x-maxHeight)}
  .xv8yize:not(#\#):not(#\#):not(#\#):not(#\#){max-height:var(--x17ekfff,calc(100vh - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-block-start, 0px) - var(--astryx-layer-inset-block-end, 0px)))}
  .x1m189uc:not(#\#):not(#\#):not(#\#):not(#\#){max-width:0}
  .x193iq5w:not(#\#):not(#\#):not(#\#):not(#\#){max-width:100%}
  .xlbgzzq:not(#\#):not(#\#):not(#\#):not(#\#){max-width:100dvw}
  .x55n99s:not(#\#):not(#\#):not(#\#):not(#\#){max-width:15em}
  .x1ncir08:not(#\#):not(#\#):not(#\#):not(#\#){max-width:200px}
  .xw5ewwj:not(#\#):not(#\#):not(#\#):not(#\#){max-width:300px}
  .xxc7z9f:not(#\#):not(#\#):not(#\#):not(#\#){max-width:360px}
  .x1j9u4d2:not(#\#):not(#\#):not(#\#):not(#\#){max-width:400px}
  .x17fpy1y:not(#\#):not(#\#):not(#\#):not(#\#){max-width:480px}
  .xrlsmeg:not(#\#):not(#\#):not(#\#):not(#\#){max-width:600px}
  .x11gisft:not(#\#):not(#\#):not(#\#):not(#\#){max-width:640px}
  .x1ap80js:not(#\#):not(#\#):not(#\#):not(#\#){max-width:800px}
  .xq8v1hd:not(#\#):not(#\#):not(#\#):not(#\#){max-width:90%}
  .x1rfgw7b:not(#\#):not(#\#):not(#\#):not(#\#){max-width:calc(100% + var(--container-padding-inline-start,0px) + var(--container-padding-inline-end,0px))}
  .xl6temz:not(#\#):not(#\#):not(#\#):not(#\#){max-width:max(80%,280px)}
  .x1m1aaou:not(#\#):not(#\#):not(#\#):not(#\#){max-width:min(960px,calc(100dvw - var(--spacing-4)))}
  .x1x1rfll:not(#\#):not(#\#):not(#\#):not(#\#){max-width:none}
  .xjl2t3p:not(#\#):not(#\#):not(#\#):not(#\#){max-width:var(--layout-content-width,none)}
  .x1jys5uj:not(#\#):not(#\#):not(#\#):not(#\#){max-width:var(--size-element-md)}
  .xf68679:not(#\#):not(#\#):not(#\#):not(#\#){max-width:var(--x-maxWidth)}
  .x1p5vr2b:not(#\#):not(#\#):not(#\#):not(#\#){max-width:var(--xdig2zt,calc(100vw - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-inline-start, 0px) - var(--astryx-layer-inset-inline-end, 0px)))}
  .x2lwn1j:not(#\#):not(#\#):not(#\#):not(#\#){min-height:0}
  .x1us19tq:not(#\#):not(#\#):not(#\#):not(#\#){min-height:100%}
  .x1ov3xa9:not(#\#):not(#\#):not(#\#):not(#\#){min-height:100dvh}
  .xz65tgg:not(#\#):not(#\#):not(#\#):not(#\#){min-height:200px}
  .xisnujt:not(#\#):not(#\#):not(#\#):not(#\#){min-height:20px}
  .xe0957l:not(#\#):not(#\#):not(#\#):not(#\#){min-height:22px}
  .xjwf9q1:not(#\#):not(#\#):not(#\#):not(#\#){min-height:24px}
  .xe0p6wg:not(#\#):not(#\#):not(#\#):not(#\#){min-height:28px}
  .x21xpn4:not(#\#):not(#\#):not(#\#):not(#\#){min-height:32px}
  .x121v3j4:not(#\#):not(#\#):not(#\#):not(#\#){min-height:min-content}
  .x1xf4nls:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--size-element-lg)}
  .x1uogy3y:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--size-element-md)}
  .x1gdqauq:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--size-element-sm)}
  .x175cymr:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--spacing-2)}
  .ximsjs8:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--spacing-7)}
  .xkoleio:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--spacing-8)}
  .x82snj4:not(#\#):not(#\#):not(#\#):not(#\#){min-height:var(--x-minHeight)}
  .x1dg37ty:not(#\#):not(#\#):not(#\#):not(#\#){min-height:44px}
  .xeuugli:not(#\#):not(#\#):not(#\#):not(#\#){min-width:0}
  .xgqtt45:not(#\#):not(#\#):not(#\#):not(#\#){min-width:100%}
  .x1i9suas:not(#\#):not(#\#):not(#\#):not(#\#){min-width:120px}
  .x1d77m7x:not(#\#):not(#\#):not(#\#):not(#\#){min-width:140px}
  .x1b27s9g:not(#\#):not(#\#):not(#\#):not(#\#){min-width:160px;min-width:min(160px,calc(100vw - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-inline-start, 0px) - var(--astryx-layer-inset-inline-end, 0px)));min-width:min(160px,calc(100vi - calc(max(var(--spacing-4), env(safe-area-inset-left, 0px)) + var(--astryx-layer-inset-inline-start, 0px)) - calc(max(var(--spacing-4), env(safe-area-inset-right, 0px)) + var(--astryx-layer-inset-inline-end, 0px))))}
  .x5w4yej:not(#\#):not(#\#):not(#\#):not(#\#){min-width:160px}
  .xfb3i0g:not(#\#):not(#\#):not(#\#):not(#\#){min-width:180px}
  .xgomdpo:not(#\#):not(#\#):not(#\#):not(#\#){min-width:1rem}
  .x1jzhcrs:not(#\#):not(#\#):not(#\#):not(#\#){min-width:200px}
  .xt4ypqs:not(#\#):not(#\#):not(#\#):not(#\#){min-width:20px}
  .x12rczxh:not(#\#):not(#\#):not(#\#):not(#\#){min-width:220px}
  .xlm99nl:not(#\#):not(#\#):not(#\#):not(#\#){min-width:240px}
  .x1u2d2a2:not(#\#):not(#\#):not(#\#):not(#\#){min-width:280px}
  .x1fns5xo:not(#\#):not(#\#):not(#\#):not(#\#){min-width:40px}
  .x900493:not(#\#):not(#\#):not(#\#):not(#\#){min-width:48px}
  .x13n9wmd:not(#\#):not(#\#):not(#\#):not(#\#){min-width:4ch}
  .xfvyar9:not(#\#):not(#\#):not(#\#):not(#\#){min-width:60px}
  .x187xtus:not(#\#):not(#\#):not(#\#):not(#\#){min-width:72px}
  .xviorkc:not(#\#):not(#\#):not(#\#):not(#\#){min-width:anchor-size(width);min-width:min(anchor-size(width),calc(100vw - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-inline-start, 0px) - var(--astryx-layer-inset-inline-end, 0px)));min-width:min(anchor-size(width),calc(100vi - calc(max(var(--spacing-4), env(safe-area-inset-left, 0px)) + var(--astryx-layer-inset-inline-start, 0px)) - calc(max(var(--spacing-4), env(safe-area-inset-right, 0px)) + var(--astryx-layer-inset-inline-end, 0px))))}
  .xrzjruh:not(#\#):not(#\#):not(#\#):not(#\#){min-width:anchor-size(width)}
  .x15x72sd:not(#\#):not(#\#):not(#\#):not(#\#){min-width:auto}
  .x8wyhu6:not(#\#):not(#\#):not(#\#):not(#\#){min-width:calc(anchor-size(width) + 16px)}
  .x1pshirs:not(#\#):not(#\#):not(#\#):not(#\#){min-width:fit-content}
  .xk8lq53:not(#\#):not(#\#):not(#\#):not(#\#){min-width:max-content}
  .xg3bzn3:not(#\#):not(#\#):not(#\#):not(#\#){min-width:min(400px,calc(100vw - var(--spacing-4) - var(--spacing-4) - var(--astryx-layer-inset-inline-start, 0px) - var(--astryx-layer-inset-inline-end, 0px)));min-width:min(400px,calc(100vi - calc(max(var(--spacing-4), env(safe-area-inset-left, 0px)) + var(--astryx-layer-inset-inline-start, 0px)) - calc(max(var(--spacing-4), env(safe-area-inset-right, 0px)) + var(--astryx-layer-inset-inline-end, 0px))))}
  .x17ydmr0:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--size-element-md)}
  .x1nkkqge:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--size-element-sm)}
  .x18ki04u:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--spacing-2)}
  .x16asifk:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--spacing-5)}
  .xy8csz5:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--spacing-7)}
  .xkj4a21:not(#\#):not(#\#):not(#\#):not(#\#){min-width:var(--x-minWidth)}
  .x1tutbut:not(#\#):not(#\#):not(#\#):not(#\#){min-width:44px}
  .xw2csxc:not(#\#):not(#\#):not(#\#):not(#\#){overflow-x:auto}
  .x101abm8:not(#\#):not(#\#):not(#\#):not(#\#){overflow-x:clip}
  .x6ikm8r:not(#\#):not(#\#):not(#\#):not(#\#){overflow-x:hidden}
  .xyto64x:not(#\#):not(#\#):not(#\#):not(#\#){overflow-x:var(--x-overflowX)}
  .x1odjw0f:not(#\#):not(#\#):not(#\#):not(#\#){overflow-y:auto}
  .x10wlt62:not(#\#):not(#\#):not(#\#):not(#\#){overflow-y:hidden}
  .x4ncuvb:not(#\#):not(#\#):not(#\#):not(#\#){overflow-y:var(--x-overflowY)}
  .x7p5m3t:not(#\#):not(#\#):not(#\#):not(#\#){overscroll-behavior-x:contain}
  .x18d9i69:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:0}
  .x1j85h84:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:1px}
  .x1wkw6tp:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:calc(env(safe-area-inset-bottom,0px) + 48px)}
  .x9jihrk:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:calc(var(--_chat-composer-padding) + var(--_chat-composer-radius))}
  .xbv1mwh:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:calc(var(--container-padding-block-end) - var(--border-width))}
  .xxbfulo:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:calc(var(--spacing-3) + var(--radius-chat))}
  .xwhchk8:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:max(var(--_tab-strip-bleed),calc(-1 * var(--_tab-indicator-bottom,-1px)))}
  .xew4nw4:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:max(var(--spacing-4),env(safe-area-inset-bottom,0px))}
  .xvpcij2:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--_chat-composer-padding)}
  .x1rgxemn:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--astryx-dialog-padding-block-end,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-bottom,0px))))}
  .x3jnfsm:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--astryx-number-input-padding-block-end,var(--astryx-number-input-padding,var(--spacing-1)))}
  .xc1wllq:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--container-padding-block-end)}
  .xg476vw:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--layout-padding-inner-y,var(--spacing-4))}
  .x1363qu6:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--layout-padding-own-outer-y,var(--layout-padding-outer-y,var(--spacing-4)))}
  .xij103a:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-0-5)}
  .x1l20ajd:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-0)}
  .x1opdxmq:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-1-5)}
  .xy143xn:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-1)}
  .x2izi54:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-10)}
  .x1wesfrj:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-2)}
  .xvmdzux:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-3)}
  .x1awphl8:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-4)}
  .x1hk98q:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-5)}
  .xjpqqx5:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-6)}
  .xekm6fs:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-7)}
  .x2oz4g1:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:var(--spacing-8)}
  .xexx8yu:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:0}
  .x1htvmrp:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:calc(var(--_chat-composer-padding) + var(--_chat-composer-radius))}
  .xdgtoc0:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:calc(var(--_field-status-overlap,var(--spacing-1-5)) + var(--spacing-2))}
  .x1enrzb7:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:calc(var(--border-width) + var(--spacing-1))}
  .x1nex4ik:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:calc(var(--container-padding-block-start) - var(--border-width))}
  .x1vjezoa:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:max(var(--spacing-4),env(safe-area-inset-top,0px))}
  .x2gtn7z:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--_chat-composer-padding)}
  .xlr2r7p:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--_tab-strip-bleed)}
  .x15ld1ci:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--astryx-dialog-padding-block-start,var(--astryx-dialog-padding,max(var(--spacing-4),env(safe-area-inset-top,0px))))}
  .x4kswst:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--astryx-number-input-padding-block-start,var(--astryx-number-input-padding,var(--spacing-1)))}
  .x14m0hsi:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--container-padding-block-start)}
  .xqty4a:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--layout-padding-inner-y,var(--spacing-4))}
  .xuqi0w:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--layout-padding-own-outer-y,var(--layout-padding-outer-y,var(--spacing-4)))}
  .xbx876j:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-0-5)}
  .x1ydh6w3:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-0)}
  .x1kwdpsa:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-1-5)}
  .xfsso4q:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-1)}
  .xk6660b:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-10)}
  .x1xye8es:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-2)}
  .x1vlblms:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-3)}
  .x1oa1p4a:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-4)}
  .xx7rijo:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-5)}
  .x1adxfkp:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-6)}
  .xoxd1wu:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-8)}
  .x13vifvy:not(#\#):not(#\#):not(#\#):not(#\#){top:0}
  .xuivejd:not(#\#):not(#\#):not(#\#):not(#\#){top:14px}
  .xs7f9wi:not(#\#):not(#\#):not(#\#):not(#\#){top:2px}
  .xwa60dl:not(#\#):not(#\#):not(#\#):not(#\#){top:50%}
  .x1ltwjim:not(#\#):not(#\#):not(#\#):not(#\#){top:anchor(--outline-active top,0px)}
  .x80663w:not(#\#):not(#\#):not(#\#):not(#\#){top:auto}
  .x7rbydg:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(50% - (28px / 2))}
  .x1oysc8t:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-lg) / 2 - 1px)}
  .xkmsrut:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-md) / 2 - 1px)}
  .x1968x6z:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-sm) / 2 - 1px)}
  .xht72ud:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--_app-shell-header-height,0px)}
  .xawarol:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--astryx-layer-inset-block-start,0px)}
  .x8d4r5l:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--spacing-1)}
  .xctzyg:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--spacing-2)}
  .xyx6v2t:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--spacing-3)}
  .xjbys53:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--x-top)}
  .x1jw3ynk:not(#\#):not(#\#):not(#\#):not(#\#){width:.75rem}
  .xnalus7:not(#\#):not(#\#):not(#\#):not(#\#){width:0}
  .xwqq7k2:not(#\#):not(#\#):not(#\#):not(#\#){width:1.25rem}
  .xp8d6y2:not(#\#):not(#\#):not(#\#):not(#\#){width:1.5rem}
  .xh8yej3:not(#\#):not(#\#):not(#\#):not(#\#){width:100%}
  .x1o6l61p:not(#\#):not(#\#):not(#\#):not(#\#){width:100dvw}
  .xn9wirt:not(#\#):not(#\#):not(#\#):not(#\#){width:100vw}
  .x1fsd2vl:not(#\#):not(#\#):not(#\#):not(#\#){width:10px}
  .xsmyaan:not(#\#):not(#\#):not(#\#):not(#\#){width:12px}
  .x6jxa94:not(#\#):not(#\#):not(#\#):not(#\#){width:14px}
  .x1kky2od:not(#\#):not(#\#):not(#\#):not(#\#){width:16px}
  .xzjbwwf:not(#\#):not(#\#):not(#\#):not(#\#){width:180px}
  .x1xp8n7a:not(#\#):not(#\#):not(#\#):not(#\#){width:18px}
  .x15vhz18:not(#\#):not(#\#):not(#\#):not(#\#){width:1em}
  .x1i1rx1s:not(#\#):not(#\#):not(#\#):not(#\#){width:1px}
  .xcdlrvm:not(#\#):not(#\#):not(#\#):not(#\#){width:1rem}
  .x1oysuqx:not(#\#):not(#\#):not(#\#):not(#\#){width:200px}
  .xw4jnvo:not(#\#):not(#\#):not(#\#):not(#\#){width:20px}
  .xafpxmx:not(#\#):not(#\#):not(#\#):not(#\#){width:240px}
  .xvy4d1p:not(#\#):not(#\#):not(#\#):not(#\#){width:24px}
  .x1hfn5x7:not(#\#):not(#\#):not(#\#):not(#\#){width:260px}
  .xfo62xy:not(#\#):not(#\#):not(#\#):not(#\#){width:2px}
  .x1td3qas:not(#\#):not(#\#):not(#\#):not(#\#){width:32px}
  .x1g8rjiy:not(#\#):not(#\#):not(#\#):not(#\#){width:3px}
  .xz84dc7:not(#\#):not(#\#):not(#\#):not(#\#){width:40%}
  .x1l2rt3b:not(#\#):not(#\#):not(#\#):not(#\#){width:400px}
  .x100vrsf:not(#\#):not(#\#):not(#\#):not(#\#){width:40px}
  .x51ohtg:not(#\#):not(#\#):not(#\#):not(#\#){width:4px}
  .x1fu8urw:not(#\#):not(#\#):not(#\#):not(#\#){width:64px}
  .x1v4s8kt:not(#\#):not(#\#):not(#\#):not(#\#){width:6px}
  .x1xc55vz:not(#\#):not(#\#):not(#\#):not(#\#){width:8px}
  .x1xgy17j:not(#\#):not(#\#):not(#\#):not(#\#){width:anchor-size(width)}
  .x14atkfc:not(#\#):not(#\#):not(#\#):not(#\#){width:auto}
  .xx6qvi6:not(#\#):not(#\#):not(#\#):not(#\#){width:calc(100% + var(--container-padding-inline-start,0px) + var(--container-padding-inline-end,0px))}
  .x1y2t9nm:not(#\#):not(#\#):not(#\#):not(#\#){width:calc(44px - 8px)}
  .xeq5yr9:not(#\#):not(#\#):not(#\#):not(#\#){width:fit-content}
  .xezivpi:not(#\#):not(#\#):not(#\#):not(#\#){width:max-content}
  .x1qwjaml:not(#\#):not(#\#):not(#\#):not(#\#){width:max(0px,calc(-1 * calc(var(--_item-swipe-travel,0px) * var(--_item-swipe-dir,1))))}
  .x96shys:not(#\#):not(#\#):not(#\#):not(#\#){width:max(0px,calc(var(--_item-swipe-travel,0px) * var(--_item-swipe-dir,1)))}
  .x17cz0of:not(#\#):not(#\#):not(#\#):not(#\#){width:min(var(--spacing-6),40px)}
  .x63cpjl:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--_progressbar-mark-width,2px)}
  .x6v0vjy:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--_spinner-box-size)}
  .xjk4fl7:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--border-width)}
  .xkhob8h:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--resize-handle-hit-area,16px)}
  .x1m747yf:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--size-element-lg)}
  .x805d0l:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--size-element-md)}
  .x1fvqzum:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--size-element-sm)}
  .x1wu31ai:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-1-5)}
  .xx9zwd3:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-1)}
  .xhgvbfk:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-12)}
  .x1f0dxl5:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-2)}
  .x1ad1g3v:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-3)}
  .x12xnipv:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-4)}
  .xfyiiit:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-5)}
  .x1mtvzj0:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-6)}
  .xgc8j7m:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--spacing-8)}
  .xta46cu:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--text-large-size)}
  .x5livx5:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--text-supporting-size)}
  .x1uyokj7:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--x-inlineSize)}
  .x5lhr3w:not(#\#):not(#\#):not(#\#):not(#\#){width:var(--x-width)}
  .x1wp2rvj.x1wp2rvj:where(.x139im0d:last-child *):not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:0}
  .x1vonza8.x1vonza8:where(.astryx-input-group > *):not(#\#):not(#\#):not(#\#):not(#\#){height:100%}
  .x132qfvm:focus-within:not(#\#):not(#\#):not(#\#):not(#\#){height:auto}
  .xsg11nj.xsg11nj:where(.x-default-marker:has(> .astryx-layout-footer:not([data-divider])) *):not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:0}
  .x1ioh5az.x1ioh5az:where(.x-default-marker:has(> .astryx-layout-header:not([data-divider])) *):not(#\#):not(#\#):not(#\#):not(#\#){padding-top:0}
  .x1kw28su:focus-within:not(#\#):not(#\#):not(#\#):not(#\#){padding-top:var(--spacing-1)}
  .x10okhzq:focus-within:not(#\#):not(#\#):not(#\#):not(#\#){width:auto}
  .x5du68j:has(~ * [data-chat-name]):not(#\#):not(#\#):not(#\#):not(#\#){margin-top:var(--spacing-5)}
  .xzzx6db:has([role="radio"]:not([aria-label])):not(#\#):not(#\#):not(#\#):not(#\#){max-width:100%}
  .xnpzo02:has(> div > .astryx-layout-content):not(#\#):not(#\#):not(#\#):not(#\#){max-width:none}
  .xpgkkid:has(> .astryx-layout-content):not(#\#):not(#\#):not(#\#):not(#\#){max-width:none}
  .xmzx3xy:has([role="radio"]:not([aria-label])):not(#\#):not(#\#):not(#\#):not(#\#){min-width:0}
  .x1d9v4yf:first-child:not(#\#):not(#\#):not(#\#):not(#\#){border-top-style:none}
  .x1g31smg:first-child:not(#\#):not(#\#):not(#\#):not(#\#){border-top-width:0}
  .xkibk3:first-child:not(#\#):not(#\#):not(#\#):not(#\#){margin-top:calc(-1 * var(--container-padding-block-start,0px))}
  .x1vjq31q:first-child:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:0}
  .x1t1lzn6:last-child:not(#\#):not(#\#):not(#\#):not(#\#){border-bottom-width:0}
  .xlayyun:last-child:not(#\#):not(#\#):not(#\#):not(#\#){margin-bottom:calc(-1 * var(--container-padding-block-end,0px))}
  .xup0pd7:last-child:not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:0}
  .xcax4zt:placeholder-shown:not(#\#):not(#\#):not(#\#):not(#\#){min-width:1px}
  .x1o13q2w:placeholder-shown:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-lg) / 2 - 1px)}
  .x811pv0:placeholder-shown:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-md) / 2 - 1px)}
  .x1a21zuh:placeholder-shown:not(#\#):not(#\#):not(#\#):not(#\#){top:calc(var(--size-element-sm) / 2 - 1px)}
  .xbuu7xz:placeholder-shown:not(#\#):not(#\#):not(#\#):not(#\#){width:calc(100% - calc(var(--spacing-1) - 1px) - var(--_tokenizer-end-lane-reserve,calc(var(--spacing-1) - 1px)) - 2px - 1px)}
  .x15cytp8:focus:not(#\#):not(#\#):not(#\#):not(#\#){height:auto}
  .x1rw3289:focus:not(#\#):not(#\#):not(#\#):not(#\#){top:var(--spacing-2)}
  .x1jqxupm:focus:not(#\#):not(#\#):not(#\#):not(#\#){width:auto}
  @media (any-pointer: coarse){.x1d3wnk4.x1d3wnk4:not(#\#):not(#\#):not(#\#):not(#\#){height:24px}}
  @media (pointer: coarse){.x80b3aj.x80b3aj:not(#\#):not(#\#):not(#\#):not(#\#){min-height:24px}}
  @media (pointer: coarse){.x17aqpur.x17aqpur:not(#\#):not(#\#):not(#\#):not(#\#){min-height:44px}}
  @media (pointer: coarse){.xygd9yz.xygd9yz:not(#\#):not(#\#):not(#\#):not(#\#){min-height:44px}}
  @media (pointer: coarse){.xkagaj0.xkagaj0:not(#\#):not(#\#):not(#\#):not(#\#){min-width:24px}}
  @media (pointer: coarse){.x1xrq5m.x1xrq5m:not(#\#):not(#\#):not(#\#):not(#\#){min-width:44px}}
  @media (pointer: coarse){.xngvp7v.xngvp7v:not(#\#):not(#\#):not(#\#):not(#\#){min-width:44px}}
  @media (any-pointer: coarse){.x1c4064q.x1c4064q:not(#\#):not(#\#):not(#\#):not(#\#){width:24px}}
  @supports (-webkit-touch-callout: none){@media (pointer: coarse){.x9w4715.x9w4715.x9w4715:not(#\#):not(#\#):not(#\#):not(#\#){height:calc(max(1rem,var(--text-body-size)) * var(--text-body-leading));height:1lh}}}
  .x8s9nux[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){animation-duration:.2s}
  .xziyay6[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){animation-fill-mode:both}
  .x14e4jsf[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){animation-name:x10jkm1t-B}
  .xwkbtvz[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){animation-timing-function:cubic-bezier(0,0,.2,1)}
  .x7qqc7o[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:var(--color-neutral)}
  .xf3x42i[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:var(--color-neutral)}
  .x1bev2v5[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:none}
  .x524tya[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:none}
  @starting-style{.x1sopeo2.x1sopeo2:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){grid-template-rows:0fr}}
  .x1xsm0q9:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset:-14px}
  .xarstr8:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset:0}
  .xxx281p:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{inset:0}
  .xht581f:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset:var(--_input-clear-hit-inset)}
  .xeu5z55:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset:var(--_thumbnail-hit-inset)}
  @starting-style{.x4itv7f.x4itv7f:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){opacity:0}}
  .x1ylxtyb[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:none}
  .x3y5scg[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:scale(.98)}
  @starting-style{.x6mt36l.x6mt36l:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateX(-100%)}}
  @starting-style{.x1yqmsfc.x1yqmsfc:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateX(100%)}}
  @starting-style{.xub2912.xub2912:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateY(-100%)}}
  @starting-style{.x12p7p72.x12p7p72:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateY(-4px)}}
  @starting-style{.xhbqy3z.xhbqy3z:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateY(100%)}}
  @starting-style{.x6s140c.x6s140c:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateY(var(--_toast-slide-y,var(--spacing-2)))}}
  .x13ugjdw.x13ugjdw:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:transparent}
  .xl8sb5e.xl8sb5e:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:transparent}
  .x1qxwyo6.x1qxwyo6:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image),linear-gradient(var(--color-neutral),var(--color-neutral))}
  .x5rw36h.x5rw36h:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image),linear-gradient(var(--color-neutral),var(--color-neutral))}
  .x7ngsy6.x7ngsy6:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}
  .xubczrd.xubczrd:where(:not(:disabled,[aria-disabled="true"]))[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-image:var(--_press-paint-image)}
  @starting-style{.x1lymnkk.x1lymnkk:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateX(-100%)}}
  @starting-style{.x14gflnl.x14gflnl:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){transform:translateX(100%)}}
  @media (forced-colors: active){.x1pjcgc3.x1pjcgc3[data-astryx-press="fading"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:Highlight}}
  @media (forced-colors: active){.x1r4mieh.x1r4mieh[data-astryx-press="on"]:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){background-color:Highlight}}
  .x1k48kgn:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-radius:inherit}
  .xxyica1:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{border-radius:inherit}
  .xq94oqs:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-radius:var(--radius-full)}
  .xtb6wbx:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-radius:var(--radius-inner)}
  .x17gn2l9:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{grid-column:1}
  .xd54j2p:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset-block:0}
  .xpsyfx0:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{margin-block:0}
  .x1qqcexc:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{margin-inline:0}
  .x1x4c3m6:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{padding-block:0}
  .xtbxizx:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-datetime-edit{padding-block:0}
  @starting-style{.x5rzir7.x5rzir7:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#){padding-bottom:0}}
  .xkqr7wz:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{padding-inline:0}
  .xslb4at:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-datetime-edit{padding-inline:0}
  .xvtkv6q:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transition:background-color .15s ease,width .15s ease}
  .x17s1k9h:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transition:opacity .15s ease}
  .x19ds33d:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{align-self:start}
  .x1abwkk1:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{backdrop-filter:blur(2px)}
  .xyhc2n1:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:transparent}
  .x1l0fnur:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:var(--_press-overlay)}
  .x1tzqye7:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{background-color:var(--color-accent)}
  .xnixb3f:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{background-color:var(--color-overlay)}
  .x1i3206j:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:var(--indicator-color,transparent)}
  .x1uvfo0n:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{background-color:var(--table-row-overlay,transparent)}
  .xccdyz0:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:linear-gradient(to left,var(--color-shadow),transparent)}
  .x1ppu1g5:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:linear-gradient(to right,var(--color-shadow),transparent)}
  .xnnzo76:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-inline-start-color:var(--color-border)}
  .xvsnedh:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-inline-start-style:solid}
  .x1p96cux:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{border-inline-start-width:var(--border-width)}
  .x147exv5:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{color:var(--color-syntax-added-marker)}
  .xtkarl4:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{color:var(--color-syntax-punctuation)}
  .x16hy5kr:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{color:var(--color-syntax-removed-marker)}
  .xnf3u0:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::placeholder{color:var(--color-text-disabled)}
  .xeyghm5:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::placeholder{color:var(--color-text-secondary)}
  .x1cpjm7i:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{content:""}
  .x1s928wv:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{content:""}
  .x46gnpd:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{content:attr(data-line)}
  .x1mls8ih:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{content:counter(astryx-list, lower-alpha) "."}
  .xdaf9gw:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{content:counter(astryx-list, lower-roman) "."}
  .xc2ndz5:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{content:counter(astryx-list) "."}
  .xh3pasq:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{content:var(--_input-clear-hit-content)}
  .xhkezso:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{display:block}
  .xolhmmf:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-calendar-picker-indicator{display:none}
  .x3nzp0f:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{font-family:var(--font-family-code)}
  .xekda60:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{inset-inline-end:-2px}
  .x1unh1gc:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset-inline-end:0}
  .xvw6utc:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{inset-inline-start:-2px}
  .x1iygr5g:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset-inline-start:0}
  .x1km86hw:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{inset-inline-start:calc(var(--spacing-4) + var(--_codeblock-gutter-width) + var(--spacing-3))}
  .x15bqym3:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-datetime-edit{line-height:inherit}
  .x1f74mqm:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{line-height:inherit}
  .xph5o2a:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{opacity:0}
  .xb3n6bw:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{opacity:1}
  .xni466t:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{opacity:var(--_sheet-scrim-opacity,1)}
  .x1c2idit:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{opacity:var(--table-sticky-shadow-end,0)}
  .x1sggmfs:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{opacity:var(--table-sticky-shadow-start,0)}
  .x2q1x1w:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{pointer-events:none}
  .xkk1bqk:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{pointer-events:none}
  .x1hmns74:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{position:absolute}
  .x1j6awrg:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{position:absolute}
  .x1wnbjh8:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{text-align:end}
  .x9rmy9g:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{text-align:start}
  .x1fgylwi:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform-origin:center top}
  .xgu12d:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform-origin:left center}
  .x1e8txe:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform:scaleX(0)}
  .xp1ps4y:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform:scaleX(1)}
  .xb5f74o:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform:scaleY(0)}
  .xd30wvy:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform:scaleY(1)}
  .xvs0bi2:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transform:translateX(-100%)}
  .x1qyefdi:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transform:translateX(100%)}
  .x142juwg:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-behavior:allow-discrete}
  .xizoc3:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-delay:var(--x-owu7oy)}
  .x18w5vxb:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transition-duration:var(--_press-overlay-transition)}
  .x1y1nw7a:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-duration:var(--duration-fast)}
  .xft5bk6:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-duration:var(--duration-medium)}
  .xuhr57t:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-duration:var(--duration-medium)}
  .x196sc62:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-duration:var(--x-1dd27dc)}
  .x1ywzrc5:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transition-property:background-color}
  .xxcwgru:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-property:background-color}
  .xc0dz0a:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-property:opacity,display}
  .x167zut7:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-property:opacity}
  .x1hu8v7x:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-property:transform}
  .x1cz9k3x:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-timing-function:linear}
  .xyt8op7:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-timing-function:linear}
  .x15h3t91:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-timing-function:var(--ease-standard)}
  .x1dlmc9c:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transition-timing-function:var(--ease-standard)}
  .xa5v58t:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-timing-function:var(--ease-standard)}
  .x1rbqspl:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{-webkit-user-select:none;user-select:none}
  .xy5mcqj:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{z-index:-1}
  .xzywxsk.xzywxsk:where(.x1odsvnm:active *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:var(--color-overlay-pressed)}
  .x2kv6q6.x2kv6q6:where(.x1odsvnm:active:not(:has(a:active,button:active,[role="button"]:active,[role="link"]:active)) *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:var(--color-overlay-pressed)}
  .xk7vujl:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:linear-gradient(to left,var(--color-shadow),transparent)}
  .xlptwl5:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:linear-gradient(to right,var(--color-shadow),transparent)}
  .xdq8fwl:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transform-origin:right center}
  .x1c108yo:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transform:translateX(-100%)}
  .x12ayhd5:is([dir="rtl"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{transform:translateX(100%)}
  @media (prefers-reduced-motion: reduce){.xhhm9v0.xhhm9v0:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-delay:0s}}
  @media (prefers-reduced-motion: reduce){.x1viac0w.x1viac0w:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{transition-duration:.01s}}
  @media (prefers-reduced-motion: reduce){.x13sdc92.x13sdc92:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{transition-duration:0s}}
  @media (pointer: coarse){.x1gybruy.x1gybruy.x1gybruy:where(.x1odsvnm:active *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:transparent}}
  @media (pointer: coarse){.xapkq76.xapkq76.xapkq76:where(.x1odsvnm:active:not(:has(a:active,button:active,[role="button"]:active,[role="link"]:active)) *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-color:transparent}}
  @media (pointer: coarse){.x1ikgzpo.x1ikgzpo.x1ikgzpo:where(.x1odsvnm[data-astryx-press="on"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:var(--_press-paint-image)}}
  @media (pointer: coarse){.xsozn46.xsozn46.xsozn46:where(.x1odsvnm[data-astryx-press="fading"] *):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{background-image:var(--_press-paint-image)}}
  .xe80sof:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{bottom:-2px}
  .x1xrz1ek:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{bottom:0}
  .xu6fald:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{height:var(--_sheet-keyboard-inset,0px)}
  .xec4aax:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::-webkit-date-and-time-value{min-height:0}
  .x51xajf:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::before{top:-2px}
  .x1m1drc7:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{top:0}
  .xkj6t0a:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{width:0}
  .xzkji8o:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{width:6px}
  .xi8c0p9:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::after{width:var(--indicator-width,1px)}
  @starting-style{.xxiuuzi.xxiuuzi:not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#):not(#\#)::backdrop{opacity:0}}
}


@layer priority1, priority2, priority3, priority4, priority5, priority6;
@property --x-width { syntax: "*"; inherits: false;}
@property --x-height { syntax: "*"; inherits: false;}
@property --x-fontSize { syntax: "*"; inherits: false;}
@keyframes x1wc8ddo-B{from{transform:rotate(0deg);}to{transform:rotate(360deg);}}
:root, .xkv17yg{--x1upgk0d:1;--x4izrdt:1.25;--xpaxrgw:1.625;--xkm99e0:Inter;--xbj2g4d:Inter-Regular;--x1nuy5tb:Inter-SemiBold;--x1kz3iu:Inter-Bold;--xahz2cc:Inter-Italic;--xjcesp8:InterVariable;--x18lg445:InterVariable-Italic;--x14lb18e:10px;--x1vaozn8:12px;--xrhlpgc:14px;--x131aim5:16px;--x67wltv:16px;--x6incdp:18px;--x1vmya28:20px;--x1yt3flf:22px;--x5i3d6m:26px;--x1a26mup:32px;--x40gspv:40px;--xxq9rdk:2px;--x1a6pvc1:4px;--xl2yw7o:8px;--xp8f0ja:12px;--x9r80ky:16px;--x13ys6sy:20px;--x1hdsvrc:24px;--xu3qclj:28px;--xva978s:32px;--x15l1h1k:40px;--x1fjokkk:italic;--x15nj7ra:400;--xl7oa1h:500;--xpvlhpi:600;--x10123e7:800;--x5b5g24:2px;--x3fnlj1:4px;--x1ud8vtb:8px;--xxmfzyb:12px;--x1rgwvtn:16px;--xlb5w0k:999px;--x1ldif33:#ffffff;--xf19ryi:#212529;--x1ltegcc:#ec4899;--x1ec7dkm:#000000;--xh9kgpf:#dee2e6;--x1x3yiq:#fbfbfc;--xo8qu2v:#f8f9fa;--xacgx6k:#f8f9fa;--x1gzxsx8:#e9ecef;--x1hta45d:#dee2e6;--xhskem5:#ced4da;--xt95z2r:#adb5bd;--xvpcptt:#6c757d;--xw750ha:#6c757d;--x1hadker:#495055;--x1hfwhfn:#343a40;--xfaa0hi:#212529;--x64arkr:#ffffff06;--x9e0aej:#ffffff0d;--x17x4q2x:#ffffff1a;--x1v4x7hv:#ffffff33;--xvlaedz:#ffffff4d;--xejo5tu:#ffffff66;--x1un6z2q:#ffffff80;--xpr51u5:#ffffff8c;--x9zgr0u:#ffffff99;--x121dxcj:#ffffffb3;--x1300git:#ffffffcc;--xyvuhyw:#ffffffff;--x1siqe1y:#00000006;--xgqsmp3:#0000000d;--xylhkyp:#0000001a;--x1bfmmck:#00000033;--xegh0ab:#0000004d;--x1ypqg74:#00000066;--xv9bwuc:#00000080;--x2kwzq3:#0000008c;--xfomotg:#00000099;--x9u2nyf:#000000b3;--xzfa39s:#000000cc;--x15q5od0:#000000ff;--xxupzyg:#fbfbfc;--x1kt1zn2:#f8f9fa;--x7rpxpz:#f8f9fa;--x1besk2v:#e9ecef;--x16oz10g:#dee2e6;--x1t764tu:#ced4da;--x1q9c2wz:#adb5bd;--x1sewkds:#6c757d;--x1fh9na:#6c757d;--x1qwmldi:#495055;--xk7eo96:#343a40;--xd93dmn:#212529;--x1ruxhy2:#f0f6fe;--x1ljiqfh:#e1eeff;--x8sslol:#a8cbfe;--x1tgj8be:#81b4fe;--x3hbhlg:#5a9cfe;--x1pq967p:#3485fd;--x2nkukf:#0d6efd;--xhlmjm9:#025ce2;--x1k4is71:#0d6efd;--x107sxa6:#0b5cd5;--x1gg5hik:#094bac;--xent46u:#073984;--x7d66wi:#05285b;--x1tf82fo:#f6fdf5;--x1diy7j5:#ebfae9;--x7wxzgx:#b1e7a6;--xkwejie:#8ad879;--x706ndn:#64c84c;--x1su2w49:#3db91f;--x1phi9qn:#19b600;--xctzpfo:#148f00;--xpq1d7m:#19b600;--x1pteeys:#159900;--x8rya83:#117b00;--x1cizpss:#0d5e00;--xo4aje0:#094100;--x8m09v2:#fff5f4;--x910uht:#feeaeb;--xwfu9wx:#f7b9b4;--xjzh7nq:#f49a93;--x176x9vt:#f17b72;--x29mg4i:#ed5c50;--xs2t4s5:#ea3d2f;--x1ncjylw:#dc2516;--xi1zg4f:#ea3d2f;--xmftjc4:#c53327;--x1tjo2uk:#9f2920;--x1iywbrq:#7a2018;--x17cxkn4:#541611;--x2orbku:#fefaf2;--xcsy6hg:#fef5e4;--x1pldo8v:#fbe0ac;--xjsw04r:#f9d387;--xobi25q:#f7c562;--xw7g23u:#f5b83d;--x2ko9n3:#f3aa18;--xh0eic1:#d9950b;--x1hsqmi7:#f3aa18;--xbwm2ud:#cc8f14;--xbd9ey7:#a57410;--x1f87dr9:#7e580c;--xgnpd67:#573d09;}
.x16yd1ti.x16yd1ti, .x16yd1ti.x16yd1ti:root{--xf19ryi:#212529;--x7rpxpz:#212529;--x1besk2v:#343a40;--xxupzyg:#212529;--x16oz10g:#495055;--x1t764tu:#6c757d;--x1kt1zn2:#212529;--x1q9c2wz:#adb5bd;--x1fh9na:#ced4da;--x1qwmldi:#dee2e6;--xk7eo96:#e9ecef;--xd93dmn:#f8f9fa;--x1ltegcc:#ec4899;--xwfu9wx:#541611;--xjzh7nq:#7a2018;--x8m09v2:#541611;--x176x9vt:#9f2920;--x29mg4i:#c53327;--x910uht:#541611;--xs2t4s5:#ea3d2f;--xmftjc4:#ed5c50;--x1tjo2uk:#f17b72;--x1iywbrq:#f49a93;--x17cxkn4:#f7b9b4;--x7wxzgx:#094100;--xkwejie:#0d5e00;--x1tf82fo:#094100;--x706ndn:#117b00;--x1su2w49:#159900;--x1diy7j5:#094100;--x1phi9qn:#19b600;--x1pteeys:#3db91f;--x8rya83:#64c84c;--x1cizpss:#8ad879;--xo4aje0:#b1e7a6;--x8sslol:#05285b;--x1tgj8be:#073984;--x1ruxhy2:#05285b;--x3hbhlg:#094bac;--x1pq967p:#0b5cd5;--x1ljiqfh:#05285b;--x2nkukf:#0d6efd;--x107sxa6:#3485fd;--x1gg5hik:#5a9cfe;--xent46u:#81b4fe;--x7d66wi:#a8cbfe;--x1ec7dkm:#000000;--x1pldo8v:#573d09;--xjsw04r:#7e580c;--x2orbku:#573d09;--xobi25q:#a57410;--xw7g23u:#cc8f14;--xcsy6hg:#573d09;--x2ko9n3:#f3aa18;--xbwm2ud:#f5b83d;--xbd9ey7:#f7c562;--x1f87dr9:#f9d387;--xgnpd67:#fbe0ac;--x1ldif33:#ffffff;}
@layer priority2{
.x10a8y8t{inset:0}
.x1ghz6dp{margin:0}
.x1oin6zd{margin:10px}
.xhifcr4{margin:20px}
.x1bpp3o7{margin:auto}
.x1w4blf{margin:var(--x1a6pvc1)}
.x1717udv{padding:0}
.x7z7khe{padding:10px}
.xc7ga6q{padding:12px}
.x1tamke2{padding:16px}
.xyf9f8g{padding:1px}
.x1qhigcl{padding:20px}
.x1i3ajwb{padding:2px}
.x9ms5i6{padding:3px}
.xfawy5m{padding:4px}
.xe8ttls{padding:8px}
.x1shk3sm{padding:var(--spacing-4)}
.x1ikrqgu{padding:var(--spacing-5)}
.x13nihcx{padding:var(--x13ys6sy)}
.xf1bb1d{padding:var(--x15l1h1k)}
.x1o2bggc{padding:var(--x1a6pvc1)}
.x1ls8ib2{padding:var(--x1hdsvrc)}
.x1uu7695{padding:var(--x9r80ky)}
.xe6vs8v{padding:var(--xl2yw7o)}
.x1ou8277{padding:var(--xp8f0ja)}
.x1vqcqi9{padding:var(--xu3qclj)}
.x1poqbw1{padding:var(--xva978s)}
}
@layer priority3{
.xxrpp8w{border-color:#3f3f3f}
.x6g0381{border-color:#b2fa57}
.xzawuh{border-color:#bbb}
.x19zwky6{border-color:#cacaca}
.xgjtq22{border-color:#d8d8d8}
.x1wnvi63{border-color:#dee2e6}
.xevbkmu{border-color:#dfe1e4}
.xlyv6qp{border-color:#edcf73}
.xjk1sbn{border-color:#f0f0f0}
.xzo1ggo{border-color:#f3f3f3}
.x1h8xh5j{border-color:#f8f9fa}
.xg29ltk{border-color:#fff}
.x12u0lhd{border-color:rgba(255,255,255,.76)}
.x9r1u3d{border-color:transparent}
.x11bxy9m{border-color:var(--x107sxa6)}
.x93991f{border-color:var(--x16oz10g)}
.xif7yvg{border-color:var(--x176x9vt)}
.x1ovr8uy{border-color:var(--x1besk2v)}
.xrazkxs{border-color:var(--x1ec7dkm)}
.x1oz7zka{border-color:var(--x1gzxsx8)}
.xng4579{border-color:var(--x1hadker)}
.x1bthqtr{border-color:var(--x1hsqmi7)}
.x1df4h50{border-color:var(--x1hta45d)}
.x17phema{border-color:var(--x1k4is71)}
.x1t71yg4{border-color:var(--x1kt1zn2)}
.x1dz4u57{border-color:var(--x1ldif33)}
.x14n6l5h{border-color:var(--x1phi9qn)}
.xm3abc9{border-color:var(--x1pldo8v)}
.xmypu9v{border-color:var(--x1q9c2wz)}
.xty8bzp{border-color:var(--x1qwmldi)}
.x1bno417{border-color:var(--x1t764tu)}
.xz5063h{border-color:var(--x2nkukf)}
.x6nzmpm{border-color:var(--x3hbhlg)}
.xbmzlud{border-color:var(--x7rpxpz)}
.x173qh14{border-color:var(--x7wxzgx)}
.x1lg64o1{border-color:var(--xacgx6k)}
.x1gxtncu{border-color:var(--xfaa0hi)}
.x19cey2f{border-color:var(--xh9kgpf)}
.xbplrlw{border-color:var(--xhlmjm9)}
.x7s701s{border-color:var(--xhskem5)}
.x191oypf{border-color:var(--xi1zg4f)}
.x131vp1j{border-color:var(--xpq1d7m)}
.xg3xfp5{border-color:var(--xs2t4s5)}
.x17izkzh{border-color:var(--xt95z2r)}
.xuqhtl8{border-color:var(--xw750ha)}
.x1k4hu5t{border-color:var(--xylhkyp)}
.x2u8bby{border-radius:0}
.x1q4ynmn{border-radius:10px}
.x4pepcl{border-radius:12px}
.x9h44rk{border-radius:13px}
.xn5hx6u{border-radius:15px}
.xgqmno8{border-radius:16px}
.xugzpu4{border-radius:18px}
.x1m3ak92{border-radius:20px}
.x13pz1uv{border-radius:22px}
.x13e3gmj{border-radius:23px}
.x14o3kyb{border-radius:26px}
.x1cum3z5{border-radius:2px}
.xpzoddv{border-radius:35px}
.x18zih8k{border-radius:3px}
.x12oqio5{border-radius:4px}
.x16rqkct{border-radius:50%}
.x1sxf85j{border-radius:5px}
.x1kogg8i{border-radius:6px}
.xu4hgxq{border-radius:7px}
.xur7f20{border-radius:8px}
.x10hpsqq{border-radius:9999px}
.x1e6avla{border-radius:999px}
.xx3sua9{border-radius:var(--radius-inner)}
.xujkapg{border-radius:var(--x1rgwvtn)}
.x5f99kx{border-radius:var(--x1ud8vtb)}
.xto4e4o{border-radius:var(--x3fnlj1)}
.xmw0ros{border-radius:var(--x5b5g24)}
.xnuhxmu{border-radius:var(--xl2yw7o)}
.x1b1croe{border-radius:var(--xlb5w0k)}
.xo2ykqs{border-radius:var(--xxmfzyb)}
.xbsl7fq{border-style:dashed}
.xng3xce{border-style:none}
.x1y0btm7{border-style:solid}
.xc342km{border-width:0}
.xmkeg23{border-width:1px}
.xdh2fpr{border-width:2px}
.x9r2w2z{border-width:3px}
.x1b0bnr5{flex:0}
.x98rzlu{flex:1}
.x1i0uq9b{flex:2}
.x1b68738{flex:3}
.x1svi29p{flex:4}
.x1tkgfop{flex:8}
.xam14yx{font-variant:no-contextual}
.x1v04owx{font-variant:tabular-nums}
.xxhr3t{gap:0}
.x1v2ro7d{gap:12px}
.x1qg7m3j{gap:15px}
.xou54vl{gap:16px}
.x1c1vhfx{gap:20px}
.x1665zp3{gap:24px}
.x195vfkc{gap:2px}
.x1ed6fcf{gap:3px}
.x1jnr06f{gap:4px}
.x3up9cc{gap:52px}
.x1nejdyq{gap:5px}
.x167g77z{gap:8px}
.x1h8offi{gap:var(--x13ys6sy)}
.x1sii2sj{gap:var(--x1a6pvc1)}
.x1rodh5w{gap:var(--x1hdsvrc)}
.x3las6w{gap:var(--x9r80ky)}
.x1rzs2vg{gap:var(--xl2yw7o)}
.x51oe94{gap:var(--xp8f0ja)}
.xuwssno{gap:var(--xva978s)}
.x1sazthg{gap:var(--xxq9rdk)}
.x10no89f{inset-block:0}
.xe8uvvx{list-style:none}
.x1jp4ehj{margin-block:8px}
.x1b6ykf0{outline:0}
.x1a2a7pz{outline:none}
.xysyzu8{overflow:auto}
.xb3r6kr{overflow:hidden}
.x1algulf{overflow:scroll}
.x1rea2x4{overflow:visible}
.xish69e{overscroll-behavior:contain}
.xt970qd{padding-block:0}
.x10dr8xq{padding-block:12px}
.xqp6ajr{padding-block:20px}
.xj8oexa{padding-block:2px}
.x1na6nto{padding-block:var(--spacing-4)}
.x9wpqrl{padding-block:var(--xl2yw7o)}
.xnjsko4{padding-inline:0}
.x1awh872{padding-inline:10px}
.x1hr3lfm{padding-inline:16px}
.x17qtykl{padding-inline:20px}
.xm9j1uf{padding-inline:5px}
.x1pzlopt{padding-inline:var(--spacing-4)}
.x1vxi2wf{padding-inline:var(--x1a6pvc1)}
.x1hl2dhg{text-decoration:none}
.xw430in{transition:all .3s ease-in-out}
.x1wzofgn{transition:all ease-out .15s}
.x1d5hn2h{transition:background-color .05s ease}
.x1ind35z{transition:transform .12s ease-out,background-color .12s ease-out}
.x1cdn2t:hover{border-color:#6c757d}
.xoruic6:hover{border-color:#cacaca}
.x1fdke2o:hover{border-color:#dfbd58}
.x1dsjv9i:hover{border-color:#dfe1e4}
.xt74ef5:hover{border-color:#e8e8e8}
.x1w5ijd1:hover{border-color:var(--x1gg5hik)}
.x1ngcl7x:hover{border-color:var(--x1gzxsx8)}
.x26xutg:hover{border-color:var(--x1hadker)}
.xhwbbpo:hover{border-color:var(--x1hsqmi7)}
.x15rq2yu:hover{border-color:var(--x1hta45d)}
.x13d4qn5:hover{border-color:var(--x1k4is71)}
.xeqqq9o:hover{border-color:var(--x1ncjylw)}
.x14zmhko:hover{border-color:var(--x1t764tu)}
.xjq2xj8:hover{border-color:var(--x1tjo2uk)}
.x1560rwu:hover{border-color:var(--x8rya83)}
.x11ixc6e:hover{border-color:var(--xbd9ey7)}
.x1uq2gnn:hover{border-color:var(--xctzpfo)}
.x1rgzspb:hover{border-color:var(--xegh0ab)}
.x16d57db:hover{border-color:var(--xh0eic1)}
.x4f7yf9:hover{border-color:var(--xhlmjm9)}
.x1lx37cp:hover{border-color:var(--xi1zg4f)}
.xnywcc4:hover{border-color:var(--xpq1d7m)}
.xukl0sx:hover{border-color:var(--xw750ha)}
.xt0b8zv:hover{text-decoration:underline}
.xfznsic:focus{border-color:#6c757d}
.xle128s:focus{border-color:#cacaca}
.xmqso59:focus{border-color:#e8e8e8}
.x1mmardj:focus{border-color:var(--x16oz10g)}
.xpvdom2:focus{border-color:var(--x1gzxsx8)}
.xupkk3u:focus{border-color:var(--xw750ha)}
}
@layer priority4{
.x1lugfcp{-webkit-appearance:none}
.x87dema{-webkit-backdrop-filter:blur(1px)}
.xs1r7gh{-webkit-backdrop-filter:none}
.x1ua5tub{-webkit-box-orient:vertical}
.x1h7i4cw{-webkit-line-clamp:2}
.x1i10hfl{-webkit-tap-highlight-color:transparent}
.x4465f1{align-content:end}
.x1pha0wt{align-items:baseline}
.x6s0dn4{align-items:center}
.xuk3077{align-items:flex-end}
.x1cy8zhl{align-items:flex-start}
.x1qjc9v5{align-items:stretch}
.xamitd3{align-self:center}
.xpvyfi4{align-self:flex-end}
.xqcrz7y{align-self:flex-start}
.xkh2ocl{align-self:stretch}
.x1c74tu6{animation-duration:2s}
.xa4qsjk{animation-iteration-count:infinite}
.x1aerksh{animation-name:x1wc8ddo-B}
.x1esw782{animation-timing-function:linear}
.xjyslct{appearance:none}
.x1plog1{aspect-ratio:1}
.xuw900x{aspect-ratio:attr(width)  / attr(height)}
.x1xe0dkm{backdrop-filter:blur(1px)}
.x1t853zo{backdrop-filter:none}
.x1qnd873{background-color:#002B51}
.xzhql22{background-color:#02ca37}
.x1kl84k5{background-color:#0d6efd}
.x1rcugw8{background-color:#0f457d}
.x1z04lf4{background-color:#111111}
.x10y7jy{background-color:#19b600}
.xxpp5wv{background-color:#242424}
.x30m8ow{background-color:#353b49}
.x1lnzjnk{background-color:#424156}
.xa56f1z{background-color:#525252}
.x1fkxg7p{background-color:#6c757d}
.xvrraga{background-color:#96a5bd}
.xyafxpt{background-color:#d6d6d6}
.x1o22s1l{background-color:#d9f3fb}
.xe6fny{background-color:#d9fdd3}
.x1keprpi{background-color:#dce1ef}
.x1hg6pl2{background-color:#dff1ff}
.x1d6q70{background-color:#e1eeff}
.xnv9r7t{background-color:#e4f3fd}
.x125g5fk{background-color:#e5e5e5}
.xli6bxb{background-color:#e9ecef}
.x19sgy3q{background-color:#ea3d2f}
.x13smabj{background-color:#ebf6ff}
.xekswlc{background-color:#ebfae9}
.x13ri40t{background-color:#ececec}
.x1vm2n5u{background-color:#eec780}
.x3fngm5{background-color:#efeae2}
.x15yo4kd{background-color:#f0f0f0}
.xdu83i5{background-color:#f0f2f5}
.x14863pf{background-color:#f1f3f5}
.x1hdrmwn{background-color:#f3aa18}
.x1ktjzyy{background-color:#f3f3f3}
.xmiktxe{background-color:#f8f9fa}
.xvwe5au{background-color:#fdf0eb}
.xvc4lur{background-color:#feeaeb}
.x7zbl5n{background-color:#feecf0}
.x1h2rkcp{background-color:#fef5e4}
.x127a1ql{background-color:#ff9800}
.x1flk3dw{background-color:#ffcaba}
.x1tfm557{background-color:#ffebaf}
.x85r2rh{background-color:#ffedb7}
.x1jfv0qe{background-color:#fff1bd}
.x18fe6us{background-color:#fffced}
.x1c5tqo3{background-color:#ffffff}
.x3o2ed7{background-color:4ellow}
.x42x0ya{background-color:black}
.x6tqnqi{background-color:pink}
.x15sir8a{background-color:rgba(0,0,0,.07)}
.x1g8cxd0{background-color:rgba(0,0,0,.23)}
.xy2ypai{background-color:rgba(0,0,0,.24)}
.x1wel3ma{background-color:rgba(0,0,0,.25)}
.xj4c5ne{background-color:rgba(0,0,0,.3)}
.x1sag07j{background-color:rgba(0,0,0,.35)}
.xa44r0r{background-color:rgba(0,0,0,.45)}
.x1jfsb7t{background-color:rgba(0,0,0,.54)}
.xphf14w{background-color:rgba(0,0,0,.58)}
.x14q89n7{background-color:rgba(0,0,0,.65)}
.x1m9af4x{background-color:rgba(0,0,0,.72)}
.xd7i8e9{background-color:rgba(0,0,0,.76)}
.x1l1cup3{background-color:rgba(13,110,253,.2)}
.xafi402{background-color:rgba(17,24,39,.86)}
.xz9wetj{background-color:rgba(229,229,229,.25)}
.x10z44ze{background-color:rgba(231,241,255,.3)}
.x1xqp7fi{background-color:rgba(255,255,255,.14)}
.x74mqcx{background-color:rgba(255,255,255,.16)}
.xrweaip{background-color:rgba(255,255,255,.5)}
.x9gdurp{background-color:rgba(255,255,255,.65)}
.xftg0ou{background-color:rgba(255,255,255,.7)}
.x1wparz{background-color:rgba(255,255,255,.72)}
.xp1gzrp{background-color:rgba(255,255,255,.75)}
.x3l3weh{background-color:rgba(255,255,255,.92)}
.xz37sua{background-color:rgba(9,38,116,.85)}
.xjbqb8w{background-color:transparent}
.x1o0wnni{background-color:var(--color-background-blue)}
.x10xzikg{background-color:var(--color-background-surface)}
.xxyk5bv{background-color:var(--x107sxa6)}
.xmjgb92{background-color:var(--x1300git)}
.x2mp7u0{background-color:var(--x14r1z6w)}
.x2tqwyx{background-color:var(--x16oz10g)}
.x2i3kxk{background-color:var(--x1besk2v)}
.x1j1ze6z{background-color:var(--x1diy7j5)}
.x14ci7hs{background-color:var(--x1ec7dkm)}
.xze2wi7{background-color:var(--x1gzxsx8)}
.x18zjpyp{background-color:var(--x1hadker)}
.xnd57y5{background-color:var(--x1hsqmi7)}
.xm19i5g{background-color:var(--x1hta45d)}
.x2r3j36{background-color:var(--x1k4is71)}
.x18ou8ue{background-color:var(--x1kt1zn2)}
.x1sudk5n{background-color:var(--x1ldif33)}
.x17sz4x7{background-color:var(--x1ljiqfh)}
.xhnchc3{background-color:var(--x1phi9qn)}
.x1ms0tie{background-color:var(--x1pldo8v)}
.x9ht9jp{background-color:var(--x1q9c2wz)}
.x1a7qz2s{background-color:var(--x1tf82fo)}
.xpqajyk{background-color:var(--x1x3yiq)}
.xybxtc4{background-color:var(--x2ko9n3)}
.x13e93nc{background-color:var(--x2nkukf)}
.x10bzsgr{background-color:var(--x2orbku)}
.x1mg2a28{background-color:var(--x7rpxpz)}
.x1az0a8x{background-color:var(--x8rya83)}
.x1u018cu{background-color:var(--x8sslol)}
.x6mm5zu{background-color:var(--x910uht)}
.x16eykc4{background-color:var(--xacgx6k)}
.xwtxrh4{background-color:var(--xcsy6hg)}
.x1rg6g9w{background-color:var(--xf19ryi)}
.x1d96ix0{background-color:var(--xfaa0hi)}
.xa7nny{background-color:var(--xgqsmp3)}
.xrwkgoa{background-color:var(--xh9kgpf)}
.xycafk2{background-color:var(--xhlmjm9)}
.xtq9kcf{background-color:var(--xhskem5)}
.x1mcp1qf{background-color:var(--xi1zg4f)}
.x1h4hd6c{background-color:var(--xk7eo96)}
.x19ru6h3{background-color:var(--xo8qu2v)}
.x1vtvorq{background-color:var(--xp8ul3m)}
.xmms12p{background-color:var(--xpq1d7m)}
.x1x8wzh5{background-color:var(--xs2t4s5)}
.x1c88sjo{background-color:var(--xt95z2r)}
.x1t9ffjf{background-color:var(--xufqp9t)}
.x7ziyk0{background-color:var(--xw750ha)}
.x1uo8ux6{background-color:var(--xwfu9wx)}
.x1w88u3g{background-color:var(--xylhkyp)}
.x1vr089q{background-color:whitesmoke}
.x1gejf6u{border-inline-end-color:var(--color-border)}
.x18b5jzi{border-inline-end-style:solid}
.x10w94by{border-inline-end-width:0}
.xw8tdv1{border-inline-end-width:var(--border-width)}
.x1j92z86{border-inline-start-color:var(--color-border)}
.x1t7ytsu{border-inline-start-style:solid}
.xgbv0en{border-inline-start-width:var(--border-width)}
.x5zv5cm{box-shadow:0 0 0 1px var(--x2nkukf)}
.xpq8j58{box-shadow:0 0 0 2px var(--x1ec7dkm)}
.x135vj0p{box-shadow:0 0 0 2px var(--x1k4is71)33}
.x1m72i7c{box-shadow:0 0 0 2px var(--x1qwmldi)}
.xfbm4y6{box-shadow:0 0 10px rgba(0,0,0,.1)}
.xmnlk68{box-shadow:0 10px 40px rgba(0,0,0,.22),0 0 16px rgba(0,0,0,.17)}
.x1weridl{box-shadow:0 1px 2px rgba(0,0,0,.06)}
.x1barp0i{box-shadow:0 1px 2px rgba(0,0,0,.2)}
.x1f96sxv{box-shadow:0 1px 3px rgba(0,0,0,.12)}
.xxr66ec{box-shadow:0 1px 6px rgba(0,0,0,.12)}
.x1bcjcdy{box-shadow:0 1px 8px rgba(0,0,0,.1),0 4px 20px rgba(0,0,0,.12)}
.x136bn5e{box-shadow:0 1px 8px rgba(0,0,0,.1),0 4px 32px rgba(0,0,0,.1),0 8px 64px rgba(0,0,0,.12)}
.x1lbf6lf{box-shadow:0 1px 8px rgba(0,0,0,.1),0 4px 32px rgba(0,0,0,.1)}
.xe8p4sd{box-shadow:0 2px 8px rgba(0,0,0,.14)}
.xu2sx8m{box-shadow:0 3px 8px var(--xoft8xo)}
.x16ome7r{box-shadow:0 4px 12px rgba(0,0,0,.15)}
.xobqyoe{box-shadow:0 4px 16px rgba(0,0,0,.16)}
.x735ykj{box-shadow:0 4px 18px rgba(0,0,0,.18)}
.xlqpsuk{box-shadow:0 4px 20px rgba(0,0,0,.18)}
.x10fe3q7{box-shadow:0 4px 6px -1px rgba(0,0,0,.1),0 2px 4px -1px rgba(0,0,0,.06)}
.xn88y6a{box-shadow:0 5px 14px rgba(0,0,0,.14)}
.xniq61t{box-shadow:0 6px 24px rgba(0,0,0,.2)}
.xaeqyxe{box-shadow:0 8px 24px rgba(0,0,0,.16)}
.x6ct3qo{box-shadow:0 8px 24px rgba(0,0,0,.18)}
.xlee6jv{box-shadow:0 8px 24px rgba(0,0,0,.32)}
.x1uk563t{box-shadow:0 8px 28px rgba(0,0,0,.16)}
.xjv9mk6{box-shadow:0 8px 28px rgba(0,0,0,.18)}
.x13dw0no{box-shadow:0 8px 30px rgba(0,0,0,.16)}
.x1gnnqk1{box-shadow:none}
.x3ahypy{box-shadow:rgba(0,0,0,.09) 0 1px 4px}
.x1xaewcv{box-shadow:rgba(0,0,0,.18) 0 1px 3px}
.x1kcpxr7{box-shadow:var(--shadow-high)}
.x9f619{box-sizing:border-box}
.xhvmetw{color:#00869e}
.x1jyroqx{color:#0b5cd5}
.x1487i13{color:#0d6efd}
.xss4q31{color:#104c7b}
.x1n69cu3{color:#111111}
.x11nrg1n{color:#159900}
.xqqgst7{color:#19b600}
.x1525slw{color:#333}
.x33gn0b{color:#666}
.x36lisw{color:#6c757d}
.x19sobpt{color:#750000}
.xzdwuq0{color:#8291e8}
.x1g3taxb{color:#888}
.x1ot86a9{color:#905a00}
.x51u02w{color:#adb5bd}
.x5ttv7o{color:#c53327}
.x1dqtfzn{color:#cacaca}
.x4ylp02{color:#cc8f14}
.x1jlblf{color:#ea3d2f}
.x1nizjcf{color:#f3aa18}
.x15p5jix{color:#ffc107}
.xluor3d{color:#fff0f0}
.x1f7m26b{color:#ffffff}
.x1heor9g{color:inherit}
.x1cvxgis{color:rgba(255,255,255,.62)}
.x1h8zzl{color:rgba(255,255,255,.82)}
.x1joocv1{color:var(--color-text-red)}
.xt1ef5e{color:var(--x107sxa6)}
.x8qwejv{color:var(--x121dxcj)}
.xxu8xcf{color:var(--x16oz10g)}
.xih5qjd{color:var(--x1c8q5z2)}
.xi89uqk{color:var(--x1f87dr9)}
.x1pj19al{color:var(--x1fh9na)}
.x2zfar8{color:var(--x1gg5hik)}
.x1u9h7fb{color:var(--x1hadker)}
.xiv6b4g{color:var(--x1hfwhfn)}
.x1j8og3s{color:var(--x1hsqmi7)}
.xrqsg0y{color:var(--x1k4is71)}
.xc9urzu{color:var(--x1ldif33)}
.x1s3cvfi{color:var(--x1phi9qn)}
.xr6fc0u{color:var(--x1q9c2wz)}
.xf45t6g{color:var(--x1qwmldi)}
.x1h23sya{color:var(--x1t764tu)}
.xx90xs9{color:var(--x1tjo2uk)}
.xpmuzgi{color:var(--x2ko9n3)}
.xj7t6mg{color:var(--x2nkukf)}
.x1kfnoop{color:var(--x8rl601)}
.x1k4xfad{color:var(--x8rya83)}
.xamb6yh{color:var(--xacgx6k)}
.x15nziuh{color:var(--xbd9ey7)}
.x1rwfb7a{color:var(--xd93dmn)}
.x1rf28yd{color:var(--xf19ryi)}
.x1dj7eoi{color:var(--xfaa0hi)}
.x188ze3t{color:var(--xhskem5)}
.x1f7gldq{color:var(--xi1zg4f)}
.xtwbc96{color:var(--xk7eo96)}
.x10mblui{color:var(--xmftjc4)}
.xkbyexg{color:var(--xpq1d7m)}
.xzzvn0w{color:var(--xs2t4s5)}
.x1u8rt55{color:var(--xt95z2r)}
.x1ayj0iu{color:var(--xufqp9t)}
.x17viya9{color:var(--xv9bwuc)}
.xifhs07{color:var(--xvpcptt)}
.x6njrlg{color:var(--xw750ha)}
.x19v4dly{color:var(--xylhkyp)}
.x1awj2ng{color:white}
.x1t1m3a5{column-gap:var(--x13ys6sy)}
.x1oul4df{column-gap:var(--x1a6pvc1)}
.x11ojado{column-gap:var(--xxq9rdk)}
.x1sqbtui{cursor:auto}
.xt0e3qv{cursor:default}
.x1jm3nie{cursor:grab}
.xi9pz9s{cursor:grabbing}
.x1146j2{cursor:help}
.x1ypdohk{cursor:pointer}
.x1ed109x{cursor:text}
.x104kibb{display:-webkit-box}
.x1lliihq{display:block}
.xjp7ctv{display:contents}
.x78zum5{display:flex}
.x1rg5ohu{display:inline-block}
.x3nfvp2{display:inline-flex}
.xt0psk2{display:inline}
.x1s85apg{display:none}
.x1v03k7{fill:var(--x1ldif33)}
.x14xfefy{filter:brightness(.9)}
.xifi7vn{filter:grayscale(1)}
.x1r8uery{flex-basis:0}
.x3ieub6{flex-direction:column-reverse}
.xdt5ytf{flex-direction:column}
.x15zctf7{flex-direction:row-reverse}
.x1q0g3np{flex-direction:row}
.x1c4vz4f{flex-grow:0}
.x1iyjqo2{flex-grow:1}
.x2lah0s{flex-shrink:0}
.xs83m0k{flex-shrink:1}
.x5wqa0o{flex-shrink:2}
.xo4cfa7{flex-shrink:3}
.xozqiw3{flex-wrap:nowrap}
.x1a02dak{flex-wrap:wrap}
.xjb2p0i{font-family:inherit}
.x1y3cpx3{font-family:InterVariable-Italic}
.x1lxnp44{font-family:monospace,"monospace"}
.x1ey7xld{font-family:monospace}
.x1a3kg6u{font-family:var(--x18lg445)}
.x1dvpr6s{font-family:var(--x1kz3iu)}
.xa49bx{font-family:var(--x1nuy5tb)}
.x1gaffeu{font-family:var(--xahz2cc)}
.xw33ypw{font-family:var(--xbj2g4d)}
.x97jhar{font-family:var(--xjcesp8)}
.x1wrden7{font-family:var(--xkm99e0)}
.xngnso2{font-size:1.5rem}
.x1k6wstc{font-size:10px}
.x1j6dyjg{font-size:11px}
.xfifm61{font-size:12px}
.x4z9k3i{font-size:13px}
.xif65rj{font-size:14px}
.x1j61zf2{font-size:16px}
.x19d36u7{font-size:17px}
.xosj86m{font-size:18px}
.xrv4cvt{font-size:1em}
.xwsyq91{font-size:20px}
.x1i1m3gp{font-size:22px}
.x1pvqxga{font-size:24px}
.x1ewwscv{font-size:26px}
.x3vlhr4{font-size:27px}
.x1ulgg28{font-size:30px}
.x1s3cmhv{font-size:32px}
.xqozcyj{font-size:36px}
.x1tgwohi{font-size:40px}
.x93iunb{font-size:48px}
.xdzlmae{font-size:8px}
.x1qlqyl8{font-size:inherit}
.xdmh292{font-size:var(--x-fontSize)}
.x1bzaf76{font-size:var(--x131aim5)}
.xizrcyr{font-size:var(--x14lb18e)}
.xw3vxul{font-size:var(--x1a26mup)}
.x1xgr292{font-size:var(--x1vaozn8)}
.xw74h57{font-size:var(--x1vmya28)}
.x116j1xo{font-size:var(--x1yt3flf)}
.x1r5j32o{font-size:var(--x40gspv)}
.x1xxyjho{font-size:var(--x5i3d6m)}
.x1szwdje{font-size:var(--x67wltv)}
.xl9s6z6{font-size:var(--x6incdp)}
.x1tv03f6{font-size:var(--xrhlpgc)}
.x1k4tb9n{font-style:italic}
.xo1l8bm{font-weight:400}
.xk50ysn{font-weight:500}
.x1s688f{font-weight:600}
.x117nqv4{font-weight:bold}
.x1pd3egz{font-weight:inherit}
.x5yhp0e{font-weight:var(--xl7oa1h)}
.xsn2yeo{font-weight:var(--xpvlhpi)}
.xtijo5x{inset-inline-end:0}
.xl56j7k{justify-content:center}
.x13a6bvl{justify-content:flex-end}
.x1nhvcw1{justify-content:flex-start}
.x1qughib{justify-content:space-between}
.x1qxw02l{line-clamp:1}
.x1eesoy2{line-clamp:4}
.x14ju556{line-height:0}
.x1xfvgam{line-height:1.35}
.xfrs9s4{line-height:1.45}
.x1evy7pa{line-height:1.5}
.xo5v014{line-height:1}
.x1d3mw78{line-height:16px}
.x43xycs{line-height:18}
.xd4r4e8{line-height:18px}
.x1i47q4g{line-height:20}
.x1fc57z9{line-height:20px}
.x15x6h47{line-height:22}
.x1o2sk6j{line-height:24px}
.x1vy86p0{line-height:36px}
.x1bsvlme{line-height:38px}
.x15bjb6t{line-height:inherit}
.x6ehuon{ms-overflow-style:none}
.x19kjcj4{object-fit:contain}
.xl1xv1r{object-fit:cover}
.xs9930i{opacity:.28}
.xuzhngd{opacity:.3}
.x3onkmb{opacity:.35}
.xyd83as{opacity:.45}
.xbyyjgo{opacity:.5}
.xwq05k6{opacity:.55}
.x197sbye{opacity:.6}
.x190dgpg{opacity:.65}
.x1ks1olk{opacity:.7}
.xf9vgkq{opacity:.72}
.x18km98s{opacity:.75}
.x1us6l5c{opacity:.8}
.x19s9pn4{opacity:.82}
.x27vdmw{opacity:.95}
.xg01cxk{opacity:0}
.x1hc1fzr{opacity:1}
.x1t137rt{outline-style:none}
.x1k57tk5{outline-width:0}
.xj0a0fe{overflow-wrap:anywhere}
.x67bb7w{pointer-events:auto}
.xp6cv0l{pointer-events:box-none}
.x47corl{pointer-events:none}
.x10l6tqk{position:absolute}
.xixxii4{position:fixed}
.x1n2onr6{position:relative}
.xtt52l0{resize:none}
.x288g5{resize:vertical}
.x1epywa{row-gap:var(--x1a6pvc1)}
.x1b3sigk{row-gap:var(--xp8f0ja)}
.x1rohswg{scrollbar-width:none}
.x1kym168{text-align-vertical:top}
.x2b8uid{text-align:center}
.x16tdsg8{text-align:inherit}
.xmw9mke{text-align:justify}
.xdpxx8g{text-align:left}
.x1hr2gdg{text-align:right}
.x1yc453h{text-align:start}
.x5lhwog{text-decoration-line:line-through}
.xkrqix3{text-decoration-line:none}
.xujl8zx{text-decoration-line:underline}
.xlyipyv{text-overflow:ellipsis}
.xtvhhri{text-transform:uppercase}
.xx69xxh{touch-action:pan-y}
.x1al4vs7{transform-origin:top left}
.x1i68sv5{transform:rotate(-90deg) translate(-100%,-50%)}
.x3oybdh{transform:scale(1)}
.x9yz5hy{transform:translateX(calc(100% - 4px))}
.x2hkv1k{transform:translateY(-16px)}
.xnn1q72{transform:translateY(0)}
.xx6bhzk{transition-duration:.15s}
.x1g2r6go{transition-duration:.1s}
.x1rvut6x{transition-duration:.25s}
.x16fj20d{transition-duration:1s}
.xts7igz{transition-property:background-color,border-color}
.x19991ni{transition-property:opacity}
.xwcsmn1{transition-property:transform,opacity}
.x11xpdln{transition-property:transform}
.xxrbq2n{transition-property:width}
.x9lcvmn{transition-timing-function:ease-out}
.xcj1dhv{transition-timing-function:linear}
.x87ps6o{-webkit-user-select:none;user-select:none}
.x1hx0egp{-webkit-user-select:text;user-select:text}
.x1n8ftqi{vertical-align:text-top}
.x16dsc37{vertical-align:top}
.xlshs6z{visibility:hidden}
.xeaf4i8{white-space:normal}
.xuxw1ft{white-space:nowrap}
.x126k92a{white-space:pre-wrap}
.x1yn0g08{word-break:break-all}
.x13faqbe{word-break:break-word}
.x1lldw8n{word-break:normal}
.x1vvkbs{word-wrap:break-word}
.xlb1s79{z-index:-9999}
.x1vjfegm{z-index:1}
.x1n327nk{z-index:10}
.x11uqc5h{z-index:100}
.xfo81ep{z-index:1000}
.x18ivbjn{z-index:10000}
.x979qle{z-index:100000}
.x1xd3u23{z-index:100001}
.xv97iv4{z-index:10001}
.x51lqrf{z-index:1050}
.x1nh0kk4{z-index:110}
.x1vg8xwf{z-index:150}
.x1exz1d9{z-index:170}
.xhtitgo{z-index:2}
.x1355qak{z-index:20}
.xzkaem6{z-index:3}
.x68pp3s{z-index:30}
.x12tvco5{z-index:35}
.xoegz02{z-index:4}
.x1u8a7rm{z-index:5}
.xa9119d{z-index:50}
.xeut3pp{z-index:99}
.x14g40p9{z-index:999}
.x1lbixdm{z-index:99999}
.x1ocn5jn:hover{background-color:#4a4a4a}
.x1pnxylw:hover{background-color:#e0f1ff}
.x1jmbrsh:hover{background-color:#e8e8e8}
.xn0a2hn:hover{background-color:#e9ecef}
.xk38gzf:hover{background-color:#ffbaaa}
.x13p300n:hover{background-color:#ffe49a}
.x1aoxtf8:hover{background-color:var(--x16oz10g)}
.x1fmeayu:hover{background-color:var(--x1besk2v)}
.xs2umxv:hover{background-color:var(--x1bfmmck)}
.x10mcd4d:hover{background-color:var(--x1gzxsx8)}
.x1hmz76o:hover{background-color:var(--x1hadker)}
.x1k5pn56:hover{background-color:var(--x1hsqmi7)}
.x16q8cis:hover{background-color:var(--x1hta45d)}
.x78mg0a:hover{background-color:var(--x1k4is71)}
.xztw1jx:hover{background-color:var(--x1ldif33)}
.x3g6kge:hover{background-color:var(--x1ljiqfh)}
.x1n2l6tc:hover{background-color:var(--x1ncjylw)}
.x1hyvv7g:hover{background-color:var(--x1pldo8v)}
.x23h9f0:hover{background-color:var(--x1ruxhy2)}
.xv78jzt:hover{background-color:var(--x1t764tu)}
.xco31h7:hover{background-color:var(--x1x3yiq)}
.x1i6ydib:hover{background-color:var(--x2nkukf)}
.x1j6g2sm:hover{background-color:var(--x7rpxpz)}
.x5n3fhs:hover{background-color:var(--x8sslol)}
.xe1fpf7:hover{background-color:var(--xacgx6k)}
.xut6wm6:hover{background-color:var(--xctzpfo)}
.x1c3yhgn:hover{background-color:var(--xh0eic1)}
.x1w76aas:hover{background-color:var(--xhlmjm9)}
.x1kylcbi:hover{background-color:var(--xhskem5)}
.x1mj8my9:hover{background-color:var(--xi1zg4f)}
.x8nikok:hover{background-color:var(--xk7eo96)}
.x1134n7w:hover{background-color:var(--xo8qu2v)}
.x15zeyke:hover{background-color:var(--xpq1d7m)}
.x1flq5tu:hover{background-color:var(--xw750ha)}
.x1evsfuh:hover{color:#010d75}
.xbjnx0s:hover{color:#0b5cd5}
.xm6dmui:hover{color:#159900}
.xunxdhb:hover{color:#212529}
.x1ri1wn9:hover{color:#495055}
.x13ow0kl:hover{color:#6c757d}
.x1ezh9gy:hover{color:#c53327}
.x1jrz6hv:hover{color:var(--x1gg5hik)}
.xyeykqa:hover{color:var(--x1hadker)}
.xult5u0:hover{color:var(--x1hfwhfn)}
.x1hxq0q8:hover{color:var(--x1k4is71)}
.x6sn4w2:hover{color:var(--x1ldif33)}
.x1auk054:hover{color:var(--x1ncjylw)}
.x35za7p:hover{color:var(--x1qwmldi)}
.x82tq3m:hover{color:var(--x1tjo2uk)}
.xb6yprq:hover{color:var(--x8rya83)}
.xl2g1pz:hover{color:var(--xbd9ey7)}
.x18bdt6m:hover{color:var(--xctzpfo)}
.x1cvq7aq:hover{color:var(--xd93dmn)}
.x9kv8pl:hover{color:var(--xf19ryi)}
.x1a3rc43:hover{color:var(--xfaa0hi)}
.xblnldc:hover{color:var(--xh0eic1)}
.xvkaua3:hover{color:var(--xhlmjm9)}
.x1o7uuvo:hover{opacity:1}
.x18osc6m:hover{transform:rotate(-90deg) translate(-100%,-70%)}
.xj2y2l9:hover{transform:scale(1.18)}
.xxnr8yj:focus{background-color:#e8e8e8}
.xpfmliz:focus{background-color:#e9ecef}
.x124lu7c:focus{background-color:var(--x1gzxsx8)}
.x6b4338:focus{background-color:var(--x7rpxpz)}
.x1y3fp3c:active{background-color:var(--x1gzxsx8)}
.x6zwc17:active{background-color:var(--x1hta45d)}
}
@layer priority5{
.x1oorwso{border-bottom-color:#a1a1a1}
.x1jdleqz{border-bottom-color:#d8d8d8}
.x1h6i44j{border-bottom-color:#dee2e6}
.x9q5a2s{border-bottom-color:#f8f9fa}
.x16stqrj{border-bottom-color:transparent}
.xw8gpjh{border-bottom-color:var(--color-border)}
.x1p6qlys{border-bottom-color:var(--x16oz10g)}
.x1xtkb7d{border-bottom-color:var(--x1besk2v)}
.xlm6mz8{border-bottom-color:var(--x1gzxsx8)}
.x1ojib8p{border-bottom-color:var(--x1hta45d)}
.x1b0y874{border-bottom-color:var(--x1k4is71)}
.x6mxae6{border-bottom-color:var(--x2nkukf)}
.x1ix2n64{border-bottom-color:var(--xacgx6k)}
.x4hrowm{border-bottom-color:var(--xh9kgpf)}
.xglb9e{border-bottom-color:var(--xi1zg4f)}
.x16toome{border-bottom-color:var(--xs2t4s5)}
.xfrllxf{border-bottom-left-radius:0}
.xabvvm4{border-bottom-left-radius:8px}
.xi8myl2{border-bottom-left-radius:var(--x1ud8vtb)}
.x18nlfsv{border-bottom-left-radius:var(--xxmfzyb)}
.xjppbhk{border-bottom-right-radius:0}
.xeyy32k{border-bottom-right-radius:8px}
.x63ehtr{border-bottom-right-radius:var(--x1ud8vtb)}
.x15r3mlg{border-bottom-right-radius:var(--xxmfzyb)}
.xpvcztv{border-bottom-style:dashed}
.x1q0q8m5{border-bottom-style:solid}
.x1qhh985{border-bottom-width:0}
.xso031l{border-bottom-width:1px}
.xlxy82{border-bottom-width:2px}
.x7zknp3{border-bottom-width:7px}
.x92x3c3{border-bottom-width:var(--border-width)}
.xalrm95{border-left-color:#dee2e6}
.x1a5az3m{border-left-color:var(--x1besk2v)}
.xkgv9lp{border-left-color:var(--x1hta45d)}
.x1oknuh6{border-left-color:var(--x1k4is71)}
.x1mg8h8o{border-left-color:var(--x1ldif33)}
.xwmxhcv{border-left-color:var(--xh9kgpf)}
.x17sc6t2{border-left-color:var(--xhskem5)}
.x15xb65w{border-left-color:var(--xpq1d7m)}
.x19ypqd9{border-left-style:solid}
.xyj58a3{border-left-width:0}
.x1ehlcdj{border-left-width:11px}
.xe0pwq{border-left-width:1px}
.x19sr0n1{border-left-width:2px}
.x1vo0akb{border-left-width:3px}
.x17fk6ux{border-right-color:#dee2e6}
.x11jm5ch{border-right-color:var(--x2nkukf)}
.xewh1r3{border-right-color:var(--xh9kgpf)}
.x32b0ac{border-right-style:solid}
.xgfja2r{border-right-width:0}
.xs1s249{border-right-width:1px}
.xyy74w7{border-right-width:2px}
.xd79e0l{border-top-color:#dee2e6}
.x1l5kr9m{border-top-color:#f5f5f5}
.xatmock{border-top-color:#f8f9fa}
.x1v8p93f{border-top-color:transparent}
.x197hkax{border-top-color:var(--x16oz10g)}
.x18zx3bu{border-top-color:var(--x1besk2v)}
.x1rm7u7t{border-top-color:var(--x1gzxsx8)}
.x1sqj61i{border-top-color:var(--x1hta45d)}
.x1ni4vnb{border-top-color:var(--x7rpxpz)}
.x1wtia47{border-top-color:var(--xacgx6k)}
.x1bphz9f{border-top-color:var(--xh9kgpf)}
.xj4kkc5{border-top-color:var(--xi1zg4f)}
.x1paufav{border-top-color:var(--xo8qu2v)}
.x1ia1hqs{border-top-left-radius:0}
.x1yh96oa{border-top-left-radius:7px}
.x1k1lpwg{border-top-left-radius:8px}
.x1wav2l1{border-top-left-radius:var(--x1rgwvtn)}
.x18gh43o{border-top-left-radius:var(--x1ud8vtb)}
.x1vyar6w{border-top-left-radius:var(--xxmfzyb)}
.x1a2w583{border-top-right-radius:0}
.x9gvle8{border-top-right-radius:7px}
.x5omr3n{border-top-right-radius:8px}
.x1on3f23{border-top-right-radius:var(--x1rgwvtn)}
.xeoauvi{border-top-right-radius:var(--x1ud8vtb)}
.x1kih51p{border-top-right-radius:var(--xxmfzyb)}
.x13fuv20{border-top-style:solid}
.x972fbf{border-top-width:0}
.x178xt8z{border-top-width:1px}
.xamhcws{border-top-width:2px}
.x1ldxqgv{border-top-width:7px}
.x1t1qrwb{bottom:-2px}
.xtzk6r2{bottom:-5px}
.xsugpx9{bottom:-6px}
.x1ey2m1c{bottom:0}
.x11unvnq{bottom:100px}
.xjnlgov{bottom:20px}
.x1c7jfne{bottom:2px}
.xyxf0pu{bottom:48px}
.xbfrwjf{bottom:4px}
.x1wa3icf{bottom:5px}
.xu9aifs{bottom:74px}
.x1w7c4q4{bottom:var(--x1a6pvc1)}
.xbcjn1g{bottom:var(--x9r80ky)}
.x190q0k4{bottom:var(--xl2yw7o)}
.x1kdgwdv{bottom:var(--xp8f0ja)}
.xqtp20y{height:0}
.x5yr21d{height:100%}
.xcctkbc{height:1000px}
.xpyat2d{height:100px}
.x1dr59a3{height:100vh}
.x170jfvy{height:10px}
.x1wkxgih{height:120px}
.x1njnjl6{height:124px}
.x1kpxq89{height:12px}
.x1h5wmu3{height:132px}
.xhjk10j{height:140px}
.x1v9usgg{height:14px}
.x18dl8mb{height:150px}
.x1ymw6g{height:160px}
.xlup9mm{height:16px}
.x1ta3ar0{height:17px}
.x1b51vyi{height:180px}
.xmix8c7{height:18px}
.xb2rc7v{height:192px}
.xjm9jq1{height:1px}
.x1m3v4wt{height:200px}
.x1qx5ct2{height:20px}
.x1isuwpm{height:220px}
.x17rw0jw{height:22px}
.xi0exxh{height:23px}
.x1u5z0ei{height:240px}
.xxk0z11{height:24px}
.x127qqk8{height:250px}
.xdwzuf7{height:260px}
.xd7y6wv{height:26px}
.x1fgtraw{height:28px}
.x1vd4hg5{height:300px}
.x1gnnpzl{height:30px}
.xu3xrit{height:320px}
.x10w6t97{height:32px}
.x90ne7k{height:34px}
.x1hia7rd{height:354px}
.x1s1d1n7{height:35px}
.xc9qbxq{height:36px}
.x16wdlz0{height:38px}
.x16nrsnc{height:400px}
.x1vqgdyp{height:40px}
.x5kalc8{height:42px}
.xn3w4p2{height:44px}
.xwvwv9b{height:46px}
.x1dqyrwa{height:47px}
.xsdox4t{height:48px}
.xqu0tyb{height:4px}
.x10wjd1d{height:50px}
.xdd8jsf{height:52px}
.x1dnml7z{height:54px}
.x169u96n{height:550px}
.x14h49td{height:55px}
.x1n46bim{height:560px}
.xnnlda6{height:56px}
.xwa7hi{height:58px}
.x1jn0hjm{height:600px}
.xng8ra{height:60px}
.x1peatla{height:64px}
.x1mgsydn{height:66px}
.x1gb2em4{height:68px}
.xols6we{height:6px}
.xy75621{height:72px}
.x14baz6b{height:76px}
.xuzvuw4{height:78px}
.x1hagigm{height:7px}
.xwzfr38{height:80px}
.x17j7krd{height:84px}
.xcbkimw{height:85px}
.xsi6dy0{height:86px}
.x14nwjz3{height:88px}
.xdk7pt{height:8px}
.x1to3lk4{height:92px}
.xegnrdp{height:9px}
.xt7dq6l{height:auto}
.x2bzn8n{height:calc(var(--spacing-10) + var(--spacing-3))}
.x45q7a{height:calc(var(--spacing-8) + var(--spacing-8) + var(--spacing-3))}
.x1ktfwt3{height:var(--spacing-10)}
.xvpftlf{height:var(--spacing-6)}
.x18to7ep{height:var(--spacing-8)}
.x16ye13r{height:var(--x-height)}
.xu96u03{left:0}
.xl8wat7{left:100%}
.x12lbrt0{left:10px}
.x1c5ba64{left:11px}
.x1c42kn3{left:20px}
.xfyllk0{left:25%}
.x54rlcq{left:2px}
.x1q9jvbm{left:50px}
.x1rvfpmx{left:5px}
.x1fxeuf5{left:60px}
.xncym2f{left:8px}
.x1t8mvi6{left:auto}
.x1lmnigz{left:calc(100% + 4px)}
.x10b14i4{left:var(--x1a6pvc1)}
.x19ihb91{left:var(--x9r80ky)}
.xjhmaga{left:var(--xp8f0ja)}
.x1jyxor1{margin-bottom:-1px}
.x9a3u73{margin-bottom:-24px}
.xmgb6t1{margin-bottom:-2px}
.xat24cr{margin-bottom:0}
.xyorhqc{margin-bottom:10px}
.xod5an3{margin-bottom:12px}
.x1fqp7bg{margin-bottom:15px}
.x1yztbdb{margin-bottom:16px}
.xieb3on{margin-bottom:20px}
.x1hq5gj4{margin-bottom:24px}
.x1chd833{margin-bottom:28px}
.xjpr12u{margin-bottom:2px}
.x1iymm2a{margin-bottom:32px}
.x14ler8{margin-bottom:40px}
.x12nagc{margin-bottom:4px}
.x1e56ztr{margin-bottom:8px}
.x4ii5y1{margin-bottom:auto}
.x1ks52xw{margin-bottom:var(--x13ys6sy)}
.x1fug7d9{margin-bottom:var(--x1a6pvc1)}
.x1c0sbpl{margin-bottom:var(--x1hdsvrc)}
.xd6x93i{margin-bottom:var(--x9r80ky)}
.x4hxt32{margin-bottom:var(--xl2yw7o)}
.x1iywiah{margin-bottom:var(--xp8f0ja)}
.xk5zpdl{margin-bottom:var(--xxq9rdk)}
.x18wv8x9{margin-left:-10px}
.x1rm44br{margin-left:-16px}
.x1d6c7ev{margin-left:-20px}
.x1mazlvb{margin-left:-5px}
.xiz41ja{margin-left:-6px}
.x1bawvfr{margin-left:-8px}
.xj3b58b{margin-left:0}
.x16ydxro{margin-left:10px}
.x1tpqehw{margin-left:12px}
.xt102qc{margin-left:15px}
.xq1n1xh{margin-left:16px}
.x400o59{margin-left:20px}
.xg1telm{margin-left:23px}
.x1gh5o4n{margin-left:24px}
.xx1l9l6{margin-left:28px}
.x1swdo50{margin-left:2px}
.xtxcnzb{margin-left:30px}
.xv90nub{margin-left:32px}
.x1fm5xbl{margin-left:35px}
.x1uoezyy{margin-left:3px}
.x11hoopg{margin-left:40px}
.x1iog12x{margin-left:4px}
.x1n4n4h2{margin-left:50px}
.xd8780z{margin-left:5px}
.x1vxotmq{margin-left:60px}
.xet2fuk{margin-left:8px}
.x1qysm24{margin-left:96px}
.x8x9d4c{margin-left:auto}
.xgumyru{margin-left:var(--x13ys6sy)}
.xke8c27{margin-left:var(--x1a6pvc1)}
.xv1m07{margin-left:var(--x9r80ky)}
.xqztqjh{margin-left:var(--xl2yw7o)}
.x1488les{margin-left:var(--xp8f0ja)}
.xqo4w2h{margin-left:var(--xva978s)}
.x4u73zf{margin-left:var(--xxq9rdk)}
.xug08bp{margin-right:-16px}
.xump6t3{margin-right:-20px}
.xv8wvd9{margin-right:-8px}
.x1yf7rl7{margin-right:0}
.xyo1k6t{margin-right:10px}
.x1wsuqlk{margin-right:12px}
.xq0ohe5{margin-right:15px}
.x1o6q14k{margin-right:16px}
.xlkxg1q{margin-right:1px}
.x1wh8b8d{margin-right:20px}
.x1rmmofs{margin-right:24px}
.x1e2p46r{margin-right:28px}
.x1ldx8e{margin-right:2px}
.x8h0jfy{margin-right:30px}
.x78see{margin-right:32px}
.x1hdptxu{margin-right:3px}
.x1qx7dla{margin-right:40px}
.xl010v5{margin-right:4px}
.x1tmrr3t{margin-right:50px}
.x17ituo4{margin-right:5px}
.xhhdfnc{margin-right:60px}
.x1db2dqx{margin-right:8px}
.xack27t{margin-right:auto}
.x1kyffke{margin-right:var(--x13ys6sy)}
.x8klodt{margin-right:var(--x1a6pvc1)}
.xz44lj3{margin-right:var(--x1f73bcj)}
.x1ds4ay3{margin-right:var(--x9r80ky)}
.xabjzzl{margin-right:var(--xl2yw7o)}
.xrxyi02{margin-right:var(--xp8f0ja)}
.xeho4sw{margin-right:var(--xva978s)}
.x1kgmq87{margin-top:-2px}
.x16ldp7u{margin-top:-5px}
.xdj266r{margin-top:0}
.x1anpbxc{margin-top:10px}
.x14vqqas{margin-top:12px}
.xcxhlts{margin-top:15px}
.xw7yly9{margin-top:16px}
.xhrpt6u{margin-top:18px}
.xvijh9v{margin-top:1px}
.x7iklje{margin-top:200px}
.x1sy10c2{margin-top:20px}
.xqui205{margin-top:24px}
.xjv05ge{margin-top:28px}
.xr9ek0c{margin-top:2px}
.x11fxgd9{margin-top:30px}
.xg87l8a{margin-top:32px}
.x7r5mf7{margin-top:3px}
.x1tfhste{margin-top:40px}
.x1gslohp{margin-top:4px}
.x1ok221b{margin-top:5px}
.x1xmf6yo{margin-top:8px}
.xr1yuqi{margin-top:auto}
.xrryhgt{margin-top:var(--x13ys6sy)}
.xks0ztd{margin-top:var(--x15l1h1k)}
.x1sqbtsi{margin-top:var(--x1a6pvc1)}
.x1jtqurp{margin-top:var(--x1hdsvrc)}
.x1he6nxw{margin-top:var(--x9r80ky)}
.xfggdkd{margin-top:var(--xl2yw7o)}
.xrfm3t8{margin-top:var(--xp8f0ja)}
.xtspeq6{margin-top:var(--xu3qclj)}
.xs7tsf6{margin-top:var(--xxq9rdk)}
.xmz0i5r{max-height:100%}
.x1hyak1l{max-height:140px}
.xctk3hg{max-height:160px}
.x1m9f1mt{max-height:188px}
.xl5ka8d{max-height:190px}
.x1983irj{max-height:220px}
.xmb9k7p{max-height:230px}
.x1xiyphd{max-height:240px}
.xq3t0pi{max-height:280px}
.xuyqlj2{max-height:300px}
.x1sslpiy{max-height:320px}
.x1csiy34{max-height:350px}
.x2z3yb8{max-height:360px}
.x1a3r9hi{max-height:380px}
.x1phlbz0{max-height:400px}
.x18wx58x{max-height:40px}
.x9sc8c8{max-height:440px}
.xwvgpe2{max-height:44px}
.x77mbcv{max-height:450px}
.x1rq5m6k{max-height:500px}
.x1rkru5j{max-height:550px}
.x1g9kxxr{max-height:560px}
.x9ybwvh{max-height:600px}
.x1jquxbb{max-height:60px}
.x1hyxz0u{max-height:768px}
.xdnzh0y{max-height:90%}
.xcaefb6{max-height:calc(var(--spacing-10) * 11)}
.xdyrldr{max-height:calc(var(--spacing-10) * 5)}
.x193iq5w{max-width:100%}
.x16xn7b0{max-width:100vw}
.x5eaxwu{max-width:112px}
.x1ikqzku{max-width:1200px}
.x2aouup{max-width:120px}
.x186ixgm{max-width:1440px}
.x16q51m2{max-width:150px}
.x18qnofl{max-width:160px}
.x1e4dklr{max-width:180px}
.x1racy4e{max-width:220px}
.x16em4ew{max-width:240px}
.x256u9z{max-width:250px}
.x14lruf5{max-width:260px}
.x1jkqq1h{max-width:280px}
.xw5ewwj{max-width:300px}
.x1qminx1{max-width:312px}
.x1va8c73{max-width:320px}
.xxc7z9f{max-width:360px}
.x1dt7z5j{max-width:380px}
.x1j9u4d2{max-width:400px}
.x1lr1uin{max-width:420px}
.xq2pcee{max-width:440px}
.x1y8h3ww{max-width:45%}
.x65f84u{max-width:500px}
.x1lwm3bp{max-width:520px}
.xp73w0s{max-width:580px}
.xrlsmeg{max-width:600px}
.x1cxeki3{max-width:70%}
.xapjn7j{max-width:760px}
.x14r61f{max-width:80%}
.x1ap80js{max-width:800px}
.xq8v1hd{max-width:90%}
.x1dtb55y{max-width:900px}
.x1kozois{max-width:920px}
.x1uyial6{max-width:940px}
.xmukzo7{max-width:96%}
.xyzno7u{max-width:960px}
.x1x1rfll{max-width:none}
.x1319t99{max-width:unset}
.x2lwn1j{min-height:0}
.x1us19tq{min-height:100%}
.x11md1zd{min-height:100px}
.x6lgdlw{min-height:112px}
.xi3av73{min-height:120px}
.xbwy6ji{min-height:150px}
.x1db3i3o{min-height:160px}
.x1shn012{min-height:180px}
.x1jc8gtk{min-height:210px}
.x9l5fec{min-height:220px}
.xe0957l{min-height:22px}
.x1mp2o57{min-height:238px}
.x1ficeh5{min-height:240px}
.xjwf9q1{min-height:24px}
.x1xaied3{min-height:260px}
.xj9xw9b{min-height:26px}
.x7hwdi7{min-height:27px}
.xe0p6wg{min-height:28px}
.x1lpwdgh{min-height:300px}
.x1rz828m{min-height:30px}
.xdk3k9y{min-height:310px}
.x21xpn4{min-height:32px}
.xu97haq{min-height:34px}
.x1dby22o{min-height:360px}
.xu0aao5{min-height:36px}
.x141feeh{min-height:38px}
.x1bifzbx{min-height:400px}
.x1ba4aug{min-height:40px}
.xg0is8a{min-height:420px}
.xgujvf1{min-height:42px}
.x1gg8mnh{min-height:44px}
.x3sc9yq{min-height:46px}
.x1wxaq2x{min-height:48px}
.x1wiwyrm{min-height:52px}
.xt55aet{min-height:54px}
.xbktkl8{min-height:56px}
.x7razj1{min-height:57px}
.xvkrg5o{min-height:58px}
.x8nclml{min-height:64px}
.x1wzw5q2{min-height:68px}
.x1rfaoo0{min-height:70px}
.x1qafhyn{min-height:72px}
.x1r3qdcx{min-height:76px}
.xseoqlg{min-height:80px}
.xefclja{min-height:88px}
.x1aes4zu{min-height:92px}
.xkoleio{min-height:var(--spacing-8)}
.xeuugli{min-width:0}
.xgqtt45{min-width:100%}
.xwsj4vy{min-width:104px}
.x1c7vg25{min-width:112px}
.x1i9suas{min-width:120px}
.xkgs3ab{min-width:130px}
.x1d77m7x{min-width:140px}
.x1i8msj3{min-width:145px}
.xt7fyls{min-width:150px}
.x5w4yej{min-width:160px}
.xfb3i0g{min-width:180px}
.x1t5bqph{min-width:190px}
.x1jzhcrs{min-width:200px}
.xt4ypqs{min-width:20px}
.x12rczxh{min-width:220px}
.xlm99nl{min-width:240px}
.xnei2rj{min-width:24px}
.x1klvvdw{min-width:260px}
.x1264ykn{min-width:28px}
.x9041oi{min-width:2px}
.x18n5i07{min-width:300px}
.x17s4nb9{min-width:30px}
.x8foose{min-width:312px}
.x46jg8d{min-width:32px}
.x187nrv{min-width:340px}
.x1aasl1c{min-width:34px}
.x13m5vm7{min-width:38px}
.x13o0s5z{min-width:400px}
.x1nb6za0{min-width:44px}
.x15cq3s0{min-width:480px}
.x900493{min-width:48px}
.xvundu9{min-width:54px}
.xxsxjwm{min-width:70px}
.x450l9j{min-width:90px}
.x1onzeue{min-width:95px}
.x17y4j5z{min-width:96px}
.xk8lq53{min-width:max-content}
.x1s91ga5{min-width:var(--xp8f0ja)}
.xw2csxc{overflow-x:auto}
.x6ikm8r{overflow-x:hidden}
.x1odjw0f{overflow-y:auto}
.x10wlt62{overflow-y:hidden}
.x1rife3k{overflow-y:scroll}
.xryxfnj{overflow-y:visible}
.x18d9i69{padding-bottom:0}
.x1a8lsjc{padding-bottom:10px}
.x129n6ie{padding-bottom:112px}
.xsag5q8{padding-bottom:12px}
.xtw9xip{padding-bottom:140px}
.xr1496l{padding-bottom:15px}
.x1l90r2v{padding-bottom:16px}
.x1hhzuzn{padding-bottom:18px}
.x1j85h84{padding-bottom:1px}
.xx6bls6{padding-bottom:20px}
.xwxc41k{padding-bottom:24px}
.x156go17{padding-bottom:25px}
.x84yb8i{padding-bottom:28px}
.x1120s5i{padding-bottom:2px}
.xbaz6xv{padding-bottom:30px}
.x1gan7if{padding-bottom:32px}
.xg8j3zb{padding-bottom:3px}
.x1t1ogtf{padding-bottom:40px}
.x1m7pmia{padding-bottom:44px}
.xjkvuk6{padding-bottom:4px}
.x1rxj1xn{padding-bottom:50px}
.x161sli9{padding-bottom:56px}
.xs9asl8{padding-bottom:5px}
.xzk7aed{padding-bottom:64px}
.x10b6aqq{padding-bottom:6px}
.x1ykpatu{padding-bottom:7px}
.xwib8y2{padding-bottom:8px}
.xo0ha1f{padding-bottom:96px}
.xdvlbce{padding-bottom:9px}
.x1oeyoj0{padding-bottom:calc(var(--spacing-10) + var(--spacing-4))}
.xlbxkz7{padding-bottom:calc(var(--spacing-10) + var(--spacing-8))}
.x1en07fd{padding-bottom:var(--x13ys6sy)}
.xf994pn{padding-bottom:var(--x15l1h1k)}
.xsfn29g{padding-bottom:var(--x1a6pvc1)}
.xoa3ajf{padding-bottom:var(--x1hdsvrc)}
.xer3c39{padding-bottom:var(--x9r80ky)}
.xhm4q4u{padding-bottom:var(--xl2yw7o)}
.x64434d{padding-bottom:var(--xp8f0ja)}
.x153bkrx{padding-bottom:var(--xu3qclj)}
.x8ad5h0{padding-bottom:var(--xva978s)}
.xqlfrz0{padding-bottom:var(--xxq9rdk)}
.x1uhho1l{padding-left:0}
.x1lqa7cf{padding-left:10px}
.xf18ygs{padding-left:12px}
.xzjhap9{padding-left:14px}
.x1igx7t4{padding-left:15px}
.xnm25rq{padding-left:16px}
.x1k8dnhd{padding-left:18px}
.x1x5zllk{padding-left:1px}
.x5tiur9{padding-left:20px}
.xnljgj5{padding-left:22px}
.xd3ty66{padding-left:24px}
.x1c7xelf{padding-left:25px}
.xxpkpgd{padding-left:28px}
.xj9uezu{padding-left:2px}
.xayvskk{padding-left:30px}
.x1tudf5h{padding-left:32px}
.x17v3rxn{padding-left:34px}
.x10de0yr{padding-left:36px}
.x19lfox8{padding-left:40px}
.xg3sno2{padding-left:44px}
.xxq6t71{padding-left:46px}
.x6wrskw{padding-left:4px}
.x1f28wsw{padding-left:50px}
.xcpk43y{padding-left:5px}
.x11iknt3{padding-left:6px}
.x163pfp{padding-left:8px}
.x1xmfc2l{padding-left:var(--x131aim5)}
.x1xolkr8{padding-left:var(--x13ys6sy)}
.x6p4jy8{padding-left:var(--x17of8ba)}
.x13er0ht{padding-left:var(--x1a6pvc1)}
.x1dxzv1v{padding-left:var(--x1hdsvrc)}
.xxez14c{padding-left:var(--x9r80ky)}
.xlr0s5t{padding-left:var(--xl2yw7o)}
.x643s5t{padding-left:var(--xp8f0ja)}
.x1vfte5g{padding-left:var(--xu3qclj)}
.x45csdi{padding-left:var(--xva978s)}
.x1k4c003{padding-left:var(--xxq9rdk)}
.x1xpa7k{padding-right:0}
.xcicffo{padding-right:10px}
.xnuq7ks{padding-right:12px}
.x19tmk5i{padding-right:14px}
.x172e5tb{padding-right:15px}
.xyfqnmn{padding-right:16px}
.x18a8kpn{padding-right:18px}
.x1jyzu15{padding-right:1px}
.x1s7jvk7{padding-right:20px}
.x1oou3sl{padding-right:22px}
.x8e5d8q{padding-right:24px}
.xk458av{padding-right:25px}
.x1sai7j1{padding-right:28px}
.xpf9j6y{padding-right:2px}
.x1nz53y6{padding-right:30px}
.x1m2p0i2{padding-right:32px}
.x17tnbgv{padding-right:36px}
.xj5tbmc{padding-right:40px}
.x1o8a8up{padding-right:42px}
.x126bw0h{padding-right:44px}
.x9b564f{padding-right:46px}
.xh80x56{padding-right:48px}
.xmzs88n{padding-right:4px}
.xk0xhvr{padding-right:50px}
.x1bbp25e{padding-right:52px}
.xkhz7bo{padding-right:56px}
.x1nx2rwh{padding-right:5px}
.x1ug7bdz{padding-right:6px}
.x82l30n{padding-right:7px}
.xn2wrzg{padding-right:80px}
.xy13l1i{padding-right:8px}
.xhrvjyn{padding-right:var(--x13ys6sy)}
.x1bsdms3{padding-right:var(--x17of8ba)}
.x1bdfx9v{padding-right:var(--x1a6pvc1)}
.x1j9nm21{padding-right:var(--x1hdsvrc)}
.x1a6qm8b{padding-right:var(--x9r80ky)}
.xi0gl9m{padding-right:var(--xl2yw7o)}
.xkzvfko{padding-right:var(--xp8f0ja)}
.x12hj8ss{padding-right:var(--xu3qclj)}
.x1x8vzks{padding-right:var(--xva978s)}
.x1aogkqy{padding-right:var(--xxq9rdk)}
.xexx8yu{padding-top:0}
.x889kno{padding-top:10px}
.x1evdl5j{padding-top:120px}
.xz9dl7a{padding-top:12px}
.x17rqnwr{padding-top:150px}
.xqy66fx{padding-top:15px}
.xyamay9{padding-top:16px}
.x109j2v6{padding-top:18px}
.x4p5aij{padding-top:1px}
.x1cnzs8{padding-top:20px}
.x1p5oq8j{padding-top:24px}
.x9tmck8{padding-top:25px}
.x7sb2j6{padding-top:28px}
.x1nn3v0j{padding-top:2px}
.x1miatn0{padding-top:32px}
.xyqdw3p{padding-top:3px}
.x13zrc24{padding-top:40px}
.x1iorvi4{padding-top:4px}
.xn2ks54{padding-top:56px}
.x123j3cw{padding-top:5px}
.x1uysmmv{padding-top:64px}
.x1yrsyyn{padding-top:6px}
.x15uerrv{padding-top:72px}
.xm7lytj{padding-top:7px}
.x1y1aw1k{padding-top:8px}
.x96k8nx{padding-top:9px}
.x1vlblms{padding-top:var(--spacing-3)}
.x135iba8{padding-top:var(--x13ys6sy)}
.xt3o1bk{padding-top:var(--x15l1h1k)}
.x1bh15a{padding-top:var(--x1a6pvc1)}
.x6soac{padding-top:var(--x1hdsvrc)}
.x1x455n8{padding-top:var(--x9r80ky)}
.x1i8dtw9{padding-top:var(--xl2yw7o)}
.x1mhpzfp{padding-top:var(--xp8f0ja)}
.x1ah5dgf{padding-top:var(--xu3qclj)}
.xienr4t{padding-top:var(--xva978s)}
.x1wquljq{padding-top:var(--xxq9rdk)}
.x1bkpikb{right:-2px}
.xzkxjte{right:-4px}
.x1w6f2ud{right:-55px}
.x6smm1b{right:-5px}
.xgzdjil{right:-6px}
.x1fn5swd{right:-72px}
.x11jdl05{right:-8px}
.x3m8u43{right:0}
.xjvjlmm{right:100%}
.x131sewu{right:10px}
.xlftelb{right:12px}
.xn5hqff{right:16px}
.xk6ci0l{right:20px}
.x3lmqil{right:2px}
.x16i1cuh{right:30px}
.x1kir1w4{right:44px}
.x1pzoy33{right:4px}
.x1f7tldq{right:50px}
.x4a824z{right:5px}
.x1dgp85l{right:60px}
.xclnmbr{right:6px}
.x1e3k1co{right:calc(100% + 4px)}
.x1741ejh{right:unset}
.x1bkg1uu{right:var(--x1a6pvc1)}
.xz5nmhf{right:var(--x9r80ky)}
.x1yzx93q{right:var(--xl2yw7o)}
.x11jn1c8{right:var(--xp8f0ja)}
.x198lmq7{right:var(--xxq9rdk)}
.x1pdr0v7{top:-1px}
.x10hu2aj{top:-22px}
.x1qiirwl{top:-2px}
.x1fo6t33{top:-4px}
.x1v4kod4{top:-8px}
.x13vifvy{top:0}
.xdsb8wn{top:100%}
.x1eu8d0j{top:10px}
.xuivejd{top:14px}
.x7be41k{top:15px}
.xjqd8mg{top:19px}
.xnfr1j{top:1px}
.xmhk92p{top:20px}
.xs7f9wi{top:2px}
.x10508h5{top:30px}
.xgza26u{top:38px}
.xxk6nc9{top:3px}
.x9ri80z{top:40px}
.xndqk7f{top:4px}
.xwa60dl{top:50%}
.x1jzctok{top:5px}
.x1atx4j1{top:6px}
.xyc4j8s{top:7px}
.xfr5jun{top:8px}
.x80663w{top:auto}
.x1d1n87m{top:calc(100% + 8px)}
.xsf42hv{top:calc(50% - 10px)}
.x1bbufrl{top:var(--x1a6pvc1)}
.x1us3xf8{top:var(--xl2yw7o)}
.x4v97z7{top:var(--xp8f0ja)}
.x1796vho{top:var(--xxq9rdk)}
.xnalus7{width:0}
.xh8yej3{width:100%}
.x1p2m28r{width:1000px}
.x1exxlbk{width:100px}
.xoyzmzd{width:1024px}
.x19zpy19{width:104px}
.x1fsd2vl{width:10px}
.xja02kk{width:110px}
.xj35x94{width:112px}
.xygnafs{width:120px}
.xrmyp2{width:124px}
.x11hnkzl{width:126px}
.xsmyaan{width:12px}
.x13ie5k6{width:130px}
.x16s0kzc{width:132px}
.xifkd7f{width:140px}
.x6jxa94{width:14px}
.xrostsh{width:150px}
.xq1dxzn{width:160px}
.x1kky2od{width:16px}
.x1se2ifz{width:17px}
.xzjbwwf{width:180px}
.x1xp8n7a{width:18px}
.x636qxn{width:190px}
.x1i1rx1s{width:1px}
.x1oysuqx{width:200px}
.xw4jnvo{width:20px}
.x16grhtn{width:220px}
.x17z2i9w{width:22px}
.x3smdqs{width:230px}
.xlzg99y{width:23px}
.xafpxmx{width:240px}
.xvy4d1p{width:24px}
.xqyf9gi{width:250px}
.x1hfn5x7{width:260px}
.x23j0i4{width:26px}
.x1dz1jew{width:280px}
.xopohe7{width:286px}
.xgd8bvy{width:28px}
.xfo62xy{width:2px}
.xdzyupr{width:300px}
.x1849jeq{width:30px}
.x1lavqec{width:310px}
.x1yinuae{width:312px}
.x1m258z3{width:320px}
.x1td3qas{width:32px}
.x1iiql3v{width:335px}
.xj6ak53{width:340px}
.x1691je0{width:34px}
.x19h4ct{width:35%}
.xxsgkw5{width:350px}
.x1cvmir6{width:360px}
.x14qfxbe{width:36px}
.xwl9fdd{width:380px}
.x1guw455{width:38px}
.x1l2rt3b{width:400px}
.x100vrsf{width:40px}
.x1fnd73c{width:42%}
.x10h3iyq{width:42px}
.x1peuizl{width:440px}
.x187nhsf{width:44px}
.x3x2bpi{width:46px}
.x14zvdfm{width:48%}
.xht4xr3{width:480px}
.x1useyqa{width:48px}
.x51ohtg{width:4px}
.x3hqpx7{width:50%}
.xvue9z{width:500px}
.x1pju0fl{width:50px}
.xvni27{width:52px}
.x1fxk84t{width:54px}
.xnfjc3l{width:55px}
.x15yg21f{width:56px}
.xjqzex7{width:580px}
.x14rvwrp{width:600px}
.x1247r65{width:60px}
.x1fu8urw{width:64px}
.xge0ay3{width:66px}
.x1v4s8kt{width:6px}
.x65xoit{width:70%}
.xo5x3gg{width:70px}
.xni59qk{width:72px}
.xgbm1jk{width:78px}
.xci0xqf{width:7px}
.xktia5q{width:80%}
.xdpfuu1{width:800px}
.x1dmp6jm{width:80px}
.x1lxuw3u{width:840px}
.x19v3vle{width:84px}
.x29ncy0{width:88px}
.x1xc55vz{width:8px}
.xm6i5cn{width:90%}
.xefyazp{width:90px}
.xjzaux3{width:92px}
.x13oubkp{width:96px}
.x1wc42o8{width:9px}
.x14atkfc{width:auto}
.xeq5yr9{width:fit-content}
.xezivpi{width:max-content}
.x11pj4at{width:min(680px,100%)}
.xailvb{width:min(680px,100vw)}
.x4pn7vq{width:unset}
.x59ufyq{width:var(--spacing-10)}
.x1mtvzj0{width:var(--spacing-6)}
.xgc8j7m{width:var(--spacing-8)}
.x5lhr3w{width:var(--x-width)}
}
@layer priority6{
.x1sm2t51::placeholder{color:var(--x1q9c2wz)}
}

body {
}

ul {
  list-style: disc;
}
ol {
  list-style: decimal;
}
ol,
ul {
	padding-left: 2rem;
}

ol,
ul,
dl {
	margin-top: 0;
	margin-bottom: 1rem;
}

ol ol,
ul ul,
ol ul,
ul ol {
	margin-bottom: 0;
}

/* CSS tương thích cho component Astryx, dùng chung mọi trang, kể cả portal.
   Chỉ các lỗi package được đánh dấu ASTRYX-WORKAROUND để rà soát khi nâng cấp. */

/* reboot.scss thêm margin-bottom cho h1–h6, ghi đè reset có layer của Astryx.
   Khôi phục margin dưới của mọi Astryx Heading, giữ heading app cũ. */
h1.astryx-heading,
h2.astryx-heading,
h3.astryx-heading,
h4.astryx-heading,
h5.astryx-heading,
h6.astryx-heading {
	margin-bottom: 0;
}

/* .card của base.scss và reset div đặt hướng column.
   Khôi phục hàng ngang cho header Banner, giữ khung banner-frame dạng cột. */
.astryx-banner {
	flex-direction: row;
}

/* .card của base.scss thêm border 1px vào khung/header Banner.
   Bỏ viền thừa ở hai phần này, giữ border của banner-content và card app cũ. */
.astryx-banner-frame,
.astryx-banner {
	border: none;
}

/* strict.css/reboot ghi đè lề, padding và marker ul/ol của Astryx.
   revert-layer trả về CSS thư viện/theme, chỉ áp dụng Astryx List. */
ul.astryx-list,
ol.astryx-list {
	margin: revert-layer;
	padding-left: revert-layer;
	padding-inline-start: revert-layer;
	list-style: revert-layer;
}

/* ASTRYX-WORKAROUND: selector-popup-width — lỗi Selector của core 0.6.1.
   Tái hiện: mở Selector có option là tên video rất dài trong dialog test AI TikTok.
   Selector chỉ đặt min-width cho layer, khiến label dài kéo popup rộng hơn control.
   Gỡ rule này sau khi upstream giới hạn popup đúng độ rộng control. Kiểm tra với
   tên dài có khoảng trắng lẫn chuỗi liền, ở dialog và trang thường, không tràn ngang.
   Kiểm tra đồng thời selector-option-truncate bên dưới, nhưng gỡ từng nhóm riêng.
   Khóa chiều rộng trên chính element [popover] có position-anchor (surface con
   position: relative không dùng được anchor-size). Áp dụng mọi Selector Astryx,
   không ảnh hưởng menu/popover khác hoặc bottom sheet. */
[popover]:has(> .astryx-selector-popup) {
	width: anchor-size(width);
}

/* ASTRYX-WORKAROUND: selector-option-truncate — lỗi option của core 0.6.1.
   Sau khi giới hạn popup, label dài vẫn có thể gây cuộn ngang trong dropdown.
   Option phải được co lại trong hàng flex để ellipsis có chiều rộng hữu hạn.
   Gỡ cả hai rule dưới khi upstream tự truncate label: tên dài hiện dấu "…",
   dropdown không cuộn ngang; icon/check, mô tả và điều hướng bàn phím vẫn hoạt động.
   Tái hiện bằng cùng Selector ở nhóm selector-popup-width, không dùng renderOption
   hoặc style đo chiều rộng riêng tại nơi gọi để tránh che mất lỗi của package.
   Giữ icon/check bên ngoài phần text; chỉ truncate label, không cắt mô tả. */
.astryx-selector-option {
	flex: 1;
	min-width: 0;
	max-width: 100%;
}
.astryx-selector-option > :is(span, button, a) > span:first-child {
	min-width: 0;
	overflow: hidden;
	text-overflow: ellipsis;
	white-space: nowrap;
}

/* Portal hosts replace the old per-page Theme DOM wrapper. Keep its inherited
   typography scoped to Astryx routes, independent of legacy Vue parent styles. */
.astryx-route {
	color: var(--color-text-primary);
	font-family: var(--font-family-body);
	color-scheme: light;
}

.resize-observer[data-v-8859cc6c]{position:absolute;top:0;left:0;z-index:-1;width:100%;height:100%;border:none;background-color:transparent;pointer-events:none;display:block;overflow:hidden;opacity:0}.resize-observer[data-v-8859cc6c] object{display:block;position:absolute;top:0;left:0;height:100%;width:100%;overflow:hidden;pointer-events:none;z-index:-1}.v-popper__popper{z-index:10000;top:0;left:0;outline:none}.v-popper__popper.v-popper__popper--hidden{visibility:hidden;opacity:0;transition:opacity .15s,visibility .15s;pointer-events:none}.v-popper__popper.v-popper__popper--shown{visibility:visible;opacity:1;transition:opacity .15s}.v-popper__popper.v-popper__popper--skip-transition,.v-popper__popper.v-popper__popper--skip-transition>.v-popper__wrapper{transition:none!important}.v-popper__backdrop{position:absolute;top:0;left:0;width:100%;height:100%;display:none}.v-popper__inner{position:relative;box-sizing:border-box;overflow-y:auto}.v-popper__inner>div{position:relative;z-index:1;max-width:inherit;max-height:inherit}.v-popper__arrow-container{position:absolute;width:10px;height:10px}.v-popper__popper--arrow-overflow .v-popper__arrow-container,.v-popper__popper--no-positioning .v-popper__arrow-container{display:none}.v-popper__arrow-inner,.v-popper__arrow-outer{border-style:solid;position:absolute;top:0;left:0;width:0;height:0}.v-popper__arrow-inner{visibility:hidden;border-width:7px}.v-popper__arrow-outer{border-width:6px}.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-inner{left:-2px}.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-outer,.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-outer{left:-1px}.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-outer{border-bottom-width:0;border-left-color:transparent!important;border-right-color:transparent!important;border-bottom-color:transparent!important}.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-inner{top:-2px}.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-container{top:0}.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-outer{border-top-width:0;border-left-color:transparent!important;border-right-color:transparent!important;border-top-color:transparent!important}.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-inner{top:-4px}.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-outer{top:-6px}.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-inner{top:-2px}.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-outer,.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-outer{top:-1px}.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-outer{border-left-width:0;border-left-color:transparent!important;border-top-color:transparent!important;border-bottom-color:transparent!important}.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-inner{left:-4px}.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-outer{left:-6px}.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-container{right:-10px}.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-inner,.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-outer{border-right-width:0;border-top-color:transparent!important;border-right-color:transparent!important;border-bottom-color:transparent!important}.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-inner{left:-2px}.v-popper--theme-dropdown .v-popper__inner{background:#fff;color:#000;border-radius:6px;border:1px solid #ddd;box-shadow:0 6px 30px #0000001a}.v-popper--theme-dropdown .v-popper__arrow-inner{visibility:visible;border-color:#fff}.v-popper--theme-dropdown .v-popper__arrow-outer{border-color:#ddd}.v-popper--theme-tooltip .v-popper__inner{background:rgba(0,0,0,.8);color:#fff;border-radius:6px;padding:7px 12px 6px}.v-popper--theme-tooltip .v-popper__arrow-outer{border-color:#000c}


@layer priority1 {
  .x16hkwys {
    --color-overlay-hover: transparent;
  }

  .xax9j7h {
    --container-padding-block-end: 0px;
  }

  .x1047aw6 {
    --container-padding-block-start: 0px;
  }

  .xjsfl84 {
    --container-padding-inline-end: 0px;
  }

  .xrhngw9 {
    --container-padding-inline-start: 0px;
  }

  .xnqkahx {
    --layout-content-width: 720px;
  }

  .xss93js {
    --text-label-size: 12px;
  }
}

@layer priority2 {
  .x10a8y8t {
    inset: 0;
  }

  .x1ghz6dp {
    margin: 0;
  }

  .x1717udv {
    padding: 0;
  }

  .x1b2ylru {
    padding: var(--spacing-3);
  }

  .x1shk3sm {
    padding: var(--spacing-4);
  }

  .x1ikrqgu {
    padding: var(--spacing-5);
  }
}

@layer priority3 {
  .xvy26l8 {
    border-color: var(--color-border-emphasized);
  }

  .x14i3s5s {
    border-color: var(--color-border);
  }

  .x2u8bby {
    border-radius: 0;
  }

  .x1hviunn {
    border-radius: var(--radius-container);
  }

  .xh6dtrn {
    border-radius: var(--radius-element);
  }

  .xjspbzw {
    border-radius: var(--radius-full);
  }

  .xx3sua9 {
    border-radius: var(--radius-inner);
  }

  .xbsl7fq {
    border-style: dashed;
  }

  .xng3xce {
    border-style: none;
  }

  .x1y0btm7 {
    border-style: solid;
  }

  .xc342km {
    border-width: 0;
  }

  .xmkeg23 {
    border-width: 1px;
  }

  .x1litavf {
    border-width: var(--border-width);
  }

  .x98rzlu {
    flex: 1;
  }

  .xzye2dw {
    gap: var(--spacing-1);
  }

  .x1txdalj {
    gap: var(--spacing-2);
  }

  .x10no89f {
    inset-block: 0;
  }

  .xe8uvvx {
    list-style: none;
  }

  .xvueqy4 {
    margin-inline: auto;
  }

  .x1ho7dyk {
    margin-inline: calc(-1 * var(--spacing-2));
  }

  .x1a2a7pz {
    outline: none;
  }

  .xysyzu8 {
    overflow: auto;
  }

  .xb3r6kr {
    overflow: hidden;
  }

  .xt970qd {
    padding-block: 0;
  }

  .xejf4mv {
    padding-block: var(--spacing-10);
  }

  .x1na6nto {
    padding-block: var(--spacing-4);
  }

  .xnjsko4 {
    padding-inline: 0;
  }

  .x1pzlopt {
    padding-inline: var(--spacing-4);
  }

  .x1hl2dhg {
    text-decoration: none;
  }
}

@layer priority4 {
  .x4465f1 {
    align-content: end;
  }

  .x6s0dn4 {
    align-items: center;
  }

  .x1qjc9v5 {
    align-items: stretch;
  }

  .xqcrz7y {
    align-self: flex-start;
  }

  .xuw900x {
    aspect-ratio: attr(width)  / attr(height);
  }

  .x42x0ya {
    background-color: #000;
  }

  .x1o0wnni {
    background-color: var(--color-background-blue);
  }

  .xwmxj5m {
    background-color: var(--color-background-muted);
  }

  .x10xzikg {
    background-color: var(--color-background-surface);
  }

  .x1v0qb69 {
    background-color: var(--color-text-accent);
  }

  .x1gejf6u {
    border-inline-end-color: var(--color-border);
  }

  .x18b5jzi {
    border-inline-end-style: solid;
  }

  .x10w94by {
    border-inline-end-width: 0;
  }

  .xw8tdv1 {
    border-inline-end-width: var(--border-width);
  }

  .x1j92z86 {
    border-inline-start-color: var(--color-border);
  }

  .x1t7ytsu {
    border-inline-start-style: solid;
  }

  .xgbv0en {
    border-inline-start-width: var(--border-width);
  }

  .x1kcpxr7 {
    box-shadow: var(--shadow-high);
  }

  .x9f619 {
    box-sizing: border-box;
  }

  .xjt36v0 {
    color: var(--color-error);
  }

  .xv9yike {
    color: var(--color-icon-secondary);
  }

  .xtjic6 {
    color: var(--color-success);
  }

  .x1joocv1 {
    color: var(--color-text-red);
  }

  .xv1l7n4 {
    color: var(--color-text-secondary);
  }

  .x1jm3nie {
    cursor: grab;
  }

  .x1ypdohk {
    cursor: pointer;
  }

  .x78zum5 {
    display: flex;
  }

  .xrvj5dj {
    display: grid;
  }

  .x3nfvp2 {
    display: inline-flex;
  }

  .x1r8uery {
    flex-basis: 0;
  }

  .xdt5ytf {
    flex-direction: column;
  }

  .x1iyjqo2 {
    flex-grow: 1;
  }

  .x2lah0s {
    flex-shrink: 0;
  }

  .xs83m0k {
    flex-shrink: 1;
  }

  .x1a02dak {
    flex-wrap: wrap;
  }

  .x1lxnp44 {
    font-family: monospace, "monospace";
  }

  .xngnso2 {
    font-size: 1.5rem;
  }

  .xrv4cvt {
    font-size: 1em;
  }

  .x117nqv4 {
    font-weight: bold;
  }

  .xiqf31s {
    grid-auto-rows: 1fr;
  }

  .xtijo5x {
    inset-inline-end: 0;
  }

  .xl56j7k {
    justify-content: center;
  }

  .xvc5jky {
    margin-inline-start: auto;
  }

  .x19kjcj4 {
    object-fit: contain;
  }

  .xl1xv1r {
    object-fit: cover;
  }

  .xti2d7y {
    opacity: .4;
  }

  .x1t137rt {
    outline-style: none;
  }

  .xj0a0fe {
    overflow-wrap: anywhere;
  }

  .x1c1uobl {
    padding-inline-start: 0;
  }

  .xchaq28 {
    padding-inline-start: var(--spacing-7);
  }

  .x47corl {
    pointer-events: none;
  }

  .x10l6tqk {
    position: absolute;
  }

  .xixxii4 {
    position: fixed;
  }

  .x1n2onr6 {
    position: relative;
  }

  .x7wzq59 {
    position: sticky;
  }

  .x288g5 {
    resize: vertical;
  }

  .x59n724 {
    row-gap: var(--spacing-12);
  }

  .x16tdsg8 {
    text-align: inherit;
  }

  .x1yc453h {
    text-align: start;
  }

  .x5ve5x3 {
    touch-action: none;
  }

  .x87ps6o {
    -webkit-user-select: none;
    user-select: none;
  }

  .xxymvpz {
    vertical-align: middle;
  }

  .xlshs6z {
    visibility: hidden;
  }

  .xeaf4i8 {
    white-space: normal;
  }

  .x126k92a {
    white-space: pre-wrap;
  }

  .x1vvkbs {
    word-wrap: break-word;
  }

  .x1vjfegm {
    z-index: 1;
  }

  .xfo81ep {
    z-index: 1000;
  }

  .xopusz {
    z-index: 105;
  }

  .x1nh0kk4 {
    z-index: 110;
  }

  .xa9119d {
    z-index: 50;
  }

  .x14g40p9 {
    z-index: 999;
  }
}

@layer priority5 {
  .xw8gpjh {
    border-bottom-color: var(--color-border);
  }

  .x1q0q8m5 {
    border-bottom-style: solid;
  }

  .x1qhh985 {
    border-bottom-width: 0;
  }

  .x92x3c3 {
    border-bottom-width: var(--border-width);
  }

  .x1ejq31n {
    border-top-style: none;
  }

  .x972fbf {
    border-top-width: 0;
  }

  .x5yr21d {
    height: 100%;
  }

  .xlup9mm {
    height: 16px;
  }

  .xjm9jq1 {
    height: 1px;
  }

  .xd7y6wv {
    height: 26px;
  }

  .xuoj239 {
    height: 3px;
  }

  .xt7dq6l {
    height: auto;
  }

  .x2bzn8n {
    height: calc(var(--spacing-10) + var(--spacing-3));
  }

  .x45q7a {
    height: calc(var(--spacing-8) + var(--spacing-8) + var(--spacing-3));
  }

  .x883ie1 {
    height: min(calc(var(--spacing-10) * 16),85dvh);
  }

  .x1ktfwt3 {
    height: var(--spacing-10);
  }

  .x1k15mir {
    height: var(--spacing-12);
  }

  .x6b6gus {
    height: var(--spacing-4);
  }

  .xvpftlf {
    height: var(--spacing-6);
  }

  .x18to7ep {
    height: var(--spacing-8);
  }

  .xu96u03 {
    left: 0;
  }

  .x4ys8kp {
    max-height: 45dvh;
  }

  .x1om5vbd {
    max-height: 50dvh;
  }

  .xcaefb6 {
    max-height: calc(var(--spacing-10) * 11);
  }

  .xdyrldr {
    max-height: calc(var(--spacing-10) * 5);
  }

  .x193iq5w {
    max-width: 100%;
  }

  .x16xn7b0 {
    max-width: 100vw;
  }

  .x1ikqzku {
    max-width: 1200px;
  }

  .xapjn7j {
    max-width: 760px;
  }

  .x1f4rozj {
    max-width: calc(720px - var(--spacing-6) * 2);
  }

  .x1ub6dmi {
    max-width: min(100%, 240px);
  }

  .x74h4c1 {
    max-width: min(320px, 100vw - 32px);
  }

  .x2lwn1j {
    min-height: 0;
  }

  .x1ov3xa9 {
    min-height: 100dvh;
  }

  .xkoleio {
    min-height: var(--spacing-8);
  }

  .xeuugli {
    min-width: 0;
  }

  .x1odjw0f {
    overflow-y: auto;
  }

  .xryxfnj {
    overflow-y: visible;
  }

  .x1oeyoj0 {
    padding-bottom: calc(var(--spacing-10) + var(--spacing-4));
  }

  .xlbxkz7 {
    padding-bottom: calc(var(--spacing-10) + var(--spacing-8));
  }

  .x2izi54 {
    padding-bottom: var(--spacing-10);
  }

  .x1vlblms {
    padding-top: var(--spacing-3);
  }

  .x13vifvy {
    top: 0;
  }

  .xh8yej3 {
    width: 100%;
  }

  .x1kky2od {
    width: 16px;
  }

  .x23j0i4 {
    width: 26px;
  }

  .x19h4ct {
    width: 35%;
  }

  .xz84dc7 {
    width: 40%;
  }

  .x14rvwrp {
    width: 600px;
  }

  .x11i3ho8 {
    width: 640px;
  }

  .x12q9v7b {
    width: calc(var(--spacing-12) * 2);
  }

  .xvzn5ge {
    width: min(560px, 100%);
  }

  .x11pj4at {
    width: min(680px, 100%);
  }

  .xailvb {
    width: min(680px, 100vw);
  }

  .x1ge0voh {
    width: min(740px, 100vw);
  }

  .x59ufyq {
    width: var(--spacing-10);
  }

  .x12xnipv {
    width: var(--spacing-4);
  }

  .x1mtvzj0 {
    width: var(--spacing-6);
  }

  .xgc8j7m {
    width: var(--spacing-8);
  }
}